pasireotide
(VMZMNAABQBOLAK-DBILLSOUSA-N)
Structure
- SMILES
- NCCCC[C@@H]1NC(=O)[C@H](NC(=O)[C@@H](NC(=O)[C@H]2N(C(=O)[C@@H](NC(=O)[C@@H](NC1=O)Cc1ccc(cc1)OCc1ccccc1)Cc1ccccc1)C[C@@H](C2)OC(=O)NCCN)c1ccccc1)Cc1c[nH]c2c1cccc2
- Type(s)
- Approved
- ATC code(s)
- H01CB05
- Molecular Formula:
- C58H66N10O9
- Molecular Weight:
- 1047.210
- Log P:
- 6.7419
- Hydrogen Bond Acceptor:
- 18
- Hydrogen Bond Donor:
- 9
- TPSA:
- 281.2
- CAS Number(s):
- 396091-73-9
Synonym(s)
1.
pasireotide
2.
SOM 230
3.
SOM-230
4.
SOM230
5.
cyclo((4R)-4-(2-aminoethylcarbamoyloxy)-L-prolyl-L-phenylglycyl-d-tryptophyl-L-lysyl-4-o-benzyl-L-tyrosyl-L-phenylalanyl-)
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Diabetes Mellitus | FAERS: 80 | SIDER US FAERS | |
| 2 | Inappropriate schedule of drug administration | FAERS: 63 | US FAERS | |
| 3 | Nausea | FAERS: 63 | SIDER US FAERS | |
| 4 | Blood glucose increased | FAERS: 60 | SIDER US FAERS | |
| 5 | Headache | FAERS: 40 | SIDER US FAERS | |
| 6 | Fatigue | FAERS: 32 | SIDER US FAERS | |
| 7 | Vomiting | FAERS: 32 | SIDER US FAERS | |
| 8 | Malaise | FAERS: 27 | US FAERS | |
| 9 | Drug ineffective | FAERS: 25 | US FAERS | |
| 10 | Dizziness | FAERS: 24 | SIDER US FAERS | |
| 11 | Abdominal Pain | FAERS: 22 | SIDER US FAERS | |
| 12 | Asthenia | FAERS: 22 | SIDER US FAERS | |
| 13 | Cholelithiasis | FAERS: 21 | SIDER US FAERS | |
| 14 | Weight decreased | FAERS: 20 | US FAERS | |
| 15 | Ascites | FAERS: 16 | US FAERS | |
| 16 | Arthralgia | FAERS: 14 | SIDER US FAERS | |
| 17 | Product use issue | FAERS: 14 | US FAERS | |
| 18 | Amylase increased | FAERS: 12 | SIDER US FAERS | |
| 19 | Diabetes mellitus inadequate control | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 20 | Alopecia | FAERS: 11 | SIDER US FAERS | |
| 21 | Hypotension | FAERS: 10 | SIDER US FAERS | |
| 22 | Incorrect drug administration duration | FAERS: 10 | US FAERS | |
| 23 | Cholecystitis | FAERS: 9 | US FAERS | |
| 24 | Infection | FAERS: 9 | US FAERS | |
| 25 | Pain | FAERS: 9 | SIDER US FAERS | |
| 26 | Urinary tract infection | FAERS: 9 | US FAERS | |
| 27 | Abdominal discomfort | FAERS: 8 | US FAERS | |
| 28 | Blood glucose decreased | FAERS: 8 | US FAERS | |
| 29 | Dehydration | FAERS: 8 | US FAERS | |
| 30 | Feeling abnormal | FAERS: 8 | US FAERS | |
| 31 | Injection site pain | FAERS: 8 | US FAERS | |
| 32 | Maternal exposure during pregnancy | FAERS: 8 | US FAERS | |
| 33 | Sepsis | FAERS: 8 | US FAERS | |
| 34 | Blood glucose fluctuation | FAERS: 7 | US FAERS | |
| 35 | Constipation | FAERS: 7 | SIDER US FAERS | |
| 36 | No adverse event | FAERS: 7 | US FAERS | |
| 37 | Polyuria | FAERS: 7 | US FAERS | |
| 38 | Pruritus | FAERS: 7 | SIDER US FAERS | |
| 39 | Syncope | FAERS: 7 | US FAERS | |
| 40 | Atrial Fibrillation | FAERS: 6 | US FAERS | |
| 41 | Back Pain | FAERS: 6 | SIDER US FAERS | |
| 42 | Injection Site Reaction | FAERS: 6 | SIDER US FAERS | |
| 43 | Product use in unapproved indication | FAERS: 6 | US FAERS | |
| 44 | Urticaria | FAERS: 6 | US FAERS | |
| 45 | Blood cortisol decreased | FAERS: 5 | US FAERS | |
| 46 | Cortisol free urine increased | FAERS: 5 | US FAERS | |
| 47 | Drug administration error | FAERS: 5 | US FAERS | |
| 48 | General physical health deterioration | FAERS: 5 | US FAERS | |
| 49 | Inappropriate schedule of product administration | FAERS: 5 | US FAERS | |
| 50 | Incorrect dose administered | FAERS: 5 | US FAERS | |
| 51 | Lip swelling | FAERS: 5 | US FAERS | |
| 52 | Myalgia | FAERS: 5 | SIDER US FAERS | |
| 53 | Myocardial Infarction | FAERS: 5 | US FAERS | |
| 54 | Needle issue | FAERS: 5 | US FAERS | |
| 55 | Pancreatitis | FAERS: 5 | SIDER US FAERS | |
| 56 | Pneumonia | FAERS: 5 | US FAERS | |
| 57 | Sinusitis | FAERS: 5 | US FAERS | |
| 58 | Syringe issue | FAERS: 5 | US FAERS | |
| 59 | Visual Impairment | FAERS: 5 | US FAERS | |
| 60 | Chills | FAERS: 4 | US FAERS | |
| 61 | Depressed mood | FAERS: 4 | US FAERS | |
| 62 | Erythema | FAERS: 4 | SIDER US FAERS | |
| 63 | Impaired gastric emptying | FAERS: 4 | US FAERS | |
| 64 | Incorrect route of drug administration | FAERS: 4 | US FAERS | |
| 65 | Inflammation | FAERS: 4 | US FAERS | |
| 66 | Nasopharyngitis | FAERS: 4 | SIDER US FAERS | |
| 67 | Pancreatic leak | FAERS: 4 | US FAERS | |
| 68 | Peripheral swelling | FAERS: 4 | US FAERS | |
| 69 | Psychiatric symptom | FAERS: 4 | US FAERS | |
| 70 | Respiratory Failure | FAERS: 4 | US FAERS | |
| 71 | Somnolence | FAERS: 4 | US FAERS | |
| 72 | Stress | FAERS: 4 | US FAERS | |
| 73 | Tachycardia | FAERS: 4 | US FAERS | |
| 74 | Thrombosis | FAERS: 4 | US FAERS | |
| 75 | Bile Duct Stenosis | FAERS: 3 | US FAERS | |
| 76 | Blood cortisol increased | FAERS: 3 | US FAERS | |
| 77 | Blood potassium decreased | FAERS: 3 | US FAERS | |
| 78 | Cerebrovascular accident | FAERS: 3 | US FAERS | |
| 79 | Chest Pain | FAERS: 3 | US FAERS | |
| 80 | Choking | FAERS: 3 | US FAERS | |
| 81 | Cholangitis | FAERS: 3 | US FAERS | |
| 82 | Concomitant disease progression | FAERS: 3 | US FAERS | |
| 83 | Dysgeusia | FAERS: 3 | US FAERS | |
| 84 | Flatulence | FAERS: 3 | US FAERS | |
| 85 | Glucocorticoid deficiency | FAERS: 3 | US FAERS | |
| 86 | Hyperthyroidism | FAERS: 3 | US FAERS | |
| 87 | Injection site erythema | FAERS: 3 | US FAERS | |
| 88 | Injection site infection | FAERS: 3 | US FAERS | |
| 89 | Injection site pruritus | FAERS: 3 | US FAERS | |
| 90 | Joint stiffness | FAERS: 3 | US FAERS | |
| 91 | Malignant neoplasm progression | FAERS: 3 | US FAERS | |
| 92 | Medication Error | FAERS: 3 | US FAERS | |
| 93 | Memory impairment | FAERS: 3 | US FAERS | |
| 94 | Metrorrhagia | FAERS: 3 | US FAERS | |
| 95 | Palpitations | FAERS: 3 | US FAERS | |
| 96 | Polydipsia | FAERS: 3 | US FAERS | |
| 97 | Post procedural bile leak | FAERS: 3 | US FAERS | |
| 98 | Pulmonary Embolism | FAERS: 3 | US FAERS | |
| 99 | Swelling | FAERS: 3 | US FAERS | |
| 100 | Transaminases increased | FAERS: 3 | US FAERS | |
| 101 | Wound Infection | FAERS: 3 | US FAERS | |
| 102 | Acute kidney injury | FAERS: 2 | US FAERS | |
| 103 | Anger | FAERS: 2 | US FAERS | |
| 104 | Atelectasis | FAERS: 2 | US FAERS | |
| 105 | Blindness | FAERS: 2 | US FAERS | |
| 106 | Blood alkaline phosphatase increased | FAERS: 2 | US FAERS | |
| 107 | Blood corticotrophin increased | FAERS: 2 | US FAERS | |
| 108 | Blood creatine phosphokinase increased | FAERS: 2 | US FAERS | |
| 109 | Blood viscosity decreased | FAERS: 2 | US FAERS | |
| 110 | Bradycardia | FAERS: 2 | SIDER US FAERS | |
| 111 | Cholestasis | FAERS: 2 | US FAERS | |
| 112 | Cortisol free urine decreased | FAERS: 2 | US FAERS | |
| 113 | Crying | FAERS: 2 | US FAERS | |
| 114 | Deep Vein Thrombosis | FAERS: 2 | US FAERS | |
| 115 | Device leakage | FAERS: 2 | US FAERS | |
| 116 | Device malfunction | FAERS: 2 | US FAERS | |
| 117 | Device related infection | FAERS: 2 | US FAERS | |
| 118 | Disease Progression | FAERS: 2 | US FAERS | |
| 119 | Dry skin | FAERS: 2 | SIDER US FAERS | |
| 120 | Dysuria | FAERS: 2 | US FAERS | |
| 121 | Embolism | FAERS: 2 | US FAERS | |
| 122 | Epistaxis | FAERS: 2 | US FAERS | |
| 123 | Feeling Cold | FAERS: 2 | US FAERS | |
| 124 | Hepatorenal Syndrome | FAERS: 2 | US FAERS | |
| 125 | Hypersensitivity | FAERS: 2 | US FAERS | |
| 126 | Hypoxia | FAERS: 2 | US FAERS | |
| 127 | Ileus | FAERS: 2 | US FAERS | |
| 128 | Initial insomnia | FAERS: 2 | US FAERS | |
| 129 | Injection site mass | FAERS: 2 | US FAERS | |
| 130 | Insulin-like growth factor increased | FAERS: 2 | US FAERS | |
| 131 | Ketoacidosis | FAERS: 2 | US FAERS | |
| 132 | Leukocytosis | FAERS: 2 | US FAERS | |
| 133 | Mood swings | FAERS: 2 | US FAERS | |
| 134 | Musculoskeletal stiffness | FAERS: 2 | US FAERS | |
| 135 | Neck Pain | FAERS: 2 | US FAERS | |
| 136 | Nephrolithiasis | FAERS: 2 | US FAERS | |
| 137 | Neuralgia | FAERS: 2 | US FAERS | |
| 138 | Night sweats | FAERS: 2 | US FAERS | |
| 139 | Osteoporosis | FAERS: 2 | US FAERS | |
| 140 | Pallor | FAERS: 2 | US FAERS | |
| 141 | Pancreatic Duct Stenosis | FAERS: 2 | US FAERS | |
| 142 | Pericarditis | FAERS: 2 | US FAERS | |
| 143 | Post procedural complication | FAERS: 2 | US FAERS | |
| 144 | Product leakage | FAERS: 2 | US FAERS | |
| 145 | Septic Shock | FAERS: 2 | US FAERS | |
| 146 | Therapeutic response unexpected | FAERS: 2 | US FAERS | |
| 147 | Tumour haemorrhage | FAERS: 2 | US FAERS | |
| 148 | Uterine Polyp | FAERS: 2 | US FAERS | |
| 149 | Vertigo | FAERS: 2 | SIDER US FAERS | |
| 150 | treatment failure | FAERS: 2 | US FAERS | |
| 151 | Abasia | FAERS: 1 | US FAERS | |
| 152 | Abdominal Abscess | FAERS: 1 | US FAERS | |
| 153 | Abdominal Infection | FAERS: 1 | US FAERS | |
| 154 | Abscess | FAERS: 1 | US FAERS | |
| 155 | Acidosis | FAERS: 1 | US FAERS | |
| 156 | Actinomycosis | FAERS: 1 | US FAERS | |
| 157 | Alanine Aminotransferase Increased | FAERS: 1 | SIDER US FAERS | |
| 158 | Amnesia | FAERS: 1 | US FAERS | |
| 159 | Angioedema | FAERS: 1 | US FAERS | |
| 160 | Antiphospholipid Syndrome | FAERS: 1 | US FAERS | |
| 161 | Aphasia | FAERS: 1 | US FAERS | |
| 162 | Appendicitis | FAERS: 1 | US FAERS | |
| 163 | Aspartate Aminotransferase Increased | FAERS: 1 | SIDER US FAERS | |
| 164 | Benign Prostatic Hyperplasia | FAERS: 1 | US FAERS | |
| 165 | Biliary Colic | FAERS: 1 | US FAERS | |
| 166 | Biliary tract infection | FAERS: 1 | US FAERS | |
| 167 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 168 | Blood cortisol abnormal | FAERS: 1 | US FAERS | |
| 169 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 170 | Blood growth hormone increased | FAERS: 1 | US FAERS | |
| 171 | Blood magnesium decreased | FAERS: 1 | US FAERS | |
| 172 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 173 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 174 | Bone density increased | FAERS: 1 | US FAERS | |
| 175 | Boredom | FAERS: 1 | US FAERS | |
| 176 | Bronchial Obstruction | FAERS: 1 | US FAERS | |
| 177 | Bruxism | FAERS: 1 | US FAERS | |
| 178 | Burning sensation | FAERS: 1 | US FAERS | |
| 179 | Calcium deficiency | FAERS: 1 | US FAERS | |
| 180 | Cardiac Death | FAERS: 1 | US FAERS | |
| 181 | Cataract | FAERS: 1 | US FAERS | |
| 182 | Cellulitis | FAERS: 1 | US FAERS | |
| 183 | Chest discomfort | FAERS: 1 | US FAERS | |
| 184 | Cholecystitis infective | FAERS: 1 | US FAERS | |
| 185 | Clostridium difficile infection | FAERS: 1 | US FAERS | |
| 186 | Colon adenoma | FAERS: 1 | US FAERS | |
| 187 | Cortisol decreased | FAERS: 1 | US FAERS | |
| 188 | Cortisol deficiency | FAERS: 1 | US FAERS | |
| 189 | Cortisol increased | FAERS: 1 | US FAERS | |
| 190 | Deficiency of bile secretion | FAERS: 1 | US FAERS | |
| 191 | Dementia | FAERS: 1 | US FAERS | |
| 192 | Diplopia | FAERS: 1 | US FAERS | |
| 193 | Diverticulitis | FAERS: 1 | US FAERS | |
| 194 | Dysarthria | FAERS: 1 | US FAERS | |
| 195 | Dyschezia | FAERS: 1 | US FAERS | |
| 196 | Eczema | FAERS: 1 | US FAERS | |
| 197 | Electrocardiogram ST-T segment abnormal | FAERS: 1 | US FAERS | |
| 198 | Electrocardiogram repolarisation abnormality | FAERS: 1 | US FAERS | |
| 199 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 200 | Eye inflammation | FAERS: 1 | US FAERS | |
| 201 | Eye pain | FAERS: 1 | US FAERS | |
| 202 | Facial Pain | FAERS: 1 | US FAERS | |
| 203 | Febrile Neutropenia | FAERS: 1 | US FAERS | |
| 204 | Flank Pain | FAERS: 1 | US FAERS | |
| 205 | Gastrointestinal infection | FAERS: 1 | US FAERS | |
| 206 | Hepatitis | FAERS: 1 | US FAERS | |
| 207 | Hormone level abnormal | FAERS: 1 | US FAERS | |
| 208 | Hypopituitarism | FAERS: 1 | SIDER US FAERS | |
| 209 | Hypothyroidism | FAERS: 1 | SIDER US FAERS | |
| 210 | Incision site pain | FAERS: 1 | US FAERS | |
| 211 | Incorrect product administration duration | FAERS: 1 | US FAERS | |
| 212 | Influenza | FAERS: 1 | SIDER US FAERS | |
| 213 | Injection site abscess | FAERS: 1 | US FAERS | |
| 214 | Injection site extravasation | FAERS: 1 | US FAERS | |
| 215 | Injection site nodule | FAERS: 1 | US FAERS | |
| 216 | Injection site urticaria | FAERS: 1 | US FAERS | |
| 217 | Insulin Resistance | FAERS: 1 | US FAERS | |
| 218 | Intracranial Hypotension | FAERS: 1 | US FAERS | |
| 219 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 220 | Joint swelling | FAERS: 1 | US FAERS | |
| 221 | Leukopenia | FAERS: 1 | US FAERS | |
| 222 | Lipodystrophy acquired | FAERS: 1 | US FAERS | |
| 223 | Localised intraabdominal fluid collection | FAERS: 1 | US FAERS | |
| 224 | Malignant Glioma | FAERS: 1 | US FAERS | |
| 225 | Maternal exposure timing unspecified | FAERS: 1 | US FAERS | |
| 226 | Menorrhagia | FAERS: 1 | US FAERS | |
| 227 | Metastasis | FAERS: 1 | US FAERS | |
| 228 | Mixed liver injury | FAERS: 1 | US FAERS | |
| 229 | Monoplegia | FAERS: 1 | US FAERS | |
| 230 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 231 | Neutropenia | FAERS: 1 | US FAERS | |
| 232 | Neutrophil count decreased | FAERS: 1 | US FAERS | |
| 233 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 234 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 235 | Pancytopenia | FAERS: 1 | US FAERS | |
| 236 | Paranasal sinus discomfort | FAERS: 1 | US FAERS | |
| 237 | Peripheral nerve lesion | FAERS: 1 | US FAERS | |
| 238 | Phlebitis | FAERS: 1 | US FAERS | |
| 239 | Photophobia | FAERS: 1 | US FAERS | |
| 240 | Pituitary enlargement | FAERS: 1 | US FAERS | |
| 241 | Portal Vein Thrombosis | FAERS: 1 | US FAERS | |
| 242 | Post procedural discharge | FAERS: 1 | US FAERS | |
| 243 | Presyncope | FAERS: 1 | US FAERS | |
| 244 | Procedural complication | FAERS: 1 | US FAERS | |
| 245 | Product administered at inappropriate site | FAERS: 1 | US FAERS | |
| 246 | Product prescribing error | FAERS: 1 | US FAERS | |
| 247 | Pyelocaliectasis | FAERS: 1 | US FAERS | |
| 248 | Pyelonephritis | FAERS: 1 | US FAERS | |
| 249 | Radicular pain | FAERS: 1 | US FAERS | |
| 250 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 251 | Rheumatic disorder | FAERS: 1 | US FAERS | |
| 252 | Sciatica | FAERS: 1 | US FAERS | |
| 253 | Sinus bradycardia | FAERS: 1 | SIDER US FAERS | |
| 254 | Skin reaction | FAERS: 1 | US FAERS | |
| 255 | Status Epilepticus | FAERS: 1 | US FAERS | |
| 256 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 257 | Terminal state | FAERS: 1 | US FAERS | |
| 258 | Therapeutic response changed | FAERS: 1 | US FAERS | |
| 259 | Thirst | FAERS: 1 | US FAERS | |
| 260 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 261 | Toothache | FAERS: 1 | US FAERS | |
| 262 | Tremor | FAERS: 1 | US FAERS | |
| 263 | Tympanic Membrane Perforation | FAERS: 1 | US FAERS | |
| 264 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 265 | Urine output increased | FAERS: 1 | US FAERS | |
| 266 | Uterine Cancer | FAERS: 1 | US FAERS | |
| 267 | Venous Thrombosis | FAERS: 1 | US FAERS | |
| 268 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 269 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 270 | Wound dehiscence | FAERS: 1 | US FAERS | |
| 271 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 272 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 273 | Xanthoma | FAERS: 1 | US FAERS | |
| 274 | furuncle | FAERS: 1 | US FAERS | |
| 275 | jaundice | FAERS: 1 | SIDER US FAERS | |
| 276 | ovarian neoplasm | FAERS: 1 | US FAERS | |
| 277 | Anxiety | SIDER | ||
| 278 | Blood amylase increased | SIDER | ||
| 279 | Gamma-Glutamyltransferase Increased | SIDER | ||
| 280 | Gastrointestinal Pain | SIDER | ||
| 281 | Ischemia | 18624922 | CTD | |
| 282 | Lipase increased | SIDER | ||
| 283 | Musculoskeletal discomfort | SIDER | ||
| 284 | Pituitary hormone deficiency | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.