salmon calcitonin
(BBBFJLBPOGFECG-UHFFFAOYSA-N)
Structure
- SMILES
- NCCCCC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N1CCCC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NCC(=O)NC(C(=O)NCC(=O)NC(C(=O)N1CCCC1C(=O)N)C(O)C)CO)C(O)C)CC(=O)N)C(O)C)CCCNC(=N)N)Cc1ccc(cc1)O)C(O)C)CCC(=O)N)CC(C)C)NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)CNC(=O)C(NC(=O)C(C(C)C)NC(=O)C1CSSCC(N)C(=O)NC(CO)C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N1)C(O)C)CO)CC(C)C)CC(=O)N)CC(C)C)CCCCN)CC(C)C)CO)CCC(=O)N)CCC(=O)O)CC(C)C)Cc1[nH]cnc1
- Molecular Formula:
- C145H240N44O48S2
- Molecular Weight:
- 3431.850
- Log P:
- -3.8963
- Hydrogen Bond Acceptor:
- 93
- Hydrogen Bond Donor:
- 52
- TPSA:
- 1558.81
- CAS Number(s):
- N/A
Synonym(s)
1.
salmon calcitonin
2.
Calcihexal
3.
Calcimar
4.
Forcaltonin
5.
Fortical
6.
Miacalcic
7.
Miacalcin
8.
calcitonin salmon
9.
recombinant salmon calcitonin
10.
salcatonin
11.
salmon calcitonin (1-32)
12.
synthetic salmon calcitonin
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Nausea | FAERS: 36 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 2 | Vomiting | FAERS: 29 | US FAERS | |
| 3 | Dizziness | FAERS: 27 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 4 | Drug ineffective | FAERS: 25 Canada Vigilance: 20 | Canada Vigilance US FAERS | |
| 5 | Arthralgia | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 6 | Back Pain | FAERS: 22 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 7 | Epistaxis | FAERS: 21 | US FAERS | |
| 8 | Pain | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 9 | Headache | FAERS: 16 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 10 | Nasal discomfort | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 11 | Flushing | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 12 | Palpitations | FAERS: 15 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 13 | Syncope | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 14 | Chills | FAERS: 11 | US FAERS | |
| 15 | Fatigue | FAERS: 11 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 16 | Abdominal Pain | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 17 | Chest discomfort | FAERS: 10 | US FAERS | |
| 18 | Asthenia | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 19 | Osteoporosis | FAERS: 9 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 20 | Bone pain | FAERS: 8 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 21 | Erythema | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 22 | Feeling abnormal | FAERS: 8 | US FAERS | |
| 23 | Myalgia | FAERS: 8 | US FAERS | |
| 24 | Sneezing | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 25 | Bone density decreased | FAERS: 7 | US FAERS | |
| 26 | Fracture | FAERS: 7 | US FAERS | |
| 27 | Hypersensitivity | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 28 | Malaise | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 29 | Pharmaceutical product complaint | FAERS: 7 | US FAERS | |
| 30 | Tachycardia | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 31 | Burning sensation | FAERS: 6 | US FAERS | |
| 32 | Electrocardiogram abnormal | FAERS: 6 | US FAERS | |
| 33 | Myocardial Infarction | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 34 | Thrombosis | FAERS: 6 | US FAERS | |
| 35 | Tremor | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 36 | Anaphylactic shock | FAERS: 5 | US FAERS | |
| 37 | Bronchitis | FAERS: 5 | US FAERS | |
| 38 | Chest Pain | FAERS: 5 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 39 | Eye pain | FAERS: 5 | US FAERS | |
| 40 | Shock | FAERS: 5 | US FAERS | |
| 41 | Vertigo | FAERS: 5 | US FAERS | |
| 42 | Anosmia | FAERS: 4 | US FAERS | |
| 43 | Cardiac Arrest | FAERS: 4 | US FAERS | |
| 44 | Cold sweat | FAERS: 4 | US FAERS | |
| 45 | Disease Progression | FAERS: 4 | US FAERS | |
| 46 | Incorrect route of drug administration | FAERS: 4 | US FAERS | |
| 47 | Pallor | FAERS: 4 | US FAERS | |
| 48 | Pruritus | FAERS: 4 | US FAERS | |
| 49 | Rash erythematous | FAERS: 4 | US FAERS | |
| 50 | Spinal column injury | FAERS: 4 | US FAERS | |
| 51 | Urticaria | FAERS: 4 | US FAERS | |
| 52 | Angle Closure Glaucoma | FAERS: 3 | US FAERS | |
| 53 | Ankle Fracture | FAERS: 3 | US FAERS | |
| 54 | Anxiety | FAERS: 3 | US FAERS | |
| 55 | Blood sodium decreased | FAERS: 3 | US FAERS | |
| 56 | Compression fracture | FAERS: 3 | US FAERS | |
| 57 | Deafness | FAERS: 3 | US FAERS | |
| 58 | Device Failure | FAERS: 3 | US FAERS | |
| 59 | Drug exposure during pregnancy | FAERS: 3 | US FAERS | |
| 60 | Glaucoma | FAERS: 3 | US FAERS | |
| 61 | Hepatitis C | FAERS: 3 | US FAERS | |
| 62 | Hypotension | FAERS: 3 | US FAERS | |
| 63 | Intestinal resection | FAERS: 3 | US FAERS | |
| 64 | Joint injury | FAERS: 3 | US FAERS | |
| 65 | Joint swelling | FAERS: 3 | US FAERS | |
| 66 | Medication Error | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 67 | Mucosal Infection | FAERS: 3 | US FAERS | |
| 68 | Oropharyngeal pain | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 69 | Osteopenia | FAERS: 3 | US FAERS | |
| 70 | Pneumonia | FAERS: 3 | US FAERS | |
| 71 | Pneumonitis | FAERS: 3 | US FAERS | |
| 72 | Polyuria | FAERS: 3 | US FAERS | |
| 73 | Retinal Detachment | FAERS: 3 | US FAERS | |
| 74 | Rhinitis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 75 | Sinus headache | FAERS: 3 | US FAERS | |
| 76 | Stomatitis | FAERS: 3 | US FAERS | |
| 77 | Throat irritation | FAERS: 3 | US FAERS | |
| 78 | Visual Impairment | FAERS: 3 | US FAERS | |
| 79 | Weight decreased | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 80 | Ageusia | FAERS: 2 | US FAERS | |
| 81 | Alanine Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 82 | Alopecia | FAERS: 2 | US FAERS | |
| 83 | Angioplasty | FAERS: 2 | US FAERS | |
| 84 | Aphagia | FAERS: 2 | US FAERS | |
| 85 | Arthritis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 86 | Aspartate Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 87 | Asthma | FAERS: 2 | US FAERS | |
| 88 | Atrial Fibrillation | FAERS: 2 | US FAERS | |
| 89 | Atrial Flutter | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 90 | Blood alkaline phosphatase increased | FAERS: 2 | US FAERS | |
| 91 | Blood amylase decreased | FAERS: 2 | US FAERS | |
| 92 | Blood creatine phosphokinase MB | FAERS: 2 | US FAERS | |
| 93 | Blood creatine phosphokinase increased | FAERS: 2 | US FAERS | |
| 94 | Calcinosis | FAERS: 2 | US FAERS | |
| 95 | Cerebral artery occlusion | FAERS: 2 | US FAERS | |
| 96 | Cheilitis | FAERS: 2 | US FAERS | |
| 97 | Choking sensation | FAERS: 2 | US FAERS | |
| 98 | Dyspepsia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 99 | Dysphonia | FAERS: 2 | US FAERS | |
| 100 | Enchondroma | FAERS: 2 | US FAERS | |
| 101 | Erythema Multiforme | FAERS: 2 | US FAERS | |
| 102 | Gastrointestinal Pain | FAERS: 2 | US FAERS | |
| 103 | Hepatitis C RNA positive | FAERS: 2 | US FAERS | |
| 104 | Infection | FAERS: 2 | US FAERS | |
| 105 | Injection site pain | FAERS: 2 | US FAERS | |
| 106 | Intervertebral Disc Degeneration | FAERS: 2 | US FAERS | |
| 107 | Intervertebral disc compression | FAERS: 2 | US FAERS | |
| 108 | Lip exfoliation | FAERS: 2 | US FAERS | |
| 109 | Lip swelling | FAERS: 2 | US FAERS | |
| 110 | Malabsorption | FAERS: 2 | US FAERS | |
| 111 | Metaplasia | FAERS: 2 | US FAERS | |
| 112 | Nephrolithiasis | FAERS: 2 | US FAERS | |
| 113 | Rheumatoid Arthritis | FAERS: 2 | US FAERS | |
| 114 | Shoulder Dystocia | FAERS: 2 | US FAERS | |
| 115 | Sinusitis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 116 | Spondylitis | FAERS: 2 | US FAERS | |
| 117 | Thirst | FAERS: 2 | US FAERS | |
| 118 | Ultrasound scan abnormal | FAERS: 2 | US FAERS | |
| 119 | Urinary tract infection | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 120 | Vascular calcification | FAERS: 2 | US FAERS | |
| 121 | Visual disturbance | FAERS: 2 | US FAERS | |
| 122 | Abasia | FAERS: 1 | US FAERS | |
| 123 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 124 | Accidental overdose | FAERS: 1 | US FAERS | |
| 125 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 126 | Adverse event | FAERS: 1 | US FAERS | |
| 127 | Agitation | FAERS: 1 | US FAERS | |
| 128 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 129 | Amnesia | FAERS: 1 | US FAERS | |
| 130 | Application site irritation | FAERS: 1 | US FAERS | |
| 131 | Basal cell carcinoma | FAERS: 1 | US FAERS | |
| 132 | Biopsy | FAERS: 1 | US FAERS | |
| 133 | Blepharitis | FAERS: 1 | US FAERS | |
| 134 | Blindness | FAERS: 1 | US FAERS | |
| 135 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 136 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 137 | Blood parathyroid hormone decreased | FAERS: 1 | US FAERS | |
| 138 | Bone graft removal | FAERS: 1 | US FAERS | |
| 139 | Breast cancer recurrent | FAERS: 1 | US FAERS | |
| 140 | Bronchospasm | FAERS: 1 | US FAERS | |
| 141 | Carotid artery occlusion | FAERS: 1 | US FAERS | |
| 142 | Cataract operation | FAERS: 1 | US FAERS | |
| 143 | Cataract | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 144 | Cerebrovascular accident | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 145 | Colonoscopy abnormal | FAERS: 1 | US FAERS | |
| 146 | Complex partial seizures | FAERS: 1 | US FAERS | |
| 147 | Cystitis | FAERS: 1 | US FAERS | |
| 148 | Cyst | FAERS: 1 | US FAERS | |
| 149 | Deafness Neurosensory | FAERS: 1 | US FAERS | |
| 150 | Dehydration | FAERS: 1 | US FAERS | |
| 151 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 152 | Device related infection | FAERS: 1 | US FAERS | |
| 153 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 154 | Discomfort | FAERS: 1 | US FAERS | |
| 155 | Diverticulitis | FAERS: 1 | US FAERS | |
| 156 | Drug administration error | FAERS: 1 | US FAERS | |
| 157 | Drug label confusion | FAERS: 1 | US FAERS | |
| 158 | Dysgeusia | FAERS: 1 | US FAERS | |
| 159 | Ear discomfort | FAERS: 1 | US FAERS | |
| 160 | Embolic stroke | FAERS: 1 | US FAERS | |
| 161 | Eructation | FAERS: 1 | US FAERS | |
| 162 | Euphoric mood | FAERS: 1 | US FAERS | |
| 163 | Eye Infection | FAERS: 1 | US FAERS | |
| 164 | Facial Pain | FAERS: 1 | US FAERS | |
| 165 | Facial asymmetry | FAERS: 1 | US FAERS | |
| 166 | Feeling Cold | FAERS: 1 | US FAERS | |
| 167 | Flatulence | FAERS: 1 | US FAERS | |
| 168 | Gastrointestinal carcinoma | FAERS: 1 | US FAERS | |
| 169 | Hemiplegia | FAERS: 1 | US FAERS | |
| 170 | Hypercalciuria | FAERS: 1 | US FAERS | |
| 171 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 172 | Influenza | FAERS: 1 | US FAERS | |
| 173 | Injection site calcification | FAERS: 1 | US FAERS | |
| 174 | Injection site inflammation | FAERS: 1 | US FAERS | |
| 175 | Lichen Planus | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 176 | Limb discomfort | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 177 | Limb injury | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 178 | Lymphoma | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 179 | Malignant melanoma in situ | FAERS: 1 | US FAERS | |
| 180 | Mastitis | FAERS: 1 | US FAERS | |
| 181 | Medical device complication | FAERS: 1 | US FAERS | |
| 182 | Memory impairment | FAERS: 1 | US FAERS | |
| 183 | Mental impairment | FAERS: 1 | US FAERS | |
| 184 | Migraine with Aura | FAERS: 1 | US FAERS | |
| 185 | Monoparesis | FAERS: 1 | US FAERS | |
| 186 | Muscle tightness | FAERS: 1 | US FAERS | |
| 187 | Musculoskeletal discomfort | FAERS: 1 | US FAERS | |
| 188 | Myositis | FAERS: 1 | US FAERS | |
| 189 | Nasal mucosal disorder | FAERS: 1 | US FAERS | |
| 190 | Nasal pruritus | FAERS: 1 | US FAERS | |
| 191 | Nervousness | FAERS: 1 | US FAERS | |
| 192 | No adverse event | FAERS: 1 | US FAERS | |
| 193 | Nocturia | FAERS: 1 | US FAERS | |
| 194 | Occult blood positive | FAERS: 1 | US FAERS | |
| 195 | Onychoclasis | FAERS: 1 | US FAERS | |
| 196 | Oropharyngeal swelling | FAERS: 1 | US FAERS | |
| 197 | Osteolysis | FAERS: 1 | US FAERS | |
| 198 | Osteosarcoma | FAERS: 1 | US FAERS | |
| 199 | Parathyroidectomy | FAERS: 1 | US FAERS | |
| 200 | Pathological fracture | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 201 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 202 | Pharyngolaryngeal Pain | FAERS: 1 | US FAERS | |
| 203 | Phlebitis | FAERS: 1 | US FAERS | |
| 204 | Physical disability | FAERS: 1 | US FAERS | |
| 205 | Plantar erythema | FAERS: 1 | US FAERS | |
| 206 | Polymyalgia Rheumatica | FAERS: 1 | US FAERS | |
| 207 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 208 | Pre-Eclampsia | FAERS: 1 | US FAERS | |
| 209 | Product container seal issue | FAERS: 1 | US FAERS | |
| 210 | Product formulation issue | FAERS: 1 | US FAERS | |
| 211 | Product label issue | FAERS: 1 | US FAERS | |
| 212 | Product substitution issue | FAERS: 1 | US FAERS | |
| 213 | Product use issue | FAERS: 1 | US FAERS | |
| 214 | Proteinuria | FAERS: 1 | US FAERS | |
| 215 | Rectal tenesmus | FAERS: 1 | US FAERS | |
| 216 | Renal pain | FAERS: 1 | US FAERS | |
| 217 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 218 | Retinal vascular occlusion | FAERS: 1 | US FAERS | |
| 219 | Rhinalgia | FAERS: 1 | US FAERS | |
| 220 | Scab | FAERS: 1 | US FAERS | |
| 221 | Secretion discharge | FAERS: 1 | US FAERS | |
| 222 | Sepsis | FAERS: 1 | US FAERS | |
| 223 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 224 | Sinus pain | FAERS: 1 | US FAERS | |
| 225 | Sjogren's Syndrome | FAERS: 1 | US FAERS | |
| 226 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 227 | Skin neoplasm excision | FAERS: 1 | US FAERS | |
| 228 | Skin reaction | FAERS: 1 | US FAERS | |
| 229 | Splenectomy | FAERS: 1 | US FAERS | |
| 230 | Splenomegaly | FAERS: 1 | US FAERS | |
| 231 | Squamous cell carcinoma | FAERS: 1 | US FAERS | |
| 232 | Swelling | FAERS: 1 | US FAERS | |
| 233 | Tachyphylaxis | FAERS: 1 | US FAERS | |
| 234 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 235 | Therapeutic procedure | FAERS: 1 | US FAERS | |
| 236 | Thermal burn | FAERS: 1 | US FAERS | |
| 237 | Thyroid Neoplasm | FAERS: 1 | US FAERS | |
| 238 | Tooth Erosion | FAERS: 1 | US FAERS | |
| 239 | Tooth Resorption | FAERS: 1 | US FAERS | |
| 240 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 241 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 242 | Urinary Retention | FAERS: 1 | US FAERS | |
| 243 | Urine amylase increased | FAERS: 1 | US FAERS | |
| 244 | Urine output increased | FAERS: 1 | US FAERS | |
| 245 | Vertebroplasty | FAERS: 1 | US FAERS | |
| 246 | Viral pericarditis | FAERS: 1 | US FAERS | |
| 247 | Wheezing | FAERS: 1 | US FAERS | |
| 248 | treatment failure | FAERS: 1 | US FAERS | |
| 249 | Corneal Opacity | Canada Vigilance: 1 | Canada Vigilance | |
| 250 | Diplopia | Canada Vigilance: 1 | Canada Vigilance | |
| 251 | Facial paralysis | Canada Vigilance: 1 | Canada Vigilance | |
| 252 | Hypomania | Canada Vigilance: 1 | Canada Vigilance | |
| 253 | Injection Site Reaction | Canada Vigilance: 1 | Canada Vigilance | |
| 254 | Musculoskeletal Pain | Canada Vigilance: 1 | Canada Vigilance | |
| 255 | Neck Pain | Canada Vigilance: 1 | Canada Vigilance | |
| 256 | Osteitis Deformans | 1933580 | CTD | |
| 257 | Pharyngeal swelling | Canada Vigilance: 1 | Canada Vigilance | |
| 258 | Quality of life decreased | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.