alfuzosin
(YTNKWDJILNVLGX-UHFFFAOYSA-N)
Structure
- SMILES
- COc1cc2nc(nc(c2cc1OC)N)N(CCCNC(=O)C1CCCO1)C.Cl
- Molecular Formula:
- C19H28ClN5O4
- Molecular Weight:
- 425.910
- Log P:
- 3.1248
- Hydrogen Bond Acceptor:
- 9
- Hydrogen Bond Donor:
- 3
- TPSA:
- 111.83
- CAS Number(s):
- 81403-68-1
Synonym(s)
1.
alfuzosin
2.
Alfetim
3.
Benestan
4.
N-(3-((4-amino-6,7-dimethoxy-2-quinazolinyl)methylamino)propyl)tetrahydro-2-furancarboxamide
5.
Urion
6.
UroXatral
7.
Xatral
8.
alfusozine
9.
alfuzosin hydrochloride
10.
alphuzosine
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Dizziness | FAERS: 65 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 2 | Syncope | FAERS: 41 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 3 | Drug ineffective | FAERS: 29 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 4 | Hypotension | FAERS: 26 | US FAERS | |
| 5 | Fatigue | FAERS: 19 | US FAERS | |
| 6 | Headache | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 7 | Arthralgia | FAERS: 15 | US FAERS | |
| 8 | Back Pain | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 9 | Erectile dysfunction | FAERS: 13 | US FAERS | |
| 10 | Urinary Retention | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 11 | Malaise | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 12 | Product substitution issue | FAERS: 12 | US FAERS | |
| 13 | Stool analysis abnormal | FAERS: 11 | US FAERS | |
| 14 | Chest Pain | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 15 | Dysuria | FAERS: 10 | US FAERS | |
| 16 | Atrial Fibrillation | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 17 | Pruritus | FAERS: 9 | US FAERS | |
| 18 | Asthenia | FAERS: 8 | US FAERS | |
| 19 | Cerebrovascular accident | FAERS: 8 | US FAERS | |
| 20 | Feeling abnormal | FAERS: 8 | US FAERS | |
| 21 | Myalgia | FAERS: 8 | US FAERS | |
| 22 | Abdominal Pain | FAERS: 7 | US FAERS | |
| 23 | Medication residue | FAERS: 7 | US FAERS | |
| 24 | Nausea | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 25 | Angina Pectoris | FAERS: 6 | US FAERS | |
| 26 | Nocturia | FAERS: 6 | US FAERS | |
| 27 | Palpitations | FAERS: 6 | US FAERS | |
| 28 | Urinary Incontinence | FAERS: 6 | US FAERS | |
| 29 | Constipation | FAERS: 5 | US FAERS | |
| 30 | Epistaxis | FAERS: 5 | US FAERS | |
| 31 | Pain | FAERS: 5 | US FAERS | |
| 32 | Somnolence | FAERS: 5 | US FAERS | |
| 33 | Tachycardia | FAERS: 5 | US FAERS | |
| 34 | Tinnitus | FAERS: 5 | US FAERS | |
| 35 | Tremor | FAERS: 5 | US FAERS | |
| 36 | Blood glucose increased | FAERS: 4 | US FAERS | |
| 37 | Cataract | FAERS: 4 | US FAERS | |
| 38 | Chills | FAERS: 4 | US FAERS | |
| 39 | Urine flow decreased | FAERS: 4 | US FAERS | |
| 40 | Urticaria | FAERS: 4 | US FAERS | |
| 41 | Abasia | FAERS: 3 | US FAERS | |
| 42 | Amnesia | FAERS: 3 | US FAERS | |
| 43 | Bladder pain | FAERS: 3 | US FAERS | |
| 44 | Disorientation | FAERS: 3 | US FAERS | |
| 45 | Epilepsy | FAERS: 3 | US FAERS | |
| 46 | Flatulence | FAERS: 3 | US FAERS | |
| 47 | Foreign body trauma | FAERS: 3 | US FAERS | |
| 48 | Incorrect dose administered | FAERS: 3 | US FAERS | |
| 49 | Musculoskeletal stiffness | FAERS: 3 | US FAERS | |
| 50 | Myocardial Infarction | FAERS: 3 | US FAERS | |
| 51 | Pancreatitis | FAERS: 3 | US FAERS | |
| 52 | Product quality issue | FAERS: 3 | US FAERS | |
| 53 | Spontaneous penile erection | FAERS: 3 | US FAERS | |
| 54 | Vomiting | FAERS: 3 | US FAERS | |
| 55 | Weight decreased | FAERS: 3 | US FAERS | |
| 56 | jaundice | FAERS: 3 | US FAERS | |
| 57 | Accidental exposure | FAERS: 2 | US FAERS | |
| 58 | Accidental overdose | FAERS: 2 | US FAERS | |
| 59 | Burning sensation | FAERS: 2 | US FAERS | |
| 60 | Cardiac Arrest | FAERS: 2 | US FAERS | |
| 61 | Cholestasis | FAERS: 2 | US FAERS | |
| 62 | Deafness | FAERS: 2 | US FAERS | |
| 63 | Dyspepsia | FAERS: 2 | US FAERS | |
| 64 | Enuresis | FAERS: 2 | US FAERS | |
| 65 | Excoriation | FAERS: 2 | US FAERS | |
| 66 | Flushing | FAERS: 2 | US FAERS | |
| 67 | Gastritis | FAERS: 2 | US FAERS | |
| 68 | Gastrointestinal Pain | FAERS: 2 | US FAERS | |
| 69 | Genital discharge | FAERS: 2 | US FAERS | |
| 70 | Gout | FAERS: 2 | US FAERS | |
| 71 | Hypersensitivity | FAERS: 2 | US FAERS | |
| 72 | Intestinal Obstruction | FAERS: 2 | US FAERS | |
| 73 | Intestinal hypomotility | FAERS: 2 | US FAERS | |
| 74 | Lipase increased | FAERS: 2 | US FAERS | |
| 75 | MYELODYSPLASTIC SYNDROME | FAERS: 2 | US FAERS | |
| 76 | Malabsorption | FAERS: 2 | US FAERS | |
| 77 | Medication Error | FAERS: 2 | US FAERS | |
| 78 | Memory impairment | FAERS: 2 | US FAERS | |
| 79 | Pallor | FAERS: 2 | US FAERS | |
| 80 | Pneumonia | FAERS: 2 | US FAERS | |
| 81 | Retinal Detachment | FAERS: 2 | US FAERS | |
| 82 | Rhinitis | FAERS: 2 | US FAERS | |
| 83 | Sudden death | FAERS: 2 | US FAERS | |
| 84 | Throat irritation | FAERS: 2 | US FAERS | |
| 85 | Toxic Epidermal Necrolysis | FAERS: 2 | US FAERS | |
| 86 | Unevaluable event | FAERS: 2 | US FAERS | |
| 87 | Unexpected therapeutic drug effect | FAERS: 2 | US FAERS | |
| 88 | Urethral Stenosis | FAERS: 2 | US FAERS | |
| 89 | Vocal Cord Paralysis | FAERS: 2 | US FAERS | |
| 90 | Wheezing | FAERS: 2 | US FAERS | |
| 91 | prostatitis | FAERS: 2 | US FAERS | |
| 92 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 93 | Acne | FAERS: 1 | US FAERS | |
| 94 | Agitation | FAERS: 1 | US FAERS | |
| 95 | Akathisia | FAERS: 1 | US FAERS | |
| 96 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 97 | Amblyopia | FAERS: 1 | US FAERS | |
| 98 | Amyotrophic Lateral Sclerosis | FAERS: 1 | US FAERS | |
| 99 | Anaphylactoid Reaction | FAERS: 1 | US FAERS | |
| 100 | Aphagia | FAERS: 1 | US FAERS | |
| 101 | Aphasia | FAERS: 1 | US FAERS | |
| 102 | Appendicitis | FAERS: 1 | US FAERS | |
| 103 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 104 | Asphyxia | FAERS: 1 | US FAERS | |
| 105 | Asthenopia | FAERS: 1 | US FAERS | |
| 106 | Asthma | FAERS: 1 | US FAERS | |
| 107 | Atrial Flutter | FAERS: 1 | US FAERS | |
| 108 | Bladder discomfort | FAERS: 1 | US FAERS | |
| 109 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 110 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 111 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 112 | Blood glucose fluctuation | FAERS: 1 | US FAERS | |
| 113 | Blood urine present | FAERS: 1 | US FAERS | |
| 114 | Bone pain | FAERS: 1 | US FAERS | |
| 115 | Bronchitis | FAERS: 1 | US FAERS | |
| 116 | Cardiovascular insufficiency | FAERS: 1 | US FAERS | |
| 117 | Cataract operation complication | FAERS: 1 | US FAERS | |
| 118 | Cervical dysplasia | FAERS: 1 | US FAERS | |
| 119 | Cheilitis | FAERS: 1 | US FAERS | |
| 120 | Chest discomfort | FAERS: 1 | US FAERS | |
| 121 | Cholelithiasis obstructive | FAERS: 1 | US FAERS | |
| 122 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 123 | Cyst | FAERS: 1 | US FAERS | |
| 124 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 125 | Depressed mood | FAERS: 1 | US FAERS | |
| 126 | Diplopia | FAERS: 1 | US FAERS | |
| 127 | Discomfort | FAERS: 1 | US FAERS | |
| 128 | Disease recurrence | FAERS: 1 | US FAERS | |
| 129 | Drooling | FAERS: 1 | US FAERS | |
| 130 | Drug effect variable | FAERS: 1 | US FAERS | |
| 131 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 132 | Eosinophilia | FAERS: 1 | US FAERS | |
| 133 | Eructation | FAERS: 1 | US FAERS | |
| 134 | Erythema | FAERS: 1 | US FAERS | |
| 135 | Extra dose administered | FAERS: 1 | US FAERS | |
| 136 | Eye irritation | FAERS: 1 | US FAERS | |
| 137 | False positive laboratory result | FAERS: 1 | US FAERS | |
| 138 | Floppy iris syndrome | FAERS: 1 | US FAERS | |
| 139 | Folliculitis | FAERS: 1 | US FAERS | |
| 140 | Full blood count decreased | FAERS: 1 | US FAERS | |
| 141 | Hemiparesis | FAERS: 1 | US FAERS | |
| 142 | Hepatitis B antigen positive | FAERS: 1 | US FAERS | |
| 143 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 144 | Hypotrichosis | FAERS: 1 | US FAERS | |
| 145 | Infection | FAERS: 1 | US FAERS | |
| 146 | Influenza | FAERS: 1 | US FAERS | |
| 147 | Joint injury | FAERS: 1 | US FAERS | |
| 148 | Joint swelling | FAERS: 1 | US FAERS | |
| 149 | Labyrinthitis | FAERS: 1 | US FAERS | |
| 150 | Laceration | FAERS: 1 | US FAERS | |
| 151 | Laziness | FAERS: 1 | US FAERS | |
| 152 | Lethargy | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 153 | Leukocytosis | FAERS: 1 | US FAERS | |
| 154 | Leukopenia | FAERS: 1 | US FAERS | |
| 155 | Lymphoma | FAERS: 1 | US FAERS | |
| 156 | Macular degeneration | FAERS: 1 | US FAERS | |
| 157 | Male sexual dysfunction | FAERS: 1 | US FAERS | |
| 158 | Mental impairment | FAERS: 1 | US FAERS | |
| 159 | Middle insomnia | FAERS: 1 | US FAERS | |
| 160 | Muscle Cramp | FAERS: 1 | US FAERS | |
| 161 | Muscle tightness | FAERS: 1 | US FAERS | |
| 162 | Mycosis Fungoides | FAERS: 1 | US FAERS | |
| 163 | Nasopharyngitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 164 | Neck Pain | FAERS: 1 | US FAERS | |
| 165 | Nervousness | FAERS: 1 | US FAERS | |
| 166 | Neuralgia | FAERS: 1 | US FAERS | |
| 167 | Neutropenia | FAERS: 1 | US FAERS | |
| 168 | Nystagmus | FAERS: 1 | US FAERS | |
| 169 | Ocular icterus | FAERS: 1 | US FAERS | |
| 170 | Optic Neuropathy | FAERS: 1 | US FAERS | |
| 171 | Oral administration complication | FAERS: 1 | US FAERS | |
| 172 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 173 | Overdose | FAERS: 1 | US FAERS | |
| 174 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 175 | Pericarditis | FAERS: 1 | US FAERS | |
| 176 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 177 | Pharyngolaryngeal Pain | FAERS: 1 | US FAERS | |
| 178 | Photodermatosis | FAERS: 1 | US FAERS | |
| 179 | Post procedural complication | FAERS: 1 | US FAERS | |
| 180 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 181 | Priapism | FAERS: 1 | US FAERS | |
| 182 | Product shape issue | FAERS: 1 | US FAERS | |
| 183 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 184 | Product use issue | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 185 | Prostatic pain | FAERS: 1 | US FAERS | |
| 186 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 187 | Rash erythematous | FAERS: 1 | US FAERS | |
| 188 | Rebound effect | FAERS: 1 | US FAERS | |
| 189 | Rectal discharge | FAERS: 1 | US FAERS | |
| 190 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 191 | Rosacea | FAERS: 1 | US FAERS | |
| 192 | Sepsis | FAERS: 1 | US FAERS | |
| 193 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 194 | Shock | FAERS: 1 | US FAERS | |
| 195 | Sinusitis | FAERS: 1 | US FAERS | |
| 196 | Skin laceration | FAERS: 1 | US FAERS | |
| 197 | Skin reaction | FAERS: 1 | US FAERS | |
| 198 | Somnambulism | FAERS: 1 | US FAERS | |
| 199 | Stomatitis | FAERS: 1 | US FAERS | |
| 200 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 201 | Synovial Cyst | FAERS: 1 | US FAERS | |
| 202 | Tablet physical issue | FAERS: 1 | US FAERS | |
| 203 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 204 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 205 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 206 | Transaminases increased | FAERS: 1 | US FAERS | |
| 207 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 208 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 209 | Urine bilirubin increased | FAERS: 1 | US FAERS | |
| 210 | Vaginal Discharge | FAERS: 1 | US FAERS | |
| 211 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 212 | Vertigo | FAERS: 1 | US FAERS | |
| 213 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 214 | pseudomembranous colitis | FAERS: 1 | US FAERS | |
| 215 | Pathological fracture | Canada Vigilance: 1 | Canada Vigilance | |
| 216 | Photophobia | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.