Galantamine
(QORVDGQLPPAFRS-XPSHAMGMSA-N)
Structure
- SMILES
- COc1ccc2c3c1O[C@@H]1[C@@]3(CCN(C2)C)C=C[C@@H](C1)O.Br
- Molecular Formula:
- C17H22BrNO3
- Molecular Weight:
- 368.265
- Log P:
- 2.7463
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 2
- TPSA:
- 41.93
- CAS Number(s):
- 1953-04-4; 193146-85-9
Synonym(s)
1.
Galantamine
2.
Galantamin
3.
Galanthamine
4.
Lycoremine
5.
Reminyl
6.
Galanthamine Hydrobromide
7.
Nivalin
8.
Nivaline
9.
Razadyne
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Nausea | FAERS: 47 Canada Vigilance: 12 | Canada Vigilance US FAERS | |
| 2 | Vomiting | FAERS: 47 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 3 | Medication Error | FAERS: 42 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 4 | Pneumonia | FAERS: 41 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 5 | No adverse event | FAERS: 40 | US FAERS | |
| 6 | Incorrect dose administered | FAERS: 30 | US FAERS | |
| 7 | Drug prescribing error | FAERS: 29 | US FAERS | |
| 8 | Dizziness | FAERS: 27 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 9 | Bradycardia | FAERS: 26 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 10 | Inappropriate schedule of drug administration | FAERS: 20 | US FAERS | |
| 11 | Accidental overdose | FAERS: 18 | US FAERS | |
| 12 | Agitation | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 13 | Myocardial Infarction | FAERS: 18 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 14 | Somnolence | FAERS: 18 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 15 | Syncope | FAERS: 18 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 16 | Malaise | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 17 | Asthenia | FAERS: 15 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 18 | Cerebral Infarction | FAERS: 14 | US FAERS | |
| 19 | Cerebrovascular accident | FAERS: 14 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 20 | Delirium | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 21 | Drug dose omission | FAERS: 14 | US FAERS | |
| 22 | Overdose | FAERS: 13 | US FAERS | |
| 23 | Respiratory arrest | FAERS: 13 | US FAERS | |
| 24 | Weight decreased | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 25 | Blood creatine phosphokinase increased | FAERS: 12 | US FAERS | |
| 26 | Headache | FAERS: 12 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 27 | Altered state of consciousness | FAERS: 10 | US FAERS | |
| 28 | Pulmonary Embolism | FAERS: 10 | US FAERS | |
| 29 | Dehydration | FAERS: 9 | US FAERS | |
| 30 | Depressed Level of Consciousness | FAERS: 9 | US FAERS | |
| 31 | Fracture | FAERS: 9 | US FAERS | |
| 32 | Ileus | FAERS: 9 | US FAERS | |
| 33 | Myoclonus | FAERS: 9 | US FAERS | |
| 34 | Restlessness | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 35 | Wrong technique in drug usage process | FAERS: 9 | US FAERS | |
| 36 | Cardiac Arrest | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 37 | Marasmus | FAERS: 8 | US FAERS | |
| 38 | Respiratory Failure | FAERS: 8 | US FAERS | |
| 39 | Urinary Retention | FAERS: 8 | US FAERS | |
| 40 | Abasia | FAERS: 7 | US FAERS | |
| 41 | Abdominal Pain | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 42 | Dementia | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 43 | Epilepsy | FAERS: 7 | US FAERS | |
| 44 | Tremor | FAERS: 7 | US FAERS | |
| 45 | Anxiety | FAERS: 6 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 46 | Atrioventricular Block | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 47 | Pancreatitis | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 48 | Atrial Fibrillation | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 49 | Dysuria | FAERS: 5 | US FAERS | |
| 50 | General physical health deterioration | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 51 | Hypotension | FAERS: 5 | US FAERS | |
| 52 | Sick Sinus Syndrome | FAERS: 5 | US FAERS | |
| 53 | Transaminases increased | FAERS: 5 | US FAERS | |
| 54 | Urticaria | FAERS: 5 | US FAERS | |
| 55 | Accidental exposure | FAERS: 4 | US FAERS | |
| 56 | Anger | FAERS: 4 | US FAERS | |
| 57 | Asthma | FAERS: 4 | US FAERS | |
| 58 | Cerebral atrophy | FAERS: 4 | US FAERS | |
| 59 | Chest Pain | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 60 | Cholecystitis | FAERS: 4 | US FAERS | |
| 61 | Disorientation | FAERS: 4 | US FAERS | |
| 62 | Drowning | FAERS: 4 | US FAERS | |
| 63 | Drug administration error | FAERS: 4 | US FAERS | |
| 64 | Drug dispensing error | FAERS: 4 | US FAERS | |
| 65 | Feeling abnormal | FAERS: 4 | US FAERS | |
| 66 | Gastric ulcer | FAERS: 4 | US FAERS | |
| 67 | Heat Stroke | FAERS: 4 | US FAERS | |
| 68 | Inappropriate schedule of product administration | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 69 | Pharmaceutical product complaint | FAERS: 4 | US FAERS | |
| 70 | Rhabdomyolysis | FAERS: 4 | US FAERS | |
| 71 | Sudden death | FAERS: 4 | US FAERS | |
| 72 | Tachycardia | FAERS: 4 | US FAERS | |
| 73 | Urinary tract infection | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 74 | Alanine Aminotransferase Increased | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 75 | Bradykinesia | FAERS: 3 | US FAERS | |
| 76 | Cardiomegaly | FAERS: 3 | US FAERS | |
| 77 | Cataract | FAERS: 3 | US FAERS | |
| 78 | Cellulitis | FAERS: 3 | US FAERS | |
| 79 | Cholelithiasis | FAERS: 3 | US FAERS | |
| 80 | Cholestasis | FAERS: 3 | US FAERS | |
| 81 | Constipation | FAERS: 3 | US FAERS | |
| 82 | Creatinine renal clearance decreased | FAERS: 3 | US FAERS | |
| 83 | Cytolytic hepatitis | FAERS: 3 | US FAERS | |
| 84 | Deafness | FAERS: 3 | US FAERS | |
| 85 | Drug ineffective | FAERS: 3 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 86 | Fatigue | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 87 | Gamma-Glutamyltransferase Increased | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 88 | Gastrointestinal hypomotility | FAERS: 3 | US FAERS | |
| 89 | Glaucoma | FAERS: 3 | US FAERS | |
| 90 | Gout | FAERS: 3 | US FAERS | |
| 91 | Hepatitis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 92 | Hyperthyroidism | FAERS: 3 | US FAERS | |
| 93 | Nervousness | FAERS: 3 | US FAERS | |
| 94 | Neuroleptic Malignant Syndrome | FAERS: 3 | US FAERS | |
| 95 | Petechiae | FAERS: 3 | US FAERS | |
| 96 | Prescribed overdose | FAERS: 3 | US FAERS | |
| 97 | Product use in unapproved indication | FAERS: 3 | US FAERS | |
| 98 | Psychiatric symptom | FAERS: 3 | US FAERS | |
| 99 | Sepsis | FAERS: 3 | US FAERS | |
| 100 | Sinus bradycardia | FAERS: 3 | US FAERS | |
| 101 | Tachyarrhythmia | FAERS: 3 | US FAERS | |
| 102 | Thrombocytopenia | FAERS: 3 | US FAERS | |
| 103 | Tuberculosis | FAERS: 3 | US FAERS | |
| 104 | Wrong technique in product usage process | FAERS: 3 | US FAERS | |
| 105 | Abdominal discomfort | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 106 | Abdominal tenderness | FAERS: 2 | US FAERS | |
| 107 | Adverse event | FAERS: 2 | US FAERS | |
| 108 | Ascites | FAERS: 2 | US FAERS | |
| 109 | Aspartate Aminotransferase Increased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 110 | Atherosclerosis | FAERS: 2 | US FAERS | |
| 111 | Behavioural and psychiatric symptoms of dementia | FAERS: 2 | US FAERS | |
| 112 | Blood creatinine increased | FAERS: 2 | US FAERS | |
| 113 | Bronchospasm | FAERS: 2 | US FAERS | |
| 114 | Cholangitis | FAERS: 2 | US FAERS | |
| 115 | Cyanosis | FAERS: 2 | US FAERS | |
| 116 | Deep Vein Thrombosis | FAERS: 2 | US FAERS | |
| 117 | Disease recurrence | FAERS: 2 | US FAERS | |
| 118 | Drug withdrawal syndrome | FAERS: 2 | US FAERS | |
| 119 | Eczema | FAERS: 2 | US FAERS | |
| 120 | Erectile dysfunction | FAERS: 2 | US FAERS | |
| 121 | Eructation | FAERS: 2 | US FAERS | |
| 122 | Erythema | FAERS: 2 | US FAERS | |
| 123 | Expired drug administered | FAERS: 2 | US FAERS | |
| 124 | Feeling Cold | FAERS: 2 | US FAERS | |
| 125 | Hepatotoxicity | FAERS: 2 | US FAERS | |
| 126 | Hip surgery | FAERS: 2 | US FAERS | |
| 127 | Hypertensive crisis | FAERS: 2 | US FAERS | |
| 128 | Hyperventilation | FAERS: 2 | US FAERS | |
| 129 | Incontinence | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 130 | Incorrect route of drug administration | FAERS: 2 | US FAERS | |
| 131 | Intentional drug misuse | FAERS: 2 | US FAERS | |
| 132 | Leukopenia | FAERS: 2 | US FAERS | |
| 133 | Malnutrition | FAERS: 2 | US FAERS | |
| 134 | Memory impairment | FAERS: 2 | US FAERS | |
| 135 | Meningitis | FAERS: 2 | US FAERS | |
| 136 | Mental status changes | FAERS: 2 | US FAERS | |
| 137 | Mood swings | FAERS: 2 | US FAERS | |
| 138 | Muscle Rigidity | FAERS: 2 | US FAERS | |
| 139 | Musculoskeletal stiffness | FAERS: 2 | US FAERS | |
| 140 | Poriomania | FAERS: 2 | US FAERS | |
| 141 | Product quality issue | FAERS: 2 | US FAERS | |
| 142 | Product use issue | FAERS: 2 | US FAERS | |
| 143 | Pruritus | FAERS: 2 | US FAERS | |
| 144 | Purpura | FAERS: 2 | US FAERS | |
| 145 | Pyelonephritis | FAERS: 2 | US FAERS | |
| 146 | Shock | FAERS: 2 | US FAERS | |
| 147 | Therapeutic response unexpected | FAERS: 2 | US FAERS | |
| 148 | Thrombosis | FAERS: 2 | US FAERS | |
| 149 | Ulcer | FAERS: 2 | US FAERS | |
| 150 | Unresponsive to stimuli | FAERS: 2 | US FAERS | |
| 151 | Urinary Incontinence | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 152 | Vertigo | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 153 | White blood cell count decreased | FAERS: 2 | US FAERS | |
| 154 | Wrong drug administered | FAERS: 2 | US FAERS | |
| 155 | jaundice | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 156 | Acidosis | FAERS: 1 | US FAERS | |
| 157 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 158 | Acute Coronary Syndrome | FAERS: 1 | US FAERS | |
| 159 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 160 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 161 | Allodynia | FAERS: 1 | US FAERS | |
| 162 | Amnesia | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 163 | Amylase increased | FAERS: 1 | US FAERS | |
| 164 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 165 | Aneurysm | FAERS: 1 | US FAERS | |
| 166 | Angiodysplasia | FAERS: 1 | US FAERS | |
| 167 | Angioedema | FAERS: 1 | US FAERS | |
| 168 | Anorexia | FAERS: 1 | US FAERS | |
| 169 | Apallic syndrome | FAERS: 1 | US FAERS | |
| 170 | Aphagia | FAERS: 1 | US FAERS | |
| 171 | Arthralgia | FAERS: 1 | US FAERS | |
| 172 | Arthritis | FAERS: 1 | US FAERS | |
| 173 | Asphyxia | FAERS: 1 | US FAERS | |
| 174 | Asterixis | FAERS: 1 | US FAERS | |
| 175 | Ataxia | FAERS: 1 | US FAERS | |
| 176 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 177 | Blindness | FAERS: 1 | US FAERS | |
| 178 | Blood alkaline phosphatase increased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 179 | Blood alkaline phosphatase | FAERS: 1 | US FAERS | |
| 180 | Blood amylase increased | FAERS: 1 | US FAERS | |
| 181 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 182 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 183 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 184 | Blood pressure inadequately controlled | FAERS: 1 | US FAERS | |
| 185 | Blood urine present | FAERS: 1 | US FAERS | |
| 186 | Cardiac Hypertrophy | FAERS: 1 | US FAERS | |
| 187 | Carotid artery occlusion | FAERS: 1 | US FAERS | |
| 188 | Chest discomfort | FAERS: 1 | US FAERS | |
| 189 | Chills | FAERS: 1 | US FAERS | |
| 190 | Choking | FAERS: 1 | US FAERS | |
| 191 | Chromaturia | FAERS: 1 | US FAERS | |
| 192 | Cognitive deterioration | FAERS: 1 | US FAERS | |
| 193 | Compression fracture | FAERS: 1 | US FAERS | |
| 194 | Conduct Disorder | FAERS: 1 | US FAERS | |
| 195 | Consciousness fluctuating | FAERS: 1 | US FAERS | |
| 196 | Cortical laminar necrosis | FAERS: 1 | US FAERS | |
| 197 | Crying | FAERS: 1 | US FAERS | |
| 198 | Cyst | FAERS: 1 | US FAERS | |
| 199 | Delusional disorder, unspecified type | FAERS: 1 | US FAERS | |
| 200 | Depressed mood | FAERS: 1 | US FAERS | |
| 201 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 202 | Diabetes mellitus inadequate control | FAERS: 1 | US FAERS | |
| 203 | Diet refusal | FAERS: 1 | US FAERS | |
| 204 | Disease complication | FAERS: 1 | US FAERS | |
| 205 | Drug abuse | FAERS: 1 | US FAERS | |
| 206 | Drug level increased | FAERS: 1 | US FAERS | |
| 207 | Drug toxicity | FAERS: 1 | US FAERS | |
| 208 | Duodenal Ulcer | FAERS: 1 | US FAERS | |
| 209 | Duodenal ulcer perforation | FAERS: 1 | US FAERS | |
| 210 | Dyspnoea exacerbated | FAERS: 1 | US FAERS | |
| 211 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 212 | Electrocardiogram ST-T segment abnormal | FAERS: 1 | US FAERS | |
| 213 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 214 | Electrocardiogram change | FAERS: 1 | US FAERS | |
| 215 | Electroencephalogram abnormal | FAERS: 1 | US FAERS | |
| 216 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 217 | Emotional disorder | FAERS: 1 | US FAERS | |
| 218 | Encephalitis | FAERS: 1 | US FAERS | |
| 219 | Enteritis | FAERS: 1 | US FAERS | |
| 220 | Epistaxis | FAERS: 1 | US FAERS | |
| 221 | Excitability | FAERS: 1 | US FAERS | |
| 222 | Fistula discharge | FAERS: 1 | US FAERS | |
| 223 | Foaming at mouth | FAERS: 1 | US FAERS | |
| 224 | Frontotemporal dementia | FAERS: 1 | US FAERS | |
| 225 | Gastrectomy | FAERS: 1 | US FAERS | |
| 226 | Gastric ulcer helicobacter | FAERS: 1 | US FAERS | |
| 227 | Gastroenteritis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 228 | Gastrointestinal hypermotility | FAERS: 1 | US FAERS | |
| 229 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 230 | Granuloma | FAERS: 1 | US FAERS | |
| 231 | Hemiparesis | FAERS: 1 | US FAERS | |
| 232 | Hepatic Vein Thrombosis | FAERS: 1 | US FAERS | |
| 233 | Hydrocephalus | FAERS: 1 | US FAERS | |
| 234 | Hypertensive heart disease | FAERS: 1 | US FAERS | |
| 235 | Hypervigilance | FAERS: 1 | US FAERS | |
| 236 | Hypophagia | FAERS: 1 | US FAERS | |
| 237 | Hyporeflexia | FAERS: 1 | US FAERS | |
| 238 | Hypoxia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 239 | Incoherent | FAERS: 1 | US FAERS | |
| 240 | Incorrect route of product administration | FAERS: 1 | US FAERS | |
| 241 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 242 | Infection | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 243 | Infective spondylitis | FAERS: 1 | US FAERS | |
| 244 | Inflammation | FAERS: 1 | US FAERS | |
| 245 | Intentional self-injury | FAERS: 1 | US FAERS | |
| 246 | Intercepted medication error | FAERS: 1 | US FAERS | |
| 247 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 248 | Joint injury | FAERS: 1 | US FAERS | |
| 249 | Labyrinthitis | FAERS: 1 | US FAERS | |
| 250 | Large intestine perforation | FAERS: 1 | US FAERS | |
| 251 | Lethargy | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 252 | Lipase increased | FAERS: 1 | US FAERS | |
| 253 | Lymphoma | FAERS: 1 | US FAERS | |
| 254 | Meningorrhagia | FAERS: 1 | US FAERS | |
| 255 | Muscle Cramp | FAERS: 1 | US FAERS | |
| 256 | Muscle Spasticity | FAERS: 1 | US FAERS | |
| 257 | Myalgia | FAERS: 1 | US FAERS | |
| 258 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 259 | Myocardial fibrosis | FAERS: 1 | US FAERS | |
| 260 | Narcolepsy | FAERS: 1 | US FAERS | |
| 261 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 262 | Neuropathy | FAERS: 1 | US FAERS | |
| 263 | Neutropenia | FAERS: 1 | US FAERS | |
| 264 | No adverse drug reaction | FAERS: 1 | US FAERS | |
| 265 | Optic Neuritis | FAERS: 1 | US FAERS | |
| 266 | Oral infection | FAERS: 1 | US FAERS | |
| 267 | Osteoporosis | FAERS: 1 | US FAERS | |
| 268 | Pallor | FAERS: 1 | US FAERS | |
| 269 | Pancreatic Cyst | FAERS: 1 | US FAERS | |
| 270 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 271 | Paranoia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 272 | Personality Change | FAERS: 1 | US FAERS | |
| 273 | Physical deconditioning | FAERS: 1 | US FAERS | |
| 274 | Poisoning | FAERS: 1 | US FAERS | |
| 275 | Polymyalgia Rheumatica | FAERS: 1 | US FAERS | |
| 276 | Poor personal hygiene | FAERS: 1 | US FAERS | |
| 277 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 278 | Portal Vein Thrombosis | FAERS: 1 | US FAERS | |
| 279 | Post procedural complication | FAERS: 1 | US FAERS | |
| 280 | Presyncope | FAERS: 1 | US FAERS | |
| 281 | Product availability issue | FAERS: 1 | US FAERS | |
| 282 | Product name confusion | FAERS: 1 | US FAERS | |
| 283 | Product packaging issue | FAERS: 1 | US FAERS | |
| 284 | Product use complaint | FAERS: 1 | US FAERS | |
| 285 | Productive Cough | FAERS: 1 | US FAERS | |
| 286 | Progressive supranuclear palsy | FAERS: 1 | US FAERS | |
| 287 | Psittacosis | FAERS: 1 | US FAERS | |
| 288 | Psoriasis | FAERS: 1 | US FAERS | |
| 289 | Pulmonary arterial hypertension | FAERS: 1 | US FAERS | |
| 290 | Pulmonary arterial pressure increased | FAERS: 1 | US FAERS | |
| 291 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 292 | Renal cyst | FAERS: 1 | US FAERS | |
| 293 | Renal tubular acidosis | FAERS: 1 | US FAERS | |
| 294 | Retching | FAERS: 1 | US FAERS | |
| 295 | Scleroderma | FAERS: 1 | US FAERS | |
| 296 | Screaming | FAERS: 1 | US FAERS | |
| 297 | Sedation complication | FAERS: 1 | US FAERS | |
| 298 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 299 | Sigmoiditis | FAERS: 1 | US FAERS | |
| 300 | Silent myocardial infarction | FAERS: 1 | US FAERS | |
| 301 | Simple Partial Seizures | FAERS: 1 | US FAERS | |
| 302 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 303 | Spinal column injury | FAERS: 1 | US FAERS | |
| 304 | Spinal column stenosis | FAERS: 1 | US FAERS | |
| 305 | Spondylitis | FAERS: 1 | US FAERS | |
| 306 | Status Epilepticus | FAERS: 1 | US FAERS | |
| 307 | Suicide attempt | FAERS: 1 | US FAERS | |
| 308 | Systolic hypertension | FAERS: 1 | US FAERS | |
| 309 | Temporal Arteritis | FAERS: 1 | US FAERS | |
| 310 | Thermal burn | FAERS: 1 | US FAERS | |
| 311 | Tongue blistering | FAERS: 1 | US FAERS | |
| 312 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 313 | Tracheobronchitis | FAERS: 1 | US FAERS | |
| 314 | Trifascicular block | FAERS: 1 | US FAERS | |
| 315 | VIIth nerve paralysis | FAERS: 1 | US FAERS | |
| 316 | Water Intoxication | FAERS: 1 | US FAERS | |
| 317 | cancer surgery | FAERS: 1 | US FAERS | |
| 318 | nervous system disorder | FAERS: 1 | US FAERS | |
| 319 | Apathy | Canada Vigilance: 1 | Canada Vigilance | |
| 320 | Aphasia | Canada Vigilance: 2 | Canada Vigilance | |
| 321 | Diverticulitis | Canada Vigilance: 1 | Canada Vigilance | |
| 322 | Dysarthria | Canada Vigilance: 2 | Canada Vigilance | |
| 323 | Dyspepsia | Canada Vigilance: 1 | Canada Vigilance | |
| 324 | Hemiplegia | Canada Vigilance: 1 | Canada Vigilance | |
| 325 | Hypokinesia | Canada Vigilance: 1 | Canada Vigilance | |
| 326 | Loss of personal independence in daily activities | Canada Vigilance: 1 | Canada Vigilance | |
| 327 | Mental impairment | Canada Vigilance: 3 | Canada Vigilance | |
| 328 | Night sweats | Canada Vigilance: 1 | Canada Vigilance | |
| 329 | Pain | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.