prednisolone phosphate
(VJZLQIPZNBPASX-OJJGEMKLSA-L)
Structure
- SMILES
- O=C1C=C[C@]2(C(=C1)CC[C@@H]1[C@@H]2[C@@H](O)C[C@]2([C@H]1CC[C@]2(O)C(=O)COP(=O)([O-])[O-])C)C.[Na+].[Na+]
- Molecular Formula:
- C21H27Na2O8P
- Molecular Weight:
- 484.388
- Log P:
- 2.5510
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 2
- TPSA:
- 156.83
- CAS Number(s):
- 125-02-0
Synonym(s)
1.
prednisolone phosphate
2.
Pediapred
3.
Predsol
4.
prednisolone 21-phosphate sodium
5.
prednisolone phosphate sodium
6.
prednisolone phosphate, monosodium salt, (11beta)-isomer
7.
prednisolone phosphate, sodium salt, (11beta)-isomer
8.
prednisolone sodium phosphate
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Maternal exposure timing unspecified | FAERS: 7 | US FAERS | |
| 2 | Adverse event | FAERS: 6 | US FAERS | |
| 3 | Low birth weight baby | FAERS: 5 | US FAERS | |
| 4 | Urticaria | FAERS: 4 | US FAERS | |
| 5 | Diabetes Mellitus | FAERS: 3 | US FAERS | |
| 6 | Pneumonia | FAERS: 3 | US FAERS | |
| 7 | Retinal Detachment | FAERS: 3 | US FAERS | |
| 8 | Scedosporium infection | FAERS: 3 | US FAERS | |
| 9 | Sepsis | FAERS: 3 | US FAERS | |
| 10 | Abscess | FAERS: 2 | US FAERS | |
| 11 | Cataract | FAERS: 2 | US FAERS | |
| 12 | Drooling | FAERS: 2 | US FAERS | |
| 13 | Drug ineffective | FAERS: 2 | US FAERS | |
| 14 | Fatigue | FAERS: 2 | US FAERS | |
| 15 | Glaucoma | FAERS: 2 | US FAERS | |
| 16 | Pemphigus | FAERS: 2 | US FAERS | |
| 17 | Respiratory distress | FAERS: 2 | US FAERS | |
| 18 | Retinal Drusen | FAERS: 2 | US FAERS | |
| 19 | Throat irritation | FAERS: 2 | US FAERS | |
| 20 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 21 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 22 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 23 | Amniotic fluid volume decreased | FAERS: 1 | US FAERS | |
| 24 | Angiogram abnormal | FAERS: 1 | US FAERS | |
| 25 | Anxiety | FAERS: 1 | US FAERS | |
| 26 | Ascites | FAERS: 1 | US FAERS | |
| 27 | Asthenopia | FAERS: 1 | US FAERS | |
| 28 | Back Pain | FAERS: 1 | US FAERS | |
| 29 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 30 | Bone Tuberculosis | FAERS: 1 | US FAERS | |
| 31 | Bone density decreased | FAERS: 1 | US FAERS | |
| 32 | Bradycardia | FAERS: 1 | US FAERS | |
| 33 | Bronchopulmonary Aspergillosis | FAERS: 1 | US FAERS | |
| 34 | Cardiac dysfunction | FAERS: 1 | US FAERS | |
| 35 | Corneal Opacity | FAERS: 1 | US FAERS | |
| 36 | Crying | FAERS: 1 | US FAERS | |
| 37 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 38 | Diastolic dysfunction | FAERS: 1 | US FAERS | |
| 39 | Ecthyma | FAERS: 1 | US FAERS | |
| 40 | Elschnig's bodies | FAERS: 1 | US FAERS | |
| 41 | Emphysematous cystitis | FAERS: 1 | US FAERS | |
| 42 | Facial paralysis | FAERS: 1 | US FAERS | |
| 43 | Gastric pneumatosis | FAERS: 1 | US FAERS | |
| 44 | Hallucinations, mixed | FAERS: 1 | US FAERS | |
| 45 | Headache | FAERS: 1 | US FAERS | |
| 46 | Hepatitis B | FAERS: 1 | US FAERS | |
| 47 | Hepatitis E | FAERS: 1 | US FAERS | |
| 48 | Hypertrophic Cardiomyopathy | FAERS: 1 | US FAERS | |
| 49 | Hypokinesia | FAERS: 1 | US FAERS | |
| 50 | Hypoperfusion | FAERS: 1 | US FAERS | |
| 51 | Hypotension | FAERS: 1 | US FAERS | |
| 52 | Hypothalamo-pituitary disorder | FAERS: 1 | US FAERS | |
| 53 | Hypoxia | FAERS: 1 | US FAERS | |
| 54 | Infection | FAERS: 1 | US FAERS | |
| 55 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 56 | Klebsiella sepsis | FAERS: 1 | US FAERS | |
| 57 | Large intestine perforation | FAERS: 1 | US FAERS | |
| 58 | Latent Tuberculosis | FAERS: 1 | US FAERS | |
| 59 | Lemierre Syndrome | FAERS: 1 | US FAERS | |
| 60 | Liver Abscess | FAERS: 1 | US FAERS | |
| 61 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 62 | Lung Abscess | FAERS: 1 | US FAERS | |
| 63 | Lymphopenia | FAERS: 1 | US FAERS | |
| 64 | Macular degeneration | FAERS: 1 | US FAERS | |
| 65 | Macular fibrosis | FAERS: 1 | US FAERS | |
| 66 | Macular pseudohole | FAERS: 1 | US FAERS | |
| 67 | Malaise | FAERS: 1 | US FAERS | |
| 68 | Malignant Hypertension | FAERS: 1 | US FAERS | |
| 69 | Meconium Aspiration Syndrome | FAERS: 1 | US FAERS | |
| 70 | Medication Error | FAERS: 1 | US FAERS | |
| 71 | Mood swings | FAERS: 1 | US FAERS | |
| 72 | Myalgia | FAERS: 1 | US FAERS | |
| 73 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 74 | Nausea | FAERS: 1 | US FAERS | |
| 75 | Necrosis | FAERS: 1 | US FAERS | |
| 76 | Neonatal respiratory failure | FAERS: 1 | US FAERS | |
| 77 | Oligohydramnios | FAERS: 1 | US FAERS | |
| 78 | Osteochondrosis | FAERS: 1 | US FAERS | |
| 79 | Osteopenia | FAERS: 1 | US FAERS | |
| 80 | Peliosis Hepatis | FAERS: 1 | US FAERS | |
| 81 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 82 | Pneumoperitoneum | FAERS: 1 | US FAERS | |
| 83 | Pneumothorax | FAERS: 1 | US FAERS | |
| 84 | Poor feeding infant | FAERS: 1 | US FAERS | |
| 85 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 86 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 87 | Retinal exudates | FAERS: 1 | US FAERS | |
| 88 | Shock | FAERS: 1 | US FAERS | |
| 89 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 90 | Soft tissue necrosis | FAERS: 1 | US FAERS | |
| 91 | Steroid diabetes | FAERS: 1 | US FAERS | |
| 92 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 93 | Stomatitis | FAERS: 1 | US FAERS | |
| 94 | Strongyloidiasis | FAERS: 1 | US FAERS | |
| 95 | Subcutaneous Emphysema | FAERS: 1 | US FAERS | |
| 96 | Systolic dysfunction | FAERS: 1 | US FAERS | |
| 97 | Thrombosis | FAERS: 1 | US FAERS | |
| 98 | Tonsillitis | FAERS: 1 | US FAERS | |
| 99 | Tremor | FAERS: 1 | US FAERS | |
| 100 | Type 2 lepra reaction | FAERS: 1 | US FAERS | |
| 101 | Unevaluable event | FAERS: 1 | US FAERS | |
| 102 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 103 | Varicella Zoster Virus Infection | FAERS: 1 | US FAERS | |
| 104 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 105 | Ventricular arrhythmia | FAERS: 1 | US FAERS | |
| 106 | Vomiting | FAERS: 1 | US FAERS | |
| 107 | Burning sensation | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.