olaparib
(FDLYAMZZIXQODN-UHFFFAOYSA-N)
Structure
- SMILES
- O=C(N1CCN(CC1)C(=O)c1cc(ccc1F)Cc1n[nH]c(=O)c2c1cccc2)C1CC1
- Type(s)
- Approved
- ATC code(s)
- L01XX46
- Molecular Formula:
- C24H23FN4O3
- Molecular Weight:
- 434.463
- Log P:
- 2.2232
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 1
- TPSA:
- 86.37
- CAS Number(s):
- 763113-22-0; 937799-91-2
Synonym(s)
1.
olaparib
2.
AZD 2281
3.
AZD-2281
4.
AZD221
5.
AZD2281
6.
Lynparza
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Nausea | FAERS: 309 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 2 | Malignant neoplasm progression | FAERS: 287 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 3 | Fatigue | FAERS: 208 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 4 | Product use issue | FAERS: 132 | US FAERS | |
| 5 | Vomiting | FAERS: 132 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 6 | Product use in unapproved indication | FAERS: 98 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 7 | Disease Progression | FAERS: 86 | US FAERS | |
| 8 | MYELODYSPLASTIC SYNDROME | FAERS: 55 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 9 | Malaise | FAERS: 55 | US FAERS | |
| 10 | Headache | FAERS: 47 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 11 | Thrombocytopenia | FAERS: 47 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 12 | Asthenia | FAERS: 44 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 13 | Arthralgia | FAERS: 40 | US FAERS | |
| 14 | Pain | FAERS: 39 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 15 | Constipation | FAERS: 33 | US FAERS | |
| 16 | Abdominal discomfort | FAERS: 32 | US FAERS | |
| 17 | Abdominal Pain | FAERS: 31 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 18 | Pancytopenia | FAERS: 30 | US FAERS | |
| 19 | Dizziness | FAERS: 29 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 20 | White blood cell count decreased | FAERS: 29 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 21 | Blood creatinine increased | FAERS: 28 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 22 | Drug ineffective | FAERS: 26 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 23 | Dyspepsia | FAERS: 26 | US FAERS | |
| 24 | Dysgeusia | FAERS: 25 | US FAERS | |
| 25 | Intestinal Obstruction | FAERS: 24 | US FAERS | |
| 26 | Weight decreased | FAERS: 24 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 27 | Ascites | FAERS: 23 | US FAERS | |
| 28 | Back Pain | FAERS: 23 | US FAERS | |
| 29 | Neutropenia | FAERS: 23 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 30 | Pneumonia | FAERS: 23 | US FAERS | |
| 31 | Ileus | FAERS: 22 | US FAERS | |
| 32 | Intentional product misuse | FAERS: 22 | US FAERS | |
| 33 | Myalgia | FAERS: 22 | US FAERS | |
| 34 | General physical health deterioration | FAERS: 19 | US FAERS | |
| 35 | Dehydration | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 36 | Drug dose omission | FAERS: 18 | US FAERS | |
| 37 | Peripheral swelling | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 38 | Disease recurrence | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 39 | Nasopharyngitis | FAERS: 17 | US FAERS | |
| 40 | Pruritus | FAERS: 17 | US FAERS | |
| 41 | Pneumonitis | FAERS: 15 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 42 | Haematotoxicity | FAERS: 14 | US FAERS | |
| 43 | Neutrophil count decreased | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 44 | Chest Pain | FAERS: 12 | US FAERS | |
| 45 | Chills | FAERS: 12 | US FAERS | |
| 46 | Toxicity to various agents | FAERS: 12 | US FAERS | |
| 47 | Erythema | FAERS: 11 | US FAERS | |
| 48 | Feeling abnormal | FAERS: 11 | US FAERS | |
| 49 | Metastasis | FAERS: 11 | US FAERS | |
| 50 | Product dose omission | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 51 | Bone pain | FAERS: 10 | US FAERS | |
| 52 | Febrile Neutropenia | FAERS: 10 | US FAERS | |
| 53 | Full blood count decreased | FAERS: 10 | US FAERS | |
| 54 | Influenza | FAERS: 10 | US FAERS | |
| 55 | Urinary tract infection | FAERS: 10 | US FAERS | |
| 56 | Urticaria | FAERS: 10 | US FAERS | |
| 57 | Alopecia | FAERS: 9 | US FAERS | |
| 58 | Blood count abnormal | FAERS: 9 | US FAERS | |
| 59 | Hypersensitivity | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 60 | Memory impairment | FAERS: 9 | US FAERS | |
| 61 | Somnolence | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 62 | Adverse event | FAERS: 8 | US FAERS | |
| 63 | Alanine Aminotransferase Increased | FAERS: 8 | US FAERS | |
| 64 | Cerebrovascular accident | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 65 | Flatulence | FAERS: 8 | US FAERS | |
| 66 | Stomatitis | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 67 | Therapy cessation | FAERS: 8 | US FAERS | |
| 68 | Tremor | FAERS: 8 | US FAERS | |
| 69 | Blood magnesium decreased | FAERS: 7 | US FAERS | |
| 70 | Drug resistance | FAERS: 7 | US FAERS | |
| 71 | Dry skin | FAERS: 7 | US FAERS | |
| 72 | Dysphonia | FAERS: 7 | US FAERS | |
| 73 | Flushing | FAERS: 7 | US FAERS | |
| 74 | Leukopenia | FAERS: 7 | US FAERS | |
| 75 | Pancreatic carcinoma | FAERS: 7 | US FAERS | |
| 76 | Product difficult to swallow | FAERS: 7 | US FAERS | |
| 77 | Respiratory Failure | FAERS: 7 | US FAERS | |
| 78 | Acute kidney injury | FAERS: 6 | US FAERS | |
| 79 | Aspartate Aminotransferase Increased | FAERS: 6 | US FAERS | |
| 80 | Atrial Fibrillation | FAERS: 6 | US FAERS | |
| 81 | Epistaxis | FAERS: 6 | US FAERS | |
| 82 | Hypophagia | FAERS: 6 | US FAERS | |
| 83 | Hypotension | FAERS: 6 | US FAERS | |
| 84 | Infection | FAERS: 6 | US FAERS | |
| 85 | Joint swelling | FAERS: 6 | US FAERS | |
| 86 | Lymphadenopathy | FAERS: 6 | US FAERS | |
| 87 | Acne | FAERS: 5 | US FAERS | |
| 88 | Arthritis | FAERS: 5 | US FAERS | |
| 89 | Blood alkaline phosphatase increased | FAERS: 5 | US FAERS | |
| 90 | Cataract | FAERS: 5 | US FAERS | |
| 91 | Cholelithiasis | FAERS: 5 | US FAERS | |
| 92 | Cytopenia | FAERS: 5 | US FAERS | |
| 93 | Erythema Multiforme | FAERS: 5 | US FAERS | |
| 94 | Inflammation | FAERS: 5 | US FAERS | |
| 95 | Retching | FAERS: 5 | US FAERS | |
| 96 | Transaminases increased | FAERS: 5 | US FAERS | |
| 97 | Visual Impairment | FAERS: 5 | US FAERS | |
| 98 | Angioedema | FAERS: 4 | US FAERS | |
| 99 | Blood glucose increased | FAERS: 4 | US FAERS | |
| 100 | Blood potassium decreased | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 101 | Bronchitis | FAERS: 4 | US FAERS | |
| 102 | Cardiac discomfort | FAERS: 4 | US FAERS | |
| 103 | Chest discomfort | FAERS: 4 | US FAERS | |
| 104 | Cystitis | FAERS: 4 | US FAERS | |
| 105 | Deep Vein Thrombosis | FAERS: 4 | US FAERS | |
| 106 | Escherichia infection | FAERS: 4 | US FAERS | |
| 107 | Hypertransaminasaemia | FAERS: 4 | US FAERS | |
| 108 | Intestinal Perforation | FAERS: 4 | US FAERS | |
| 109 | Metastases to pelvis | FAERS: 4 | US FAERS | |
| 110 | Musculoskeletal stiffness | FAERS: 4 | US FAERS | |
| 111 | Neck Pain | FAERS: 4 | US FAERS | |
| 112 | No adverse event | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 113 | Product use complaint | FAERS: 4 | US FAERS | |
| 114 | treatment failure | FAERS: 4 | US FAERS | |
| 115 | Acquired gene mutation | FAERS: 3 | US FAERS | |
| 116 | Anxiety | FAERS: 3 | US FAERS | |
| 117 | Ataxia | FAERS: 3 | US FAERS | |
| 118 | Blast cell count increased | FAERS: 3 | US FAERS | |
| 119 | Blood electrolytes decreased | FAERS: 3 | US FAERS | |
| 120 | Cellulitis | FAERS: 3 | US FAERS | |
| 121 | Circumstance or information capable of leading to medication error | FAERS: 3 | US FAERS | |
| 122 | Diverticulitis | FAERS: 3 | US FAERS | |
| 123 | Dysuria | FAERS: 3 | US FAERS | |
| 124 | Eructation | FAERS: 3 | US FAERS | |
| 125 | Fracture | FAERS: 3 | US FAERS | |
| 126 | Gamma-Glutamyltransferase Increased | FAERS: 3 | US FAERS | |
| 127 | Hepatotoxicity | FAERS: 3 | US FAERS | |
| 128 | Histiocytosis haematophagic | FAERS: 3 | US FAERS | |
| 129 | Hypokinesia | FAERS: 3 | US FAERS | |
| 130 | Intentional product use issue | FAERS: 3 | US FAERS | |
| 131 | Lip swelling | FAERS: 3 | US FAERS | |
| 132 | Lymphangiosis carcinomatosa | FAERS: 3 | US FAERS | |
| 133 | Lymphocyte count decreased | FAERS: 3 | US FAERS | |
| 134 | Meningitis | FAERS: 3 | US FAERS | |
| 135 | Metastases to abdominal cavity | FAERS: 3 | US FAERS | |
| 136 | Musculoskeletal Pain | FAERS: 3 | US FAERS | |
| 137 | Myocardial Infarction | FAERS: 3 | US FAERS | |
| 138 | Neuralgia | FAERS: 3 | US FAERS | |
| 139 | Night sweats | FAERS: 3 | US FAERS | |
| 140 | Nodule | FAERS: 3 | US FAERS | |
| 141 | Oral pain | FAERS: 3 | US FAERS | |
| 142 | Oropharyngeal pain | FAERS: 3 | US FAERS | |
| 143 | Pericardial effusion | FAERS: 3 | US FAERS | |
| 144 | Physical deconditioning | FAERS: 3 | US FAERS | |
| 145 | Product storage error | FAERS: 3 | US FAERS | |
| 146 | Pulmonary Embolism | FAERS: 3 | US FAERS | |
| 147 | Restlessness | FAERS: 3 | US FAERS | |
| 148 | Rhinitis | FAERS: 3 | US FAERS | |
| 149 | Sepsis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 150 | Stress | FAERS: 3 | US FAERS | |
| 151 | Subileus | FAERS: 3 | US FAERS | |
| 152 | Swelling | FAERS: 3 | US FAERS | |
| 153 | Syncope | FAERS: 3 | US FAERS | |
| 154 | Thirst | FAERS: 3 | US FAERS | |
| 155 | Throat irritation | FAERS: 3 | US FAERS | |
| 156 | Thrombosis | FAERS: 3 | US FAERS | |
| 157 | Upper-airway cough syndrome | FAERS: 3 | US FAERS | |
| 158 | Vasculitis | FAERS: 3 | US FAERS | |
| 159 | Abscess | FAERS: 2 | US FAERS | |
| 160 | Agitation | FAERS: 2 | US FAERS | |
| 161 | Aphasia | FAERS: 2 | US FAERS | |
| 162 | Biliary dilatation | FAERS: 2 | US FAERS | |
| 163 | Blood creatinine decreased | FAERS: 2 | US FAERS | |
| 164 | Blood iron decreased | FAERS: 2 | US FAERS | |
| 165 | Bone marrow toxicity | FAERS: 2 | US FAERS | |
| 166 | Cerebral disorder | FAERS: 2 | US FAERS | |
| 167 | Clostridium difficile infection | FAERS: 2 | US FAERS | |
| 168 | Colitis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 169 | Cyst | FAERS: 2 | US FAERS | |
| 170 | Dermatomyositis | FAERS: 2 | US FAERS | |
| 171 | Discomfort | FAERS: 2 | US FAERS | |
| 172 | Ecchymosis | FAERS: 2 | US FAERS | |
| 173 | Electrolyte imbalance | FAERS: 2 | US FAERS | |
| 174 | Embolism | FAERS: 2 | US FAERS | |
| 175 | Emotional disorder | FAERS: 2 | US FAERS | |
| 176 | Encephalitis | FAERS: 2 | US FAERS | |
| 177 | Erythroblastosis | FAERS: 2 | US FAERS | |
| 178 | Febrile infection | FAERS: 2 | US FAERS | |
| 179 | Food Poisoning | FAERS: 2 | US FAERS | |
| 180 | Full blood count abnormal | FAERS: 2 | US FAERS | |
| 181 | Gastritis | FAERS: 2 | US FAERS | |
| 182 | Hordeolum | FAERS: 2 | US FAERS | |
| 183 | Hunger | FAERS: 2 | US FAERS | |
| 184 | Hypersomnia | FAERS: 2 | US FAERS | |
| 185 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 186 | Intestinal metastasis | FAERS: 2 | US FAERS | |
| 187 | Large intestinal stenosis | FAERS: 2 | US FAERS | |
| 188 | Limb discomfort | FAERS: 2 | US FAERS | |
| 189 | Lower respiratory tract infection | FAERS: 2 | US FAERS | |
| 190 | Lymphocele | FAERS: 2 | US FAERS | |
| 191 | Musculoskeletal chest pain | FAERS: 2 | US FAERS | |
| 192 | Obesity | FAERS: 2 | US FAERS | |
| 193 | Oncologic complication | FAERS: 2 | US FAERS | |
| 194 | Onychoclasis | FAERS: 2 | US FAERS | |
| 195 | Ovarian cancer stage IV | FAERS: 2 | US FAERS | |
| 196 | Platelet count abnormal | FAERS: 2 | US FAERS | |
| 197 | Pleurisy | FAERS: 2 | US FAERS | |
| 198 | Product administration interrupted | FAERS: 2 | US FAERS | |
| 199 | Product quality issue | FAERS: 2 | US FAERS | |
| 200 | Product used for unknown indication | FAERS: 2 | US FAERS | |
| 201 | Productive Cough | FAERS: 2 | US FAERS | |
| 202 | Prostatic specific antigen decreased | FAERS: 2 | US FAERS | |
| 203 | Pulmonary congestion | FAERS: 2 | US FAERS | |
| 204 | Pyelonephritis | FAERS: 2 | US FAERS | |
| 205 | Red blood cell nucleated morphology present | FAERS: 2 | US FAERS | |
| 206 | Refractory cytopenia with multilineage dysplasia | FAERS: 2 | US FAERS | |
| 207 | Sneezing | FAERS: 2 | US FAERS | |
| 208 | Sunburn | FAERS: 2 | US FAERS | |
| 209 | White blood cell count abnormal | FAERS: 2 | US FAERS | |
| 210 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 211 | Abdominal Infection | FAERS: 1 | US FAERS | |
| 212 | Abdominal adhesions | FAERS: 1 | US FAERS | |
| 213 | Abdominal mass | FAERS: 1 | US FAERS | |
| 214 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 215 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 216 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 217 | Acute respiratory failure | FAERS: 1 | US FAERS | |
| 218 | Ageusia | FAERS: 1 | US FAERS | |
| 219 | Amnesia | FAERS: 1 | US FAERS | |
| 220 | Anal Fistula | FAERS: 1 | US FAERS | |
| 221 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 222 | Anaphylactoid Reaction | FAERS: 1 | US FAERS | |
| 223 | Aphonia | FAERS: 1 | US FAERS | |
| 224 | Appendicitis | FAERS: 1 | US FAERS | |
| 225 | Asthma | FAERS: 1 | US FAERS | |
| 226 | BRCA1 gene mutation | FAERS: 1 | US FAERS | |
| 227 | Bacterial test positive | FAERS: 1 | US FAERS | |
| 228 | Basal cell carcinoma | FAERS: 1 | US FAERS | |
| 229 | Biliary sepsis | FAERS: 1 | US FAERS | |
| 230 | Blindness | FAERS: 1 | US FAERS | |
| 231 | Blood chloride decreased | FAERS: 1 | US FAERS | |
| 232 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 233 | Blood creatine abnormal | FAERS: 1 | US FAERS | |
| 234 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 235 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 236 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 237 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 238 | Blood sodium abnormal | FAERS: 1 | US FAERS | |
| 239 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 240 | Blood thyroid stimulating hormone decreased | FAERS: 1 | US FAERS | |
| 241 | Blood thyroid stimulating hormone increased | FAERS: 1 | US FAERS | |
| 242 | Blood urea increased | FAERS: 1 | US FAERS | |
| 243 | Brain scan abnormal | FAERS: 1 | US FAERS | |
| 244 | Bronchopneumopathy | FAERS: 1 | US FAERS | |
| 245 | Bronchopulmonary Aspergillosis | FAERS: 1 | US FAERS | |
| 246 | Burning sensation | FAERS: 1 | US FAERS | |
| 247 | Carbohydrate antigen 15-3 increased | FAERS: 1 | US FAERS | |
| 248 | Carbohydrate antigen 19-9 increased | FAERS: 1 | US FAERS | |
| 249 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 250 | Cardiac Tamponade | FAERS: 1 | US FAERS | |
| 251 | Cardiac dysfunction | FAERS: 1 | US FAERS | |
| 252 | Cheilitis | FAERS: 1 | US FAERS | |
| 253 | Chromaturia | FAERS: 1 | US FAERS | |
| 254 | Colon cancer recurrent | FAERS: 1 | US FAERS | |
| 255 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 256 | Cystocele | FAERS: 1 | US FAERS | |
| 257 | Cytokine Release Syndrome | FAERS: 1 | US FAERS | |
| 258 | Dark circles under eyes | FAERS: 1 | US FAERS | |
| 259 | Deafness | FAERS: 1 | US FAERS | |
| 260 | Dental Restoration Failure | FAERS: 1 | US FAERS | |
| 261 | Dermatitis | FAERS: 1 | US FAERS | |
| 262 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 263 | Disorientation | FAERS: 1 | US FAERS | |
| 264 | Drug abuse | FAERS: 1 | US FAERS | |
| 265 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 266 | Drug effect delayed | FAERS: 1 | US FAERS | |
| 267 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 268 | Drug effective for unapproved indication | FAERS: 1 | US FAERS | |
| 269 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 270 | Ear discomfort | FAERS: 1 | US FAERS | |
| 271 | Empyema | FAERS: 1 | US FAERS | |
| 272 | Enteritis | FAERS: 1 | US FAERS | |
| 273 | Escherichia sepsis | FAERS: 1 | US FAERS | |
| 274 | Euthanasia | FAERS: 1 | US FAERS | |
| 275 | Feeling Cold | FAERS: 1 | US FAERS | |
| 276 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 277 | Flank Pain | FAERS: 1 | US FAERS | |
| 278 | Fluid overload | FAERS: 1 | US FAERS | |
| 279 | Frustration | FAERS: 1 | US FAERS | |
| 280 | Full blood count increased | FAERS: 1 | US FAERS | |
| 281 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 282 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 283 | Gastrointestinal infection | FAERS: 1 | US FAERS | |
| 284 | Gastrointestinal toxicity | FAERS: 1 | US FAERS | |
| 285 | Gastrostomy tube site complication | FAERS: 1 | US FAERS | |
| 286 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 287 | Genital discharge | FAERS: 1 | US FAERS | |
| 288 | Gout | FAERS: 1 | US FAERS | |
| 289 | Granuloma Annulare | FAERS: 1 | US FAERS | |
| 290 | Hemiparesis | FAERS: 1 | US FAERS | |
| 291 | Hepatic Infarction | FAERS: 1 | US FAERS | |
| 292 | Hepatitis | FAERS: 1 | US FAERS | |
| 293 | Hernial eventration | FAERS: 1 | US FAERS | |
| 294 | Hyperacusis | FAERS: 1 | US FAERS | |
| 295 | Hyperchlorhydria | FAERS: 1 | US FAERS | |
| 296 | Hypermetabolism | FAERS: 1 | US FAERS | |
| 297 | Hyperphagia | FAERS: 1 | US FAERS | |
| 298 | Hypertrophic Cardiomyopathy | FAERS: 1 | US FAERS | |
| 299 | Immune thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 300 | Incontinence | FAERS: 1 | US FAERS | |
| 301 | Intra-abdominal fluid collection | FAERS: 1 | US FAERS | |
| 302 | Intracranial Aneurysm | FAERS: 1 | US FAERS | |
| 303 | Investigation abnormal | FAERS: 1 | US FAERS | |
| 304 | Laceration | FAERS: 1 | US FAERS | |
| 305 | Laryngitis | FAERS: 1 | US FAERS | |
| 306 | Lethargy | FAERS: 1 | US FAERS | |
| 307 | Limb injury | FAERS: 1 | US FAERS | |
| 308 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 309 | Lyme Disease | FAERS: 1 | US FAERS | |
| 310 | Lymphopenia | FAERS: 1 | US FAERS | |
| 311 | Macrocytosis | FAERS: 1 | US FAERS | |
| 312 | Malignant Bowel Obstruction | FAERS: 1 | US FAERS | |
| 313 | Malignant ascites | FAERS: 1 | US FAERS | |
| 314 | Malignant neoplasm of uterine adnexa | FAERS: 1 | US FAERS | |
| 315 | Malnutrition | FAERS: 1 | US FAERS | |
| 316 | Mental status changes | FAERS: 1 | US FAERS | |
| 317 | Metastases to abdominal wall | FAERS: 1 | US FAERS | |
| 318 | Metastases to adrenals | FAERS: 1 | US FAERS | |
| 319 | Metastases to stomach | FAERS: 1 | US FAERS | |
| 320 | Metastases to thorax | FAERS: 1 | US FAERS | |
| 321 | Metastatic Neoplasm | FAERS: 1 | US FAERS | |
| 322 | Mouth swelling | FAERS: 1 | US FAERS | |
| 323 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 324 | Muscle tightness | FAERS: 1 | US FAERS | |
| 325 | Obstruction | FAERS: 1 | US FAERS | |
| 326 | Optic Neuritis | FAERS: 1 | US FAERS | |
| 327 | Osteoporosis | FAERS: 1 | US FAERS | |
| 328 | Ovarian cancer stage III | FAERS: 1 | US FAERS | |
| 329 | Pain of skin | FAERS: 1 | US FAERS | |
| 330 | Pallor | FAERS: 1 | US FAERS | |
| 331 | Pancreatic carcinoma recurrent | FAERS: 1 | US FAERS | |
| 332 | Pancreatitis | FAERS: 1 | US FAERS | |
| 333 | Paranasal sinus discomfort | FAERS: 1 | US FAERS | |
| 334 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 335 | Pericarditis | FAERS: 1 | US FAERS | |
| 336 | Peritonitis | FAERS: 1 | US FAERS | |
| 337 | Platelet Transfusion | FAERS: 1 | US FAERS | |
| 338 | Pneumothorax | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 339 | Polyarthritis | FAERS: 1 | US FAERS | |
| 340 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 341 | Portal Hypertension | FAERS: 1 | US FAERS | |
| 342 | Post procedural complication | FAERS: 1 | US FAERS | |
| 343 | Postoperative ileus | FAERS: 1 | US FAERS | |
| 344 | Presyncope | FAERS: 1 | US FAERS | |
| 345 | Product administration error | FAERS: 1 | US FAERS | |
| 346 | Product dispensing error | FAERS: 1 | US FAERS | |
| 347 | Product physical issue | FAERS: 1 | US FAERS | |
| 348 | Product preparation error | FAERS: 1 | US FAERS | |
| 349 | Product prescribing error | FAERS: 1 | US FAERS | |
| 350 | Product prescribing issue | FAERS: 1 | US FAERS | |
| 351 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 352 | Prostate cancer recurrent | FAERS: 1 | US FAERS | |
| 353 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 354 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 355 | Radiation associated pain | FAERS: 1 | US FAERS | |
| 356 | Radiation skin injury | FAERS: 1 | US FAERS | |
| 357 | Rash erythematous | FAERS: 1 | US FAERS | |
| 358 | Red blood cell schistocytes present | FAERS: 1 | US FAERS | |
| 359 | Refractory cancer | FAERS: 1 | US FAERS | |
| 360 | Regurgitation | FAERS: 1 | US FAERS | |
| 361 | Renal cyst | FAERS: 1 | US FAERS | |
| 362 | Respiratory distress | FAERS: 1 | US FAERS | |
| 363 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 364 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 365 | Reticulocyte count decreased | FAERS: 1 | US FAERS | |
| 366 | Sciatica | FAERS: 1 | US FAERS | |
| 367 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 368 | Sinusitis | FAERS: 1 | US FAERS | |
| 369 | Skin Papilloma | FAERS: 1 | US FAERS | |
| 370 | Skin irritation | FAERS: 1 | US FAERS | |
| 371 | Skin laceration | FAERS: 1 | US FAERS | |
| 372 | Skin reaction | FAERS: 1 | US FAERS | |
| 373 | Skin tightness | FAERS: 1 | US FAERS | |
| 374 | Skin toxicity | FAERS: 1 | US FAERS | |
| 375 | Splenic Infarction | FAERS: 1 | US FAERS | |
| 376 | Superior Vena Cava Syndrome | FAERS: 1 | US FAERS | |
| 377 | Tachycardia | FAERS: 1 | US FAERS | |
| 378 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 379 | Therapeutic response changed | FAERS: 1 | US FAERS | |
| 380 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 381 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 382 | Therapy partial responder | FAERS: 1 | US FAERS | |
| 383 | Tinnitus | FAERS: 1 | US FAERS | |
| 384 | Tongue blistering | FAERS: 1 | US FAERS | |
| 385 | Toothache | FAERS: 1 | US FAERS | |
| 386 | Tumour haemorrhage | FAERS: 1 | US FAERS | |
| 387 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 388 | Vaginal Discharge | FAERS: 1 | US FAERS | |
| 389 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 390 | Viral upper respiratory tract infection | FAERS: 1 | US FAERS | |
| 391 | Vulvovaginal pain | FAERS: 1 | US FAERS | |
| 392 | Waist circumference increased | FAERS: 1 | US FAERS | |
| 393 | Wheezing | FAERS: 1 | US FAERS | |
| 394 | furuncle | FAERS: 1 | US FAERS | |
| 395 | Therapy change | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.