Pantoprazole
(YNWDKZIIWCEDEE-UHFFFAOYSA-N)
Structure
- SMILES
- COc1c(OC)ccnc1CS(=O)c1[n-]c2c(n1)cc(cc2)OC(F)F.[Na+]
- Molecular Formula:
- C16H14F2N3NaO4S
- Molecular Weight:
- 405.352
- Log P:
- 3.3791
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 0
- TPSA:
- 102.64
- CAS Number(s):
- 138786-67-1; 164579-32-2
Synonym(s)
1.
Pantoprazole
2.
BY 1023
3.
BY-1023
4.
Pantoprazole Sodium
5.
Protonix
6.
SK&F 96022
7.
SK&F-96022
8.
SKF-96022
9.
BY1023
10.
SK&F96022
11.
SKF 96022
12.
SKF96022
External Link(s)
| MeSH | D000077402 |
| PubChem Compound | 23713799 15008962 |
| ChEBI | 50270 |
| CHEMBL | CHEMBL1200408 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 57 Canada Vigilance: 46 | Canada Vigilance US FAERS | |
| 2 | Product substitution issue | FAERS: 29 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 3 | Vomiting | FAERS: 23 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 4 | Nausea | FAERS: 21 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 5 | Malaise | FAERS: 19 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 6 | Dizziness | FAERS: 17 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 7 | Flatulence | FAERS: 16 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 8 | Headache | FAERS: 16 Canada Vigilance: 14 | Canada Vigilance US FAERS | |
| 9 | Abdominal Pain | FAERS: 15 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 10 | Dyspepsia | FAERS: 15 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 11 | Hypersensitivity | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 12 | Pruritus | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 13 | Urticaria | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 14 | Arthralgia | FAERS: 13 | US FAERS | |
| 15 | Product quality issue | FAERS: 13 | US FAERS | |
| 16 | Asthenia | FAERS: 12 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 17 | Weight decreased | FAERS: 12 | US FAERS | |
| 18 | Abdominal discomfort | FAERS: 11 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 19 | Fatigue | FAERS: 10 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 20 | Eructation | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 21 | Oropharyngeal pain | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 22 | Anxiety | FAERS: 8 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 23 | Chest Pain | FAERS: 8 | US FAERS | |
| 24 | Erythema | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 25 | Pain | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 26 | Vertigo | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 27 | Feeling abnormal | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 28 | Tachycardia | FAERS: 7 | US FAERS | |
| 29 | Therapeutic response unexpected with drug substitution | FAERS: 7 | US FAERS | |
| 30 | Lip swelling | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 31 | Burning sensation | FAERS: 5 | US FAERS | |
| 32 | Choking | FAERS: 5 | US FAERS | |
| 33 | Injection site phlebitis | FAERS: 5 | US FAERS | |
| 34 | Myalgia | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 35 | Panniculitis | FAERS: 5 | US FAERS | |
| 36 | Visual Impairment | FAERS: 5 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 37 | jaundice | FAERS: 5 | US FAERS | |
| 38 | Constipation | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 39 | Hypotension | FAERS: 4 | US FAERS | |
| 40 | Overdose | FAERS: 4 | US FAERS | |
| 41 | Tremor | FAERS: 4 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 42 | Unevaluable event | FAERS: 4 | US FAERS | |
| 43 | Wheezing | FAERS: 4 | US FAERS | |
| 44 | Alanine Aminotransferase Increased | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 45 | Alopecia | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 46 | Angioedema | FAERS: 3 | US FAERS | |
| 47 | Asthma | FAERS: 3 | US FAERS | |
| 48 | Back Pain | FAERS: 3 | US FAERS | |
| 49 | Blood alkaline phosphatase increased | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 50 | Bone pain | FAERS: 3 | US FAERS | |
| 51 | Bronchitis | FAERS: 3 | US FAERS | |
| 52 | Chills | FAERS: 3 | US FAERS | |
| 53 | Chromaturia | FAERS: 3 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 54 | Clostridium test positive | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 55 | Discomfort | FAERS: 3 | US FAERS | |
| 56 | Dysgeusia | FAERS: 3 | US FAERS | |
| 57 | Gluten sensitivity | FAERS: 3 | US FAERS | |
| 58 | Joint swelling | FAERS: 3 | US FAERS | |
| 59 | Lethargy | FAERS: 3 | US FAERS | |
| 60 | Mental impairment | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 61 | Musculoskeletal stiffness | FAERS: 3 | US FAERS | |
| 62 | Myocardial Infarction | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 63 | Neutropenia | FAERS: 3 | US FAERS | |
| 64 | Nonspecific reaction | FAERS: 3 | US FAERS | |
| 65 | Pharmaceutical product complaint | FAERS: 3 | US FAERS | |
| 66 | Productive Cough | FAERS: 3 | US FAERS | |
| 67 | Swelling | FAERS: 3 | US FAERS | |
| 68 | Syncope | FAERS: 3 | US FAERS | |
| 69 | Adverse event | FAERS: 2 | US FAERS | |
| 70 | Agitation | FAERS: 2 | US FAERS | |
| 71 | Agranulocytosis | FAERS: 2 | US FAERS | |
| 72 | Amnesia | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 73 | Anaphylactic shock | FAERS: 2 | US FAERS | |
| 74 | Aspartate Aminotransferase Increased | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 75 | Atrial Fibrillation | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 76 | Blindness | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 77 | Blood iron decreased | FAERS: 2 | US FAERS | |
| 78 | Bronchospasm | FAERS: 2 | US FAERS | |
| 79 | Cerebrovascular accident | FAERS: 2 | US FAERS | |
| 80 | Chest discomfort | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 81 | Cholestasis | FAERS: 2 | US FAERS | |
| 82 | Cyanosis | FAERS: 2 | US FAERS | |
| 83 | Cytolytic hepatitis | FAERS: 2 | US FAERS | |
| 84 | Dementia | FAERS: 2 | US FAERS | |
| 85 | Dengue Fever | FAERS: 2 | US FAERS | |
| 86 | Depressed mood | FAERS: 2 | US FAERS | |
| 87 | Disorientation | FAERS: 2 | US FAERS | |
| 88 | Drug dispensing error | FAERS: 2 | US FAERS | |
| 89 | Drug exposure during pregnancy | FAERS: 2 | US FAERS | |
| 90 | Drug screen positive | FAERS: 2 | US FAERS | |
| 91 | Dry skin | FAERS: 2 | US FAERS | |
| 92 | Dysentery | FAERS: 2 | US FAERS | |
| 93 | Dysphonia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 94 | Flushing | FAERS: 2 | US FAERS | |
| 95 | Gastric pH decreased | FAERS: 2 | US FAERS | |
| 96 | Gastritis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 97 | Gastrointestinal Pain | FAERS: 2 | US FAERS | |
| 98 | General physical health deterioration | FAERS: 2 | US FAERS | |
| 99 | Glaucoma | FAERS: 2 | US FAERS | |
| 100 | Granulomatous dermatitis | FAERS: 2 | US FAERS | |
| 101 | Hepatic cancer metastatic | FAERS: 2 | US FAERS | |
| 102 | Hepatitis B | FAERS: 2 | US FAERS | |
| 103 | Hepatitis | FAERS: 2 | US FAERS | |
| 104 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 105 | Irritable Bowel Syndrome | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 106 | Lymphadenopathy | FAERS: 2 | US FAERS | |
| 107 | Medication Error | FAERS: 2 | US FAERS | |
| 108 | Memory impairment | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 109 | Micturition frequency decreased | FAERS: 2 | US FAERS | |
| 110 | Muscle tightness | FAERS: 2 | US FAERS | |
| 111 | Musculoskeletal Pain | FAERS: 2 | US FAERS | |
| 112 | Musculoskeletal discomfort | FAERS: 2 | US FAERS | |
| 113 | Nervousness | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 114 | Nocturia | FAERS: 2 | US FAERS | |
| 115 | Non-cardiac chest pain | FAERS: 2 | US FAERS | |
| 116 | Osteoporosis | FAERS: 2 | US FAERS | |
| 117 | Pallor | FAERS: 2 | US FAERS | |
| 118 | Palpitations | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 119 | Pancytopenia | FAERS: 2 | US FAERS | |
| 120 | Post-traumatic pain | FAERS: 2 | US FAERS | |
| 121 | Product use issue | FAERS: 2 | US FAERS | |
| 122 | Rash erythematous | FAERS: 2 | US FAERS | |
| 123 | Renal cyst | FAERS: 2 | US FAERS | |
| 124 | Respiratory distress | FAERS: 2 | US FAERS | |
| 125 | Somnolence | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 126 | Thrombocytopenia | FAERS: 2 | US FAERS | |
| 127 | Thrombosis | FAERS: 2 | US FAERS | |
| 128 | Toxic Epidermal Necrolysis | FAERS: 2 | US FAERS | |
| 129 | Urinary Retention | FAERS: 2 | US FAERS | |
| 130 | Urinary tract infection | FAERS: 2 | US FAERS | |
| 131 | Visual disturbance | FAERS: 2 | US FAERS | |
| 132 | Wound infection pseudomonas | FAERS: 2 | US FAERS | |
| 133 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 134 | 5'nucleotidase increased | FAERS: 1 | US FAERS | |
| 135 | Abscess | FAERS: 1 | US FAERS | |
| 136 | Acarodermatitis | FAERS: 1 | US FAERS | |
| 137 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 138 | Achlorhydria | FAERS: 1 | US FAERS | |
| 139 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 140 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 141 | Ageusia | FAERS: 1 | US FAERS | |
| 142 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 143 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 144 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 145 | Anosmia | FAERS: 1 | US FAERS | |
| 146 | Aphonia | FAERS: 1 | US FAERS | |
| 147 | Arthropathy | FAERS: 1 | US FAERS | |
| 148 | Ataxia | FAERS: 1 | US FAERS | |
| 149 | Biliary dilatation | FAERS: 1 | US FAERS | |
| 150 | Bilirubin conjugated increased | FAERS: 1 | US FAERS | |
| 151 | Blepharospasm | FAERS: 1 | US FAERS | |
| 152 | Blood calcium abnormal | FAERS: 1 | US FAERS | |
| 153 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 154 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 155 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 156 | Blood lactate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 157 | Blood urine present | FAERS: 1 | US FAERS | |
| 158 | Body temperature fluctuation | FAERS: 1 | US FAERS | |
| 159 | Bradycardia | FAERS: 1 | US FAERS | |
| 160 | Calcification of muscle | FAERS: 1 | US FAERS | |
| 161 | Cardiac discomfort | FAERS: 1 | US FAERS | |
| 162 | Carpal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 163 | Cataract | FAERS: 1 | US FAERS | |
| 164 | Choking sensation | FAERS: 1 | US FAERS | |
| 165 | Cholelithiasis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 166 | Clostridium difficile colitis | FAERS: 1 | US FAERS | |
| 167 | Clostridium difficile infection | FAERS: 1 | US FAERS | |
| 168 | Colitis | FAERS: 1 | US FAERS | |
| 169 | Completed Suicide | FAERS: 1 | US FAERS | |
| 170 | Dehydration | FAERS: 1 | US FAERS | |
| 171 | Delirium | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 172 | Dermatitis Herpetiformis | FAERS: 1 | US FAERS | |
| 173 | Dermatitis acneiform | FAERS: 1 | US FAERS | |
| 174 | Diabetes Insipidus | FAERS: 1 | US FAERS | |
| 175 | Diverticulitis | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 176 | Drug dose omission | FAERS: 1 | US FAERS | |
| 177 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 178 | Drug label confusion | FAERS: 1 | US FAERS | |
| 179 | Drug level increased | FAERS: 1 | US FAERS | |
| 180 | Drug name confusion | FAERS: 1 | US FAERS | |
| 181 | Drug screen false positive | FAERS: 1 | US FAERS | |
| 182 | Dysbacteriosis | FAERS: 1 | US FAERS | |
| 183 | Ecchymosis | FAERS: 1 | US FAERS | |
| 184 | Economic problem | FAERS: 1 | US FAERS | |
| 185 | Embolism | FAERS: 1 | US FAERS | |
| 186 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 187 | Excoriation | FAERS: 1 | US FAERS | |
| 188 | Eye Burns | FAERS: 1 | US FAERS | |
| 189 | Fluid overload | FAERS: 1 | US FAERS | |
| 190 | Gamma-Glutamyltransferase Increased | FAERS: 1 | US FAERS | |
| 191 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 192 | Gastrointestinal bacterial overgrowth | FAERS: 1 | US FAERS | |
| 193 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 194 | Gastrointestinal ulcer | FAERS: 1 | US FAERS | |
| 195 | Gliosis | FAERS: 1 | US FAERS | |
| 196 | Glomerulonephritis | FAERS: 1 | US FAERS | |
| 197 | Granulocyte count decreased | FAERS: 1 | US FAERS | |
| 198 | Hepatic necrosis | FAERS: 1 | US FAERS | |
| 199 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 200 | Hepatosplenomegaly | FAERS: 1 | US FAERS | |
| 201 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 202 | Hunger | FAERS: 1 | US FAERS | |
| 203 | Hyperchlorhydria | FAERS: 1 | US FAERS | |
| 204 | Hyperpyrexia | FAERS: 1 | US FAERS | |
| 205 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 206 | Hyperthyroidism | FAERS: 1 | US FAERS | |
| 207 | Hypoventilation | FAERS: 1 | US FAERS | |
| 208 | Ileitis | FAERS: 1 | US FAERS | |
| 209 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 210 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 211 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 212 | Infection | FAERS: 1 | US FAERS | |
| 213 | Initial insomnia | FAERS: 1 | US FAERS | |
| 214 | Injection site thrombosis | FAERS: 1 | US FAERS | |
| 215 | Intercepted product selection error | FAERS: 1 | US FAERS | |
| 216 | Iron deficiency | FAERS: 1 | US FAERS | |
| 217 | Joint injury | FAERS: 1 | US FAERS | |
| 218 | Joint stiffness | FAERS: 1 | US FAERS | |
| 219 | Laryngitis | FAERS: 1 | US FAERS | |
| 220 | Leukocytosis | FAERS: 1 | US FAERS | |
| 221 | Limb discomfort | FAERS: 1 | US FAERS | |
| 222 | Lip pruritus | FAERS: 1 | US FAERS | |
| 223 | Low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 224 | Lymphoma | FAERS: 1 | US FAERS | |
| 225 | Magnesium Deficiency | FAERS: 1 | US FAERS | |
| 226 | Malnutrition | FAERS: 1 | US FAERS | |
| 227 | Maternal exposure during breast feeding | FAERS: 1 | US FAERS | |
| 228 | Meniscus injury | FAERS: 1 | US FAERS | |
| 229 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 230 | Metaplasia | FAERS: 1 | US FAERS | |
| 231 | Metastasis | FAERS: 1 | US FAERS | |
| 232 | Mixed liver injury | FAERS: 1 | US FAERS | |
| 233 | Night sweats | FAERS: 1 | US FAERS | |
| 234 | No adverse event | FAERS: 1 | US FAERS | |
| 235 | No reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 236 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 237 | Oral pain | FAERS: 1 | US FAERS | |
| 238 | Osteitis | FAERS: 1 | US FAERS | |
| 239 | Pain of skin | FAERS: 1 | US FAERS | |
| 240 | Pancreatic duct dilatation | FAERS: 1 | US FAERS | |
| 241 | Pancreatic enzymes increased | FAERS: 1 | US FAERS | |
| 242 | Pancreatitis | FAERS: 1 | US FAERS | |
| 243 | Papillary muscle disorder | FAERS: 1 | US FAERS | |
| 244 | Performance status decreased | FAERS: 1 | US FAERS | |
| 245 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 246 | Phlebitis | FAERS: 1 | US FAERS | |
| 247 | Phobia of driving | FAERS: 1 | US FAERS | |
| 248 | Photophobia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 249 | Poisoning | FAERS: 1 | US FAERS | |
| 250 | Polyuria | FAERS: 1 | US FAERS | |
| 251 | Product coating issue | FAERS: 1 | US FAERS | |
| 252 | Product counterfeit | FAERS: 1 | US FAERS | |
| 253 | Product dispensing error | FAERS: 1 | US FAERS | |
| 254 | Product dose omission | FAERS: 1 | US FAERS | |
| 255 | Product measured potency issue | FAERS: 1 | US FAERS | |
| 256 | Protein S Deficiency | FAERS: 1 | US FAERS | |
| 257 | Psoriasis | FAERS: 1 | US FAERS | |
| 258 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 259 | Purpura | FAERS: 1 | US FAERS | |
| 260 | Regurgitation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 261 | Renal pain | FAERS: 1 | US FAERS | |
| 262 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 263 | Respiratory Failure | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 264 | Sarcoidosis | FAERS: 1 | US FAERS | |
| 265 | Secretion discharge | FAERS: 1 | US FAERS | |
| 266 | Shock | FAERS: 1 | US FAERS | |
| 267 | Sinusitis | FAERS: 1 | US FAERS | |
| 268 | Skin Papilloma | FAERS: 1 | US FAERS | |
| 269 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 270 | Skin reaction | FAERS: 1 | US FAERS | |
| 271 | Small intestine carcinoma | FAERS: 1 | US FAERS | |
| 272 | Splenomegaly | FAERS: 1 | US FAERS | |
| 273 | Sternitis | FAERS: 1 | US FAERS | |
| 274 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 275 | Stomatitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 276 | Suicide attempt | FAERS: 1 | US FAERS | |
| 277 | Thirst | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 278 | Throat irritation | FAERS: 1 | US FAERS | |
| 279 | Thrombophlebitis | FAERS: 1 | US FAERS | |
| 280 | Thrombosis in device | FAERS: 1 | US FAERS | |
| 281 | Transaminases increased | FAERS: 1 | US FAERS | |
| 282 | Transcription medication error | FAERS: 1 | US FAERS | |
| 283 | Trismus | FAERS: 1 | US FAERS | |
| 284 | Vascular access site occlusion | FAERS: 1 | US FAERS | |
| 285 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 286 | Vitreous opacities | FAERS: 1 | US FAERS | |
| 287 | Wart excision | FAERS: 1 | US FAERS | |
| 288 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 289 | Yawning | FAERS: 1 | US FAERS | |
| 290 | Fibromyalgia | Canada Vigilance: 1 | Canada Vigilance | |
| 291 | Incorrect product administration duration | Canada Vigilance: 1 | Canada Vigilance | |
| 292 | Intestinal Obstruction | Canada Vigilance: 1 | Canada Vigilance | |
| 293 | Neck Pain | Canada Vigilance: 1 | Canada Vigilance | |
| 294 | Poor quality sleep | Canada Vigilance: 1 | Canada Vigilance | |
| 295 | Reaction to excipient | Canada Vigilance: 1 | Canada Vigilance | |
| 296 | Therapeutic product effect decreased | Canada Vigilance: 2 | Canada Vigilance | |
| 297 | Therapy non-responder | Canada Vigilance: 1 | Canada Vigilance | |
| 298 | Tinnitus | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.