Propranolol
(ZMRUPTIKESYGQW-UHFFFAOYSA-N)
Structure
- SMILES
- OC(COc1cccc2c1cccc2)CNC(C)C.Cl
- Molecular Formula:
- C16H22ClNO2
- Molecular Weight:
- 295.804
- Log P:
- 3.7704
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 3
- TPSA:
- 41.49
- CAS Number(s):
- 318-98-9; 3506-09-0
Synonym(s)
1.
Propranolol
2.
Dexpropranolol
3.
AY-20694
4.
Anaprilin
5.
Anapriline
6.
Avlocardyl
7.
Betadren
8.
Dociton
9.
Inderal
10.
Obsidan
11.
Obzidan
12.
Propanolol
13.
Propranolol Hydrochloride
14.
Rexigen
15.
AY 20694
16.
AY20694
17.
Hydrochloride, Propranolol
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug administered to patient of inappropriate age | FAERS: 64 | US FAERS | |
| 2 | Drug ineffective | FAERS: 46 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 3 | Hypotension | FAERS: 45 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 4 | Toxicity to various agents | FAERS: 41 | US FAERS | |
| 5 | Bradycardia | FAERS: 38 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 6 | Overdose | FAERS: 35 | US FAERS | |
| 7 | Vomiting | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 8 | Dizziness | FAERS: 28 | US FAERS | |
| 9 | Myopathy | FAERS: 24 | US FAERS | |
| 10 | Completed Suicide | FAERS: 23 | US FAERS | |
| 11 | Nausea | FAERS: 21 | US FAERS | |
| 12 | Somnolence | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 13 | Palpitations | FAERS: 16 | US FAERS | |
| 14 | Headache | FAERS: 15 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 15 | Product use issue | FAERS: 15 | US FAERS | |
| 16 | Tachycardia | FAERS: 15 | US FAERS | |
| 17 | Unresponsive to stimuli | FAERS: 15 | US FAERS | |
| 18 | Agitation | FAERS: 14 | US FAERS | |
| 19 | Cyanosis | FAERS: 14 | US FAERS | |
| 20 | Lethargy | FAERS: 14 | US FAERS | |
| 21 | Atrial Fibrillation | FAERS: 12 | US FAERS | |
| 22 | Cardiac Arrest | FAERS: 12 | US FAERS | |
| 23 | Depressed Level of Consciousness | FAERS: 12 | US FAERS | |
| 24 | Feeling abnormal | FAERS: 12 | US FAERS | |
| 25 | Malaise | FAERS: 12 | US FAERS | |
| 26 | Rhabdomyolysis | FAERS: 12 | US FAERS | |
| 27 | Asthenia | FAERS: 11 | US FAERS | |
| 28 | Fatigue | FAERS: 11 | US FAERS | |
| 29 | Poor quality sleep | FAERS: 11 | US FAERS | |
| 30 | Weight decreased | FAERS: 11 | US FAERS | |
| 31 | Accidental overdose | FAERS: 10 | US FAERS | |
| 32 | Bronchial Hyperreactivity | FAERS: 10 | US FAERS | |
| 33 | Constipation | FAERS: 10 | US FAERS | |
| 34 | Medication Error | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 35 | Product use in unapproved indication | FAERS: 10 | US FAERS | |
| 36 | Tremor | FAERS: 10 | US FAERS | |
| 37 | Abdominal discomfort | FAERS: 9 | US FAERS | |
| 38 | Chest Pain | FAERS: 9 | US FAERS | |
| 39 | Product substitution issue | FAERS: 9 | US FAERS | |
| 40 | Pruritus | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 41 | Hypersensitivity | FAERS: 8 | US FAERS | |
| 42 | Nasopharyngitis | FAERS: 8 | US FAERS | |
| 43 | Wheezing | FAERS: 8 | US FAERS | |
| 44 | Drug dose omission | FAERS: 7 | US FAERS | |
| 45 | Drug toxicity | FAERS: 7 | US FAERS | |
| 46 | Pain | FAERS: 7 | US FAERS | |
| 47 | Pallor | FAERS: 7 | US FAERS | |
| 48 | Respiratory arrest | FAERS: 7 | US FAERS | |
| 49 | Restlessness | FAERS: 7 | US FAERS | |
| 50 | Shock | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 51 | Abdominal Pain | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 52 | Asthma | FAERS: 6 | US FAERS | |
| 53 | Crying | FAERS: 6 | US FAERS | |
| 54 | Disorientation | FAERS: 6 | US FAERS | |
| 55 | Inappropriate schedule of drug administration | FAERS: 6 | US FAERS | |
| 56 | Incorrect drug administration duration | FAERS: 6 | US FAERS | |
| 57 | Mydriasis | FAERS: 6 | US FAERS | |
| 58 | Sinus bradycardia | FAERS: 6 | US FAERS | |
| 59 | Therapeutic response unexpected with drug substitution | FAERS: 6 | US FAERS | |
| 60 | Alopecia | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 61 | Arthralgia | FAERS: 5 | US FAERS | |
| 62 | Blood glucose decreased | FAERS: 5 | US FAERS | |
| 63 | Cardiotoxicity | FAERS: 5 | US FAERS | |
| 64 | Cerebral disorder | FAERS: 5 | US FAERS | |
| 65 | Chest discomfort | FAERS: 5 | US FAERS | |
| 66 | Cold sweat | FAERS: 5 | US FAERS | |
| 67 | Drug exposure during pregnancy | FAERS: 5 | US FAERS | |
| 68 | Drug titration error | FAERS: 5 | US FAERS | |
| 69 | Dyspepsia | FAERS: 5 | US FAERS | |
| 70 | Erythema | FAERS: 5 | US FAERS | |
| 71 | Flushing | FAERS: 5 | US FAERS | |
| 72 | Gastroenteritis | FAERS: 5 | US FAERS | |
| 73 | General physical health deterioration | FAERS: 5 | US FAERS | |
| 74 | Hypophagia | FAERS: 5 | US FAERS | |
| 75 | Product administered to patient of inappropriate age | FAERS: 5 | US FAERS | |
| 76 | Suicide attempt | FAERS: 5 | US FAERS | |
| 77 | Unevaluable event | FAERS: 5 | US FAERS | |
| 78 | Urticaria | FAERS: 5 | US FAERS | |
| 79 | Anxiety | FAERS: 4 | US FAERS | |
| 80 | Blood glucose increased | FAERS: 4 | US FAERS | |
| 81 | Blood lactate dehydrogenase increased | FAERS: 4 | US FAERS | |
| 82 | Cardiac Flutter | FAERS: 4 | US FAERS | |
| 83 | Dehydration | FAERS: 4 | US FAERS | |
| 84 | Hunger | FAERS: 4 | US FAERS | |
| 85 | Incorrect dose administered | FAERS: 4 | US FAERS | |
| 86 | Intentional product misuse | FAERS: 4 | US FAERS | |
| 87 | Intentional product use issue | FAERS: 4 | US FAERS | |
| 88 | Memory impairment | FAERS: 4 | US FAERS | |
| 89 | Pharmaceutical product complaint | FAERS: 4 | US FAERS | |
| 90 | Pneumatosis intestinalis | FAERS: 4 | US FAERS | |
| 91 | Presyncope | FAERS: 4 | US FAERS | |
| 92 | Accelerated Idioventricular Rhythm | FAERS: 3 | US FAERS | |
| 93 | Accidental exposure to product | FAERS: 3 | US FAERS | |
| 94 | Atrioventricular Block | FAERS: 3 | US FAERS | |
| 95 | Blood ketone body increased | FAERS: 3 | US FAERS | |
| 96 | Blood pressure fluctuation | FAERS: 3 | US FAERS | |
| 97 | Bronchiolitis | FAERS: 3 | US FAERS | |
| 98 | Coma scale abnormal | FAERS: 3 | US FAERS | |
| 99 | Deafness | FAERS: 3 | US FAERS | |
| 100 | Depressed mood | FAERS: 3 | US FAERS | |
| 101 | Drug withdrawal syndrome | FAERS: 3 | US FAERS | |
| 102 | Ejection Fraction Decreased | FAERS: 3 | US FAERS | |
| 103 | Hyperventilation | FAERS: 3 | US FAERS | |
| 104 | Infection | FAERS: 3 | US FAERS | |
| 105 | Maternal exposure during pregnancy | FAERS: 3 | US FAERS | |
| 106 | Mental status changes | FAERS: 3 | US FAERS | |
| 107 | Metabolic acidosis | FAERS: 3 | US FAERS | |
| 108 | Middle insomnia | FAERS: 3 | US FAERS | |
| 109 | Product taste abnormal | FAERS: 3 | US FAERS | |
| 110 | Pulmonary congestion | FAERS: 3 | US FAERS | |
| 111 | Stress | FAERS: 3 | US FAERS | |
| 112 | Therapy non-responder | FAERS: 3 | US FAERS | |
| 113 | Accidental exposure | FAERS: 2 | US FAERS | |
| 114 | Adrenal mass | FAERS: 2 | US FAERS | |
| 115 | Amnesia | FAERS: 2 | US FAERS | |
| 116 | Anuria | FAERS: 2 | US FAERS | |
| 117 | Apathy | FAERS: 2 | US FAERS | |
| 118 | Ascites | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 119 | Bedridden | FAERS: 2 | US FAERS | |
| 120 | Blood cholesterol increased | FAERS: 2 | US FAERS | |
| 121 | Blood creatine phosphokinase increased | FAERS: 2 | US FAERS | |
| 122 | Blood sodium decreased | FAERS: 2 | US FAERS | |
| 123 | Blood triglycerides increased | FAERS: 2 | US FAERS | |
| 124 | Bronchial Obstruction | FAERS: 2 | US FAERS | |
| 125 | Bronchospasm | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 126 | Burning sensation | FAERS: 2 | US FAERS | |
| 127 | Capillary nail refill test abnormal | FAERS: 2 | US FAERS | |
| 128 | Cerebral Infarction | FAERS: 2 | US FAERS | |
| 129 | Colonic Pseudo-Obstruction | FAERS: 2 | US FAERS | |
| 130 | Dark circles under eyes | FAERS: 2 | US FAERS | |
| 131 | Drug administration error | FAERS: 2 | US FAERS | |
| 132 | Drug ineffective for unapproved indication | FAERS: 2 | US FAERS | |
| 133 | Dry skin | FAERS: 2 | US FAERS | |
| 134 | Dysarthria | FAERS: 2 | US FAERS | |
| 135 | Electrocardiogram abnormal | FAERS: 2 | US FAERS | |
| 136 | Erectile dysfunction | FAERS: 2 | US FAERS | |
| 137 | Extra dose administered | FAERS: 2 | US FAERS | |
| 138 | Failure to Thrive | FAERS: 2 | US FAERS | |
| 139 | Feeling Cold | FAERS: 2 | US FAERS | |
| 140 | Hypermetabolism | FAERS: 2 | US FAERS | |
| 141 | Hyperphagia | FAERS: 2 | US FAERS | |
| 142 | Hypoxia | FAERS: 2 | US FAERS | |
| 143 | Idiosyncratic drug reaction | FAERS: 2 | US FAERS | |
| 144 | Infantile spitting up | FAERS: 2 | US FAERS | |
| 145 | Inflammation | FAERS: 2 | US FAERS | |
| 146 | Initial insomnia | FAERS: 2 | US FAERS | |
| 147 | Intentional misuse | FAERS: 2 | US FAERS | |
| 148 | Joint swelling | FAERS: 2 | US FAERS | |
| 149 | Ketoacidosis | FAERS: 2 | US FAERS | |
| 150 | Lip swelling | FAERS: 2 | US FAERS | |
| 151 | Multiple drug overdose | FAERS: 2 | US FAERS | |
| 152 | Myocardial necrosis marker increased | FAERS: 2 | US FAERS | |
| 153 | Paranoia | FAERS: 2 | US FAERS | |
| 154 | Peripheral swelling | FAERS: 2 | US FAERS | |
| 155 | Poor peripheral circulation | FAERS: 2 | US FAERS | |
| 156 | Post procedural complication | FAERS: 2 | US FAERS | |
| 157 | Product physical issue | FAERS: 2 | US FAERS | |
| 158 | Product quality issue | FAERS: 2 | US FAERS | |
| 159 | Pseudomonal sepsis | FAERS: 2 | US FAERS | |
| 160 | Reaction to excipient | FAERS: 2 | US FAERS | |
| 161 | Respiratory distress | FAERS: 2 | US FAERS | |
| 162 | Retching | FAERS: 2 | US FAERS | |
| 163 | Sinus Tachycardia | FAERS: 2 | US FAERS | |
| 164 | Supraventricular tachycardia | FAERS: 2 | US FAERS | |
| 165 | Syncope | FAERS: 2 | US FAERS | |
| 166 | Therapeutic response unexpected | FAERS: 2 | US FAERS | |
| 167 | Therapy cessation | FAERS: 2 | US FAERS | |
| 168 | Thrombocytopenia | FAERS: 2 | US FAERS | |
| 169 | Troponin I increased | FAERS: 2 | US FAERS | |
| 170 | Ventricular hypokinesia | FAERS: 2 | US FAERS | |
| 171 | White blood cell count decreased | FAERS: 2 | US FAERS | |
| 172 | treatment failure | FAERS: 2 | US FAERS | |
| 173 | Abnormal sleep-related event | FAERS: 1 | US FAERS | |
| 174 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 175 | Acute prerenal failure | FAERS: 1 | US FAERS | |
| 176 | Adverse event | FAERS: 1 | US FAERS | |
| 177 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 178 | Allodynia | FAERS: 1 | US FAERS | |
| 179 | Amphetamines positive | FAERS: 1 | US FAERS | |
| 180 | Arteriosclerosis | FAERS: 1 | US FAERS | |
| 181 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 182 | Asthenopia | FAERS: 1 | US FAERS | |
| 183 | Atrial Flutter | FAERS: 1 | US FAERS | |
| 184 | Blindness | FAERS: 1 | US FAERS | |
| 185 | Blood catecholamines abnormal | FAERS: 1 | US FAERS | |
| 186 | Blood pressure immeasurable | FAERS: 1 | US FAERS | |
| 187 | Blood pressure inadequately controlled | FAERS: 1 | US FAERS | |
| 188 | Brain Hypoxia | FAERS: 1 | US FAERS | |
| 189 | Brain natriuretic peptide increased | FAERS: 1 | US FAERS | |
| 190 | Breath Holding | FAERS: 1 | US FAERS | |
| 191 | Bronchiectasis | FAERS: 1 | US FAERS | |
| 192 | Bronchitis | FAERS: 1 | US FAERS | |
| 193 | Cardiac stress test abnormal | FAERS: 1 | US FAERS | |
| 194 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 195 | Cataract | FAERS: 1 | US FAERS | |
| 196 | Cerebral atrophy | FAERS: 1 | US FAERS | |
| 197 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 198 | Charles Bonnet Syndrome | FAERS: 1 | US FAERS | |
| 199 | Chills | FAERS: 1 | US FAERS | |
| 200 | Choking | FAERS: 1 | US FAERS | |
| 201 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 202 | Clostridium difficile infection | FAERS: 1 | US FAERS | |
| 203 | Complications of maternal exposure to therapeutic drugs | FAERS: 1 | US FAERS | |
| 204 | Congenital pyelocaliectasis | FAERS: 1 | US FAERS | |
| 205 | Croup infectious | FAERS: 1 | US FAERS | |
| 206 | Dacryostenosis acquired | FAERS: 1 | US FAERS | |
| 207 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 208 | Dermoid Cyst | FAERS: 1 | US FAERS | |
| 209 | Diet refusal | FAERS: 1 | US FAERS | |
| 210 | Diplopia | FAERS: 1 | US FAERS | |
| 211 | Disease recurrence | FAERS: 1 | US FAERS | |
| 212 | Disseminated Intravascular Coagulation | FAERS: 1 | US FAERS | |
| 213 | Drug Dependence | FAERS: 1 | US FAERS | |
| 214 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 215 | Drug effect variable | FAERS: 1 | US FAERS | |
| 216 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 217 | Drug resistance | FAERS: 1 | US FAERS | |
| 218 | Ear discomfort | FAERS: 1 | US FAERS | |
| 219 | Economic problem | FAERS: 1 | US FAERS | |
| 220 | Eczema | FAERS: 1 | US FAERS | |
| 221 | Epilepsy | FAERS: 1 | US FAERS | |
| 222 | Epistaxis | FAERS: 1 | US FAERS | |
| 223 | Escherichia sepsis | FAERS: 1 | US FAERS | |
| 224 | Escherichia test positive | FAERS: 1 | US FAERS | |
| 225 | Euphoric mood | FAERS: 1 | US FAERS | |
| 226 | Expired product administered | FAERS: 1 | US FAERS | |
| 227 | Exposure via ingestion | FAERS: 1 | US FAERS | |
| 228 | Eye pain | FAERS: 1 | US FAERS | |
| 229 | Facial Pain | FAERS: 1 | US FAERS | |
| 230 | Facial Paresis | FAERS: 1 | US FAERS | |
| 231 | Feeling jittery | FAERS: 1 | US FAERS | |
| 232 | Food Allergy | FAERS: 1 | US FAERS | |
| 233 | Fungus urine test positive | FAERS: 1 | US FAERS | |
| 234 | Gastrointestinal Pain | FAERS: 1 | US FAERS | |
| 235 | Growth retardation | FAERS: 1 | US FAERS | |
| 236 | Head discomfort | FAERS: 1 | US FAERS | |
| 237 | Hepatorenal Syndrome | FAERS: 1 | US FAERS | |
| 238 | Histiocytosis haematophagic | FAERS: 1 | US FAERS | |
| 239 | Hypersomnia | FAERS: 1 | US FAERS | |
| 240 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 241 | Inability to afford medication | FAERS: 1 | US FAERS | |
| 242 | Inappropriate affect | FAERS: 1 | US FAERS | |
| 243 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 244 | Incontinence | FAERS: 1 | US FAERS | |
| 245 | Incorrect product administration duration | FAERS: 1 | US FAERS | |
| 246 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 247 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 248 | Increased viscosity of bronchial secretion | FAERS: 1 | US FAERS | |
| 249 | Infantile Colic | FAERS: 1 | US FAERS | |
| 250 | Intentional self-injury | FAERS: 1 | US FAERS | |
| 251 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 252 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 253 | Libido disorder | FAERS: 1 | US FAERS | |
| 254 | Livedo Reticularis | FAERS: 1 | US FAERS | |
| 255 | Loss of dreaming | FAERS: 1 | US FAERS | |
| 256 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 257 | Lymphohistiocytosis | FAERS: 1 | US FAERS | |
| 258 | Mastoiditis | FAERS: 1 | US FAERS | |
| 259 | Mental impairment | FAERS: 1 | US FAERS | |
| 260 | Metanephrine urine decreased | FAERS: 1 | US FAERS | |
| 261 | Metanephrine urine increased | FAERS: 1 | US FAERS | |
| 262 | Miliaria | FAERS: 1 | US FAERS | |
| 263 | Muscle tightness | FAERS: 1 | US FAERS | |
| 264 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 265 | Myalgia | FAERS: 1 | US FAERS | |
| 266 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 267 | Myopia | FAERS: 1 | US FAERS | |
| 268 | Neck Pain | FAERS: 1 | US FAERS | |
| 269 | Necrosis | FAERS: 1 | US FAERS | |
| 270 | Nervousness | FAERS: 1 | US FAERS | |
| 271 | Neurological decompensation | FAERS: 1 | US FAERS | |
| 272 | Neuroma | FAERS: 1 | US FAERS | |
| 273 | No adverse effect | FAERS: 1 | US FAERS | |
| 274 | Non-cardiac chest pain | FAERS: 1 | US FAERS | |
| 275 | Normetanephrine urine increased | FAERS: 1 | US FAERS | |
| 276 | Oliguria | FAERS: 1 | US FAERS | |
| 277 | Oral mucosal exfoliation | FAERS: 1 | US FAERS | |
| 278 | Oral pain | FAERS: 1 | US FAERS | |
| 279 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 280 | Parasomnia | FAERS: 1 | US FAERS | |
| 281 | Performance status decreased | FAERS: 1 | US FAERS | |
| 282 | Phalangeal agenesis | FAERS: 1 | US FAERS | |
| 283 | Pharyngitis | FAERS: 1 | US FAERS | |
| 284 | Pharyngolaryngeal discomfort | FAERS: 1 | US FAERS | |
| 285 | Pleuritic pain | FAERS: 1 | US FAERS | |
| 286 | Pneumothorax | FAERS: 1 | US FAERS | |
| 287 | Poisoning | FAERS: 1 | US FAERS | |
| 288 | Portal venous gas | FAERS: 1 | US FAERS | |
| 289 | Precancerous skin lesion | FAERS: 1 | US FAERS | |
| 290 | Pregnancy | FAERS: 1 | US FAERS | |
| 291 | Product appearance confusion | FAERS: 1 | US FAERS | |
| 292 | Product formulation issue | FAERS: 1 | US FAERS | |
| 293 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 294 | Product storage error | FAERS: 1 | US FAERS | |
| 295 | Pulmonary hypertensive crisis | FAERS: 1 | US FAERS | |
| 296 | Rash erythematous | FAERS: 1 | US FAERS | |
| 297 | Reaction to azo-dyes | FAERS: 1 | US FAERS | |
| 298 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 299 | Renal pain | FAERS: 1 | US FAERS | |
| 300 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 301 | Respiratory syncytial virus bronchiolitis | FAERS: 1 | US FAERS | |
| 302 | Respiratory syncytial virus test positive | FAERS: 1 | US FAERS | |
| 303 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 304 | Rhinovirus infection | FAERS: 1 | US FAERS | |
| 305 | Sclerosing encapsulating peritonitis | FAERS: 1 | US FAERS | |
| 306 | Screaming | FAERS: 1 | US FAERS | |
| 307 | Secretion discharge | FAERS: 1 | US FAERS | |
| 308 | Seizure like phenomena | FAERS: 1 | US FAERS | |
| 309 | Sense of oppression | FAERS: 1 | US FAERS | |
| 310 | Sick relative | FAERS: 1 | US FAERS | |
| 311 | Sinus operation | FAERS: 1 | US FAERS | |
| 312 | Skin irritation | FAERS: 1 | US FAERS | |
| 313 | Somatoform Disorder | FAERS: 1 | US FAERS | |
| 314 | Somnambulism | FAERS: 1 | US FAERS | |
| 315 | Staphylococcus test positive | FAERS: 1 | US FAERS | |
| 316 | Staring | FAERS: 1 | US FAERS | |
| 317 | Stenosis | FAERS: 1 | US FAERS | |
| 318 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 319 | Strabismus | FAERS: 1 | US FAERS | |
| 320 | Stress ulcer | FAERS: 1 | US FAERS | |
| 321 | Swelling | FAERS: 1 | US FAERS | |
| 322 | Syndactyly | FAERS: 1 | US FAERS | |
| 323 | Systemic Inflammatory Response Syndrome | FAERS: 1 | US FAERS | |
| 324 | Therapeutic product effect decreased | FAERS: 1 | US FAERS | |
| 325 | Tinnitus | FAERS: 1 | US FAERS | |
| 326 | Tonic clonic movements | FAERS: 1 | US FAERS | |
| 327 | Ulcer | FAERS: 1 | US FAERS | |
| 328 | Upper respiratory tract congestion | FAERS: 1 | US FAERS | |
| 329 | Ventricular arrhythmia | FAERS: 1 | US FAERS | |
| 330 | Ventricular hypertrophy | FAERS: 1 | US FAERS | |
| 331 | Vertebral artery occlusion | FAERS: 1 | US FAERS | |
| 332 | Vertigo | FAERS: 1 | US FAERS | |
| 333 | Visual Impairment | FAERS: 1 | US FAERS | |
| 334 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 335 | Wheelchair user | FAERS: 1 | US FAERS | |
| 336 | Wolff-Parkinson-White Syndrome | FAERS: 1 | US FAERS | |
| 337 | Wrong patient received medication | FAERS: 1 | US FAERS | |
| 338 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 339 | jaundice | FAERS: 1 | US FAERS | |
| 340 | Ageusia | Canada Vigilance: 1 | Canada Vigilance | |
| 341 | Conjunctivitis | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.