Hydroxychloroquine
(JCBIVZZPXRZKTI-UHFFFAOYSA-N)
Structure
- SMILES
- OS(=O)(=O)O.OCCN(CCCC(Nc1ccnc2c1ccc(c2)Cl)C)CC
- Molecular Formula:
- C18H28ClN3O5S
- Molecular Weight:
- 433.950
- Log P:
- 4.2840
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 4
- TPSA:
- 131.37
- CAS Number(s):
- 747-36-4
Synonym(s)
1.
Hydroxychloroquine
2.
Hydroxychlorochin
3.
Oxychlorochin
4.
Oxychloroquine
5.
Hydroxychloroquine Sulfate
6.
Hydroxychloroquine Sulfate (1:1) Salt
7.
Plaquenil
External Link(s)
| MeSH | D006886 |
| PubChem Compound | 12947 |
| BindingDB | 50247975 |
| CHEMBL | CHEMBL1690 |
| KEGG | dr:D02114 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 22 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 2 | Nausea | FAERS: 20 | US FAERS | |
| 3 | Pain | FAERS: 18 | US FAERS | |
| 4 | Toxicity to various agents | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 5 | Pruritus | FAERS: 12 | US FAERS | |
| 6 | Tinnitus | FAERS: 12 | US FAERS | |
| 7 | Urticaria | FAERS: 11 | US FAERS | |
| 8 | Arthralgia | FAERS: 10 | US FAERS | |
| 9 | Dizziness | FAERS: 10 | US FAERS | |
| 10 | Pharmaceutical product complaint | FAERS: 10 | US FAERS | |
| 11 | Product substitution issue | FAERS: 10 | US FAERS | |
| 12 | Vomiting | FAERS: 10 | US FAERS | |
| 13 | Deafness | FAERS: 9 | US FAERS | |
| 14 | Fatigue | FAERS: 9 | US FAERS | |
| 15 | Retinal toxicity | FAERS: 9 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 16 | Asthenia | FAERS: 8 | US FAERS | |
| 17 | MYELODYSPLASTIC SYNDROME | FAERS: 8 | US FAERS | |
| 18 | Alopecia | FAERS: 7 | US FAERS | |
| 19 | Dyspepsia | FAERS: 7 | US FAERS | |
| 20 | Headache | FAERS: 7 | US FAERS | |
| 21 | Overdose | FAERS: 7 | US FAERS | |
| 22 | Rheumatoid Arthritis | FAERS: 7 | US FAERS | |
| 23 | Hypotension | FAERS: 6 | US FAERS | |
| 24 | Respiratory Failure | FAERS: 6 | US FAERS | |
| 25 | Abdominal discomfort | FAERS: 5 | US FAERS | |
| 26 | Cardiac Arrest | FAERS: 5 | US FAERS | |
| 27 | Erythema Multiforme | FAERS: 5 | US FAERS | |
| 28 | Joint swelling | FAERS: 5 | US FAERS | |
| 29 | Malaise | FAERS: 5 | US FAERS | |
| 30 | Myopathy | FAERS: 5 | US FAERS | |
| 31 | Palpitations | FAERS: 5 | US FAERS | |
| 32 | Visual Impairment | FAERS: 5 | US FAERS | |
| 33 | Abdominal Pain | FAERS: 4 | US FAERS | |
| 34 | Blindness | FAERS: 4 | US FAERS | |
| 35 | Erythema | FAERS: 4 | US FAERS | |
| 36 | Lip swelling | FAERS: 4 | US FAERS | |
| 37 | Myasthenia Gravis | FAERS: 4 | US FAERS | |
| 38 | Product quality issue | FAERS: 4 | US FAERS | |
| 39 | Rash erythematous | FAERS: 4 | US FAERS | |
| 40 | Restrictive cardiomyopathy | FAERS: 4 | US FAERS | |
| 41 | Sinus Tachycardia | FAERS: 4 | US FAERS | |
| 42 | Therapeutic response unexpected with drug substitution | FAERS: 4 | US FAERS | |
| 43 | Weight decreased | FAERS: 4 | US FAERS | |
| 44 | Burning sensation | FAERS: 3 | US FAERS | |
| 45 | Dysgeusia | FAERS: 3 | US FAERS | |
| 46 | Ejection Fraction Decreased | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 47 | Feeling abnormal | FAERS: 3 | US FAERS | |
| 48 | Hypersensitivity | FAERS: 3 | US FAERS | |
| 49 | Left Ventricular Hypertrophy | FAERS: 3 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 50 | Myalgia | FAERS: 3 | US FAERS | |
| 51 | Petechiae | FAERS: 3 | US FAERS | |
| 52 | Syncope | FAERS: 3 | US FAERS | |
| 53 | Tremor | FAERS: 3 | US FAERS | |
| 54 | Vertigo | FAERS: 3 | US FAERS | |
| 55 | Acute left ventricular failure | FAERS: 2 | US FAERS | |
| 56 | Acute respiratory failure | FAERS: 2 | US FAERS | |
| 57 | Alveolitis | FAERS: 2 | US FAERS | |
| 58 | Angioedema | FAERS: 2 | US FAERS | |
| 59 | Atrial Fibrillation | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 60 | Blood creatine phosphokinase increased | FAERS: 2 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 61 | Cardiac Hypertrophy | FAERS: 2 | US FAERS | |
| 62 | Cardiotoxicity | FAERS: 2 | US FAERS | |
| 63 | Cataract | FAERS: 2 | US FAERS | |
| 64 | Detachment of retinal pigment epithelium | FAERS: 2 | US FAERS | |
| 65 | Diastolic dysfunction | FAERS: 2 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 66 | Diplopia | FAERS: 2 | US FAERS | |
| 67 | Drug dispensing error | FAERS: 2 | US FAERS | |
| 68 | Dry skin | FAERS: 2 | US FAERS | |
| 69 | Electrolyte imbalance | FAERS: 2 | US FAERS | |
| 70 | Hypoxia | FAERS: 2 | US FAERS | |
| 71 | Joint stiffness | FAERS: 2 | US FAERS | |
| 72 | Lethargy | FAERS: 2 | US FAERS | |
| 73 | Leukocytoclastic vasculitis | FAERS: 2 | US FAERS | |
| 74 | Leukocytosis | FAERS: 2 | US FAERS | |
| 75 | Leukopenia | FAERS: 2 | US FAERS | |
| 76 | Macular degeneration | FAERS: 2 | US FAERS | |
| 77 | Malignant melanoma in situ | FAERS: 2 | US FAERS | |
| 78 | Maternal exposure during pregnancy | FAERS: 2 | US FAERS | |
| 79 | Neutropenia | FAERS: 2 | US FAERS | |
| 80 | Oral pain | FAERS: 2 | US FAERS | |
| 81 | Oropharyngeal pain | FAERS: 2 | US FAERS | |
| 82 | Pericardial effusion | FAERS: 2 | US FAERS | |
| 83 | Pneumonitis | FAERS: 2 | US FAERS | |
| 84 | Product use issue | FAERS: 2 | US FAERS | |
| 85 | Pustular psoriasis | FAERS: 2 | US FAERS | |
| 86 | Retinal Degeneration | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 87 | Retinal pigment epitheliopathy | FAERS: 2 | US FAERS | |
| 88 | Retinogram abnormal | FAERS: 2 | US FAERS | |
| 89 | Somnolence | FAERS: 2 | US FAERS | |
| 90 | Stevens-Johnson Syndrome | FAERS: 2 | US FAERS | |
| 91 | Suicide attempt | FAERS: 2 | US FAERS | |
| 92 | Swelling | FAERS: 2 | US FAERS | |
| 93 | Toxic Epidermal Necrolysis | FAERS: 2 | US FAERS | |
| 94 | Urinary tract infection | FAERS: 2 | US FAERS | |
| 95 | Vasculitis | FAERS: 2 | US FAERS | |
| 96 | Ventricular hypertrophy | FAERS: 2 | US FAERS | |
| 97 | Vulvovaginal pruritus | FAERS: 2 | US FAERS | |
| 98 | White blood cell count decreased | FAERS: 2 | US FAERS | |
| 99 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 100 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 101 | Agranulocytosis | FAERS: 1 | US FAERS | |
| 102 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 103 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 104 | Amnesia | FAERS: 1 | US FAERS | |
| 105 | Anxiety | FAERS: 1 | US FAERS | |
| 106 | Aphasia | FAERS: 1 | US FAERS | |
| 107 | Arthritis | FAERS: 1 | US FAERS | |
| 108 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 109 | Atelectasis | FAERS: 1 | US FAERS | |
| 110 | Atrioventricular Block | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 111 | Autoimmune hepatitis | FAERS: 1 | US FAERS | |
| 112 | Bacterial culture positive | FAERS: 1 | US FAERS | |
| 113 | Biliary dilatation | FAERS: 1 | US FAERS | |
| 114 | Biopsy heart abnormal | FAERS: 1 | US FAERS | |
| 115 | Biopsy muscle abnormal | FAERS: 1 | US FAERS | |
| 116 | Blood albumin decreased | FAERS: 1 | US FAERS | |
| 117 | Blood chloride decreased | FAERS: 1 | US FAERS | |
| 118 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 119 | Bone pain | FAERS: 1 | US FAERS | |
| 120 | Bronchial wall thickening | FAERS: 1 | US FAERS | |
| 121 | Bronchitis | FAERS: 1 | US FAERS | |
| 122 | Bursitis | FAERS: 1 | US FAERS | |
| 123 | Butterfly rash | FAERS: 1 | US FAERS | |
| 124 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 125 | Chest Pain | FAERS: 1 | US FAERS | |
| 126 | Chest discomfort | FAERS: 1 | US FAERS | |
| 127 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 128 | Completed Suicide | FAERS: 1 | US FAERS | |
| 129 | Corneal dystrophy | FAERS: 1 | US FAERS | |
| 130 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 131 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 132 | Dermatitis Herpetiformis | FAERS: 1 | US FAERS | |
| 133 | Discomfort | FAERS: 1 | US FAERS | |
| 134 | Disorientation | FAERS: 1 | US FAERS | |
| 135 | Documented hypersensitivity to administered drug | FAERS: 1 | US FAERS | |
| 136 | Drug effect delayed | FAERS: 1 | US FAERS | |
| 137 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 138 | Drug exposure during pregnancy | FAERS: 1 | US FAERS | |
| 139 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 140 | Drug monitoring procedure not performed | FAERS: 1 | US FAERS | |
| 141 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 142 | Drug toxicity | FAERS: 1 | US FAERS | |
| 143 | Drug withdrawal syndrome | FAERS: 1 | US FAERS | |
| 144 | Dysuria | FAERS: 1 | US FAERS | |
| 145 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 146 | Electromechanical dissociation | FAERS: 1 | US FAERS | |
| 147 | Emotional disorder | FAERS: 1 | US FAERS | |
| 148 | Empyema | FAERS: 1 | US FAERS | |
| 149 | Endocarditis | FAERS: 1 | US FAERS | |
| 150 | Enterococcal infection | FAERS: 1 | US FAERS | |
| 151 | Exposure via father | FAERS: 1 | US FAERS | |
| 152 | Extranodal marginal zone B-cell lymphoma (MALT type) | FAERS: 1 | US FAERS | |
| 153 | Extravasation | FAERS: 1 | US FAERS | |
| 154 | Facial Pain | FAERS: 1 | US FAERS | |
| 155 | Failure to Thrive | FAERS: 1 | US FAERS | |
| 156 | Flatulence | FAERS: 1 | US FAERS | |
| 157 | Gallbladder pain | FAERS: 1 | US FAERS | |
| 158 | Gastrointestinal perforation | FAERS: 1 | US FAERS | |
| 159 | Genital rash | FAERS: 1 | US FAERS | |
| 160 | Glasgow coma scale abnormal | FAERS: 1 | US FAERS | |
| 161 | Heart sounds abnormal | FAERS: 1 | US FAERS | |
| 162 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 163 | Hepatotoxicity | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 164 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 165 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 166 | Inflammation | FAERS: 1 | US FAERS | |
| 167 | Influenza | FAERS: 1 | US FAERS | |
| 168 | Joint Tuberculosis | FAERS: 1 | US FAERS | |
| 169 | Joint warmth | FAERS: 1 | US FAERS | |
| 170 | Lupus-like syndrome | FAERS: 1 | US FAERS | |
| 171 | Lymphangioma | FAERS: 1 | US FAERS | |
| 172 | Macular detachment | FAERS: 1 | US FAERS | |
| 173 | Medication Error | FAERS: 1 | US FAERS | |
| 174 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 175 | Mood swings | FAERS: 1 | US FAERS | |
| 176 | Mouth swelling | FAERS: 1 | US FAERS | |
| 177 | Multi-organ disorder | FAERS: 1 | US FAERS | |
| 178 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 179 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 180 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 181 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 182 | Myocardial fibrosis | FAERS: 1 | US FAERS | |
| 183 | Myositis | FAERS: 1 | US FAERS | |
| 184 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 185 | Nervousness | FAERS: 1 | US FAERS | |
| 186 | Neuritis | FAERS: 1 | US FAERS | |
| 187 | Neutrophil count decreased | FAERS: 1 | US FAERS | |
| 188 | Ophthalmological examination abnormal | FAERS: 1 | US FAERS | |
| 189 | Optic Neuropathy | FAERS: 1 | US FAERS | |
| 190 | Ototoxicity | FAERS: 1 | US FAERS | |
| 191 | Oxygen consumption increased | FAERS: 1 | US FAERS | |
| 192 | PCO2 decreased | FAERS: 1 | US FAERS | |
| 193 | Palindromic rheumatism | FAERS: 1 | US FAERS | |
| 194 | Palpable purpura | FAERS: 1 | US FAERS | |
| 195 | Pancytopenia | FAERS: 1 | US FAERS | |
| 196 | Peripheral motor neuropathy | FAERS: 1 | US FAERS | |
| 197 | Personality Change | FAERS: 1 | US FAERS | |
| 198 | Pharyngolaryngeal Pain | FAERS: 1 | US FAERS | |
| 199 | Porphyria non-acute | FAERS: 1 | US FAERS | |
| 200 | Post procedural complication | FAERS: 1 | US FAERS | |
| 201 | Posterior reversible encephalopathy syndrome | FAERS: 1 | US FAERS | |
| 202 | Product coating issue | FAERS: 1 | US FAERS | |
| 203 | Product label issue | FAERS: 1 | US FAERS | |
| 204 | Product physical issue | FAERS: 1 | US FAERS | |
| 205 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 206 | Proteinuria | FAERS: 1 | US FAERS | |
| 207 | Pulmonary Eosinophilia | FAERS: 1 | US FAERS | |
| 208 | Purpura | FAERS: 1 | US FAERS | |
| 209 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 210 | Rales | FAERS: 1 | US FAERS | |
| 211 | Rash papulosquamous | FAERS: 1 | US FAERS | |
| 212 | Rebound effect | FAERS: 1 | US FAERS | |
| 213 | Restlessness | FAERS: 1 | US FAERS | |
| 214 | Retching | FAERS: 1 | US FAERS | |
| 215 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 216 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 217 | Sciatica | FAERS: 1 | US FAERS | |
| 218 | Sepsis | FAERS: 1 | US FAERS | |
| 219 | Septic Shock | FAERS: 1 | US FAERS | |
| 220 | Shock | FAERS: 1 | US FAERS | |
| 221 | Sinoatrial Block | FAERS: 1 | US FAERS | |
| 222 | Sjogren's Syndrome | FAERS: 1 | US FAERS | |
| 223 | Skin hypertrophy | FAERS: 1 | US FAERS | |
| 224 | Staphylococcus test positive | FAERS: 1 | US FAERS | |
| 225 | Stomatitis | FAERS: 1 | US FAERS | |
| 226 | Systemic lupus erythematosus rash | FAERS: 1 | US FAERS | |
| 227 | Systolic dysfunction | FAERS: 1 | US FAERS | |
| 228 | Tachycardia | FAERS: 1 | US FAERS | |
| 229 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 230 | Thermal burn | FAERS: 1 | US FAERS | |
| 231 | Throat irritation | FAERS: 1 | US FAERS | |
| 232 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 233 | Troponin I increased | FAERS: 1 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 234 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 235 | Urinary Retention | FAERS: 1 | US FAERS | |
| 236 | Ventricular arrhythmia | FAERS: 1 | US FAERS | |
| 237 | Ventricular failure | FAERS: 1 | US FAERS | |
| 238 | Withdrawal arrhythmia | FAERS: 1 | US FAERS | |
| 239 | Wound infection pseudomonas | FAERS: 1 | US FAERS | |
| 240 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 241 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 242 | jaundice | FAERS: 1 | US FAERS | |
| 243 | treatment failure | FAERS: 1 | US FAERS | |
| 244 | Atrial Flutter | Canada Vigilance: 1 | Canada Vigilance | |
| 245 | Brain natriuretic peptide abnormal | Canada Vigilance: 8 | Canada Vigilance | |
| 246 | Cardiac septal hypertrophy | Canada Vigilance: 9 | Canada Vigilance | |
| 247 | Dyschromatopsia | Canada Vigilance: 1 | Canada Vigilance | |
| 248 | Left atrial dilatation | Canada Vigilance: 5 | Canada Vigilance | |
| 249 | Macular pigmentation | Canada Vigilance: 1 | Canada Vigilance | |
| 250 | Myocardial necrosis marker increased | Canada Vigilance: 4 | Canada Vigilance | |
| 251 | Ocular Toxicity | Canada Vigilance: 1 | Canada Vigilance | |
| 252 | Right Ventricular Hypertrophy | Canada Vigilance: 2 | Canada Vigilance | |
| 253 | Right atrial dilatation | Canada Vigilance: 3 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.