insulin glulisine
(RCHHVVGSTHAVPF-ZPHPLDECSA-N)
Structure
- SMILES
- NCCCC[C@@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H]1CSSC[C@@H]2NC(=O)[C@H](CSSC[C@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC2=O)[C@H](O)C)CO)[C@H](CC)C)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc2ccc(cc2)O)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CC(=O)N)C(=O)N[C@@H](Cc2ccc(cc2)O)C(=O)N[C@@H](CSSC[C@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)CNC1=O)CO)Cc1c[nH]cn1)CC(C)C)C(C)C)CCC(=O)O)C)CC(C)C)Cc1ccc(cc1)O)CC(C)C)C(C)C)C(=O)NCC(=O)N[C@H](C(=O)N[C@H](C(=O)NCC(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)N[C@H](C(=O)N[C@H](C(=O)O)[C@H](O)C)CCC(=O)O)[C@H](O)C)Cc1ccc(cc1)O)Cc1ccccc1)Cc1ccccc1)CCCNC(=N)N)CCC(=O)O)C(=O)N[C@H](C(=O)O)CC(=O)N)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](C(C)C)NC(=O)[C@H]([C@H](CC)C)NC(=O)CN)CCC(=O)O)CCC(=O)N)CC(C)C)Cc1c[nH]cn1)CCC(=O)N)NC(=O)[C@H](C(C)C)NC(=O)[C@H](Cc1ccccc1)N
- Molecular Formula:
- C258H384N64O78S6
- Molecular Weight:
- 5822.580
- Log P:
- 5.4969
- Hydrogen Bond Acceptor:
- 146
- Hydrogen Bond Donor:
- 78
- TPSA:
- 2445.08
- CAS Number(s):
- 207748-29-6
Synonym(s)
1.
insulin glulisine
2.
Apidra
3.
B3-lysyl-B29-glutamylinsulin
4.
glulisine insulin
5.
insulin, Lys(B3)-Glu(B29)-
6.
insulin, lysyl(B3)-glutamyl(B29)-
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Blood glucose increased | FAERS: 197 Canada Vigilance: 16 | Canada Vigilance US FAERS | |
| 2 | Drug ineffective | FAERS: 134 Canada Vigilance: 16 | Canada Vigilance US FAERS | |
| 3 | Product quality issue | FAERS: 62 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 4 | Diabetic Ketoacidosis | FAERS: 55 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 5 | Blood glucose abnormal | FAERS: 43 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 6 | Malaise | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 7 | Blood glucose decreased | FAERS: 23 | US FAERS | |
| 8 | Vomiting | FAERS: 19 | US FAERS | |
| 9 | Feeling abnormal | FAERS: 18 | US FAERS | |
| 10 | Liquid product physical issue | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 11 | Nausea | FAERS: 17 | US FAERS | |
| 12 | Ketoacidosis | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 13 | Fatigue | FAERS: 13 | US FAERS | |
| 14 | Unevaluable event | FAERS: 12 | US FAERS | |
| 15 | Diabetes mellitus inadequate control | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 16 | Drug dose omission | FAERS: 11 | US FAERS | |
| 17 | Dizziness | FAERS: 10 | US FAERS | |
| 18 | Headache | FAERS: 10 | US FAERS | |
| 19 | Abdominal discomfort | FAERS: 9 | US FAERS | |
| 20 | Adverse event | FAERS: 9 | US FAERS | |
| 21 | Drug exposure during pregnancy | FAERS: 9 | US FAERS | |
| 22 | Ketosis | FAERS: 9 | US FAERS | |
| 23 | Myalgia | FAERS: 9 | US FAERS | |
| 24 | Pruritus | FAERS: 9 | US FAERS | |
| 25 | Weight decreased | FAERS: 9 | US FAERS | |
| 26 | Incorrect dose administered | FAERS: 8 | US FAERS | |
| 27 | Product use issue | FAERS: 8 | US FAERS | |
| 28 | Tremor | FAERS: 8 | US FAERS | |
| 29 | Urticaria | FAERS: 8 | US FAERS | |
| 30 | Expired product administered | FAERS: 7 | US FAERS | |
| 31 | Hypersensitivity | FAERS: 7 | US FAERS | |
| 32 | Inappropriate schedule of product administration | FAERS: 7 | US FAERS | |
| 33 | Pain | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 34 | Pharmaceutical product complaint | FAERS: 7 | US FAERS | |
| 35 | Syncope | FAERS: 7 | US FAERS | |
| 36 | Drug administration error | FAERS: 6 | US FAERS | |
| 37 | Incorrect product storage | FAERS: 6 | US FAERS | |
| 38 | Myocardial Infarction | FAERS: 6 | US FAERS | |
| 39 | Visual Impairment | FAERS: 6 | US FAERS | |
| 40 | Anxiety | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 41 | Blood glucose fluctuation | FAERS: 5 | US FAERS | |
| 42 | Device leakage | FAERS: 5 | US FAERS | |
| 43 | Device operational issue | FAERS: 5 | US FAERS | |
| 44 | Injection site bruising | FAERS: 5 | US FAERS | |
| 45 | Injection site pain | FAERS: 5 | US FAERS | |
| 46 | Injection site scar | FAERS: 5 | US FAERS | |
| 47 | Palpitations | FAERS: 5 | US FAERS | |
| 48 | Product dose omission | FAERS: 5 | US FAERS | |
| 49 | Product storage error | FAERS: 5 | US FAERS | |
| 50 | Asthenia | FAERS: 4 | US FAERS | |
| 51 | Cerebrovascular accident | FAERS: 4 | US FAERS | |
| 52 | Device occlusion | FAERS: 4 | US FAERS | |
| 53 | Infection | FAERS: 4 | US FAERS | |
| 54 | Nasopharyngitis | FAERS: 4 | US FAERS | |
| 55 | Product gel formation | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 56 | Blood ketone body increased | FAERS: 3 | US FAERS | |
| 57 | Burning sensation | FAERS: 3 | US FAERS | |
| 58 | Device malfunction | FAERS: 3 | US FAERS | |
| 59 | Drug dispensing error | FAERS: 3 | US FAERS | |
| 60 | Dysgeusia | FAERS: 3 | US FAERS | |
| 61 | Eye irritation | FAERS: 3 | US FAERS | |
| 62 | Incorrect dose administered by device | FAERS: 3 | US FAERS | |
| 63 | Injection site erythema | FAERS: 3 | US FAERS | |
| 64 | Pallor | FAERS: 3 | US FAERS | |
| 65 | Product contamination with body fluid | FAERS: 3 | US FAERS | |
| 66 | Product physical consistency issue | FAERS: 3 | US FAERS | |
| 67 | Product physical issue | FAERS: 3 | US FAERS | |
| 68 | Activities of daily living impaired | FAERS: 2 | US FAERS | |
| 69 | Arthritis | FAERS: 2 | US FAERS | |
| 70 | Atrial Fibrillation | FAERS: 2 | US FAERS | |
| 71 | Bacteriuria | FAERS: 2 | US FAERS | |
| 72 | Blood creatine phosphokinase MB increased | FAERS: 2 | US FAERS | |
| 73 | Blood creatinine increased | FAERS: 2 | US FAERS | |
| 74 | Blood gases abnormal | FAERS: 2 | US FAERS | |
| 75 | Blood ketone body | FAERS: 2 | US FAERS | |
| 76 | Blood pH decreased | FAERS: 2 | US FAERS | |
| 77 | Carbon dioxide decreased | FAERS: 2 | US FAERS | |
| 78 | Cataract operation | FAERS: 2 | US FAERS | |
| 79 | Dehydration | FAERS: 2 | US FAERS | |
| 80 | Device breakage | FAERS: 2 | US FAERS | |
| 81 | Disability | FAERS: 2 | US FAERS | |
| 82 | Dyspepsia | FAERS: 2 | US FAERS | |
| 83 | Erythema | FAERS: 2 | US FAERS | |
| 84 | Expired drug administered | FAERS: 2 | US FAERS | |
| 85 | Exposure during breast feeding | FAERS: 2 | US FAERS | |
| 86 | Extra dose administered | FAERS: 2 | US FAERS | |
| 87 | Feeling Cold | FAERS: 2 | US FAERS | |
| 88 | Feeling jittery | FAERS: 2 | US FAERS | |
| 89 | Flushing | FAERS: 2 | US FAERS | |
| 90 | Hemiplegia | FAERS: 2 | US FAERS | |
| 91 | Hunger | FAERS: 2 | US FAERS | |
| 92 | Inability to afford medication | FAERS: 2 | US FAERS | |
| 93 | Inferior vena cava dilatation | FAERS: 2 | US FAERS | |
| 94 | Infusion site reaction | FAERS: 2 | US FAERS | |
| 95 | Injection site abscess | FAERS: 2 | US FAERS | |
| 96 | Injection site mass | FAERS: 2 | US FAERS | |
| 97 | Injection site pruritus | FAERS: 2 | US FAERS | |
| 98 | Insulin Resistance | FAERS: 2 | US FAERS | |
| 99 | Laceration | FAERS: 2 | US FAERS | |
| 100 | Lipodystrophy acquired | FAERS: 2 | US FAERS | |
| 101 | Memory impairment | FAERS: 2 | US FAERS | |
| 102 | Nervousness | FAERS: 2 | US FAERS | |
| 103 | Overdose | FAERS: 2 | US FAERS | |
| 104 | PCO2 decreased | FAERS: 2 | US FAERS | |
| 105 | Product contamination physical | FAERS: 2 | US FAERS | |
| 106 | Protein urine present | FAERS: 2 | US FAERS | |
| 107 | Sepsis | FAERS: 2 | US FAERS | |
| 108 | Somnolence | FAERS: 2 | US FAERS | |
| 109 | Swelling | FAERS: 2 | US FAERS | |
| 110 | Therapeutic response delayed | FAERS: 2 | US FAERS | |
| 111 | Tinnitus | FAERS: 2 | US FAERS | |
| 112 | Trisomy 21 | FAERS: 2 | US FAERS | |
| 113 | Urinary tract infection | FAERS: 2 | US FAERS | |
| 114 | Wrong drug administered | FAERS: 2 | US FAERS | |
| 115 | Abasia | FAERS: 1 | US FAERS | |
| 116 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 117 | Accidental overdose | FAERS: 1 | US FAERS | |
| 118 | Agitation | FAERS: 1 | US FAERS | |
| 119 | Alopecia | FAERS: 1 | US FAERS | |
| 120 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 121 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 122 | Antibody test positive | FAERS: 1 | US FAERS | |
| 123 | Aphasia | FAERS: 1 | US FAERS | |
| 124 | Application site hypersensitivity | FAERS: 1 | US FAERS | |
| 125 | Application site rash | FAERS: 1 | US FAERS | |
| 126 | Arthralgia | FAERS: 1 | US FAERS | |
| 127 | Arthropathy | FAERS: 1 | US FAERS | |
| 128 | Back Pain | FAERS: 1 | US FAERS | |
| 129 | Blood insulin abnormal | FAERS: 1 | US FAERS | |
| 130 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 131 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 132 | Cataract | FAERS: 1 | US FAERS | |
| 133 | Catheter site discharge | FAERS: 1 | US FAERS | |
| 134 | Catheter site mass | FAERS: 1 | US FAERS | |
| 135 | Catheter site swelling | FAERS: 1 | US FAERS | |
| 136 | Chest Pain | FAERS: 1 | US FAERS | |
| 137 | Chest discomfort | FAERS: 1 | US FAERS | |
| 138 | Constipation | FAERS: 1 | US FAERS | |
| 139 | Dementia | FAERS: 1 | US FAERS | |
| 140 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 141 | Depressed mood | FAERS: 1 | US FAERS | |
| 142 | Dermatitis | FAERS: 1 | US FAERS | |
| 143 | Device Failure | FAERS: 1 | US FAERS | |
| 144 | Device difficult to use | FAERS: 1 | US FAERS | |
| 145 | Device ineffective | FAERS: 1 | US FAERS | |
| 146 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 147 | Diabetic Foot | FAERS: 1 | US FAERS | |
| 148 | Diabetic Retinopathy | FAERS: 1 | US FAERS | |
| 149 | Drug Tolerance | FAERS: 1 | US FAERS | |
| 150 | Drug abuse | FAERS: 1 | US FAERS | |
| 151 | Drug effect delayed | FAERS: 1 | US FAERS | |
| 152 | Drug resistance | FAERS: 1 | US FAERS | |
| 153 | Dysuria | FAERS: 1 | US FAERS | |
| 154 | Ear discomfort | FAERS: 1 | US FAERS | |
| 155 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 156 | Endocrine test abnormal | FAERS: 1 | US FAERS | |
| 157 | Epistaxis | FAERS: 1 | US FAERS | |
| 158 | Euphoric mood | FAERS: 1 | US FAERS | |
| 159 | Exposure via father | FAERS: 1 | US FAERS | |
| 160 | Eye pain | FAERS: 1 | US FAERS | |
| 161 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 162 | Granuloma Annulare | FAERS: 1 | US FAERS | |
| 163 | Hyperkeratosis | FAERS: 1 | US FAERS | |
| 164 | Impaired work ability | FAERS: 1 | US FAERS | |
| 165 | Incoherent | FAERS: 1 | US FAERS | |
| 166 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 167 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 168 | Infusion site erythema | FAERS: 1 | US FAERS | |
| 169 | Infusion site infection | FAERS: 1 | US FAERS | |
| 170 | Injection Site Reaction | FAERS: 1 | US FAERS | |
| 171 | Injection site infection | FAERS: 1 | US FAERS | |
| 172 | Injection site inflammation | FAERS: 1 | US FAERS | |
| 173 | Injection site nodule | FAERS: 1 | US FAERS | |
| 174 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 175 | Intercepted product storage error | FAERS: 1 | US FAERS | |
| 176 | Joint stiffness | FAERS: 1 | US FAERS | |
| 177 | Laryngitis | FAERS: 1 | US FAERS | |
| 178 | Laryngospasm | FAERS: 1 | US FAERS | |
| 179 | Lethargy | FAERS: 1 | US FAERS | |
| 180 | Limb injury | FAERS: 1 | US FAERS | |
| 181 | Macular degeneration | FAERS: 1 | US FAERS | |
| 182 | Medical device complication | FAERS: 1 | US FAERS | |
| 183 | Menorrhagia | FAERS: 1 | US FAERS | |
| 184 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 185 | Motion Sickness | FAERS: 1 | US FAERS | |
| 186 | Multiple sclerosis relapse | FAERS: 1 | US FAERS | |
| 187 | Multiple use of single-use product | FAERS: 1 | US FAERS | |
| 188 | Muscle tightness | FAERS: 1 | US FAERS | |
| 189 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 190 | Myositis | FAERS: 1 | US FAERS | |
| 191 | Neck Pain | FAERS: 1 | US FAERS | |
| 192 | Needle issue | FAERS: 1 | US FAERS | |
| 193 | No adverse event | FAERS: 1 | US FAERS | |
| 194 | Nodule | FAERS: 1 | US FAERS | |
| 195 | Ocular icterus | FAERS: 1 | US FAERS | |
| 196 | Onychomycosis | FAERS: 1 | US FAERS | |
| 197 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 198 | Pain of skin | FAERS: 1 | US FAERS | |
| 199 | Pancreatic Neoplasm | FAERS: 1 | US FAERS | |
| 200 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 201 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 202 | Pneumonia | FAERS: 1 | US FAERS | |
| 203 | Polydipsia | FAERS: 1 | US FAERS | |
| 204 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 205 | Post procedural complication | FAERS: 1 | US FAERS | |
| 206 | Pre-Eclampsia | FAERS: 1 | US FAERS | |
| 207 | Product measured potency issue | FAERS: 1 | US FAERS | |
| 208 | Product name confusion | FAERS: 1 | US FAERS | |
| 209 | Product packaging confusion | FAERS: 1 | US FAERS | |
| 210 | Product substitution issue | FAERS: 1 | US FAERS | |
| 211 | Product use complaint | FAERS: 1 | US FAERS | |
| 212 | Productive Cough | FAERS: 1 | US FAERS | |
| 213 | Proteinuria | FAERS: 1 | US FAERS | |
| 214 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 215 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 216 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 217 | Pyelonephritis | FAERS: 1 | US FAERS | |
| 218 | Renal cyst | FAERS: 1 | US FAERS | |
| 219 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 220 | Serum Sickness | FAERS: 1 | US FAERS | |
| 221 | Shock | FAERS: 1 | US FAERS | |
| 222 | Sinusitis | FAERS: 1 | US FAERS | |
| 223 | Skin Induration | FAERS: 1 | US FAERS | |
| 224 | Skin irritation | FAERS: 1 | US FAERS | |
| 225 | Skin nodule | FAERS: 1 | US FAERS | |
| 226 | Soft Tissue Infection | FAERS: 1 | US FAERS | |
| 227 | Sopor | FAERS: 1 | US FAERS | |
| 228 | Spinal fusion surgery | FAERS: 1 | US FAERS | |
| 229 | Stress | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 230 | Suspected product tampering | FAERS: 1 | US FAERS | |
| 231 | Tachyphrenia | FAERS: 1 | US FAERS | |
| 232 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 233 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 234 | Thirst | FAERS: 1 | US FAERS | |
| 235 | Thrombosis | FAERS: 1 | US FAERS | |
| 236 | Thrombotic stroke | FAERS: 1 | US FAERS | |
| 237 | Tooth Infection | FAERS: 1 | US FAERS | |
| 238 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 239 | Transcription medication error | FAERS: 1 | US FAERS | |
| 240 | Ulcer | FAERS: 1 | US FAERS | |
| 241 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 242 | Urethritis | FAERS: 1 | US FAERS | |
| 243 | Urine ketone body present | FAERS: 1 | US FAERS | |
| 244 | Vasculitis | FAERS: 1 | US FAERS | |
| 245 | Victim of homicide | FAERS: 1 | US FAERS | |
| 246 | Vulvovaginal burning sensation | FAERS: 1 | US FAERS | |
| 247 | Vulvovaginal mycotic infection | FAERS: 1 | US FAERS | |
| 248 | Wrong product administered | FAERS: 1 | US FAERS | |
| 249 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 250 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 251 | jaundice | FAERS: 1 | US FAERS | |
| 252 | Product administration error | Canada Vigilance: 1 | Canada Vigilance | |
| 253 | Product complaint | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120240
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.