teduglutide
(CILIXQOJUNDIDU-ASQIGDHWSA-N)
Structure
- SMILES
- NCCCC[C@@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)O)CC(=O)O)[C@H](O)C)[C@H](CC)C)NC(=O)[C@H]([C@H](O)C)NC(=O)[C@@H](NC(=O)[C@H]([C@H](CC)C)NC(=O)[C@@H](NC(=O)[C@H](Cc1c[nH]c2c1cccc2)NC(=O)[C@@H](NC(=O)[C@H]([C@H](CC)C)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H]([C@H](CC)C)NC(=O)[C@H]([C@H](O)C)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)CNC(=O)[C@@H](NC(=O)CNC(=O)[C@H](Cc1[nH]cnc1)N)CC(=O)O)CO)Cc1ccccc1)CO)CC(=O)O)CCC(=O)O)CCSC)CC(=O)N)CC(C)C)CC(=O)O)CC(=O)N)CC(C)C)C)C)CCCNC(=N)N)CC(=O)O)Cc1ccccc1)CC(=O)N)CC(C)C)CCC(=O)N
- Molecular Formula:
- C164H252N44O55S
- Molecular Weight:
- 3752.080
- Log P:
- 1.0163
- Hydrogen Bond Acceptor:
- 98
- Hydrogen Bond Donor:
- 55
- TPSA:
- 1649.52
- CAS Number(s):
- 197922-42-2
Synonym(s)
1.
teduglutide
2.
(Gly2)GLP-2
3.
Gly(2)-GLP-2
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Abdominal Pain | FAERS: 149 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 2 | Nausea | FAERS: 148 | SIDER US FAERS | |
| 3 | Dehydration | FAERS: 104 | US FAERS | |
| 4 | Vomiting | FAERS: 97 | SIDER US FAERS | |
| 5 | Weight decreased | FAERS: 86 | US FAERS | |
| 6 | Drug ineffective | FAERS: 72 | US FAERS | |
| 7 | Inappropriate schedule of drug administration | FAERS: 67 | US FAERS | |
| 8 | Intestinal Obstruction | FAERS: 67 | SIDER US FAERS | |
| 9 | Drug dose omission | FAERS: 59 | US FAERS | |
| 10 | Sepsis | FAERS: 57 | US FAERS | |
| 11 | Headache | FAERS: 53 | SIDER US FAERS | |
| 12 | Obstruction | FAERS: 53 | US FAERS | |
| 13 | Stoma complication | FAERS: 52 | US FAERS | |
| 14 | Fatigue | FAERS: 51 | US FAERS | |
| 15 | Device related infection | FAERS: 50 | US FAERS | |
| 16 | Pneumonia | FAERS: 50 | US FAERS | |
| 17 | Constipation | FAERS: 45 | US FAERS | |
| 18 | Flatulence | FAERS: 42 | US FAERS | |
| 19 | Peripheral swelling | FAERS: 42 | US FAERS | |
| 20 | Malaise | FAERS: 41 | US FAERS | |
| 21 | Pain | FAERS: 36 | US FAERS | |
| 22 | Asthenia | FAERS: 33 | US FAERS | |
| 23 | Infection | FAERS: 31 | SIDER US FAERS | |
| 24 | Inappropriate schedule of product administration | FAERS: 27 | US FAERS | |
| 25 | Abdominal discomfort | FAERS: 26 | US FAERS | |
| 26 | Urinary tract infection | FAERS: 23 | US FAERS | |
| 27 | Gastrointestinal stoma complication | FAERS: 22 | SIDER US FAERS | |
| 28 | Injection site bruising | FAERS: 22 | US FAERS | |
| 29 | Injection site pain | FAERS: 22 | SIDER US FAERS | |
| 30 | Vascular device infection | FAERS: 22 | US FAERS | |
| 31 | Fluid overload | FAERS: 21 | US FAERS | |
| 32 | Injection site erythema | FAERS: 21 | SIDER US FAERS | |
| 33 | Pancreatitis | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 34 | Back Pain | FAERS: 18 | US FAERS | |
| 35 | Nasopharyngitis | FAERS: 18 | US FAERS | |
| 36 | Thrombosis | FAERS: 18 | US FAERS | |
| 37 | Swelling | FAERS: 17 | SIDER US FAERS | |
| 38 | Arthralgia | FAERS: 16 | SIDER US FAERS | |
| 39 | Blood magnesium decreased | FAERS: 16 | US FAERS | |
| 40 | Blood potassium decreased | FAERS: 16 | US FAERS | |
| 41 | Dizziness | FAERS: 16 | SIDER US FAERS | |
| 42 | Influenza | FAERS: 16 | SIDER US FAERS | |
| 43 | Nephrolithiasis | FAERS: 15 | US FAERS | |
| 44 | Amylase increased | FAERS: 14 | US FAERS | |
| 45 | Chest Pain | FAERS: 14 | SIDER US FAERS | |
| 46 | Complication associated with device | FAERS: 14 | US FAERS | |
| 47 | Adverse event | FAERS: 13 | US FAERS | |
| 48 | Chills | FAERS: 13 | US FAERS | |
| 49 | Lipase increased | FAERS: 13 | US FAERS | |
| 50 | Joint swelling | FAERS: 12 | US FAERS | |
| 51 | No adverse event | FAERS: 12 | US FAERS | |
| 52 | Unevaluable event | FAERS: 12 | US FAERS | |
| 53 | Cholelithiasis | FAERS: 11 | US FAERS | |
| 54 | Hypotension | FAERS: 11 | US FAERS | |
| 55 | Alopecia | FAERS: 10 | US FAERS | |
| 56 | Dyspepsia | FAERS: 10 | US FAERS | |
| 57 | Hernia | FAERS: 10 | US FAERS | |
| 58 | Hypersensitivity | FAERS: 10 | US FAERS | |
| 59 | Injection Site Reaction | FAERS: 10 | SIDER US FAERS | |
| 60 | Pruritus | FAERS: 10 | US FAERS | |
| 61 | Device related sepsis | FAERS: 8 | US FAERS | |
| 62 | Gastrointestinal stoma output increased | FAERS: 8 | US FAERS | |
| 63 | Malnutrition | FAERS: 8 | SIDER US FAERS | |
| 64 | Product dose omission | FAERS: 8 | US FAERS | |
| 65 | Stoma obstruction | FAERS: 8 | US FAERS | |
| 66 | Therapy cessation | FAERS: 8 | US FAERS | |
| 67 | Cerebrovascular accident | FAERS: 7 | US FAERS | |
| 68 | Clostridium difficile infection | FAERS: 7 | US FAERS | |
| 69 | Feeling abnormal | FAERS: 7 | US FAERS | |
| 70 | Gastrointestinal obstruction | FAERS: 7 | US FAERS | |
| 71 | Incorrect dose administered | FAERS: 7 | US FAERS | |
| 72 | Injection site mass | FAERS: 7 | US FAERS | |
| 73 | Urticaria | FAERS: 7 | US FAERS | |
| 74 | Arthritis | FAERS: 6 | US FAERS | |
| 75 | Blood creatine increased | FAERS: 6 | US FAERS | |
| 76 | Blood potassium increased | FAERS: 6 | US FAERS | |
| 77 | Bone pain | FAERS: 6 | US FAERS | |
| 78 | Bronchitis | FAERS: 6 | US FAERS | |
| 79 | Cholecystitis | FAERS: 6 | SIDER US FAERS | |
| 80 | Cystitis | FAERS: 6 | US FAERS | |
| 81 | Product quality issue | FAERS: 6 | US FAERS | |
| 82 | Septic Shock | FAERS: 6 | US FAERS | |
| 83 | Sinusitis | FAERS: 6 | US FAERS | |
| 84 | Stoma site pain | FAERS: 6 | US FAERS | |
| 85 | Anxiety | FAERS: 5 | SIDER US FAERS | |
| 86 | Bowel movement irregularity | FAERS: 5 | US FAERS | |
| 87 | Cellulitis | FAERS: 5 | US FAERS | |
| 88 | Colitis | FAERS: 5 | US FAERS | |
| 89 | Depressed mood | FAERS: 5 | US FAERS | |
| 90 | Electrolyte imbalance | FAERS: 5 | US FAERS | |
| 91 | Erythema | FAERS: 5 | US FAERS | |
| 92 | Injection site discomfort | FAERS: 5 | US FAERS | |
| 93 | Musculoskeletal Pain | FAERS: 5 | US FAERS | |
| 94 | Myocardial Infarction | FAERS: 5 | US FAERS | |
| 95 | Needle issue | FAERS: 5 | US FAERS | |
| 96 | Oropharyngeal pain | FAERS: 5 | US FAERS | |
| 97 | Ascites | FAERS: 4 | US FAERS | |
| 98 | Blood albumin decreased | FAERS: 4 | US FAERS | |
| 99 | Flushing | FAERS: 4 | SIDER US FAERS | |
| 100 | Hypophagia | FAERS: 4 | US FAERS | |
| 101 | Inflammation | FAERS: 4 | US FAERS | |
| 102 | Nonspecific reaction | FAERS: 4 | US FAERS | |
| 103 | Osteoporosis | FAERS: 4 | US FAERS | |
| 104 | Secretion discharge | FAERS: 4 | US FAERS | |
| 105 | Stoma site inflammation | FAERS: 4 | US FAERS | |
| 106 | Stoma site reaction | FAERS: 4 | US FAERS | |
| 107 | Abdominal Abscess | FAERS: 3 | US FAERS | |
| 108 | Abdominal adhesions | FAERS: 3 | US FAERS | |
| 109 | Acute kidney injury | FAERS: 3 | US FAERS | |
| 110 | Ageusia | FAERS: 3 | US FAERS | |
| 111 | Ammonia increased | FAERS: 3 | US FAERS | |
| 112 | Anorectal discomfort | FAERS: 3 | US FAERS | |
| 113 | Atrial Fibrillation | FAERS: 3 | US FAERS | |
| 114 | Blood creatinine increased | FAERS: 3 | US FAERS | |
| 115 | Blood glucose abnormal | FAERS: 3 | US FAERS | |
| 116 | Chest discomfort | FAERS: 3 | US FAERS | |
| 117 | Cholecystitis infective | FAERS: 3 | US FAERS | |
| 118 | Deafness | FAERS: 3 | US FAERS | |
| 119 | Device difficult to use | FAERS: 3 | US FAERS | |
| 120 | Device dislocation | FAERS: 3 | US FAERS | |
| 121 | Electrolyte depletion | FAERS: 3 | US FAERS | |
| 122 | Gastrointestinal motility disorder | FAERS: 3 | US FAERS | |
| 123 | Gastrointestinal wall thickening | FAERS: 3 | US FAERS | |
| 124 | Injection site nodule | FAERS: 3 | US FAERS | |
| 125 | Lethargy | FAERS: 3 | US FAERS | |
| 126 | Malabsorption | FAERS: 3 | US FAERS | |
| 127 | Night sweats | FAERS: 3 | SIDER US FAERS | |
| 128 | Osteomyelitis | FAERS: 3 | US FAERS | |
| 129 | Pancreatic Cyst | FAERS: 3 | US FAERS | |
| 130 | Parenteral Nutrition | FAERS: 3 | US FAERS | |
| 131 | Pericardial effusion | FAERS: 3 | US FAERS | |
| 132 | Post procedural complication | FAERS: 3 | US FAERS | |
| 133 | Procedural complication | FAERS: 3 | US FAERS | |
| 134 | Product use issue | FAERS: 3 | US FAERS | |
| 135 | Somnolence | FAERS: 3 | US FAERS | |
| 136 | Tremor | FAERS: 3 | US FAERS | |
| 137 | Urine output increased | FAERS: 3 | US FAERS | |
| 138 | Abdominal tenderness | FAERS: 2 | US FAERS | |
| 139 | Abscess | FAERS: 2 | US FAERS | |
| 140 | Anosmia | FAERS: 2 | US FAERS | |
| 141 | Anuria | FAERS: 2 | US FAERS | |
| 142 | Aphasia | FAERS: 2 | US FAERS | |
| 143 | Aphonia | FAERS: 2 | US FAERS | |
| 144 | Arthropathy | FAERS: 2 | US FAERS | |
| 145 | Asthma | FAERS: 2 | US FAERS | |
| 146 | Bedridden | FAERS: 2 | US FAERS | |
| 147 | Biliary dilatation | FAERS: 2 | US FAERS | |
| 148 | Blood alkaline phosphatase increased | FAERS: 2 | US FAERS | |
| 149 | Blood glucose decreased | FAERS: 2 | US FAERS | |
| 150 | Blood iron decreased | FAERS: 2 | US FAERS | |
| 151 | Blood phosphorus increased | FAERS: 2 | US FAERS | |
| 152 | Blood sodium decreased | FAERS: 2 | US FAERS | |
| 153 | Blood urine present | FAERS: 2 | US FAERS | |
| 154 | Cyst | FAERS: 2 | US FAERS | |
| 155 | Dementia | FAERS: 2 | US FAERS | |
| 156 | Device breakage | FAERS: 2 | US FAERS | |
| 157 | Device leakage | FAERS: 2 | US FAERS | |
| 158 | Disease Progression | FAERS: 2 | US FAERS | |
| 159 | Dry skin | FAERS: 2 | US FAERS | |
| 160 | Dysarthria | FAERS: 2 | US FAERS | |
| 161 | Dysphonia | FAERS: 2 | US FAERS | |
| 162 | Dysplasia | FAERS: 2 | US FAERS | |
| 163 | Dysuria | FAERS: 2 | US FAERS | |
| 164 | Epistaxis | FAERS: 2 | US FAERS | |
| 165 | Fibromyalgia | FAERS: 2 | US FAERS | |
| 166 | Gastrointestinal Pain | FAERS: 2 | SIDER US FAERS | |
| 167 | Gastrointestinal infection | FAERS: 2 | US FAERS | |
| 168 | Gastrointestinal inflammation | FAERS: 2 | US FAERS | |
| 169 | Gastrointestinal stoma output abnormal | FAERS: 2 | US FAERS | |
| 170 | Gastrointestinal stoma output decreased | FAERS: 2 | US FAERS | |
| 171 | Gout | FAERS: 2 | US FAERS | |
| 172 | Incorrect product storage | FAERS: 2 | US FAERS | |
| 173 | Infected fistula | FAERS: 2 | US FAERS | |
| 174 | Infusion site reaction | FAERS: 2 | US FAERS | |
| 175 | Injection site irritation | FAERS: 2 | US FAERS | |
| 176 | Injection site pruritus | FAERS: 2 | US FAERS | |
| 177 | Insurance issue | FAERS: 2 | US FAERS | |
| 178 | Intestinal Perforation | FAERS: 2 | US FAERS | |
| 179 | Lymphadenopathy | FAERS: 2 | US FAERS | |
| 180 | Memory impairment | FAERS: 2 | US FAERS | |
| 181 | Multiple allergies | FAERS: 2 | US FAERS | |
| 182 | Myalgia | FAERS: 2 | US FAERS | |
| 183 | Neck Pain | FAERS: 2 | US FAERS | |
| 184 | Pancreatic carcinoma | FAERS: 2 | US FAERS | |
| 185 | Patient dissatisfaction with treatment | FAERS: 2 | US FAERS | |
| 186 | Pharyngitis | FAERS: 2 | US FAERS | |
| 187 | Pneumothorax | FAERS: 2 | US FAERS | |
| 188 | Precancerous cells present | FAERS: 2 | US FAERS | |
| 189 | Pulmonary Embolism | FAERS: 2 | US FAERS | |
| 190 | Puncture site erythema | FAERS: 2 | US FAERS | |
| 191 | Regurgitation | FAERS: 2 | US FAERS | |
| 192 | Renal Cell Carcinoma | FAERS: 2 | US FAERS | |
| 193 | Renal mass | FAERS: 2 | US FAERS | |
| 194 | Skin Papilloma | FAERS: 2 | US FAERS | |
| 195 | Skin Wrinkling | FAERS: 2 | US FAERS | |
| 196 | Stoma Site Infection | FAERS: 2 | US FAERS | |
| 197 | Stoma site discharge | FAERS: 2 | US FAERS | |
| 198 | Stoma site extravasation | FAERS: 2 | US FAERS | |
| 199 | Stoma site hypergranulation | FAERS: 2 | US FAERS | |
| 200 | Stomatitis | FAERS: 2 | US FAERS | |
| 201 | Therapeutic response unexpected | FAERS: 2 | US FAERS | |
| 202 | Thirst | FAERS: 2 | US FAERS | |
| 203 | Thrombocytopenia | FAERS: 2 | US FAERS | |
| 204 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 205 | Abdominal mass | FAERS: 1 | US FAERS | |
| 206 | Abdominal rigidity | FAERS: 1 | US FAERS | |
| 207 | Absent bowel movement | FAERS: 1 | US FAERS | |
| 208 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 209 | Accidental overdose | FAERS: 1 | US FAERS | |
| 210 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 211 | Adenocarcinoma | FAERS: 1 | US FAERS | |
| 212 | Administration site bruise | FAERS: 1 | US FAERS | |
| 213 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 214 | Albumin globulin ratio increased | FAERS: 1 | US FAERS | |
| 215 | Amnesia | FAERS: 1 | US FAERS | |
| 216 | Amyloidosis | FAERS: 1 | US FAERS | |
| 217 | Anal Fistula | FAERS: 1 | US FAERS | |
| 218 | Anal abscess | FAERS: 1 | US FAERS | |
| 219 | Aneurysm | FAERS: 1 | US FAERS | |
| 220 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 221 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 222 | Aortic Aneurysm | FAERS: 1 | US FAERS | |
| 223 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 224 | Atypical pneumonia | FAERS: 1 | US FAERS | |
| 225 | Bacterial disease carrier | FAERS: 1 | US FAERS | |
| 226 | Bile Duct Stenosis | FAERS: 1 | US FAERS | |
| 227 | Biliary cancer metastatic | FAERS: 1 | US FAERS | |
| 228 | Blindness | FAERS: 1 | US FAERS | |
| 229 | Blood albumin abnormal | FAERS: 1 | US FAERS | |
| 230 | Blood count abnormal | FAERS: 1 | US FAERS | |
| 231 | Blood creatine | FAERS: 1 | US FAERS | |
| 232 | Blood creatinine abnormal | FAERS: 1 | US FAERS | |
| 233 | Blood creatinine decreased | FAERS: 1 | US FAERS | |
| 234 | Blood electrolytes abnormal | FAERS: 1 | US FAERS | |
| 235 | Blood lactate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 236 | Blood magnesium abnormal | FAERS: 1 | US FAERS | |
| 237 | Blood magnesium increased | FAERS: 1 | US FAERS | |
| 238 | Blood potassium abnormal | FAERS: 1 | US FAERS | |
| 239 | Blood urea nitrogen/creatinine ratio increased | FAERS: 1 | US FAERS | |
| 240 | Bronchospasm | FAERS: 1 | US FAERS | |
| 241 | Calciphylaxis | FAERS: 1 | US FAERS | |
| 242 | Carbohydrate antigen 19-9 increased | FAERS: 1 | US FAERS | |
| 243 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 244 | Cataract | FAERS: 1 | US FAERS | |
| 245 | Catheter site extravasation | FAERS: 1 | US FAERS | |
| 246 | Catheter site injury | FAERS: 1 | US FAERS | |
| 247 | Catheter site pain | FAERS: 1 | US FAERS | |
| 248 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 249 | Chromaturia | FAERS: 1 | US FAERS | |
| 250 | Chronic disease | FAERS: 1 | US FAERS | |
| 251 | Clubbing | FAERS: 1 | US FAERS | |
| 252 | Cold sweat | FAERS: 1 | US FAERS | |
| 253 | Compression fracture | FAERS: 1 | US FAERS | |
| 254 | Conjunctivitis | FAERS: 1 | US FAERS | |
| 255 | Conversion disorder | FAERS: 1 | US FAERS | |
| 256 | Corneal dystrophy | FAERS: 1 | US FAERS | |
| 257 | Cyst removal | FAERS: 1 | US FAERS | |
| 258 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 259 | Dermal absorption increased | FAERS: 1 | US FAERS | |
| 260 | Device Failure | FAERS: 1 | US FAERS | |
| 261 | Device occlusion | FAERS: 1 | US FAERS | |
| 262 | Device use issue | FAERS: 1 | US FAERS | |
| 263 | Dialysis related complication | FAERS: 1 | US FAERS | |
| 264 | Disorientation | FAERS: 1 | US FAERS | |
| 265 | Disturbance in sexual arousal | FAERS: 1 | US FAERS | |
| 266 | Drug Dependence | FAERS: 1 | US FAERS | |
| 267 | Drug administration error | FAERS: 1 | US FAERS | |
| 268 | Dumping Syndrome | FAERS: 1 | US FAERS | |
| 269 | Duodenitis | FAERS: 1 | US FAERS | |
| 270 | Eating disorder symptom | FAERS: 1 | US FAERS | |
| 271 | Embolism | FAERS: 1 | US FAERS | |
| 272 | Emergency Care | FAERS: 1 | US FAERS | |
| 273 | Environmental Exposure | FAERS: 1 | US FAERS | |
| 274 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 275 | Epilepsy | FAERS: 1 | US FAERS | |
| 276 | Eructation | FAERS: 1 | US FAERS | |
| 277 | Escherichia infection | FAERS: 1 | US FAERS | |
| 278 | Expired product administered | FAERS: 1 | US FAERS | |
| 279 | Extra dose administered | FAERS: 1 | US FAERS | |
| 280 | Eyelid margin crusting | FAERS: 1 | US FAERS | |
| 281 | Febrile infection | FAERS: 1 | US FAERS | |
| 282 | Feeding tube complication | FAERS: 1 | US FAERS | |
| 283 | Feeling Cold | FAERS: 1 | US FAERS | |
| 284 | Fluid imbalance | FAERS: 1 | US FAERS | |
| 285 | Frustration tolerance decreased | FAERS: 1 | US FAERS | |
| 286 | Gait inability | FAERS: 1 | US FAERS | |
| 287 | Gangrene | FAERS: 1 | US FAERS | |
| 288 | Gastric Dilatation | FAERS: 1 | US FAERS | |
| 289 | Gastric mucosa erythema | FAERS: 1 | US FAERS | |
| 290 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 291 | Gastritis | FAERS: 1 | US FAERS | |
| 292 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 293 | Gastrointestinal bacterial overgrowth | FAERS: 1 | US FAERS | |
| 294 | Gastrointestinal carcinoma | FAERS: 1 | US FAERS | |
| 295 | Gastrointestinal hypermotility | FAERS: 1 | US FAERS | |
| 296 | Gastrointestinal perforation | FAERS: 1 | US FAERS | |
| 297 | Gender reassignment therapy | FAERS: 1 | US FAERS | |
| 298 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 299 | Glaucoma | FAERS: 1 | US FAERS | |
| 300 | Graft infection | FAERS: 1 | US FAERS | |
| 301 | Hepatic Encephalopathy | FAERS: 1 | US FAERS | |
| 302 | Hepatic Infection | FAERS: 1 | US FAERS | |
| 303 | Hepatitis C | FAERS: 1 | US FAERS | |
| 304 | Hepatitis | FAERS: 1 | US FAERS | |
| 305 | Hernia pain | FAERS: 1 | US FAERS | |
| 306 | Hospice Care | FAERS: 1 | US FAERS | |
| 307 | Hydronephrosis | FAERS: 1 | US FAERS | |
| 308 | Hyperkeratosis | FAERS: 1 | US FAERS | |
| 309 | Hypersomnia | FAERS: 1 | US FAERS | |
| 310 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 311 | Immunosuppressant drug level increased | FAERS: 1 | US FAERS | |
| 312 | Inability to afford medication | FAERS: 1 | US FAERS | |
| 313 | Incision site complication | FAERS: 1 | US FAERS | |
| 314 | Infrequent bowel movements | FAERS: 1 | US FAERS | |
| 315 | Infusion site erythema | FAERS: 1 | US FAERS | |
| 316 | Infusion site pain | FAERS: 1 | US FAERS | |
| 317 | Injection related reaction | FAERS: 1 | US FAERS | |
| 318 | Injection site dryness | FAERS: 1 | US FAERS | |
| 319 | Injection site extravasation | FAERS: 1 | US FAERS | |
| 320 | Injection site hypersensitivity | FAERS: 1 | US FAERS | |
| 321 | Injection site infection | FAERS: 1 | US FAERS | |
| 322 | Injection site papule | FAERS: 1 | US FAERS | |
| 323 | Injection site scab | FAERS: 1 | US FAERS | |
| 324 | Injection site scar | FAERS: 1 | US FAERS | |
| 325 | Injection site urticaria | FAERS: 1 | US FAERS | |
| 326 | Injection site warmth | FAERS: 1 | US FAERS | |
| 327 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 328 | Intestinal infarction | FAERS: 1 | US FAERS | |
| 329 | Intestinal resection | FAERS: 1 | US FAERS | |
| 330 | Intestinal scarring | FAERS: 1 | US FAERS | |
| 331 | Intestinal villi atrophy | FAERS: 1 | US FAERS | |
| 332 | Iron deficiency | FAERS: 1 | US FAERS | |
| 333 | Large intestine perforation | FAERS: 1 | US FAERS | |
| 334 | Leukopenia | FAERS: 1 | US FAERS | |
| 335 | Ligament rupture | FAERS: 1 | US FAERS | |
| 336 | Limb discomfort | FAERS: 1 | US FAERS | |
| 337 | Limb injury | FAERS: 1 | US FAERS | |
| 338 | Limb mass | FAERS: 1 | US FAERS | |
| 339 | Limb operation | FAERS: 1 | US FAERS | |
| 340 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 341 | Lyme Disease | FAERS: 1 | US FAERS | |
| 342 | Lymphocyte count decreased | FAERS: 1 | US FAERS | |
| 343 | Macular degeneration | FAERS: 1 | US FAERS | |
| 344 | Magnesium Deficiency | FAERS: 1 | US FAERS | |
| 345 | Mastectomy | FAERS: 1 | US FAERS | |
| 346 | Medical device complication | FAERS: 1 | US FAERS | |
| 347 | Medication Error | FAERS: 1 | US FAERS | |
| 348 | Megacolon | FAERS: 1 | US FAERS | |
| 349 | Meniscus injury | FAERS: 1 | US FAERS | |
| 350 | Menorrhagia | FAERS: 1 | US FAERS | |
| 351 | Mental status changes | FAERS: 1 | US FAERS | |
| 352 | Myasthenic Syndrome | FAERS: 1 | US FAERS | |
| 353 | Nodule | FAERS: 1 | US FAERS | |
| 354 | Nutritional condition abnormal | FAERS: 1 | US FAERS | |
| 355 | Overdose | FAERS: 1 | US FAERS | |
| 356 | Pain of skin | FAERS: 1 | US FAERS | |
| 357 | Pallor | FAERS: 1 | US FAERS | |
| 358 | Palpitations | FAERS: 1 | US FAERS | |
| 359 | Pancreatic duct dilatation | FAERS: 1 | US FAERS | |
| 360 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 361 | Pneumatosis intestinalis | FAERS: 1 | US FAERS | |
| 362 | Portal Hypertension | FAERS: 1 | US FAERS | |
| 363 | Post procedural discomfort | FAERS: 1 | US FAERS | |
| 364 | Post procedural infection | FAERS: 1 | US FAERS | |
| 365 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 366 | Prealbumin | FAERS: 1 | US FAERS | |
| 367 | Precancerous skin lesion | FAERS: 1 | US FAERS | |
| 368 | Prescribed underdose | FAERS: 1 | US FAERS | |
| 369 | Proctitis | FAERS: 1 | US FAERS | |
| 370 | Product administration error | FAERS: 1 | US FAERS | |
| 371 | Product availability issue | FAERS: 1 | US FAERS | |
| 372 | Product container issue | FAERS: 1 | US FAERS | |
| 373 | Product label issue | FAERS: 1 | US FAERS | |
| 374 | Product packaging issue | FAERS: 1 | US FAERS | |
| 375 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 376 | Product physical consistency issue | FAERS: 1 | US FAERS | |
| 377 | Progressive multiple sclerosis | FAERS: 1 | US FAERS | |
| 378 | Protein Deficiency | FAERS: 1 | US FAERS | |
| 379 | Protein total decreased | FAERS: 1 | US FAERS | |
| 380 | Psychiatric evaluation | FAERS: 1 | US FAERS | |
| 381 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 382 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 383 | Pupil dilation procedure | FAERS: 1 | US FAERS | |
| 384 | Radiation injury | FAERS: 1 | US FAERS | |
| 385 | Rectal discharge | FAERS: 1 | US FAERS | |
| 386 | Rectal fissure | FAERS: 1 | US FAERS | |
| 387 | Red man syndrome | FAERS: 1 | US FAERS | |
| 388 | Rehabilitation therapy | FAERS: 1 | US FAERS | |
| 389 | Renal pain | FAERS: 1 | US FAERS | |
| 390 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 391 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 392 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 393 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 394 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 395 | Sciatica | FAERS: 1 | US FAERS | |
| 396 | Seroma | FAERS: 1 | US FAERS | |
| 397 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 398 | Skin irritation | FAERS: 1 | US FAERS | |
| 399 | Skin lesion | FAERS: 1 | US FAERS | |
| 400 | Skin tightness | FAERS: 1 | US FAERS | |
| 401 | Slow speech | FAERS: 1 | US FAERS | |
| 402 | Sneezing | FAERS: 1 | US FAERS | |
| 403 | Spinal cord infection | FAERS: 1 | US FAERS | |
| 404 | Squamous cell carcinoma of skin | FAERS: 1 | US FAERS | |
| 405 | Squamous cell carcinoma | FAERS: 1 | US FAERS | |
| 406 | Starvation | FAERS: 1 | US FAERS | |
| 407 | Stoma site discomfort | FAERS: 1 | US FAERS | |
| 408 | Stoma site erythema | FAERS: 1 | US FAERS | |
| 409 | Stoma site irritation | FAERS: 1 | US FAERS | |
| 410 | Stomal hernia | FAERS: 1 | US FAERS | |
| 411 | Stress | FAERS: 1 | US FAERS | |
| 412 | Syncope | FAERS: 1 | SIDER US FAERS | |
| 413 | Tachycardia | FAERS: 1 | US FAERS | |
| 414 | Therapeutic product effect decreased | FAERS: 1 | US FAERS | |
| 415 | Therapeutic product effect incomplete | FAERS: 1 | US FAERS | |
| 416 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 417 | Thirst decreased | FAERS: 1 | US FAERS | |
| 418 | Throat irritation | FAERS: 1 | US FAERS | |
| 419 | Thrombosis in device | FAERS: 1 | US FAERS | |
| 420 | Thymoma | FAERS: 1 | US FAERS | |
| 421 | Tinnitus | FAERS: 1 | US FAERS | |
| 422 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 423 | Tracheomalacia | FAERS: 1 | US FAERS | |
| 424 | Ulcer | FAERS: 1 | US FAERS | |
| 425 | Underweight | FAERS: 1 | US FAERS | |
| 426 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 427 | Upper-airway cough syndrome | FAERS: 1 | US FAERS | |
| 428 | Urinary Retention | FAERS: 1 | US FAERS | |
| 429 | Urinary tract obstruction | FAERS: 1 | US FAERS | |
| 430 | Vaginal lesion | FAERS: 1 | US FAERS | |
| 431 | Visual Impairment | FAERS: 1 | US FAERS | |
| 432 | Vocal Cord Paralysis | FAERS: 1 | US FAERS | |
| 433 | Vulvovaginal swelling | FAERS: 1 | US FAERS | |
| 434 | Wrong device used | FAERS: 1 | US FAERS | |
| 435 | Wrong dose | FAERS: 1 | US FAERS | |
| 436 | Cholestasis | SIDER | ||
| 437 | Infestation | SIDER | ||
| 438 | Musculoskeletal discomfort | SIDER | ||
| 439 | Neutropenia | Canada Vigilance: 1 | Canada Vigilance | |
| 440 | Pericarditis | Canada Vigilance: 1 | Canada Vigilance | |
| 441 | Renal Colic | SIDER | ||
| 442 | Shock | SIDER | ||
| 443 | Vasculitis | Canada Vigilance: 1 | Canada Vigilance | |
| 444 | nervous system disorder | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.