Valacyclovir
(ZCDDBUOENGJMLV-QRPNPIFTSA-N)
Structure
- SMILES
- CC([C@@H](C(=O)OCCOCn1cnc2c1nc(N)[nH]c2=O)N)C.Cl
- Molecular Formula:
- C13H21ClN6O4
- Molecular Weight:
- 360.797
- Log P:
- 1.2859
- Hydrogen Bond Acceptor:
- 9
- Hydrogen Bond Donor:
- 4
- TPSA:
- 151.14
- CAS Number(s):
- 124832-27-5
Synonym(s)
1.
Valacyclovir
2.
2-((2-Amino-1,6-dihydro-6-oxo-9H-purin-9-yl)methoxy)ethyl L-valinate
3.
256U87
4.
Acyclovir, L-valyl Ester
5.
BW256U87
6.
L-Valylacyclovir
7.
Valaciclovir
8.
Valacyclovir Hydrochloride
9.
Valacyclovir Hydrochloride, (DL)-isomer
10.
Valacyclovir, (D)-isomer
11.
Valacyclovir, (DL)-isomer
12.
Valacyclovir, (L)-isomer
13.
Valacyclovir, D-
14.
Valacyclovir, X-Hydrochloride, (D)-isomer
15.
Valacyclovir, X-Hydrochloride, (DL)-isomer
16.
Valtrex
17.
Acyclovir, L valyl Ester
18.
D- Valacyclovir
19.
L Valylacyclovir
20.
L-valyl Ester Acyclovir
External Link(s)
| MeSH | D000077483 |
| PubChem Compound | 135398741 137066184 |
| BindingDB | 50248296 |
| ChEBI | 9919 |
| CHEMBL | CHEMBL1201110 |
| KEGG | cpd:C07184 dr:D00398 |
| Therapeutic Target Database | D05MFA |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 76 | US FAERS | |
| 2 | Product substitution issue | FAERS: 25 | US FAERS | |
| 3 | Nausea | FAERS: 15 | US FAERS | |
| 4 | Malaise | FAERS: 13 | US FAERS | |
| 5 | Altered state of consciousness | FAERS: 12 | US FAERS | |
| 6 | Headache | FAERS: 12 | US FAERS | |
| 7 | Vomiting | FAERS: 11 | US FAERS | |
| 8 | Blood creatinine increased | FAERS: 9 | US FAERS | |
| 9 | Dizziness | FAERS: 9 | US FAERS | |
| 10 | Dysarthria | FAERS: 9 | US FAERS | |
| 11 | Therapeutic response unexpected with drug substitution | FAERS: 8 | US FAERS | |
| 12 | Toxicity to various agents | FAERS: 8 | US FAERS | |
| 13 | Disorientation | FAERS: 6 | US FAERS | |
| 14 | Fatigue | FAERS: 6 | US FAERS | |
| 15 | Feeling abnormal | FAERS: 6 | US FAERS | |
| 16 | Acute kidney injury | FAERS: 5 | US FAERS | |
| 17 | Depressed Level of Consciousness | FAERS: 5 | US FAERS | |
| 18 | Dysgeusia | FAERS: 5 | US FAERS | |
| 19 | Hypersensitivity | FAERS: 5 | US FAERS | |
| 20 | Product quality issue | FAERS: 5 | US FAERS | |
| 21 | Abdominal Pain | FAERS: 4 | US FAERS | |
| 22 | Angioedema | FAERS: 4 | US FAERS | |
| 23 | Back Pain | FAERS: 4 | US FAERS | |
| 24 | Blood urea increased | FAERS: 4 | US FAERS | |
| 25 | Drug exposure during pregnancy | FAERS: 4 | US FAERS | |
| 26 | Dyslalia | FAERS: 4 | US FAERS | |
| 27 | Incoherent | FAERS: 4 | US FAERS | |
| 28 | Pruritus | FAERS: 4 | US FAERS | |
| 29 | Somnolence | FAERS: 4 | US FAERS | |
| 30 | Thrombocytopenia | FAERS: 4 | US FAERS | |
| 31 | Abdominal discomfort | FAERS: 3 | US FAERS | |
| 32 | Agitation | FAERS: 3 | US FAERS | |
| 33 | Chest Pain | FAERS: 3 | US FAERS | |
| 34 | Delirium | FAERS: 3 | US FAERS | |
| 35 | Disease recurrence | FAERS: 3 | US FAERS | |
| 36 | Genital Herpes | FAERS: 3 | US FAERS | |
| 37 | Overdose | FAERS: 3 | US FAERS | |
| 38 | Product taste abnormal | FAERS: 3 | US FAERS | |
| 39 | Transaminases increased | FAERS: 3 | US FAERS | |
| 40 | nervous system disorder | FAERS: 3 | US FAERS | |
| 41 | Alopecia | FAERS: 2 | US FAERS | |
| 42 | Bradycardia | FAERS: 2 | US FAERS | |
| 43 | Burning sensation | FAERS: 2 | US FAERS | |
| 44 | Central nervous system lesion | FAERS: 2 | US FAERS | |
| 45 | Dehydration | FAERS: 2 | US FAERS | |
| 46 | Drug resistance | FAERS: 2 | US FAERS | |
| 47 | Erythema Multiforme | FAERS: 2 | US FAERS | |
| 48 | Expired product administered | FAERS: 2 | US FAERS | |
| 49 | Gamma-Glutamyltransferase Increased | FAERS: 2 | US FAERS | |
| 50 | Medication Error | FAERS: 2 | US FAERS | |
| 51 | Memory impairment | FAERS: 2 | US FAERS | |
| 52 | Mental status changes | FAERS: 2 | US FAERS | |
| 53 | Microcephaly | FAERS: 2 | US FAERS | |
| 54 | Neuralgia | FAERS: 2 | US FAERS | |
| 55 | Pain | FAERS: 2 | US FAERS | |
| 56 | Pathogen resistance | FAERS: 2 | US FAERS | |
| 57 | Product solubility abnormal | FAERS: 2 | US FAERS | |
| 58 | Product use complaint | FAERS: 2 | US FAERS | |
| 59 | Purpura | FAERS: 2 | US FAERS | |
| 60 | Quality of life decreased | FAERS: 2 | US FAERS | |
| 61 | Respiratory distress | FAERS: 2 | US FAERS | |
| 62 | Sluggishness | FAERS: 2 | US FAERS | |
| 63 | Stevens-Johnson Syndrome | FAERS: 2 | US FAERS | |
| 64 | Tachycardia | FAERS: 2 | US FAERS | |
| 65 | Therapeutic response changed | FAERS: 2 | US FAERS | |
| 66 | Throat irritation | FAERS: 2 | US FAERS | |
| 67 | Tremor | FAERS: 2 | US FAERS | |
| 68 | Urticaria | FAERS: 2 | US FAERS | |
| 69 | Vertigo | FAERS: 2 | US FAERS | |
| 70 | Acute psychosis | FAERS: 1 | US FAERS | |
| 71 | Adverse event | FAERS: 1 | US FAERS | |
| 72 | Amnesia | FAERS: 1 | US FAERS | |
| 73 | Anger | FAERS: 1 | US FAERS | |
| 74 | Anorexia | FAERS: 1 | US FAERS | |
| 75 | Anuria | FAERS: 1 | US FAERS | |
| 76 | Anxiety | FAERS: 1 | US FAERS | |
| 77 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 78 | Ataxia | FAERS: 1 | US FAERS | |
| 79 | Aura | FAERS: 1 | US FAERS | |
| 80 | Bacterial pyelonephritis | FAERS: 1 | US FAERS | |
| 81 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 82 | Bronchitis | FAERS: 1 | US FAERS | |
| 83 | Calcinosis | FAERS: 1 | US FAERS | |
| 84 | Cellulitis | FAERS: 1 | US FAERS | |
| 85 | Cerebral ventricle dilatation | FAERS: 1 | US FAERS | |
| 86 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 87 | Chest discomfort | FAERS: 1 | US FAERS | |
| 88 | Chills | FAERS: 1 | US FAERS | |
| 89 | Cleft Palate | FAERS: 1 | US FAERS | |
| 90 | Congenital brain damage | FAERS: 1 | US FAERS | |
| 91 | Congenital hepatomegaly | FAERS: 1 | US FAERS | |
| 92 | Conjunctivitis | FAERS: 1 | US FAERS | |
| 93 | Constipation | FAERS: 1 | US FAERS | |
| 94 | Cotard's syndrome | FAERS: 1 | US FAERS | |
| 95 | Cytopenia | FAERS: 1 | US FAERS | |
| 96 | Deafness | FAERS: 1 | US FAERS | |
| 97 | Depressed mood | FAERS: 1 | US FAERS | |
| 98 | Diplopia | FAERS: 1 | US FAERS | |
| 99 | Disease prodromal stage | FAERS: 1 | US FAERS | |
| 100 | Documented hypersensitivity to administered product | FAERS: 1 | US FAERS | |
| 101 | Drug administration error | FAERS: 1 | US FAERS | |
| 102 | Drug dispensed to wrong patient | FAERS: 1 | US FAERS | |
| 103 | Drug effect delayed | FAERS: 1 | US FAERS | |
| 104 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 105 | Drug level increased | FAERS: 1 | US FAERS | |
| 106 | Dysmorphism | FAERS: 1 | US FAERS | |
| 107 | Dyspepsia | FAERS: 1 | US FAERS | |
| 108 | Dysphonia | FAERS: 1 | US FAERS | |
| 109 | Dysuria | FAERS: 1 | US FAERS | |
| 110 | Eczema weeping | FAERS: 1 | US FAERS | |
| 111 | Eczema | FAERS: 1 | US FAERS | |
| 112 | Elevated mood | FAERS: 1 | US FAERS | |
| 113 | Erythema | FAERS: 1 | US FAERS | |
| 114 | Exposure during breast feeding | FAERS: 1 | US FAERS | |
| 115 | Eye irritation | FAERS: 1 | US FAERS | |
| 116 | Eye pain | FAERS: 1 | US FAERS | |
| 117 | Facial asymmetry | FAERS: 1 | US FAERS | |
| 118 | Flatulence | FAERS: 1 | US FAERS | |
| 119 | Food Allergy | FAERS: 1 | US FAERS | |
| 120 | Gait deviation | FAERS: 1 | US FAERS | |
| 121 | Gaze palsy | FAERS: 1 | US FAERS | |
| 122 | General symptom | FAERS: 1 | US FAERS | |
| 123 | Glaucoma | FAERS: 1 | US FAERS | |
| 124 | Gluten sensitivity | FAERS: 1 | US FAERS | |
| 125 | Growth retardation | FAERS: 1 | US FAERS | |
| 126 | Head deformity | FAERS: 1 | US FAERS | |
| 127 | Head discomfort | FAERS: 1 | US FAERS | |
| 128 | Hepatitis | FAERS: 1 | US FAERS | |
| 129 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 130 | Hepatosplenomegaly | FAERS: 1 | US FAERS | |
| 131 | Hordeolum | FAERS: 1 | US FAERS | |
| 132 | Hyperkinesia | FAERS: 1 | US FAERS | |
| 133 | Hypotension | FAERS: 1 | US FAERS | |
| 134 | Hysterectomy | FAERS: 1 | US FAERS | |
| 135 | Influenza | FAERS: 1 | US FAERS | |
| 136 | Intentional misuse | FAERS: 1 | US FAERS | |
| 137 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 138 | Intertrigo | FAERS: 1 | US FAERS | |
| 139 | Laceration | FAERS: 1 | US FAERS | |
| 140 | Leukocytosis | FAERS: 1 | US FAERS | |
| 141 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 142 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 143 | Meconium peritonitis | FAERS: 1 | US FAERS | |
| 144 | Megakaryocytes increased | FAERS: 1 | US FAERS | |
| 145 | Meningitis herpes | FAERS: 1 | US FAERS | |
| 146 | Meningitis | FAERS: 1 | US FAERS | |
| 147 | Menorrhagia | FAERS: 1 | US FAERS | |
| 148 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 149 | Metastasis | FAERS: 1 | US FAERS | |
| 150 | Mouth swelling | FAERS: 1 | US FAERS | |
| 151 | Myalgia | FAERS: 1 | US FAERS | |
| 152 | Nephrotic Syndrome | FAERS: 1 | US FAERS | |
| 153 | No adverse event | FAERS: 1 | US FAERS | |
| 154 | Oral mucosal erythema | FAERS: 1 | US FAERS | |
| 155 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 156 | Pallor | FAERS: 1 | US FAERS | |
| 157 | Palpitations | FAERS: 1 | US FAERS | |
| 158 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 159 | Pancytopenia | FAERS: 1 | US FAERS | |
| 160 | Pneumonia | FAERS: 1 | US FAERS | |
| 161 | Pneumonitis | FAERS: 1 | US FAERS | |
| 162 | Poriomania | FAERS: 1 | US FAERS | |
| 163 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 164 | Product counterfeit | FAERS: 1 | US FAERS | |
| 165 | Product difficult to swallow | FAERS: 1 | US FAERS | |
| 166 | Product dispensing error | FAERS: 1 | US FAERS | |
| 167 | Product lot number issue | FAERS: 1 | US FAERS | |
| 168 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 169 | Prurigo | FAERS: 1 | US FAERS | |
| 170 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 171 | Reaction to food additive | FAERS: 1 | US FAERS | |
| 172 | Restlessness | FAERS: 1 | US FAERS | |
| 173 | Retinal scar | FAERS: 1 | US FAERS | |
| 174 | Scab | FAERS: 1 | US FAERS | |
| 175 | Screaming | FAERS: 1 | US FAERS | |
| 176 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 177 | Sinusitis | FAERS: 1 | US FAERS | |
| 178 | Skin Erosion | FAERS: 1 | US FAERS | |
| 179 | Skin lesion | FAERS: 1 | US FAERS | |
| 180 | Skin reaction | FAERS: 1 | US FAERS | |
| 181 | Skin test positive | FAERS: 1 | US FAERS | |
| 182 | Skin toxicity | FAERS: 1 | US FAERS | |
| 183 | Stomatitis | FAERS: 1 | US FAERS | |
| 184 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 185 | Swelling | FAERS: 1 | US FAERS | |
| 186 | Symptom recurrence | FAERS: 1 | US FAERS | |
| 187 | Syncope | FAERS: 1 | US FAERS | |
| 188 | Talipes | FAERS: 1 | US FAERS | |
| 189 | Therapeutic product effect incomplete | FAERS: 1 | US FAERS | |
| 190 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 191 | Thirst | FAERS: 1 | US FAERS | |
| 192 | Toxic Epidermal Necrolysis | FAERS: 1 | US FAERS | |
| 193 | Trisomy 21 | FAERS: 1 | US FAERS | |
| 194 | Ultrasound scan abnormal | FAERS: 1 | US FAERS | |
| 195 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 196 | Uterine Cancer | FAERS: 1 | US FAERS | |
| 197 | Varicella virus test negative | FAERS: 1 | US FAERS | |
| 198 | Vascular calcification | FAERS: 1 | US FAERS | |
| 199 | Vasculitis | FAERS: 1 | US FAERS | |
| 200 | Viral mutation identified | FAERS: 1 | US FAERS | |
| 201 | Visual Impairment | FAERS: 1 | US FAERS | |
| 202 | Vulvovaginal mycotic infection | FAERS: 1 | US FAERS | |
| 203 | Wheezing | FAERS: 1 | US FAERS | |
| 204 | jaundice | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.