indacaterol
(QZZUEBNBZAPZLX-QFIPXVFZSA-N)
Structure
- SMILES
- CCc1cc2CC(Cc2cc1CC)NC[C@@H](c1ccc(c2c1ccc(=O)[nH]2)O)O
- Type(s)
- Approved
- ATC code(s)
- R03AC18; R03AL04
- Molecular Formula:
- C24H28N2O3
- Molecular Weight:
- 392.491
- Log P:
- 3.5398
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 4
- TPSA:
- 85.35
- CAS Number(s):
- 312753-06-3; 753498-25-8
Synonym(s)
1.
indacaterol
2.
5-(2-(5,6-diethylindan-2-ylamino)-1-hydroxyethyl)-8-hydroxy-1H-quinolin-2-one
3.
Onbrez
4.
QAB-149
5.
arcapta neohaler
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Pneumonia | FAERS: 57 | SIDER US FAERS | |
| 2 | Malaise | FAERS: 45 | US FAERS | |
| 3 | Inappropriate schedule of drug administration | FAERS: 33 | US FAERS | |
| 4 | Incorrect route of drug administration | FAERS: 33 | US FAERS | |
| 5 | Fatigue | FAERS: 32 | US FAERS | |
| 6 | Myocardial Infarction | FAERS: 32 | US FAERS | |
| 7 | Bronchitis | FAERS: 30 | US FAERS | |
| 8 | Cardiac Arrest | FAERS: 29 | US FAERS | |
| 9 | Asphyxia | FAERS: 24 | US FAERS | |
| 10 | Respiratory Failure | FAERS: 23 | US FAERS | |
| 11 | Agitation | FAERS: 22 | US FAERS | |
| 12 | Asthma | FAERS: 22 | SIDER US FAERS | |
| 13 | Chest Pain | FAERS: 22 | SIDER US FAERS | |
| 14 | Dizziness | FAERS: 19 | SIDER US FAERS | |
| 15 | Infarction | FAERS: 19 | US FAERS | |
| 16 | Cerebrovascular accident | FAERS: 18 | US FAERS | |
| 17 | Choking | FAERS: 18 | US FAERS | |
| 18 | Pain | FAERS: 18 | US FAERS | |
| 19 | Tachycardia | FAERS: 18 | SIDER US FAERS | |
| 20 | Influenza | FAERS: 16 | US FAERS | |
| 21 | Palpitations | FAERS: 16 | SIDER US FAERS | |
| 22 | Vomiting | FAERS: 16 | US FAERS | |
| 23 | Drug ineffective | FAERS: 15 | US FAERS | |
| 24 | Headache | FAERS: 15 | SIDER US FAERS | |
| 25 | Asthenia | FAERS: 14 | US FAERS | |
| 26 | Bronchospasm | FAERS: 14 | SIDER US FAERS | |
| 27 | Throat irritation | FAERS: 14 | SIDER US FAERS | |
| 28 | Nasopharyngitis | FAERS: 13 | SIDER US FAERS | |
| 29 | Syncope | FAERS: 13 | US FAERS | |
| 30 | Feeling abnormal | FAERS: 12 | US FAERS | |
| 31 | Infection | FAERS: 12 | SIDER US FAERS | |
| 32 | Product use in unapproved indication | FAERS: 12 | US FAERS | |
| 33 | Back Pain | FAERS: 11 | US FAERS | |
| 34 | Chest discomfort | FAERS: 11 | SIDER US FAERS | |
| 35 | General physical health deterioration | FAERS: 11 | US FAERS | |
| 36 | Hypersensitivity | FAERS: 11 | SIDER US FAERS | |
| 37 | Increased upper airway secretion | FAERS: 11 | US FAERS | |
| 38 | Respiratory arrest | FAERS: 11 | US FAERS | |
| 39 | Abasia | FAERS: 10 | US FAERS | |
| 40 | Arthralgia | FAERS: 10 | US FAERS | |
| 41 | Incorrect dose administered | FAERS: 10 | US FAERS | |
| 42 | Nervousness | FAERS: 10 | US FAERS | |
| 43 | Pulmonary Fibrosis | FAERS: 10 | US FAERS | |
| 44 | Tremor | FAERS: 10 | SIDER US FAERS | |
| 45 | Deafness | FAERS: 9 | US FAERS | |
| 46 | Oropharyngeal pain | FAERS: 9 | SIDER US FAERS | |
| 47 | Septic Shock | FAERS: 9 | US FAERS | |
| 48 | Atrial Fibrillation | FAERS: 8 | SIDER US FAERS | |
| 49 | Cataract | FAERS: 8 | US FAERS | |
| 50 | Constipation | FAERS: 8 | US FAERS | |
| 51 | Hypotension | FAERS: 8 | US FAERS | |
| 52 | Nausea | FAERS: 8 | SIDER US FAERS | |
| 53 | Productive Cough | FAERS: 8 | US FAERS | |
| 54 | Wheezing | FAERS: 8 | US FAERS | |
| 55 | Aphonia | FAERS: 7 | US FAERS | |
| 56 | Dysphonia | FAERS: 7 | US FAERS | |
| 57 | Pulmonary Embolism | FAERS: 7 | US FAERS | |
| 58 | Weight decreased | FAERS: 7 | US FAERS | |
| 59 | Angioedema | FAERS: 6 | US FAERS | |
| 60 | Blood glucose increased | FAERS: 6 | US FAERS | |
| 61 | Cholelithiasis | FAERS: 6 | US FAERS | |
| 62 | Concomitant disease progression | FAERS: 6 | US FAERS | |
| 63 | Memory impairment | FAERS: 6 | US FAERS | |
| 64 | Pneumothorax | FAERS: 6 | US FAERS | |
| 65 | Pruritus | FAERS: 6 | SIDER US FAERS | |
| 66 | Swelling | FAERS: 6 | US FAERS | |
| 67 | Atrial Flutter | FAERS: 5 | US FAERS | |
| 68 | Dysuria | FAERS: 5 | US FAERS | |
| 69 | Flatulence | FAERS: 5 | US FAERS | |
| 70 | Hypoxia | FAERS: 5 | US FAERS | |
| 71 | Product use issue | FAERS: 5 | US FAERS | |
| 72 | Respiratory tract congestion | FAERS: 5 | US FAERS | |
| 73 | Supraventricular tachycardia | FAERS: 5 | US FAERS | |
| 74 | Tachyarrhythmia | FAERS: 5 | US FAERS | |
| 75 | Tuberculosis | FAERS: 5 | US FAERS | |
| 76 | Urinary Retention | FAERS: 5 | US FAERS | |
| 77 | Urinary tract infection | FAERS: 5 | US FAERS | |
| 78 | Abdominal Pain | FAERS: 4 | US FAERS | |
| 79 | Abdominal discomfort | FAERS: 4 | US FAERS | |
| 80 | Angina Pectoris | FAERS: 4 | SIDER US FAERS | |
| 81 | Anxiety | FAERS: 4 | US FAERS | |
| 82 | Concomitant disease aggravated | FAERS: 4 | US FAERS | |
| 83 | Coronary Artery Disease | FAERS: 4 | US FAERS | |
| 84 | Dementia | FAERS: 4 | US FAERS | |
| 85 | Diabetes Mellitus | FAERS: 4 | SIDER US FAERS | |
| 86 | Discomfort | FAERS: 4 | US FAERS | |
| 87 | Disease Progression | FAERS: 4 | US FAERS | |
| 88 | Inflammation | FAERS: 4 | US FAERS | |
| 89 | Pulmonary congestion | FAERS: 4 | US FAERS | |
| 90 | Sepsis | FAERS: 4 | US FAERS | |
| 91 | Sinusitis | FAERS: 4 | SIDER US FAERS | |
| 92 | Sudden death | FAERS: 4 | US FAERS | |
| 93 | Thrombosis | FAERS: 4 | US FAERS | |
| 94 | Tonsillitis | FAERS: 4 | US FAERS | |
| 95 | Urinary Incontinence | FAERS: 4 | US FAERS | |
| 96 | Vertigo | FAERS: 4 | SIDER US FAERS | |
| 97 | Abscess | FAERS: 3 | US FAERS | |
| 98 | Acute respiratory failure | FAERS: 3 | US FAERS | |
| 99 | Back disorder | FAERS: 3 | US FAERS | |
| 100 | Blood pressure fluctuation | FAERS: 3 | US FAERS | |
| 101 | Blood sodium decreased | FAERS: 3 | US FAERS | |
| 102 | Bradycardia | FAERS: 3 | US FAERS | |
| 103 | Bronchiectasis | FAERS: 3 | US FAERS | |
| 104 | Cor pulmonale | FAERS: 3 | US FAERS | |
| 105 | Dehydration | FAERS: 3 | US FAERS | |
| 106 | Epistaxis | FAERS: 3 | US FAERS | |
| 107 | Fracture | FAERS: 3 | US FAERS | |
| 108 | Gastrointestinal carcinoma | FAERS: 3 | US FAERS | |
| 109 | Hernia | FAERS: 3 | US FAERS | |
| 110 | Intestinal Obstruction | FAERS: 3 | US FAERS | |
| 111 | Lip swelling | FAERS: 3 | US FAERS | |
| 112 | Medication Error | FAERS: 3 | US FAERS | |
| 113 | Musculoskeletal chest pain | FAERS: 3 | US FAERS | |
| 114 | No adverse event | FAERS: 3 | US FAERS | |
| 115 | Peripheral swelling | FAERS: 3 | US FAERS | |
| 116 | Pulmonary Hypertension | FAERS: 3 | US FAERS | |
| 117 | Respiratory distress | FAERS: 3 | US FAERS | |
| 118 | Retching | FAERS: 3 | US FAERS | |
| 119 | Secretion discharge | FAERS: 3 | US FAERS | |
| 120 | Somnolence | FAERS: 3 | US FAERS | |
| 121 | Visual Impairment | FAERS: 3 | US FAERS | |
| 122 | Acute myocardial infarction | FAERS: 2 | US FAERS | |
| 123 | Arthropathy | FAERS: 2 | US FAERS | |
| 124 | Atrioventricular Block | FAERS: 2 | US FAERS | |
| 125 | Blood creatinine increased | FAERS: 2 | US FAERS | |
| 126 | Blood potassium decreased | FAERS: 2 | US FAERS | |
| 127 | Cardiomegaly | FAERS: 2 | US FAERS | |
| 128 | Completed Suicide | FAERS: 2 | US FAERS | |
| 129 | Cyanosis | FAERS: 2 | US FAERS | |
| 130 | Delirium | FAERS: 2 | US FAERS | |
| 131 | Drug administration error | FAERS: 2 | US FAERS | |
| 132 | Dysgeusia | FAERS: 2 | US FAERS | |
| 133 | Dysphemia | FAERS: 2 | US FAERS | |
| 134 | Emotional disorder | FAERS: 2 | US FAERS | |
| 135 | Eye pain | FAERS: 2 | US FAERS | |
| 136 | Feeling jittery | FAERS: 2 | US FAERS | |
| 137 | Gastric ulcer | FAERS: 2 | US FAERS | |
| 138 | Gastrointestinal infection | FAERS: 2 | US FAERS | |
| 139 | Glaucoma | FAERS: 2 | US FAERS | |
| 140 | Head discomfort | FAERS: 2 | US FAERS | |
| 141 | Hyperventilation | FAERS: 2 | US FAERS | |
| 142 | Hypokinesia | FAERS: 2 | US FAERS | |
| 143 | Immobile | FAERS: 2 | US FAERS | |
| 144 | Incorrect route of product administration | FAERS: 2 | US FAERS | |
| 145 | Joint swelling | FAERS: 2 | US FAERS | |
| 146 | Laceration | FAERS: 2 | US FAERS | |
| 147 | Laryngitis | FAERS: 2 | US FAERS | |
| 148 | Limb injury | FAERS: 2 | US FAERS | |
| 149 | Lung hyperinflation | FAERS: 2 | US FAERS | |
| 150 | Mesothelioma | FAERS: 2 | US FAERS | |
| 151 | Myalgia | FAERS: 2 | SIDER US FAERS | |
| 152 | Nephrolithiasis | FAERS: 2 | US FAERS | |
| 153 | Osteoporosis | FAERS: 2 | US FAERS | |
| 154 | Pharyngitis | FAERS: 2 | US FAERS | |
| 155 | Product quality issue | FAERS: 2 | US FAERS | |
| 156 | Pulmonary function test decreased | FAERS: 2 | US FAERS | |
| 157 | Pulmonary thrombosis | FAERS: 2 | US FAERS | |
| 158 | Sinus Tachycardia | FAERS: 2 | US FAERS | |
| 159 | Sputum retention | FAERS: 2 | US FAERS | |
| 160 | Terminal state | FAERS: 2 | US FAERS | |
| 161 | Thirst decreased | FAERS: 2 | US FAERS | |
| 162 | Ulcer | FAERS: 2 | US FAERS | |
| 163 | Umbilical hernia | FAERS: 2 | US FAERS | |
| 164 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 165 | Acne | FAERS: 1 | US FAERS | |
| 166 | Acute Coronary Syndrome | FAERS: 1 | US FAERS | |
| 167 | Alopecia | FAERS: 1 | US FAERS | |
| 168 | Alpha-1 anti-trypsin decreased | FAERS: 1 | US FAERS | |
| 169 | Alveolar lung disease | FAERS: 1 | US FAERS | |
| 170 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 171 | Aneurysm | FAERS: 1 | US FAERS | |
| 172 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 173 | Aortic Rupture | FAERS: 1 | US FAERS | |
| 174 | Aphagia | FAERS: 1 | US FAERS | |
| 175 | Aphasia | FAERS: 1 | US FAERS | |
| 176 | Apparent death | FAERS: 1 | US FAERS | |
| 177 | Arthritis | FAERS: 1 | US FAERS | |
| 178 | Ascites | FAERS: 1 | US FAERS | |
| 179 | Atrial tachycardia | FAERS: 1 | US FAERS | |
| 180 | Benign Prostatic Hyperplasia | FAERS: 1 | US FAERS | |
| 181 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 182 | Blindness | FAERS: 1 | US FAERS | |
| 183 | Blood cholesterol abnormal | FAERS: 1 | US FAERS | |
| 184 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 185 | Blood fibrinogen increased | FAERS: 1 | US FAERS | |
| 186 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 187 | Blood immunoglobulin E increased | FAERS: 1 | US FAERS | |
| 188 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 189 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 190 | Body height below normal | FAERS: 1 | US FAERS | |
| 191 | Bone fissure | FAERS: 1 | US FAERS | |
| 192 | Bone marrow transplant rejection | FAERS: 1 | US FAERS | |
| 193 | Brain natriuretic peptide increased | FAERS: 1 | US FAERS | |
| 194 | Bronchial Hyperreactivity | FAERS: 1 | US FAERS | |
| 195 | Bronchiolitis | FAERS: 1 | US FAERS | |
| 196 | Bullous lung disease | FAERS: 1 | US FAERS | |
| 197 | Carbon dioxide increased | FAERS: 1 | US FAERS | |
| 198 | Cardiac Death | FAERS: 1 | US FAERS | |
| 199 | Cardiac asthma | FAERS: 1 | US FAERS | |
| 200 | Cellulitis | FAERS: 1 | US FAERS | |
| 201 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 202 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 203 | Chills | FAERS: 1 | US FAERS | |
| 204 | Choking sensation | FAERS: 1 | US FAERS | |
| 205 | Cold sweat | FAERS: 1 | US FAERS | |
| 206 | Colitis | FAERS: 1 | US FAERS | |
| 207 | Conjunctival irritation | FAERS: 1 | US FAERS | |
| 208 | Convalescent | FAERS: 1 | US FAERS | |
| 209 | Crying | FAERS: 1 | US FAERS | |
| 210 | Cyst | FAERS: 1 | US FAERS | |
| 211 | Dengue Fever | FAERS: 1 | US FAERS | |
| 212 | Depressed mood | FAERS: 1 | US FAERS | |
| 213 | Dermatitis | FAERS: 1 | SIDER US FAERS | |
| 214 | Device malfunction | FAERS: 1 | US FAERS | |
| 215 | Device use issue | FAERS: 1 | US FAERS | |
| 216 | Disease complication | FAERS: 1 | US FAERS | |
| 217 | Disorientation | FAERS: 1 | US FAERS | |
| 218 | Disuse syndrome | FAERS: 1 | US FAERS | |
| 219 | Drooling | FAERS: 1 | US FAERS | |
| 220 | Drug Dependence | FAERS: 1 | US FAERS | |
| 221 | Drug administered in wrong device | FAERS: 1 | US FAERS | |
| 222 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 223 | Dysarthria | FAERS: 1 | US FAERS | |
| 224 | Dysgraphia | FAERS: 1 | US FAERS | |
| 225 | Dyspepsia | FAERS: 1 | US FAERS | |
| 226 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 227 | Electrocardiogram QT interval abnormal | FAERS: 1 | US FAERS | |
| 228 | Epilepsy | FAERS: 1 | US FAERS | |
| 229 | Eructation | FAERS: 1 | US FAERS | |
| 230 | Erysipelas | FAERS: 1 | US FAERS | |
| 231 | Erythema | FAERS: 1 | US FAERS | |
| 232 | Essential Hypertension | FAERS: 1 | US FAERS | |
| 233 | Expired product administered | FAERS: 1 | US FAERS | |
| 234 | Fibrosis | FAERS: 1 | US FAERS | |
| 235 | Flank Pain | FAERS: 1 | US FAERS | |
| 236 | Foaming at mouth | FAERS: 1 | US FAERS | |
| 237 | Foreign body aspiration | FAERS: 1 | US FAERS | |
| 238 | Fracture pain | FAERS: 1 | US FAERS | |
| 239 | Gastritis | FAERS: 1 | US FAERS | |
| 240 | Gout | FAERS: 1 | US FAERS | |
| 241 | Granuloma | FAERS: 1 | US FAERS | |
| 242 | Heart sounds abnormal | FAERS: 1 | US FAERS | |
| 243 | Hepatitis C | FAERS: 1 | US FAERS | |
| 244 | Hepatitis | FAERS: 1 | US FAERS | |
| 245 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 246 | Hormone level abnormal | FAERS: 1 | US FAERS | |
| 247 | Hyperkeratosis | FAERS: 1 | US FAERS | |
| 248 | Hypophagia | FAERS: 1 | US FAERS | |
| 249 | Hypoventilation | FAERS: 1 | US FAERS | |
| 250 | Incisional hernia | FAERS: 1 | US FAERS | |
| 251 | Incontinence | FAERS: 1 | US FAERS | |
| 252 | Incorrect dose administered by device | FAERS: 1 | US FAERS | |
| 253 | Increased bronchial secretion | FAERS: 1 | US FAERS | |
| 254 | Infective exacerbation of chronic obstructive airways disease | FAERS: 1 | US FAERS | |
| 255 | Intervertebral disc disorder | FAERS: 1 | US FAERS | |
| 256 | Joint injury | FAERS: 1 | US FAERS | |
| 257 | Joint stiffness | FAERS: 1 | US FAERS | |
| 258 | Lactose Intolerance | FAERS: 1 | US FAERS | |
| 259 | Laryngospasm | FAERS: 1 | US FAERS | |
| 260 | Left ventricle outflow tract obstruction | FAERS: 1 | US FAERS | |
| 261 | Ligament rupture | FAERS: 1 | US FAERS | |
| 262 | Lower respiratory tract infection viral | FAERS: 1 | US FAERS | |
| 263 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 264 | Macular degeneration | FAERS: 1 | US FAERS | |
| 265 | Malignant neoplasm progression | FAERS: 1 | US FAERS | |
| 266 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 267 | Meniscus injury | FAERS: 1 | US FAERS | |
| 268 | Metastasis | FAERS: 1 | US FAERS | |
| 269 | Mucosal induration | FAERS: 1 | US FAERS | |
| 270 | Musculoskeletal Pain | FAERS: 1 | SIDER US FAERS | |
| 271 | Myopathy | FAERS: 1 | US FAERS | |
| 272 | Neck Pain | FAERS: 1 | US FAERS | |
| 273 | Nerve injury | FAERS: 1 | US FAERS | |
| 274 | Neutropenia | FAERS: 1 | US FAERS | |
| 275 | Nodule | FAERS: 1 | US FAERS | |
| 276 | Nystagmus | FAERS: 1 | US FAERS | |
| 277 | Obstruction | FAERS: 1 | US FAERS | |
| 278 | Oral pain | FAERS: 1 | US FAERS | |
| 279 | Overdose | FAERS: 1 | US FAERS | |
| 280 | Pancreatic duct obstruction | FAERS: 1 | US FAERS | |
| 281 | Pancreatitis | FAERS: 1 | US FAERS | |
| 282 | Pelvic Infection | FAERS: 1 | US FAERS | |
| 283 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 284 | Pleuritic pain | FAERS: 1 | US FAERS | |
| 285 | Polydipsia | FAERS: 1 | US FAERS | |
| 286 | Polymyalgia Rheumatica | FAERS: 1 | US FAERS | |
| 287 | Polyuria | FAERS: 1 | US FAERS | |
| 288 | Post procedural complication | FAERS: 1 | US FAERS | |
| 289 | Presyncope | FAERS: 1 | US FAERS | |
| 290 | Product used for unknown indication | FAERS: 1 | US FAERS | |
| 291 | Protein total decreased | FAERS: 1 | US FAERS | |
| 292 | Pulmonary Valve Stenosis | FAERS: 1 | US FAERS | |
| 293 | Purulent discharge | FAERS: 1 | US FAERS | |
| 294 | Radiation Pneumonitis | FAERS: 1 | US FAERS | |
| 295 | Rales | FAERS: 1 | US FAERS | |
| 296 | Renal pain | FAERS: 1 | US FAERS | |
| 297 | Respiratory tract irritation | FAERS: 1 | US FAERS | |
| 298 | Retinal infarction | FAERS: 1 | US FAERS | |
| 299 | Rhinitis | FAERS: 1 | US FAERS | |
| 300 | Right ventricular failure | FAERS: 1 | US FAERS | |
| 301 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 302 | Shock | FAERS: 1 | US FAERS | |
| 303 | Skin irritation | FAERS: 1 | US FAERS | |
| 304 | Skin lesion | FAERS: 1 | US FAERS | |
| 305 | Skin reaction | FAERS: 1 | US FAERS | |
| 306 | Spinal column injury | FAERS: 1 | US FAERS | |
| 307 | Spirometry abnormal | FAERS: 1 | US FAERS | |
| 308 | Spondylolisthesis | FAERS: 1 | US FAERS | |
| 309 | Status Asthmaticus | FAERS: 1 | US FAERS | |
| 310 | Subcutaneous Abscess | FAERS: 1 | US FAERS | |
| 311 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 312 | Tinnitus | FAERS: 1 | US FAERS | |
| 313 | Tracheitis | FAERS: 1 | US FAERS | |
| 314 | Urticaria | FAERS: 1 | US FAERS | |
| 315 | Vascular stenosis | FAERS: 1 | US FAERS | |
| 316 | Vasculitic rash | FAERS: 1 | US FAERS | |
| 317 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 318 | Vestibular Neuronitis | FAERS: 1 | US FAERS | |
| 319 | Viral upper respiratory tract infection | FAERS: 1 | US FAERS | |
| 320 | Vital functions abnormal | FAERS: 1 | US FAERS | |
| 321 | Wound dehiscence | FAERS: 1 | US FAERS | |
| 322 | Wrong product administered | FAERS: 1 | US FAERS | |
| 323 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 324 | nervous system disorder | FAERS: 1 | SIDER US FAERS | |
| 325 | prostatitis | FAERS: 1 | US FAERS | |
| 326 | COPD exacerbation | SIDER | ||
| 327 | Exacerbation of asthma | SIDER | ||
| 328 | Infestation | SIDER | ||
| 329 | Malnutrition | SIDER | ||
| 330 | Musculoskeletal discomfort | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120329
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.