Zanamivir
(ARAIBEBZBOPLMB-UFGQHTETSA-N)
Structure
- SMILES
- OC[C@H]([C@H]([C@@H]1OC(=C[C@@H]([C@H]1NC(=O)C)N=C(N)N)C(=O)O)O)O
- Type(s)
- Approved; Investigational
- ATC code(s)
- J05AH01
- Molecular Formula:
- C12H20N4O7
- Molecular Weight:
- 332.310
- Log P:
- -1.9940
- Hydrogen Bond Acceptor:
- 11
- Hydrogen Bond Donor:
- 7
- TPSA:
- 200.72
- CAS Number(s):
- 139110-80-8
Synonym(s)
1.
Zanamivir
2.
2,3-Didehydro-2,4-Dideoxy-4-Guanidino-N-Acetyl-D-Neuraminic Acid
3.
2,3-Didehydro-2,4-Dideoxy-4-Guanidinyl-N-Acetylneuraminic Acid
4.
4-Guanidino-2,4-Dideoxy-2,3-Didehydro-N-Acetylneuraminic Acid
5.
4-Guanidino-2-Deoxy-2,3-Didehydro-N-Acetylneuraminic Acid
6.
4-Guanidino-Neu5Ac2en
7.
5-Acetylamino-2,6-Anhydro-4-Guanidino-3,4,5-Trideoxy-D-Galacto-Non-Enoic Acid
8.
GG 167
9.
GG-167
10.
GG167
11.
Relenza
12.
4 Guanidino 2 Deoxy 2,3 Didehydro N Acetylneuraminic Acid
13.
4 Guanidino Neu5Ac2en
14.
Acid, 4-Guanidino-2-Deoxy-2,3-Didehydro-N-Acetylneuraminic
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Overdose | FAERS: 420 | OFFSIDES US FAERS | |
| 2 | Drug exposure during pregnancy | FAERS: 305 | OFFSIDES US FAERS | |
| 3 | Drug exposure via breast milk | FAERS: 132 | OFFSIDES US FAERS | |
| 4 | No adverse event | FAERS: 112 | US FAERS | |
| 5 | Delirium | FAERS: 89 | SIDER US FAERS | |
| 6 | Depressed Level of Consciousness | FAERS: 46 | OFFSIDES US FAERS | |
| 7 | Altered state of consciousness | FAERS: 45 | OFFSIDES US FAERS | |
| 8 | Vomiting | FAERS: 34 | SIDER US FAERS | |
| 9 | Nausea | FAERS: 32 | SIDER US FAERS | |
| 10 | Agitation | FAERS: 26 | SIDER US FAERS | |
| 11 | Restlessness | FAERS: 24 | US FAERS | |
| 12 | Syncope | FAERS: 23 | SIDER US FAERS | |
| 13 | Dizziness | FAERS: 22 | SIDER US FAERS | |
| 14 | Abdominal Pain | FAERS: 20 | SIDER US FAERS | |
| 15 | Pallor | FAERS: 20 | OFFSIDES US FAERS | |
| 16 | Accidental overdose | FAERS: 19 | US FAERS | |
| 17 | Memory impairment | FAERS: 19 | US FAERS | |
| 18 | Product quality issue | FAERS: 18 | OFFSIDES US FAERS | |
| 19 | Feeling abnormal | FAERS: 17 | OFFSIDES SIDER US FAERS | |
| 20 | Incorrect route of drug administration | FAERS: 17 | OFFSIDES US FAERS | |
| 21 | Malaise | FAERS: 17 | SIDER US FAERS | |
| 22 | Drug ineffective | FAERS: 16 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 23 | Anaphylactic shock | FAERS: 15 | SIDER US FAERS | |
| 24 | Epistaxis | FAERS: 15 | OFFSIDES US FAERS | |
| 25 | Amnesia | FAERS: 13 | OFFSIDES US FAERS | |
| 26 | Asthma | FAERS: 13 | OFFSIDES SIDER US FAERS | |
| 27 | Incoherent | FAERS: 13 | OFFSIDES US FAERS | |
| 28 | Somnolence | FAERS: 13 | US FAERS | |
| 29 | Wrong technique in drug usage process | FAERS: 13 | US FAERS | |
| 30 | Crying | FAERS: 12 | OFFSIDES US FAERS | |
| 31 | Tremor | FAERS: 12 | US FAERS | |
| 32 | Pneumonia | FAERS: 11 | US FAERS | |
| 33 | Shock | FAERS: 11 | SIDER US FAERS | |
| 34 | Drug administration error | FAERS: 10 | US FAERS | |
| 35 | Influenza | FAERS: 10 | SIDER US FAERS | |
| 36 | Urticaria | FAERS: 10 | SIDER US FAERS | |
| 37 | Visual Impairment | FAERS: 10 | US FAERS | |
| 38 | Headache | FAERS: 9 | SIDER US FAERS | |
| 39 | Musculoskeletal stiffness | FAERS: 9 | OFFSIDES US FAERS | |
| 40 | Respiratory Failure | FAERS: 9 | US FAERS | |
| 41 | Asthenia | FAERS: 8 | SIDER US FAERS | |
| 42 | Dysgeusia | FAERS: 8 | OFFSIDES US FAERS | |
| 43 | Hypotension | FAERS: 8 | US FAERS | |
| 44 | Screaming | FAERS: 8 | OFFSIDES US FAERS | |
| 45 | Cardiac Arrest | FAERS: 7 | US FAERS | |
| 46 | Epilepsy | FAERS: 7 | US FAERS | |
| 47 | Live Birth | FAERS: 7 | OFFSIDES US FAERS | |
| 48 | Tinnitus | FAERS: 7 | OFFSIDES US FAERS | |
| 49 | Unresponsive to stimuli | FAERS: 7 | US FAERS | |
| 50 | Wheezing | FAERS: 7 | US FAERS | |
| 51 | Alanine Aminotransferase Increased | FAERS: 6 | US FAERS | |
| 52 | Bronchospasm | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 53 | Encephalitis | FAERS: 6 | OFFSIDES US FAERS | |
| 54 | Anaphylactoid Reaction | FAERS: 5 | SIDER US FAERS | |
| 55 | Anosmia | FAERS: 5 | OFFSIDES US FAERS | |
| 56 | Anxiety | FAERS: 5 | SIDER US FAERS | |
| 57 | Cyanosis | FAERS: 5 | OFFSIDES US FAERS | |
| 58 | Disorientation | FAERS: 5 | US FAERS | |
| 59 | Euphoric mood | FAERS: 5 | OFFSIDES US FAERS | |
| 60 | Fatigue | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 61 | Hyperventilation | FAERS: 5 | OFFSIDES US FAERS | |
| 62 | Medication Error | FAERS: 5 | US FAERS | |
| 63 | Pharyngolaryngeal Pain | FAERS: 5 | US FAERS | |
| 64 | Presyncope | FAERS: 5 | US FAERS | |
| 65 | Sleep Talking | FAERS: 5 | OFFSIDES US FAERS | |
| 66 | Stevens-Johnson Syndrome | FAERS: 5 | 25811541 | CTD SIDER US FAERS |
| 67 | nervous system disorder | FAERS: 5 | US FAERS | |
| 68 | Anger | FAERS: 4 | US FAERS | |
| 69 | Angioedema | FAERS: 4 | US FAERS | |
| 70 | Anorexia | FAERS: 4 | SIDER US FAERS | |
| 71 | Aphasia | FAERS: 4 | US FAERS | |
| 72 | Arthralgia | FAERS: 4 | SIDER US FAERS | |
| 73 | Chest discomfort | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 74 | Chills | FAERS: 4 | SIDER US FAERS | |
| 75 | Cold sweat | FAERS: 4 | US FAERS | |
| 76 | Dehydration | FAERS: 4 | SIDER US FAERS | |
| 77 | Delirium febrile | FAERS: 4 | OFFSIDES US FAERS | |
| 78 | Discomfort | FAERS: 4 | SIDER US FAERS | |
| 79 | Dysphonia | FAERS: 4 | US FAERS | |
| 80 | Erythema | FAERS: 4 | US FAERS | |
| 81 | Inappropriate schedule of drug administration | FAERS: 4 | US FAERS | |
| 82 | Initial insomnia | FAERS: 4 | OFFSIDES US FAERS | |
| 83 | Nystagmus | FAERS: 4 | OFFSIDES US FAERS | |
| 84 | Palpitations | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 85 | Productive Cough | FAERS: 4 | US FAERS | |
| 86 | Pruritus | FAERS: 4 | US FAERS | |
| 87 | Retrograde amnesia | FAERS: 4 | OFFSIDES US FAERS | |
| 88 | Rhabdomyolysis | FAERS: 4 | US FAERS | |
| 89 | Septic Shock | FAERS: 4 | US FAERS | |
| 90 | White blood cell count decreased | FAERS: 4 | US FAERS | |
| 91 | Acute kidney injury | FAERS: 3 | US FAERS | |
| 92 | Aspartate Aminotransferase Increased | FAERS: 3 | US FAERS | |
| 93 | Chest Pain | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 94 | Deafness | FAERS: 3 | US FAERS | |
| 95 | Dissociative disorder | FAERS: 3 | OFFSIDES US FAERS | |
| 96 | Dysarthria | FAERS: 3 | US FAERS | |
| 97 | Ear discomfort | FAERS: 3 | US FAERS | |
| 98 | Erythema Multiforme | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 99 | Febrile Neutropenia | FAERS: 3 | US FAERS | |
| 100 | Incorrect dose administered | FAERS: 3 | US FAERS | |
| 101 | Mental impairment | FAERS: 3 | US FAERS | |
| 102 | Muscle Rigidity | FAERS: 3 | US FAERS | |
| 103 | Oculomucocutaneous syndrome | FAERS: 3 | US FAERS | |
| 104 | Oropharyngeal pain | FAERS: 3 | US FAERS | |
| 105 | Pain | FAERS: 3 | SIDER US FAERS | |
| 106 | Pericardial effusion | FAERS: 3 | US FAERS | |
| 107 | Poor quality sleep | FAERS: 3 | OFFSIDES US FAERS | |
| 108 | Respiratory distress | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 109 | Restless Legs Syndrome | FAERS: 3 | US FAERS | |
| 110 | Somnambulism | FAERS: 3 | US FAERS | |
| 111 | Urinary Incontinence | FAERS: 3 | US FAERS | |
| 112 | Viral myocarditis | FAERS: 3 | US FAERS | |
| 113 | Abdominal discomfort | FAERS: 2 | US FAERS | |
| 114 | Accidental exposure | FAERS: 2 | US FAERS | |
| 115 | Ageusia | FAERS: 2 | US FAERS | |
| 116 | Back Pain | FAERS: 2 | US FAERS | |
| 117 | Blood alkaline phosphatase increased | FAERS: 2 | US FAERS | |
| 118 | Blood creatine phosphokinase increased | FAERS: 2 | US FAERS | |
| 119 | Blood lactate dehydrogenase increased | FAERS: 2 | US FAERS | |
| 120 | Body Temperature | FAERS: 2 | OFFSIDES US FAERS | |
| 121 | Bradycardia | FAERS: 2 | US FAERS | |
| 122 | Bronchitis | FAERS: 2 | SIDER US FAERS | |
| 123 | Choking | FAERS: 2 | US FAERS | |
| 124 | Conjunctivitis | FAERS: 2 | US FAERS | |
| 125 | Cytolytic hepatitis | FAERS: 2 | OFFSIDES US FAERS | |
| 126 | Disseminated Intravascular Coagulation | FAERS: 2 | US FAERS | |
| 127 | Drug label confusion | FAERS: 2 | US FAERS | |
| 128 | Electrocardiogram abnormal | FAERS: 2 | US FAERS | |
| 129 | Eye pain | FAERS: 2 | US FAERS | |
| 130 | Feeling Cold | FAERS: 2 | US FAERS | |
| 131 | Flatulence | FAERS: 2 | US FAERS | |
| 132 | Foaming at mouth | FAERS: 2 | US FAERS | |
| 133 | Gastroenteritis | FAERS: 2 | OFFSIDES US FAERS | |
| 134 | General physical health deterioration | FAERS: 2 | US FAERS | |
| 135 | Hypoxia | FAERS: 2 | US FAERS | |
| 136 | Incontinence | FAERS: 2 | OFFSIDES US FAERS | |
| 137 | Ketosis | FAERS: 2 | US FAERS | |
| 138 | Laryngospasm | FAERS: 2 | US FAERS | |
| 139 | Leukopenia | FAERS: 2 | US FAERS | |
| 140 | Low birth weight baby | FAERS: 2 | US FAERS | |
| 141 | Medication residue | FAERS: 2 | US FAERS | |
| 142 | Middle insomnia | FAERS: 2 | OFFSIDES US FAERS | |
| 143 | Monoplegia | FAERS: 2 | OFFSIDES US FAERS | |
| 144 | Muscle strain | FAERS: 2 | OFFSIDES US FAERS | |
| 145 | Myalgia | FAERS: 2 | SIDER US FAERS | |
| 146 | Nasal discomfort | FAERS: 2 | US FAERS | |
| 147 | Neuromyelitis Optica | FAERS: 2 | US FAERS | |
| 148 | Oral pain | FAERS: 2 | US FAERS | |
| 149 | Pharyngeal lesion | FAERS: 2 | US FAERS | |
| 150 | Pneumothorax | FAERS: 2 | US FAERS | |
| 151 | Pulmonary Fibrosis | FAERS: 2 | US FAERS | |
| 152 | Sepsis | FAERS: 2 | US FAERS | |
| 153 | Sinus bradycardia | FAERS: 2 | OFFSIDES US FAERS | |
| 154 | Staring | FAERS: 2 | OFFSIDES US FAERS | |
| 155 | Stillbirth | FAERS: 2 | US FAERS | |
| 156 | Stupor | FAERS: 2 | US FAERS | |
| 157 | Suicide attempt | FAERS: 2 | US FAERS | |
| 158 | Tachycardia | FAERS: 2 | US FAERS | |
| 159 | Trismus | FAERS: 2 | US FAERS | |
| 160 | Unevaluable event | FAERS: 2 | US FAERS | |
| 161 | Vestibular Neuronitis | FAERS: 2 | OFFSIDES US FAERS | |
| 162 | Abnormal clotting factor | FAERS: 1 | OFFSIDES US FAERS | |
| 163 | Accidental underdose | FAERS: 1 | US FAERS | |
| 164 | Acute respiratory failure | FAERS: 1 | US FAERS | |
| 165 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 166 | Apathy | FAERS: 1 | US FAERS | |
| 167 | Appendicitis | FAERS: 1 | US FAERS | |
| 168 | Arthropathy | FAERS: 1 | US FAERS | |
| 169 | Astigmatism | FAERS: 1 | OFFSIDES US FAERS | |
| 170 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 171 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 172 | Blepharospasm | FAERS: 1 | US FAERS | |
| 173 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 174 | Body temperature fluctuation | FAERS: 1 | OFFSIDES US FAERS | |
| 175 | Brain Contusion | FAERS: 1 | US FAERS | |
| 176 | Bronchopleural Fistula | FAERS: 1 | US FAERS | |
| 177 | Bronchopulmonary Aspergillosis | FAERS: 1 | US FAERS | |
| 178 | Bruxism | FAERS: 1 | OFFSIDES US FAERS | |
| 179 | Cardiac valve vegetation | FAERS: 1 | US FAERS | |
| 180 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 181 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 182 | Cerebral vasoconstriction | FAERS: 1 | US FAERS | |
| 183 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 184 | Cholecystitis | FAERS: 1 | US FAERS | |
| 185 | Chorioamnionitis | FAERS: 1 | US FAERS | |
| 186 | Colitis | FAERS: 1 | US FAERS | |
| 187 | Completed Suicide | FAERS: 1 | US FAERS | |
| 188 | Congenital hydronephrosis | FAERS: 1 | US FAERS | |
| 189 | Conversion disorder | FAERS: 1 | US FAERS | |
| 190 | Dark circles under eyes | FAERS: 1 | US FAERS | |
| 191 | Depressed mood | FAERS: 1 | US FAERS | |
| 192 | Device occlusion | FAERS: 1 | US FAERS | |
| 193 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 194 | Diplopia | FAERS: 1 | US FAERS | |
| 195 | Disease Progression | FAERS: 1 | US FAERS | |
| 196 | Dissociation | FAERS: 1 | US FAERS | |
| 197 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 198 | Drug dose omission | FAERS: 1 | US FAERS | |
| 199 | Dry skin | FAERS: 1 | US FAERS | |
| 200 | Eczema | FAERS: 1 | US FAERS | |
| 201 | Electroencephalogram abnormal | FAERS: 1 | US FAERS | |
| 202 | Enuresis | FAERS: 1 | US FAERS | |
| 203 | Expired drug administered | FAERS: 1 | US FAERS | |
| 204 | Expired product administered | FAERS: 1 | US FAERS | |
| 205 | Exposure during breast feeding | FAERS: 1 | US FAERS | |
| 206 | Facial Pain | FAERS: 1 | US FAERS | |
| 207 | Flushing | FAERS: 1 | US FAERS | |
| 208 | Fracture | FAERS: 1 | US FAERS | |
| 209 | Gamma-Glutamyltransferase Increased | FAERS: 1 | US FAERS | |
| 210 | Gaze palsy | FAERS: 1 | US FAERS | |
| 211 | Granulocyte count decreased | FAERS: 1 | US FAERS | |
| 212 | Guillain-Barre Syndrome | FAERS: 1 | US FAERS | |
| 213 | Haematotoxicity | FAERS: 1 | US FAERS | |
| 214 | Hallucinations, mixed | FAERS: 1 | US FAERS | |
| 215 | Head titubation | FAERS: 1 | US FAERS | |
| 216 | Hyperacusis | FAERS: 1 | US FAERS | |
| 217 | Hypersensitivity | FAERS: 1 | SIDER US FAERS | |
| 218 | Hyperthyroidism | FAERS: 1 | US FAERS | |
| 219 | Hypoaesthesia facial | FAERS: 1 | OFFSIDES US FAERS | |
| 220 | Hyporesponsive to stimuli | FAERS: 1 | US FAERS | |
| 221 | Immune thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 222 | Impetigo | FAERS: 1 | US FAERS | |
| 223 | Inappropriate affect | FAERS: 1 | US FAERS | |
| 224 | Induration | FAERS: 1 | US FAERS | |
| 225 | Infection | FAERS: 1 | SIDER US FAERS | |
| 226 | Inflammation | FAERS: 1 | US FAERS | |
| 227 | Intercepted drug administration error | FAERS: 1 | US FAERS | |
| 228 | Laceration | FAERS: 1 | OFFSIDES US FAERS | |
| 229 | Leucine aminopeptidase increased | FAERS: 1 | OFFSIDES US FAERS | |
| 230 | Leukoderma | FAERS: 1 | US FAERS | |
| 231 | Mechanical ventilation | FAERS: 1 | US FAERS | |
| 232 | Meningitis | FAERS: 1 | US FAERS | |
| 233 | Mental status changes | FAERS: 1 | US FAERS | |
| 234 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 235 | Miller Fisher Syndrome | FAERS: 1 | US FAERS | |
| 236 | Moaning | FAERS: 1 | OFFSIDES US FAERS | |
| 237 | Mood swings | FAERS: 1 | US FAERS | |
| 238 | Multiple Pregnancy | FAERS: 1 | US FAERS | |
| 239 | Multiple use of single-use product | FAERS: 1 | US FAERS | |
| 240 | Myelitis | FAERS: 1 | US FAERS | |
| 241 | Myopathy | FAERS: 1 | US FAERS | |
| 242 | Neck Pain | FAERS: 1 | US FAERS | |
| 243 | Nerve injury | FAERS: 1 | US FAERS | |
| 244 | Neutropenia | FAERS: 1 | SIDER US FAERS | |
| 245 | Neutrophil count decreased | FAERS: 1 | US FAERS | |
| 246 | Nipple pain | FAERS: 1 | US FAERS | |
| 247 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 248 | Obsessive thoughts | FAERS: 1 | US FAERS | |
| 249 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 250 | Pancytopenia | FAERS: 1 | US FAERS | |
| 251 | Personality Change | FAERS: 1 | US FAERS | |
| 252 | Physical assault | FAERS: 1 | US FAERS | |
| 253 | Pleurisy | FAERS: 1 | US FAERS | |
| 254 | Pneumococcal sepsis | FAERS: 1 | US FAERS | |
| 255 | Poriomania | FAERS: 1 | OFFSIDES US FAERS | |
| 256 | Protein urine present | FAERS: 1 | US FAERS | |
| 257 | Psychiatric symptom | FAERS: 1 | OFFSIDES US FAERS | |
| 258 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 259 | Radioallergosorbent test positive | FAERS: 1 | US FAERS | |
| 260 | Rash erythematous | FAERS: 1 | US FAERS | |
| 261 | Renal Cell Carcinoma | FAERS: 1 | US FAERS | |
| 262 | Renal tubular necrosis | FAERS: 1 | OFFSIDES US FAERS | |
| 263 | Schizophrenia | FAERS: 1 | US FAERS | |
| 264 | Septic embolus | FAERS: 1 | US FAERS | |
| 265 | Single functional kidney | FAERS: 1 | US FAERS | |
| 266 | Sleep Paralysis | FAERS: 1 | OFFSIDES US FAERS | |
| 267 | Staphylococcus test positive | FAERS: 1 | US FAERS | |
| 268 | Status Epilepticus | FAERS: 1 | US FAERS | |
| 269 | Stomatitis | FAERS: 1 | US FAERS | |
| 270 | Superinfection | FAERS: 1 | US FAERS | |
| 271 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 272 | Talipes | FAERS: 1 | US FAERS | |
| 273 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 274 | Therapy cessation | FAERS: 1 | US FAERS | |
| 275 | Throat irritation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 276 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 277 | Thrombocytosis | FAERS: 1 | US FAERS | |
| 278 | Transaminases increased | FAERS: 1 | US FAERS | |
| 279 | Vascular pain | FAERS: 1 | US FAERS | |
| 280 | jaundice | FAERS: 1 | US FAERS | |
| 281 | Abnormal vision | OFFSIDES | ||
| 282 | Alcoholic Intoxication | OFFSIDES | ||
| 283 | Ascites | OFFSIDES | ||
| 284 | Aura | OFFSIDES | ||
| 285 | Beta 2 microglobulin urine increased | OFFSIDES | ||
| 286 | Blood fibrinogen | OFFSIDES | ||
| 287 | Blood lactate dehydrogenase abnormal | OFFSIDES | ||
| 288 | Blurred vision | OFFSIDES | ||
| 289 | Cell Death | OFFSIDES | ||
| 290 | Coagulation test abnormal | OFFSIDES | ||
| 291 | Color blindness | OFFSIDES | ||
| 292 | Dermatitis | SIDER | ||
| 293 | Elevated mood | OFFSIDES | ||
| 294 | Gastric mucosal lesion | OFFSIDES | ||
| 295 | Gastrointestinal Pain | SIDER | ||
| 296 | Hepatic vein occlusion | OFFSIDES | ||
| 297 | Herpes simplex hepatitis | OFFSIDES | ||
| 298 | Hypervigilance | OFFSIDES | ||
| 299 | Hyporeflexia | OFFSIDES | ||
| 300 | Influenza-like symptoms | SIDER | ||
| 301 | Lip exfoliation | OFFSIDES | ||
| 302 | Lymphopenia | SIDER | ||
| 303 | Metrorrhagia | Canada Vigilance: 1 | Canada Vigilance | |
| 304 | Musculoskeletal Pain | SIDER | ||
| 305 | Musculoskeletal discomfort | SIDER | ||
| 306 | Mutism | OFFSIDES | ||
| 307 | Nasal inflammation | SIDER | ||
| 308 | Neonatal respiratory failure | OFFSIDES | ||
| 309 | Oral mucosal erythema | OFFSIDES | ||
| 310 | Oropharyngeal swelling | SIDER | ||
| 311 | Platelet count abnormal | OFFSIDES | ||
| 312 | Pulmonary Infarction | OFFSIDES | ||
| 313 | Retrograde portal vein flow | OFFSIDES | ||
| 314 | Rheumatic disorder | SIDER | ||
| 315 | Rheumatism | SIDER | ||
| 316 | Rhinovirus infection | OFFSIDES | ||
| 317 | Sinusitis | SIDER | ||
| 318 | Toxic Epidermal Necrolysis | SIDER | ||
| 319 | Ulcer | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.