olmesartan
(VTRAEEWXHOVJFV-UHFFFAOYSA-N)
Structure
- SMILES
- CCCc1nc(c(n1Cc1ccc(cc1)c1ccccc1c1n[nH]nn1)C(=O)O)C(O)(C)C
- Type(s)
- Approved; Investigational
- ATC code(s)
- C09CA08; C09DA08; C09DB02; C09DX03
- Molecular Formula:
- C24H26N6O3
- Molecular Weight:
- 446.502
- Log P:
- 3.6566
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 3
- TPSA:
- 129.81
- CAS Number(s):
- 144689-24-7
Synonym(s)
1.
olmesartan
2.
4-(hydroxy-1-methylethyl)-2-propyl-1-((2'-(1H-tetrazol-5-yl)-1,1'-biphenyl-4-yl)methyl)-1H-imidazole-5-carboxylic acid
3.
CS-088
4.
RNH 6270
5.
omesartan
External Link(s)
| MeSH | C437965 |
| PubChem Compound | 158781 |
| BindingDB | 50241364 |
| ChEBI | 48416 |
| CHEMBL | CHEMBL1516 |
| DrugBank | DB00275 |
| KEGG | cpd:C21543 dr:D01204 dr:D05246 |
| ZINC | 538621 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Sprue-like enteropathy | FAERS: 63 | US FAERS | |
| 2 | Acute kidney injury | FAERS: 25 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 3 | Intestinal villi atrophy | FAERS: 23 | US FAERS | |
| 4 | Weight decreased | FAERS: 23 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 5 | Drug ineffective | FAERS: 14 Canada Vigilance: 13 | Canada Vigilance US FAERS | |
| 6 | Malabsorption | FAERS: 14 | SIDER US FAERS | |
| 7 | Dehydration | FAERS: 12 | US FAERS | |
| 8 | Metabolic acidosis | FAERS: 11 | US FAERS | |
| 9 | Product substitution issue | FAERS: 10 Canada Vigilance: 16 | Canada Vigilance US FAERS | |
| 10 | Dizziness | FAERS: 9 Canada Vigilance: 9 | Canada Vigilance SIDER US FAERS | |
| 11 | Vomiting | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 12 | Headache | FAERS: 8 Canada Vigilance: 7 | Canada Vigilance SIDER US FAERS | |
| 13 | Hypotension | FAERS: 7 | SIDER US FAERS | |
| 14 | Nausea | FAERS: 7 Canada Vigilance: 7 | Canada Vigilance SIDER US FAERS | |
| 15 | Enteritis | FAERS: 5 | US FAERS | |
| 16 | Pruritus | FAERS: 5 | SIDER US FAERS | |
| 17 | Abdominal Pain | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 18 | Abdominal discomfort | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 19 | Blood pressure inadequately controlled | FAERS: 4 Canada Vigilance: 5 | Canada Vigilance OFFSIDES US FAERS | |
| 20 | Electrolyte imbalance | FAERS: 4 | SIDER US FAERS | |
| 21 | Therapy non-responder | FAERS: 4 | US FAERS | |
| 22 | Asthenia | FAERS: 3 | SIDER US FAERS | |
| 23 | Blood potassium decreased | FAERS: 3 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 24 | Colitis | FAERS: 3 | US FAERS | |
| 25 | Epistaxis | FAERS: 3 | US FAERS | |
| 26 | Erosive Duodenitis | FAERS: 3 | US FAERS | |
| 27 | Hypertensive crisis | FAERS: 3 | US FAERS | |
| 28 | Oligohydramnios | FAERS: 3 | US FAERS | |
| 29 | Renal failure neonatal | FAERS: 3 | US FAERS | |
| 30 | Thrombocytopenia | FAERS: 3 | SIDER US FAERS | |
| 31 | treatment failure | FAERS: 3 | US FAERS | |
| 32 | Alopecia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 33 | Anxiety | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 34 | Autoimmune hepatitis | FAERS: 2 | US FAERS | |
| 35 | Blood magnesium decreased | FAERS: 2 | US FAERS | |
| 36 | Blood sodium decreased | FAERS: 2 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 37 | Depressed Level of Consciousness | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 38 | Dry skin | FAERS: 2 | US FAERS | |
| 39 | Enterocolitis | FAERS: 2 | US FAERS | |
| 40 | Feeling abnormal | FAERS: 2 | SIDER US FAERS | |
| 41 | Flatulence | FAERS: 2 | US FAERS | |
| 42 | Gastrointestinal hypermotility | FAERS: 2 | US FAERS | |
| 43 | MYELODYSPLASTIC SYNDROME | FAERS: 2 | US FAERS | |
| 44 | Mesenteric artery stenosis | FAERS: 2 | US FAERS | |
| 45 | Mesenteric artery stent insertion | FAERS: 2 | US FAERS | |
| 46 | Neonatal hypotension | FAERS: 2 | US FAERS | |
| 47 | Nephrolithiasis | FAERS: 2 | OFFSIDES US FAERS | |
| 48 | Palpitations | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 49 | Prerenal failure | FAERS: 2 | US FAERS | |
| 50 | Swelling | FAERS: 2 | US FAERS | |
| 51 | Tremor | FAERS: 2 | US FAERS | |
| 52 | Abdominal symptom | FAERS: 1 | US FAERS | |
| 53 | Acidosis | FAERS: 1 | US FAERS | |
| 54 | Alanine Aminotransferase Increased | FAERS: 1 | SIDER US FAERS | |
| 55 | Angioedema | FAERS: 1 | SIDER US FAERS | |
| 56 | Anti-transglutaminase antibody | FAERS: 1 | US FAERS | |
| 57 | Ascites | FAERS: 1 | US FAERS | |
| 58 | Back Pain | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 59 | Blood albumin decreased | FAERS: 1 | US FAERS | |
| 60 | Blood creatinine increased | FAERS: 1 | SIDER US FAERS | |
| 61 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 62 | Cachexia | FAERS: 1 | US FAERS | |
| 63 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 64 | Chest Pain | FAERS: 1 | SIDER US FAERS | |
| 65 | Chronic gastritis | FAERS: 1 | US FAERS | |
| 66 | Dermatitis | FAERS: 1 | SIDER US FAERS | |
| 67 | Eye pain | FAERS: 1 | US FAERS | |
| 68 | Feeling jittery | FAERS: 1 | US FAERS | |
| 69 | Gastritis | FAERS: 1 | US FAERS | |
| 70 | Gastroduodenitis | FAERS: 1 | US FAERS | |
| 71 | Gastroenteritis | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 72 | Gastrointestinal inflammation | FAERS: 1 | US FAERS | |
| 73 | Gastrointestinal stoma output decreased | FAERS: 1 | US FAERS | |
| 74 | Hepatic Encephalopathy | FAERS: 1 | US FAERS | |
| 75 | Hypersensitivity | FAERS: 1 | US FAERS | |
| 76 | Inability to afford medication | FAERS: 1 | US FAERS | |
| 77 | Inflammation | FAERS: 1 | US FAERS | |
| 78 | Intestinal intraepithelial lymphocytes increased | FAERS: 1 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 79 | Intra-abdominal fluid collection | FAERS: 1 | US FAERS | |
| 80 | Labyrinthitis | FAERS: 1 | US FAERS | |
| 81 | Large intestine perforation | FAERS: 1 | OFFSIDES US FAERS | |
| 82 | Lymphocytic infiltration | FAERS: 1 | US FAERS | |
| 83 | Lymphocytosis | FAERS: 1 | US FAERS | |
| 84 | Malaise | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 85 | Malnutrition | FAERS: 1 | SIDER US FAERS | |
| 86 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 87 | Medication Error | FAERS: 1 | US FAERS | |
| 88 | Mouth swelling | FAERS: 1 | US FAERS | |
| 89 | Mucosal atrophy | FAERS: 1 | US FAERS | |
| 90 | Neonatal disorder | FAERS: 1 | US FAERS | |
| 91 | Neonatal respiratory failure | FAERS: 1 | US FAERS | |
| 92 | No adverse event | FAERS: 1 | US FAERS | |
| 93 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 94 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 95 | Pallor | FAERS: 1 | US FAERS | |
| 96 | Pancreatitis | FAERS: 1 | SIDER US FAERS | |
| 97 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 98 | Peripheral swelling | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 99 | Peritoneal Dialysis | FAERS: 1 | US FAERS | |
| 100 | Pneumothorax | FAERS: 1 | US FAERS | |
| 101 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 102 | Product complaint | FAERS: 1 | US FAERS | |
| 103 | Product use issue | FAERS: 1 | US FAERS | |
| 104 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 105 | Shock | FAERS: 1 | SIDER US FAERS | |
| 106 | Skin irritation | FAERS: 1 | US FAERS | |
| 107 | Tachyarrhythmia | FAERS: 1 | US FAERS | |
| 108 | Tachycardia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 109 | Tinnitus | FAERS: 1 | US FAERS | |
| 110 | Transaminases increased | FAERS: 1 | SIDER US FAERS | |
| 111 | Urinary tract infection | FAERS: 1 | SIDER US FAERS | |
| 112 | Urticaria | FAERS: 1 | SIDER US FAERS | |
| 113 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 114 | Withdrawal hypertension | FAERS: 1 | US FAERS | |
| 115 | Acute bronchitis | SIDER | ||
| 116 | Acute myocardial infarction | OFFSIDES | ||
| 117 | Agitation | SIDER | ||
| 118 | Agranulocytosis | SIDER | ||
| 119 | Albuminuria | 18363646 | CTD | |
| 120 | Alveolitis | OFFSIDES | ||
| 121 | Amnestic Disorder | OFFSIDES | ||
| 122 | Anaphylactic shock | SIDER | ||
| 123 | Angina Pectoris | SIDER | ||
| 124 | Anorexia | SIDER | ||
| 125 | Arthralgia | SIDER | ||
| 126 | Arthritis | SIDER | ||
| 127 | Aspartate Aminotransferase Increased | SIDER | ||
| 128 | Asthenic conditions | SIDER | ||
| 129 | Asthenopia | OFFSIDES | ||
| 130 | Aura | OFFSIDES | ||
| 131 | Bilirubin value increased | SIDER | ||
| 132 | Blood Glucose | OFFSIDES | ||
| 133 | Blood amylase increased | OFFSIDES | ||
| 134 | Blood and lymphatic system disorders | SIDER | ||
| 135 | Blood creatine phosphokinase increased | SIDER | ||
| 136 | Blood glucose increased | SIDER | ||
| 137 | Blood potassium increased | SIDER | ||
| 138 | Blood sodium | OFFSIDES | ||
| 139 | Blood triglycerides increased | OFFSIDES SIDER | ||
| 140 | Blood urea increased | SIDER | ||
| 141 | Body temperature fluctuation | OFFSIDES | ||
| 142 | Bone marrow depression | SIDER | ||
| 143 | Bone pain | SIDER | ||
| 144 | Bronchitis | SIDER | ||
| 145 | Bronchoalveolar lavage abnormal | OFFSIDES | ||
| 146 | Cardiomegaly | CTD | ||
| 147 | Chemical and Drug Induced Liver Injury | 24144775 | CTD | |
| 148 | Clostridium colitis | OFFSIDES | ||
| 149 | Congenital tricuspid valve incompetence | OFFSIDES | ||
| 150 | Constipation | SIDER | ||
| 151 | Creatine Phosphokinase Increased | SIDER | ||
| 152 | Crying | OFFSIDES | ||
| 153 | Cyst | OFFSIDES | ||
| 154 | Diabetes Mellitus | SIDER | ||
| 155 | Diabetic | SIDER | ||
| 156 | Discomfort | SIDER | ||
| 157 | Diverticulosis | OFFSIDES | ||
| 158 | Drowsiness | OFFSIDES | ||
| 159 | Dysarthria | Canada Vigilance: 1 | Canada Vigilance | |
| 160 | Dyspepsia | OFFSIDES SIDER | ||
| 161 | Dysthymic Disorder | OFFSIDES | ||
| 162 | Ear and labyrinth disorders | SIDER | ||
| 163 | Eczema | SIDER | ||
| 164 | Electrocardiogram ST segment abnormal | OFFSIDES | ||
| 165 | Eosinophilia | SIDER | ||
| 166 | Epigastric discomfort | SIDER | ||
| 167 | Erectile dysfunction | SIDER | ||
| 168 | Erosive gastritis | OFFSIDES | ||
| 169 | Erysipelas | OFFSIDES | ||
| 170 | Fatigue | Canada Vigilance: 2 | Canada Vigilance SIDER | |
| 171 | Fibrosis | 17170375 | CTD | |
| 172 | Formication | OFFSIDES | ||
| 173 | Gamma-Glutamyltransferase Increased | SIDER | ||
| 174 | Gastric irritation | SIDER | ||
| 175 | Gastrointestinal Pain | SIDER | ||
| 176 | Glycosuria | SIDER | ||
| 177 | Gout | SIDER | ||
| 178 | Granulocyte count decreased | OFFSIDES | ||
| 179 | Granulocytosis | OFFSIDES | ||
| 180 | Hepatic necrosis | OFFSIDES | ||
| 181 | Hyperplasia | 16148612 | CTD | |
| 182 | Hypophagia | OFFSIDES | ||
| 183 | Infection | OFFSIDES SIDER | ||
| 184 | Infestation | SIDER | ||
| 185 | Inflicted injury | SIDER | ||
| 186 | Influenza-like symptoms | SIDER | ||
| 187 | Influenza | SIDER | ||
| 188 | Intestinal Perforation | OFFSIDES | ||
| 189 | Joint injury | OFFSIDES | ||
| 190 | Kidney Diseases | 22318512 | CTD | |
| 191 | Left Ventricular Hypertrophy | OFFSIDES | ||
| 192 | Lethargy | SIDER | ||
| 193 | Leukopenia | SIDER | ||
| 194 | Lightheadedness | SIDER | ||
| 195 | Limb injury | OFFSIDES | ||
| 196 | Lip swelling | Canada Vigilance: 1 | Canada Vigilance | |
| 197 | Lipase | OFFSIDES | ||
| 198 | Lupus Erythematosus | SIDER | ||
| 199 | Microalbuminuria | SIDER | ||
| 200 | Muscle Weakness | OFFSIDES | ||
| 201 | Musculoskeletal discomfort | SIDER | ||
| 202 | Musculoskeletal stiffness | OFFSIDES | ||
| 203 | Myalgia | SIDER | ||
| 204 | Myocardial Infarction | 17208988 | CTD | |
| 205 | Myocardial Reperfusion Injury | 18434761 | CTD | |
| 206 | Nasopharyngitis | OFFSIDES SIDER | ||
| 207 | Neck Pain | Canada Vigilance: 1 | Canada Vigilance | |
| 208 | Necrosis | 20638619 | CTD | |
| 209 | Nerve Degeneration | 20638619 | CTD | |
| 210 | Neutropenia | SIDER | ||
| 211 | Pain | SIDER | ||
| 212 | Pancytopenia | SIDER | ||
| 213 | Peritonitis | OFFSIDES | ||
| 214 | Personality Change | OFFSIDES | ||
| 215 | Pharyngitis | SIDER | ||
| 216 | Pharyngolaryngeal Pain | SIDER | ||
| 217 | Plaque, Atherosclerotic | 16148612 | CTD | |
| 218 | Platelet function test abnormal | OFFSIDES | ||
| 219 | Pleuropericarditis | OFFSIDES | ||
| 220 | Pneumonia | SIDER | ||
| 221 | Product substitution | Canada Vigilance: 1 | Canada Vigilance | |
| 222 | Proteinuria | 18448808 | CTD | |
| 223 | Pseudohyperkalaemia | SIDER | ||
| 224 | Reperfusion Injury | 20638619 | CTD | |
| 225 | Respiratory distress | SIDER | ||
| 226 | Rhabdomyolysis | SIDER | ||
| 227 | Rhinitis | SIDER | ||
| 228 | Sinusitis | SIDER | ||
| 229 | Somnolence | Canada Vigilance: 2 | Canada Vigilance | |
| 230 | Sphincter of Oddi Dysfunction | OFFSIDES | ||
| 231 | Spinal Cord Ischemia | 20638619 | CTD | |
| 232 | Sprue | SIDER | ||
| 233 | Sudden Cardiac Death | OFFSIDES | ||
| 234 | Superficial injury of eye | OFFSIDES | ||
| 235 | Syncope | SIDER | ||
| 236 | Temporal Arteritis | Canada Vigilance: 1 | Canada Vigilance | |
| 237 | Therapeutic product ineffective | Canada Vigilance: 1 | Canada Vigilance | |
| 238 | Throat irritation | Canada Vigilance: 1 | Canada Vigilance | |
| 239 | Toothache | SIDER | ||
| 240 | Toxic Epidermal Necrolysis | SIDER | ||
| 241 | Tracheobronchitis | SIDER | ||
| 242 | Vasculitis | SIDER | ||
| 243 | Ventricular hypokinesia | OFFSIDES | ||
| 244 | Vertigo | Canada Vigilance: 2 | Canada Vigilance SIDER | |
| 245 | Viral upper respiratory tract infection | SIDER | ||
| 246 | Wound dehiscence | OFFSIDES | ||
| 247 | Xanthopsia | SIDER | ||
| 248 | angiogram | OFFSIDES | ||
| 249 | effusion | OFFSIDES | ||
| 250 | jaundice | SIDER | ||
| 251 | nervous system disorder | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.