Verteporfin
(YTZALCGQUPRCGW-ZSFNYQMMSA-N)
Structure
- SMILES
- COC(=O)CCc1c2C=C3N=C(C(=C3CCC(=O)O)C)C=c3[nH]c(=CC4=NC(=Cc(c1C)[nH]2)[C@]1(C)[C@H](C(=O)OC)C(=CC=C41)C(=O)OC)c(c3C=C)C
- Type(s)
- Approved; Investigational
- ATC code(s)
- S01LA01
- Molecular Formula:
- C41H42N4O8
- Molecular Weight:
- 718.794
- Log P:
- 3.4614
- Hydrogen Bond Acceptor:
- 10
- Hydrogen Bond Donor:
- 3
- TPSA:
- 172.5
- CAS Number(s):
- 129497-78-5; 133513-12-9
Synonym(s)
1.
Verteporfin
2.
18-Ethenyl-4,4a-dihydro-3,4-bis(methoxycarbonyl)-4a,8,14,19-tetramethyl-23H,25H-benzo(b)porphine-9,13-dipropanoic acid monomethyl ester
3.
BPD Verteporfin
4.
BPD-MA
5.
Benzoporphyrin Derivative Monoacid Ring A
6.
Verteporphin
7.
Visudyne
External Link(s)
| MeSH | D000077362 |
| PubChem Compound | 5362420 |
| ChEBI | 60775 |
| CHEMBL | CHEMBL3822934 CHEMBL2052016 |
| DrugBank | DB00460 |
| Therapeutic Target Database | D0I3XG |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Disease Progression | FAERS: 100 | US FAERS | |
| 2 | Detachment of retinal pigment epithelium | FAERS: 43 | US FAERS | |
| 3 | Retinal Detachment | FAERS: 30 | US FAERS | |
| 4 | Retinal pigment epithelial tear | FAERS: 30 | US FAERS | |
| 5 | Subretinal fibrosis | FAERS: 27 | US FAERS | |
| 6 | Blindness | FAERS: 25 | US FAERS | |
| 7 | Macular degeneration | FAERS: 25 | US FAERS | |
| 8 | Metamorphopsia | FAERS: 25 | US FAERS | |
| 9 | Polypoidal choroidal vasculopathy | FAERS: 22 | US FAERS | |
| 10 | Retinal Degeneration | FAERS: 19 | US FAERS | |
| 11 | Chorioretinal atrophy | FAERS: 17 | US FAERS | |
| 12 | Back Pain | FAERS: 16 | US FAERS | |
| 13 | Retinal exudates | FAERS: 15 | US FAERS | |
| 14 | Post procedural complication | FAERS: 13 | US FAERS | |
| 15 | Angiogram abnormal | FAERS: 12 | US FAERS | |
| 16 | Fibrosis | FAERS: 12 | US FAERS | |
| 17 | Nausea | FAERS: 12 | US FAERS | |
| 18 | Pain | FAERS: 12 | US FAERS | |
| 19 | Retinal scar | FAERS: 12 | US FAERS | |
| 20 | Scotoma | FAERS: 12 | US FAERS | |
| 21 | Headache | FAERS: 11 | US FAERS | |
| 22 | Retinal pigment epitheliopathy | FAERS: 11 | US FAERS | |
| 23 | Cataract | FAERS: 9 | US FAERS | |
| 24 | Chest Pain | FAERS: 9 | US FAERS | |
| 25 | Disease recurrence | FAERS: 9 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 26 | Retinal Vascular Disorder | FAERS: 9 | US FAERS | |
| 27 | Visual disturbance | FAERS: 9 | US FAERS | |
| 28 | Dizziness | FAERS: 8 | US FAERS | |
| 29 | Extravasation | FAERS: 8 | US FAERS | |
| 30 | No adverse event | FAERS: 8 | US FAERS | |
| 31 | Arthralgia | FAERS: 7 | US FAERS | |
| 32 | Infusion site erythema | FAERS: 7 | US FAERS | |
| 33 | Injection site extravasation | FAERS: 7 | US FAERS | |
| 34 | Cerebral Infarction | FAERS: 6 | US FAERS | |
| 35 | Drug ineffective | FAERS: 6 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 36 | Hypersensitivity | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 37 | Injection site pain | FAERS: 6 | US FAERS | |
| 38 | Myocardial Infarction | FAERS: 6 | US FAERS | |
| 39 | Product use in unapproved indication | FAERS: 6 | US FAERS | |
| 40 | Product use issue | FAERS: 6 | US FAERS | |
| 41 | Syncope | FAERS: 6 | US FAERS | |
| 42 | Vomiting | FAERS: 6 | US FAERS | |
| 43 | Deafness | FAERS: 5 | US FAERS | |
| 44 | Fatigue | FAERS: 5 | US FAERS | |
| 45 | Infusion Site Extravasation | FAERS: 5 | US FAERS | |
| 46 | Injection site necrosis | FAERS: 5 | US FAERS | |
| 47 | Retinal depigmentation | FAERS: 5 | US FAERS | |
| 48 | Anaphylactic shock | FAERS: 4 | US FAERS | |
| 49 | Cerebrovascular accident | FAERS: 4 | US FAERS | |
| 50 | Chorioretinal scar | FAERS: 4 | US FAERS | |
| 51 | Choroiditis | FAERS: 4 | US FAERS | |
| 52 | Eye operation complication | FAERS: 4 | US FAERS | |
| 53 | Glaucoma | FAERS: 4 | US FAERS | |
| 54 | Infusion site pain | FAERS: 4 | US FAERS | |
| 55 | Injection site erythema | FAERS: 4 | US FAERS | |
| 56 | Musculoskeletal stiffness | FAERS: 4 | US FAERS | |
| 57 | Necrosis | FAERS: 4 | US FAERS | |
| 58 | Retinal infarction | FAERS: 4 | US FAERS | |
| 59 | Shock | FAERS: 4 | US FAERS | |
| 60 | Accidental exposure | FAERS: 3 | US FAERS | |
| 61 | Alanine Aminotransferase Increased | FAERS: 3 | US FAERS | |
| 62 | Anxiety | FAERS: 3 | US FAERS | |
| 63 | Aspartate Aminotransferase Increased | FAERS: 3 | US FAERS | |
| 64 | Asthenia | FAERS: 3 | US FAERS | |
| 65 | Asthma | FAERS: 3 | US FAERS | |
| 66 | Bone pain | FAERS: 3 | US FAERS | |
| 67 | Choroidal dystrophy | FAERS: 3 | US FAERS | |
| 68 | Cystitis | FAERS: 3 | US FAERS | |
| 69 | Drug administration error | FAERS: 3 | US FAERS | |
| 70 | Drug dose omission | FAERS: 3 | US FAERS | |
| 71 | Drug effect incomplete | FAERS: 3 | US FAERS | |
| 72 | Drug exposure during pregnancy | FAERS: 3 | US FAERS | |
| 73 | Erythema | FAERS: 3 | US FAERS | |
| 74 | Exudative retinopathy | FAERS: 3 | US FAERS | |
| 75 | General physical health deterioration | FAERS: 3 | US FAERS | |
| 76 | Infusion site swelling | FAERS: 3 | US FAERS | |
| 77 | Intentional product use issue | FAERS: 3 | US FAERS | |
| 78 | Medication Error | FAERS: 3 | US FAERS | |
| 79 | Ocular vascular disorder | FAERS: 3 | US FAERS | |
| 80 | Pharyngolaryngeal Pain | FAERS: 3 | US FAERS | |
| 81 | Photophobia | FAERS: 3 | US FAERS | |
| 82 | Pruritus | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 83 | Pulmonary Embolism | FAERS: 3 | US FAERS | |
| 84 | Retinal Artery Occlusion | FAERS: 3 | US FAERS | |
| 85 | Retinal Vein Occlusion | FAERS: 3 | US FAERS | |
| 86 | Urticaria | FAERS: 3 | US FAERS | |
| 87 | Vitreous Detachment | FAERS: 3 | US FAERS | |
| 88 | Angina Pectoris | FAERS: 2 | US FAERS | |
| 89 | Angle Closure Glaucoma | FAERS: 2 | US FAERS | |
| 90 | Blood pressure fluctuation | FAERS: 2 | US FAERS | |
| 91 | Bradycardia | FAERS: 2 | US FAERS | |
| 92 | Bronchospasm | FAERS: 2 | US FAERS | |
| 93 | Cardiac Arrest | FAERS: 2 | US FAERS | |
| 94 | Chest discomfort | FAERS: 2 | US FAERS | |
| 95 | Chills | FAERS: 2 | US FAERS | |
| 96 | Chromatopsia | FAERS: 2 | US FAERS | |
| 97 | Corneal Scar | FAERS: 2 | US FAERS | |
| 98 | Dermatitis | FAERS: 2 | US FAERS | |
| 99 | Discomfort | FAERS: 2 | US FAERS | |
| 100 | Eczema | FAERS: 2 | US FAERS | |
| 101 | Iatrogenic injury | FAERS: 2 | US FAERS | |
| 102 | Infusion site rash | FAERS: 2 | US FAERS | |
| 103 | Injection site infection | FAERS: 2 | US FAERS | |
| 104 | Intestinal Obstruction | FAERS: 2 | US FAERS | |
| 105 | Joint swelling | FAERS: 2 | US FAERS | |
| 106 | Macular pseudohole | FAERS: 2 | US FAERS | |
| 107 | Malignant neoplasm progression | FAERS: 2 | US FAERS | |
| 108 | Musculoskeletal Pain | FAERS: 2 | US FAERS | |
| 109 | Myalgia | FAERS: 2 | US FAERS | |
| 110 | Nervousness | FAERS: 2 | US FAERS | |
| 111 | Pallor | FAERS: 2 | US FAERS | |
| 112 | Psoriasis | FAERS: 2 | US FAERS | |
| 113 | Renal Colic | FAERS: 2 | US FAERS | |
| 114 | Retinal vascular occlusion | FAERS: 2 | US FAERS | |
| 115 | Scab | FAERS: 2 | US FAERS | |
| 116 | Sinusitis | FAERS: 2 | US FAERS | |
| 117 | Skin necrosis | FAERS: 2 | US FAERS | |
| 118 | Sunburn | FAERS: 2 | US FAERS | |
| 119 | Thermal burn | FAERS: 2 | US FAERS | |
| 120 | Tilted disc syndrome | FAERS: 2 | US FAERS | |
| 121 | Tinnitus | FAERS: 2 | US FAERS | |
| 122 | Urinary tract infection | FAERS: 2 | US FAERS | |
| 123 | Vascular occlusion | FAERS: 2 | US FAERS | |
| 124 | Visual Impairment | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 125 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 126 | Administration site reaction | FAERS: 1 | US FAERS | |
| 127 | Administration site swelling | FAERS: 1 | US FAERS | |
| 128 | Alopecia | FAERS: 1 | US FAERS | |
| 129 | Amyotrophic Lateral Sclerosis | FAERS: 1 | US FAERS | |
| 130 | Anaphylactoid Reaction | FAERS: 1 | US FAERS | |
| 131 | Anhedonia | FAERS: 1 | US FAERS | |
| 132 | Anterior chamber inflammation | FAERS: 1 | US FAERS | |
| 133 | Asphyxia | FAERS: 1 | US FAERS | |
| 134 | Asthenopia | FAERS: 1 | US FAERS | |
| 135 | Astigmatism | FAERS: 1 | US FAERS | |
| 136 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 137 | Bacteria blood identified | FAERS: 1 | US FAERS | |
| 138 | Bacteria urine identified | FAERS: 1 | US FAERS | |
| 139 | Blepharitis | FAERS: 1 | US FAERS | |
| 140 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 141 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 142 | Carbohydrate antigen 15-3 increased | FAERS: 1 | US FAERS | |
| 143 | Cataract operation | FAERS: 1 | US FAERS | |
| 144 | Catheter related complication | FAERS: 1 | US FAERS | |
| 145 | Cellulitis | FAERS: 1 | US FAERS | |
| 146 | Cerebral Atherosclerosis | FAERS: 1 | US FAERS | |
| 147 | Cerebral Thrombosis | FAERS: 1 | US FAERS | |
| 148 | Cerebral atrophy | FAERS: 1 | US FAERS | |
| 149 | Choking sensation | FAERS: 1 | US FAERS | |
| 150 | Choroidal Detachment | FAERS: 1 | US FAERS | |
| 151 | Choroidal rupture | FAERS: 1 | US FAERS | |
| 152 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 153 | Clostridium colitis | FAERS: 1 | US FAERS | |
| 154 | Completed Suicide | FAERS: 1 | US FAERS | |
| 155 | Conjunctivitis | FAERS: 1 | US FAERS | |
| 156 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 157 | Culture urine positive | FAERS: 1 | US FAERS | |
| 158 | Cyanosis | FAERS: 1 | US FAERS | |
| 159 | Cytolytic hepatitis | FAERS: 1 | US FAERS | |
| 160 | Dacryostenosis acquired | FAERS: 1 | US FAERS | |
| 161 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 162 | Disorientation | FAERS: 1 | US FAERS | |
| 163 | Drug exposure before pregnancy | FAERS: 1 | US FAERS | |
| 164 | Dysentery | FAERS: 1 | US FAERS | |
| 165 | Dyspepsia | FAERS: 1 | US FAERS | |
| 166 | Embolism | FAERS: 1 | US FAERS | |
| 167 | Endophthalmitis | FAERS: 1 | US FAERS | |
| 168 | Epistaxis | FAERS: 1 | US FAERS | |
| 169 | Eye Burns | FAERS: 1 | US FAERS | |
| 170 | Eye inflammation | FAERS: 1 | US FAERS | |
| 171 | Eye laser scar | FAERS: 1 | US FAERS | |
| 172 | Eye pain | FAERS: 1 | US FAERS | |
| 173 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 174 | Fracture | FAERS: 1 | US FAERS | |
| 175 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 176 | Glaucoma surgery | FAERS: 1 | US FAERS | |
| 177 | Gliosis | FAERS: 1 | US FAERS | |
| 178 | Hepatitis C positive | FAERS: 1 | US FAERS | |
| 179 | Hyperventilation | FAERS: 1 | US FAERS | |
| 180 | Hypotension | FAERS: 1 | US FAERS | |
| 181 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 182 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 183 | Infection reactivation | FAERS: 1 | US FAERS | |
| 184 | Inflammation | FAERS: 1 | US FAERS | |
| 185 | Infusion site burning | FAERS: 1 | US FAERS | |
| 186 | Infusion site erosion | FAERS: 1 | US FAERS | |
| 187 | Infusion site necrosis | FAERS: 1 | US FAERS | |
| 188 | Infusion site ulcer | FAERS: 1 | US FAERS | |
| 189 | Injection Site Reaction | FAERS: 1 | US FAERS | |
| 190 | Injection site vesicles | FAERS: 1 | US FAERS | |
| 191 | Intentional drug misuse | FAERS: 1 | US FAERS | |
| 192 | Keratoplasty | FAERS: 1 | US FAERS | |
| 193 | Laryngospasm | FAERS: 1 | US FAERS | |
| 194 | Lip swelling | FAERS: 1 | US FAERS | |
| 195 | Macular detachment | FAERS: 1 | US FAERS | |
| 196 | Malaise | FAERS: 1 | US FAERS | |
| 197 | Melanoma recurrent | FAERS: 1 | US FAERS | |
| 198 | Middle insomnia | FAERS: 1 | US FAERS | |
| 199 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 200 | Myopia | FAERS: 1 | US FAERS | |
| 201 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 202 | Neck Pain | FAERS: 1 | US FAERS | |
| 203 | Nephritis | FAERS: 1 | US FAERS | |
| 204 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 205 | Nephrotic Syndrome | FAERS: 1 | US FAERS | |
| 206 | Nerve Degeneration | FAERS: 1 | US FAERS | |
| 207 | Nerve injury | FAERS: 1 | US FAERS | |
| 208 | Open wound | FAERS: 1 | US FAERS | |
| 209 | Pericarditis | FAERS: 1 | US FAERS | |
| 210 | Peripheral embolism | FAERS: 1 | US FAERS | |
| 211 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 212 | Pneumonia | FAERS: 1 | US FAERS | |
| 213 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 214 | Post procedural discharge | FAERS: 1 | US FAERS | |
| 215 | Pregnancy | FAERS: 1 | US FAERS | |
| 216 | Presyncope | FAERS: 1 | US FAERS | |
| 217 | Procedural complication | FAERS: 1 | US FAERS | |
| 218 | Product label issue | FAERS: 1 | US FAERS | |
| 219 | Product quality issue | FAERS: 1 | US FAERS | |
| 220 | Prostate cancer recurrent | FAERS: 1 | US FAERS | |
| 221 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 222 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 223 | Purulent discharge | FAERS: 1 | US FAERS | |
| 224 | Rash erythematous | FAERS: 1 | US FAERS | |
| 225 | Restlessness | FAERS: 1 | US FAERS | |
| 226 | Retinal cyst | FAERS: 1 | US FAERS | |
| 227 | Retinal thickening | FAERS: 1 | US FAERS | |
| 228 | Retinoblastoma unilateral | FAERS: 1 | US FAERS | |
| 229 | Retinoblastoma | FAERS: 1 | US FAERS | |
| 230 | Sepsis | FAERS: 1 | US FAERS | |
| 231 | Serous retinal detachment | FAERS: 1 | US FAERS | |
| 232 | Skin lesion | FAERS: 1 | US FAERS | |
| 233 | Somatoform Disorder | FAERS: 1 | US FAERS | |
| 234 | Somnolence | FAERS: 1 | US FAERS | |
| 235 | Stress | FAERS: 1 | US FAERS | |
| 236 | Suicide attempt | FAERS: 1 | US FAERS | |
| 237 | Tachycardia | FAERS: 1 | US FAERS | |
| 238 | Therapeutic procedure | FAERS: 1 | US FAERS | |
| 239 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 240 | Thrombosis | FAERS: 1 | US FAERS | |
| 241 | Transplant | FAERS: 1 | US FAERS | |
| 242 | Tremor | FAERS: 1 | US FAERS | |
| 243 | Tumour haemorrhage | FAERS: 1 | US FAERS | |
| 244 | Unevaluable event | FAERS: 1 | US FAERS | |
| 245 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 246 | Urinary Retention | FAERS: 1 | US FAERS | |
| 247 | Urinary tract obstruction | FAERS: 1 | US FAERS | |
| 248 | Vein collapse | FAERS: 1 | US FAERS | |
| 249 | Venous occlusion | FAERS: 1 | US FAERS | |
| 250 | Vertigo | FAERS: 1 | US FAERS | |
| 251 | Visual acuity reduced transiently | FAERS: 1 | US FAERS | |
| 252 | Vitreous adhesions | FAERS: 1 | US FAERS | |
| 253 | Wheezing | FAERS: 1 | US FAERS | |
| 254 | jaundice | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.