Enfuvirtide
(PEASPLKKXBYDKL-FXEVSJAOSA-N)
Structure
- SMILES
- NCCCC[C@@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N)Cc1ccccc1)Cc1c[nH]c2c1cccc2)CC(=O)N)Cc1c[nH]c2c1cccc2)CC(C)C)CO)C)Cc1c[nH]c2c1cccc2)CCCCN)CC(=O)O)CC(C)C)CCC(=O)O)CC(C)C)CC(C)C)CCC(=O)O)CCC(=O)N)CCC(=O)O)CC(=O)N)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H]([C@H](CC)C)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H]([C@H](CC)C)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H]([C@H](O)C)NC(=O)[C@H](Cc1ccc(cc1)O)NC(=O)C)CO)CC(C)C)Cc1cnc[nH]1)CO)CC(C)C)CCC(=O)O)CCC(=O)O)CO)CCC(=O)N)CC(=O)N)CCC(=O)N)CCC(=O)N)CCC(=O)O
- Molecular Formula:
- C204H301N51O64
- Molecular Weight:
- 4491.880
- Log P:
- 5.6970
- Hydrogen Bond Acceptor:
- 111
- Hydrogen Bond Donor:
- 63
- TPSA:
- 1902.89
- CAS Number(s):
- N/A
Synonym(s)
1.
Enfuvirtide
2.
DP 178
3.
DP-178
4.
DP178
5.
Fuzeon
6.
Pentafuside
7.
Peptide T20
8.
T20 Peptide
9.
T20, Peptide
External Link(s)
| MeSH | D000077560 |
| PubChem Compound | 16157631 126456160 16130199 |
| BindingDB | 50023615 |
| ChEBI | 608828 |
| CHEMBL | CHEMBL525076 |
| DrugCentral | 1010 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Injection Site Reaction | FAERS: 153 | US FAERS | |
| 2 | Medication Error | FAERS: 61 | US FAERS | |
| 3 | Injection site pain | FAERS: 38 | US FAERS | |
| 4 | No adverse effect | FAERS: 30 | US FAERS | |
| 5 | Pneumonia | FAERS: 26 | US FAERS | |
| 6 | Injection site erythema | FAERS: 24 | US FAERS | |
| 7 | No adverse event | FAERS: 24 | US FAERS | |
| 8 | Adverse event | FAERS: 19 | US FAERS | |
| 9 | Product quality issue | FAERS: 19 | US FAERS | |
| 10 | Injection site mass | FAERS: 18 | US FAERS | |
| 11 | Injection site nodule | FAERS: 18 | US FAERS | |
| 12 | Pain | FAERS: 17 | US FAERS | |
| 13 | Drug administration error | FAERS: 16 | US FAERS | |
| 14 | Swelling | FAERS: 15 | US FAERS | |
| 15 | Erythema | FAERS: 14 | US FAERS | |
| 16 | Injection site pruritus | FAERS: 14 | US FAERS | |
| 17 | Urticaria | FAERS: 14 | US FAERS | |
| 18 | Hypersensitivity | FAERS: 12 | US FAERS | |
| 19 | Viral load increased | FAERS: 12 | US FAERS | |
| 20 | Chills | FAERS: 9 | US FAERS | |
| 21 | Disease Progression | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 22 | Drug ineffective | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 23 | Pruritus | FAERS: 9 | US FAERS | |
| 24 | Drug resistance | FAERS: 8 | US FAERS | |
| 25 | Hypotension | FAERS: 8 | US FAERS | |
| 26 | Injection site discomfort | FAERS: 8 | US FAERS | |
| 27 | Injection site urticaria | FAERS: 8 | US FAERS | |
| 28 | Nodule | FAERS: 8 | US FAERS | |
| 29 | Cellulitis | FAERS: 7 | US FAERS | |
| 30 | Fatigue | FAERS: 7 | US FAERS | |
| 31 | Lymphoma | FAERS: 7 | US FAERS | |
| 32 | Skin hypertrophy | FAERS: 7 | US FAERS | |
| 33 | Accidental exposure | FAERS: 6 | US FAERS | |
| 34 | Discomfort | FAERS: 6 | US FAERS | |
| 35 | Incorrect dose administered | FAERS: 6 | US FAERS | |
| 36 | Incorrect route of drug administration | FAERS: 6 | US FAERS | |
| 37 | Lipodystrophy acquired | FAERS: 6 | US FAERS | |
| 38 | Myalgia | FAERS: 6 | US FAERS | |
| 39 | Arthralgia | FAERS: 5 | US FAERS | |
| 40 | Bone pain | FAERS: 5 | US FAERS | |
| 41 | Dizziness | FAERS: 5 | US FAERS | |
| 42 | Malaise | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 43 | Vomiting | FAERS: 5 | US FAERS | |
| 44 | Accidental needle stick | FAERS: 4 | US FAERS | |
| 45 | Acquired Immunodeficiency Syndrome | FAERS: 4 | US FAERS | |
| 46 | Amyloidosis | FAERS: 4 | US FAERS | |
| 47 | Asthenia | FAERS: 4 | US FAERS | |
| 48 | Blood glucose abnormal | FAERS: 4 | US FAERS | |
| 49 | CD4 Lymphocytes Decreased | FAERS: 4 | US FAERS | |
| 50 | Dehydration | FAERS: 4 | US FAERS | |
| 51 | End stage AIDS | FAERS: 4 | US FAERS | |
| 52 | Induration | FAERS: 4 | US FAERS | |
| 53 | Injection site bruising | FAERS: 4 | US FAERS | |
| 54 | Injection site inflammation | FAERS: 4 | US FAERS | |
| 55 | Nausea | FAERS: 4 | US FAERS | |
| 56 | Pancreatitis | FAERS: 4 | US FAERS | |
| 57 | Sepsis | FAERS: 4 | US FAERS | |
| 58 | Unevaluable event | FAERS: 4 | US FAERS | |
| 59 | Accidental exposure to product | FAERS: 3 | US FAERS | |
| 60 | Anxiety | FAERS: 3 | US FAERS | |
| 61 | Chest Pain | FAERS: 3 | US FAERS | |
| 62 | Injection site abscess | FAERS: 3 | US FAERS | |
| 63 | Injection site atrophy | FAERS: 3 | US FAERS | |
| 64 | Injection site cyst | FAERS: 3 | US FAERS | |
| 65 | Myocardial Infarction | FAERS: 3 | US FAERS | |
| 66 | Needle issue | FAERS: 3 | US FAERS | |
| 67 | Nephrolithiasis | FAERS: 3 | US FAERS | |
| 68 | Obstruction | FAERS: 3 | US FAERS | |
| 69 | Restlessness | FAERS: 3 | US FAERS | |
| 70 | Skin reaction | FAERS: 3 | US FAERS | |
| 71 | Syncope | FAERS: 3 | US FAERS | |
| 72 | Ulcer | FAERS: 3 | US FAERS | |
| 73 | Weight decreased | FAERS: 3 | US FAERS | |
| 74 | Wrong technique in drug usage process | FAERS: 3 | US FAERS | |
| 75 | Abdominal Pain | FAERS: 2 | US FAERS | |
| 76 | Abdominal discomfort | FAERS: 2 | US FAERS | |
| 77 | Angina Pectoris | FAERS: 2 | US FAERS | |
| 78 | Anorexia | FAERS: 2 | US FAERS | |
| 79 | Arthritis | FAERS: 2 | US FAERS | |
| 80 | Atrial Fibrillation | FAERS: 2 | US FAERS | |
| 81 | Bacteria blood identified | FAERS: 2 | US FAERS | |
| 82 | Blood amylase increased | FAERS: 2 | US FAERS | |
| 83 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 84 | Burning sensation | FAERS: 2 | US FAERS | |
| 85 | CD4 lymphocytes increased | FAERS: 2 | US FAERS | |
| 86 | Cachexia | FAERS: 2 | US FAERS | |
| 87 | Device Failure | FAERS: 2 | US FAERS | |
| 88 | Drug dose omission | FAERS: 2 | US FAERS | |
| 89 | Drug exposure during pregnancy | FAERS: 2 | US FAERS | |
| 90 | Expired drug administered | FAERS: 2 | US FAERS | |
| 91 | Eye Redness | FAERS: 2 | US FAERS | |
| 92 | Feeling abnormal | FAERS: 2 | US FAERS | |
| 93 | Flushing | FAERS: 2 | US FAERS | |
| 94 | Headache | FAERS: 2 | US FAERS | |
| 95 | Immune reconstitution syndrome | FAERS: 2 | US FAERS | |
| 96 | Infection | FAERS: 2 | US FAERS | |
| 97 | Injection site infection | FAERS: 2 | US FAERS | |
| 98 | Injection site irritation | FAERS: 2 | US FAERS | |
| 99 | Injection site stinging | FAERS: 2 | US FAERS | |
| 100 | Injection site vesicles | FAERS: 2 | US FAERS | |
| 101 | Injection site warmth | FAERS: 2 | US FAERS | |
| 102 | Injury associated with device | FAERS: 2 | US FAERS | |
| 103 | Joint swelling | FAERS: 2 | US FAERS | |
| 104 | Lipoma | FAERS: 2 | US FAERS | |
| 105 | Memory impairment | FAERS: 2 | US FAERS | |
| 106 | Mental impairment | FAERS: 2 | US FAERS | |
| 107 | Myasthenia Gravis | FAERS: 2 | US FAERS | |
| 108 | Nervousness | FAERS: 2 | US FAERS | |
| 109 | Neuropathy | FAERS: 2 | US FAERS | |
| 110 | Peripheral swelling | FAERS: 2 | US FAERS | |
| 111 | Peritonitis | FAERS: 2 | US FAERS | |
| 112 | Pneumocystis jiroveci pneumonia | FAERS: 2 | US FAERS | |
| 113 | Poor quality drug administered | FAERS: 2 | US FAERS | |
| 114 | Skin irritation | FAERS: 2 | US FAERS | |
| 115 | Skin lesion | FAERS: 2 | US FAERS | |
| 116 | Suicide attempt | FAERS: 2 | US FAERS | |
| 117 | Tremor | FAERS: 2 | US FAERS | |
| 118 | Vasculitis | FAERS: 2 | US FAERS | |
| 119 | treatment failure | FAERS: 2 | US FAERS | |
| 120 | AIDS related complication | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 121 | Abasia | FAERS: 1 | US FAERS | |
| 122 | Abscess | FAERS: 1 | US FAERS | |
| 123 | Accidental death | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 124 | Adrenogenital Syndrome | FAERS: 1 | US FAERS | |
| 125 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 126 | Appendicitis | FAERS: 1 | US FAERS | |
| 127 | Arterial thrombosis | FAERS: 1 | US FAERS | |
| 128 | Asthma | FAERS: 1 | US FAERS | |
| 129 | Back Pain | FAERS: 1 | US FAERS | |
| 130 | Back disorder | FAERS: 1 | US FAERS | |
| 131 | Biliary cancer metastatic | FAERS: 1 | US FAERS | |
| 132 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 133 | Blood HIV RNA increased | FAERS: 1 | US FAERS | |
| 134 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 135 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 136 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 137 | Body fat disorder | FAERS: 1 | US FAERS | |
| 138 | Bronchitis | FAERS: 1 | US FAERS | |
| 139 | Catheter related complication | FAERS: 1 | US FAERS | |
| 140 | Central line infection | FAERS: 1 | US FAERS | |
| 141 | Cerebral Thrombosis | FAERS: 1 | US FAERS | |
| 142 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 143 | Chest discomfort | FAERS: 1 | US FAERS | |
| 144 | Chromaturia | FAERS: 1 | US FAERS | |
| 145 | Colitis | FAERS: 1 | US FAERS | |
| 146 | Constipation | FAERS: 1 | US FAERS | |
| 147 | Creatinine renal clearance increased | FAERS: 1 | US FAERS | |
| 148 | Cyanosis | FAERS: 1 | US FAERS | |
| 149 | Cytomegalovirus chorioretinitis | FAERS: 1 | US FAERS | |
| 150 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 151 | Deformity | FAERS: 1 | US FAERS | |
| 152 | Device malfunction | FAERS: 1 | US FAERS | |
| 153 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 154 | Disease recurrence | FAERS: 1 | US FAERS | |
| 155 | Diverticulitis | FAERS: 1 | US FAERS | |
| 156 | Drug screen false positive | FAERS: 1 | US FAERS | |
| 157 | Drug screen positive | FAERS: 1 | US FAERS | |
| 158 | Enterococcal infection | FAERS: 1 | US FAERS | |
| 159 | Eosinophilia | FAERS: 1 | US FAERS | |
| 160 | Expired product administered | FAERS: 1 | US FAERS | |
| 161 | Exposure via direct contact | FAERS: 1 | US FAERS | |
| 162 | Exposure via eye contact | FAERS: 1 | US FAERS | |
| 163 | Eye irritation | FAERS: 1 | US FAERS | |
| 164 | Eye pain | FAERS: 1 | US FAERS | |
| 165 | Fat redistribution | FAERS: 1 | US FAERS | |
| 166 | Feeling Cold | FAERS: 1 | US FAERS | |
| 167 | Flatulence | FAERS: 1 | US FAERS | |
| 168 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 169 | Guillain-Barre Syndrome | FAERS: 1 | US FAERS | |
| 170 | Hepatitis | FAERS: 1 | US FAERS | |
| 171 | Hyperkeratosis palmaris and plantaris | FAERS: 1 | US FAERS | |
| 172 | Hypersomnia | FAERS: 1 | US FAERS | |
| 173 | Hypoventilation | FAERS: 1 | US FAERS | |
| 174 | Implant site irritation | FAERS: 1 | US FAERS | |
| 175 | Incoherent | FAERS: 1 | US FAERS | |
| 176 | Inflammation | FAERS: 1 | US FAERS | |
| 177 | Infusion site erythema | FAERS: 1 | US FAERS | |
| 178 | Infusion site warmth | FAERS: 1 | US FAERS | |
| 179 | Injection site discharge | FAERS: 1 | US FAERS | |
| 180 | Injection site extravasation | FAERS: 1 | US FAERS | |
| 181 | Injection site hypersensitivity | FAERS: 1 | US FAERS | |
| 182 | Injection site scar | FAERS: 1 | US FAERS | |
| 183 | Injection site ulcer | FAERS: 1 | US FAERS | |
| 184 | Insulin Resistance | FAERS: 1 | US FAERS | |
| 185 | Intercepted medication error | FAERS: 1 | US FAERS | |
| 186 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 187 | Keratoconjunctivitis Sicca | FAERS: 1 | US FAERS | |
| 188 | Labyrinthitis | FAERS: 1 | US FAERS | |
| 189 | Leukoencephalomyelitis | FAERS: 1 | US FAERS | |
| 190 | Limb injury | FAERS: 1 | US FAERS | |
| 191 | Live Birth | FAERS: 1 | US FAERS | |
| 192 | Lobar Pneumonia | FAERS: 1 | US FAERS | |
| 193 | Lung infection pseudomonal | FAERS: 1 | US FAERS | |
| 194 | Lymphocyte stimulation test positive | FAERS: 1 | US FAERS | |
| 195 | Malabsorption from injection site | FAERS: 1 | US FAERS | |
| 196 | Malabsorption | FAERS: 1 | US FAERS | |
| 197 | Malignant neoplasm progression | FAERS: 1 | US FAERS | |
| 198 | Metastasis | FAERS: 1 | US FAERS | |
| 199 | Muscle strain | FAERS: 1 | US FAERS | |
| 200 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 201 | Neutropenia | FAERS: 1 | US FAERS | |
| 202 | Nipple pain | FAERS: 1 | US FAERS | |
| 203 | Open wound | FAERS: 1 | US FAERS | |
| 204 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 205 | Personality Change | FAERS: 1 | US FAERS | |
| 206 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 207 | Pharyngitis | FAERS: 1 | US FAERS | |
| 208 | Pleuritic pain | FAERS: 1 | US FAERS | |
| 209 | Pneumococcal sepsis | FAERS: 1 | US FAERS | |
| 210 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 211 | Poor quality product administered | FAERS: 1 | US FAERS | |
| 212 | Presyncope | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 213 | Product counterfeit | FAERS: 1 | US FAERS | |
| 214 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 215 | Product preparation error | FAERS: 1 | US FAERS | |
| 216 | Product size issue | FAERS: 1 | US FAERS | |
| 217 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 218 | Product storage error | FAERS: 1 | US FAERS | |
| 219 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 220 | Quadriplegia | FAERS: 1 | US FAERS | |
| 221 | Retinitis | FAERS: 1 | US FAERS | |
| 222 | Septic Shock | FAERS: 1 | US FAERS | |
| 223 | Sicca Syndrome | FAERS: 1 | US FAERS | |
| 224 | Sinusitis | FAERS: 1 | US FAERS | |
| 225 | Sjogren's Syndrome | FAERS: 1 | US FAERS | |
| 226 | Skin Induration | FAERS: 1 | US FAERS | |
| 227 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 228 | Somnolence | FAERS: 1 | US FAERS | |
| 229 | Subcutaneous Abscess | FAERS: 1 | US FAERS | |
| 230 | Subcutaneous nodule | FAERS: 1 | US FAERS | |
| 231 | T-lymphocyte count increased | FAERS: 1 | US FAERS | |
| 232 | Therapy cessation | FAERS: 1 | US FAERS | |
| 233 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 234 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 235 | Thrombosis | FAERS: 1 | US FAERS | |
| 236 | Tinnitus | FAERS: 1 | US FAERS | |
| 237 | Tonsillitis | FAERS: 1 | US FAERS | |
| 238 | Tuberculosis | FAERS: 1 | US FAERS | |
| 239 | Underweight | FAERS: 1 | US FAERS | |
| 240 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 241 | Viral load decreased | FAERS: 1 | US FAERS | |
| 242 | Viral mutation identified | FAERS: 1 | US FAERS | |
| 243 | Visual Impairment | FAERS: 1 | US FAERS | |
| 244 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 245 | Cholangiocarcinoma | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.