gadodiamide
(XPCLDSMKWNNKOM-UHFFFAOYSA-K)
Structure
- SMILES
- CNC(=O)CN(CC(=O)[O-])CCN(CC(=O)[O-])CCN(CC(=O)NC)CC(=O)[O-].O.[Gd+3]
- Molecular Formula:
- C16H28GdN5O9
- Molecular Weight:
- 591.672
- Log P:
- -6.6484
- Hydrogen Bond Acceptor:
- 14
- Hydrogen Bond Donor:
- 3
- TPSA:
- 197.54
- CAS Number(s):
- 122795-43-1
Synonym(s)
1.
gadodiamide
2.
Gd-DTPA bis-(methylamide)
3.
Gd-DTPA-BMA
4.
Omniscan
5.
Omniscan Unique Softpack
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Nephrogenic Systemic Fibrosis | FAERS: 852 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 2 | Nephrogenic Fibrosing Dermopathy | FAERS: 230 | US FAERS | |
| 3 | Pruritus | FAERS: 60 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 4 | Arthralgia | FAERS: 58 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 5 | Nausea | FAERS: 49 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 6 | Erythema | FAERS: 44 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 7 | Vomiting | FAERS: 43 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 8 | Pain | FAERS: 39 | US FAERS | |
| 9 | Fibrosis | FAERS: 35 | US FAERS | |
| 10 | Asthenia | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 11 | Urticaria | FAERS: 29 Canada Vigilance: 16 | Canada Vigilance US FAERS | |
| 12 | Dizziness | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 13 | Headache | FAERS: 26 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 14 | Myalgia | FAERS: 24 | US FAERS | |
| 15 | Biopsy brain abnormal | FAERS: 23 | US FAERS | |
| 16 | Fatigue | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 17 | Hypotension | FAERS: 21 | US FAERS | |
| 18 | Hypersensitivity | FAERS: 20 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 19 | Burning sensation | FAERS: 18 | US FAERS | |
| 20 | Malaise | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 21 | Palpitations | FAERS: 18 | US FAERS | |
| 22 | Pneumonia | FAERS: 17 | US FAERS | |
| 23 | Sepsis | FAERS: 17 | US FAERS | |
| 24 | Activities of daily living impaired | FAERS: 16 | US FAERS | |
| 25 | Musculoskeletal stiffness | FAERS: 16 | US FAERS | |
| 26 | Skin hypertrophy | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 27 | Weight decreased | FAERS: 16 | US FAERS | |
| 28 | Wheelchair user | FAERS: 15 | US FAERS | |
| 29 | Anisocytosis | FAERS: 14 | US FAERS | |
| 30 | Throat irritation | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 31 | Alopecia | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 32 | Anxiety | FAERS: 13 | US FAERS | |
| 33 | Skin Induration | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 34 | Back Pain | FAERS: 12 | US FAERS | |
| 35 | Eczema | FAERS: 12 | US FAERS | |
| 36 | Incorrect dose administered | FAERS: 12 | US FAERS | |
| 37 | Bone pain | FAERS: 11 | US FAERS | |
| 38 | Chills | FAERS: 11 | US FAERS | |
| 39 | Contrast media reaction | FAERS: 11 | US FAERS | |
| 40 | General physical health deterioration | FAERS: 11 | US FAERS | |
| 41 | Abasia | FAERS: 10 | US FAERS | |
| 42 | Abdominal Pain | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 43 | Blood creatinine increased | FAERS: 10 | US FAERS | |
| 44 | Drug ineffective | FAERS: 10 | US FAERS | |
| 45 | Gadolinium deposition disease | FAERS: 10 | US FAERS | |
| 46 | No adverse event | FAERS: 10 | US FAERS | |
| 47 | Scleroderma | FAERS: 10 | US FAERS | |
| 48 | Skin tightness | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 49 | Amnesia | FAERS: 9 | US FAERS | |
| 50 | Anaphylactoid Reaction | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 51 | Inflammation | FAERS: 9 | US FAERS | |
| 52 | Pulmonary Embolism | FAERS: 9 | US FAERS | |
| 53 | Red blood cell target cells present | FAERS: 9 | US FAERS | |
| 54 | Tremor | FAERS: 9 | US FAERS | |
| 55 | Chest Pain | FAERS: 8 | US FAERS | |
| 56 | Cold sweat | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 57 | Joint Range of Motion Decreased | FAERS: 8 | US FAERS | |
| 58 | Post procedural complication | FAERS: 8 | US FAERS | |
| 59 | Procedural complication | FAERS: 8 | US FAERS | |
| 60 | Respiratory Failure | FAERS: 8 | US FAERS | |
| 61 | Shock | FAERS: 8 | US FAERS | |
| 62 | Swelling | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 63 | Cellulitis | FAERS: 7 | US FAERS | |
| 64 | Feeling abnormal | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 65 | Joint swelling | FAERS: 7 | US FAERS | |
| 66 | Pain of skin | FAERS: 7 | US FAERS | |
| 67 | Restless Legs Syndrome | FAERS: 7 | US FAERS | |
| 68 | Tachycardia | FAERS: 7 | US FAERS | |
| 69 | Visual Impairment | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 70 | Cardiac Arrest | FAERS: 6 | US FAERS | |
| 71 | Chest discomfort | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 72 | Emotional distress | FAERS: 6 | US FAERS | |
| 73 | Eye pain | FAERS: 6 | US FAERS | |
| 74 | Immobile | FAERS: 6 | US FAERS | |
| 75 | Joint stiffness | FAERS: 6 | US FAERS | |
| 76 | Musculoskeletal Pain | FAERS: 6 | US FAERS | |
| 77 | Sneezing | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 78 | Subcutaneous nodule | FAERS: 6 | US FAERS | |
| 79 | Syncope | FAERS: 6 | US FAERS | |
| 80 | treatment failure | FAERS: 6 | US FAERS | |
| 81 | Anaphylactic shock | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 82 | Blood iron increased | FAERS: 5 | US FAERS | |
| 83 | Cachexia | FAERS: 5 | US FAERS | |
| 84 | Disease Progression | FAERS: 5 | US FAERS | |
| 85 | Drug clearance decreased | FAERS: 5 | US FAERS | |
| 86 | Dry skin | FAERS: 5 | US FAERS | |
| 87 | Dysphonia | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 88 | Flushing | FAERS: 5 | US FAERS | |
| 89 | Induration | FAERS: 5 | US FAERS | |
| 90 | Infection | FAERS: 5 | US FAERS | |
| 91 | Metabolic acidosis | FAERS: 5 | US FAERS | |
| 92 | Panniculitis | FAERS: 5 | US FAERS | |
| 93 | Peritoneal Dialysis | FAERS: 5 | US FAERS | |
| 94 | Peritonitis | FAERS: 5 | US FAERS | |
| 95 | Polyneuropathy | FAERS: 5 | US FAERS | |
| 96 | Retching | FAERS: 5 | US FAERS | |
| 97 | Transferrin saturation increased | FAERS: 5 | US FAERS | |
| 98 | nervous system disorder | FAERS: 5 | US FAERS | |
| 99 | Bedridden | FAERS: 4 | US FAERS | |
| 100 | Blood parathyroid hormone increased | FAERS: 4 | US FAERS | |
| 101 | Calcinosis | FAERS: 4 | US FAERS | |
| 102 | Cerebrovascular accident | FAERS: 4 | US FAERS | |
| 103 | Depressed Level of Consciousness | FAERS: 4 | US FAERS | |
| 104 | Depressed mood | FAERS: 4 | US FAERS | |
| 105 | Disease complication | FAERS: 4 | US FAERS | |
| 106 | Dysgeusia | FAERS: 4 | US FAERS | |
| 107 | Dysuria | FAERS: 4 | US FAERS | |
| 108 | Fluid overload | FAERS: 4 | US FAERS | |
| 109 | Impaired work ability | FAERS: 4 | US FAERS | |
| 110 | Initial insomnia | FAERS: 4 | US FAERS | |
| 111 | Intermittent Claudication | FAERS: 4 | US FAERS | |
| 112 | Malnutrition | FAERS: 4 | US FAERS | |
| 113 | Medication residue present | FAERS: 4 | US FAERS | |
| 114 | Myocardial fibrosis | FAERS: 4 | US FAERS | |
| 115 | Myopathy | FAERS: 4 | US FAERS | |
| 116 | Myositis | FAERS: 4 | US FAERS | |
| 117 | Nephrotic Syndrome | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 118 | Poikilocytosis | FAERS: 4 | US FAERS | |
| 119 | Rash erythematous | FAERS: 4 | US FAERS | |
| 120 | Renal tubular necrosis | FAERS: 4 | US FAERS | |
| 121 | Respiratory arrest | FAERS: 4 | US FAERS | |
| 122 | Rhabdomyolysis | FAERS: 4 | US FAERS | |
| 123 | Septic Shock | FAERS: 4 | US FAERS | |
| 124 | Skin lesion | FAERS: 4 | US FAERS | |
| 125 | Sudden Cardiac Death | FAERS: 4 | US FAERS | |
| 126 | Adverse event | FAERS: 3 | US FAERS | |
| 127 | Altered state of consciousness | FAERS: 3 | US FAERS | |
| 128 | Arthropathy | FAERS: 3 | US FAERS | |
| 129 | Blindness | FAERS: 3 | US FAERS | |
| 130 | Bone scan abnormal | FAERS: 3 | US FAERS | |
| 131 | Cerebral calcification | FAERS: 3 | US FAERS | |
| 132 | Contrast media deposition | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 133 | Deep Vein Thrombosis | FAERS: 3 | US FAERS | |
| 134 | Dependence on enabling machine or device | FAERS: 3 | US FAERS | |
| 135 | Disorientation | FAERS: 3 | US FAERS | |
| 136 | Gout | FAERS: 3 | US FAERS | |
| 137 | Grip strength decreased | FAERS: 3 | US FAERS | |
| 138 | Hypokinesia | FAERS: 3 | US FAERS | |
| 139 | Incorrect route of drug administration | FAERS: 3 | US FAERS | |
| 140 | Leukocytosis | FAERS: 3 | US FAERS | |
| 141 | Malignant Fibrous Histiocytoma | FAERS: 3 | US FAERS | |
| 142 | Musculoskeletal chest pain | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 143 | Neck Pain | FAERS: 3 | US FAERS | |
| 144 | Oral fungal infection | FAERS: 3 | US FAERS | |
| 145 | Pallor | FAERS: 3 | US FAERS | |
| 146 | Pancreatitis | FAERS: 3 | US FAERS | |
| 147 | Papule | FAERS: 3 | US FAERS | |
| 148 | Pathogen resistance | FAERS: 3 | US FAERS | |
| 149 | Petechiae | FAERS: 3 | US FAERS | |
| 150 | Sudden death | FAERS: 3 | US FAERS | |
| 151 | Thrombosis | FAERS: 3 | US FAERS | |
| 152 | Visual disturbance | FAERS: 3 | US FAERS | |
| 153 | Abdominal discomfort | FAERS: 2 | US FAERS | |
| 154 | Ageusia | FAERS: 2 | US FAERS | |
| 155 | Angina Pectoris | FAERS: 2 | US FAERS | |
| 156 | Arteriovenous fistula | FAERS: 2 | US FAERS | |
| 157 | Atrial Fibrillation | FAERS: 2 | US FAERS | |
| 158 | Atrial Flutter | FAERS: 2 | US FAERS | |
| 159 | Bacterial sepsis | FAERS: 2 | US FAERS | |
| 160 | Biopsy muscle abnormal | FAERS: 2 | US FAERS | |
| 161 | Blood albumin decreased | FAERS: 2 | US FAERS | |
| 162 | Blood pressure fluctuation | FAERS: 2 | US FAERS | |
| 163 | Carpal Tunnel Syndrome | FAERS: 2 | US FAERS | |
| 164 | Chromaturia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 165 | Cyanosis | FAERS: 2 | US FAERS | |
| 166 | Dehydration | FAERS: 2 | US FAERS | |
| 167 | Dermatitis Herpetiformis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 168 | Discomfort | FAERS: 2 | US FAERS | |
| 169 | Disease recurrence | FAERS: 2 | US FAERS | |
| 170 | Electrolyte imbalance | FAERS: 2 | US FAERS | |
| 171 | Feeling Cold | FAERS: 2 | US FAERS | |
| 172 | Feeling of body temperature change | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 173 | Gangrene | FAERS: 2 | US FAERS | |
| 174 | Hepatic congestion | FAERS: 2 | US FAERS | |
| 175 | Incoherent | FAERS: 2 | US FAERS | |
| 176 | Injection site pain | FAERS: 2 | US FAERS | |
| 177 | Intracranial Aneurysm | FAERS: 2 | US FAERS | |
| 178 | Left Ventricular Hypertrophy | FAERS: 2 | US FAERS | |
| 179 | Medication Error | FAERS: 2 | US FAERS | |
| 180 | Mental impairment | FAERS: 2 | US FAERS | |
| 181 | Muscle Rigidity | FAERS: 2 | US FAERS | |
| 182 | Muscle fibrosis | FAERS: 2 | US FAERS | |
| 183 | Myocardial Infarction | FAERS: 2 | US FAERS | |
| 184 | Myoclonus | FAERS: 2 | US FAERS | |
| 185 | Neuralgia | FAERS: 2 | US FAERS | |
| 186 | Oliguria | FAERS: 2 | US FAERS | |
| 187 | Overdose | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 188 | Paresis | FAERS: 2 | US FAERS | |
| 189 | Pelvic abscess | FAERS: 2 | US FAERS | |
| 190 | Pharmaceutical product complaint | FAERS: 2 | US FAERS | |
| 191 | Physical examination abnormal | FAERS: 2 | US FAERS | |
| 192 | Pleurisy | FAERS: 2 | US FAERS | |
| 193 | Podagra | FAERS: 2 | US FAERS | |
| 194 | Poor quality sleep | FAERS: 2 | US FAERS | |
| 195 | Presyncope | FAERS: 2 | US FAERS | |
| 196 | Prostatic pain | FAERS: 2 | US FAERS | |
| 197 | Purpura | FAERS: 2 | US FAERS | |
| 198 | Red blood cell spherocytes present | FAERS: 2 | US FAERS | |
| 199 | Renal Artery Stenosis | FAERS: 2 | US FAERS | |
| 200 | Renal cyst | FAERS: 2 | US FAERS | |
| 201 | Respiratory distress | FAERS: 2 | US FAERS | |
| 202 | Sclerema | FAERS: 2 | US FAERS | |
| 203 | Sclerosing encapsulating peritonitis | FAERS: 2 | US FAERS | |
| 204 | Thirst | FAERS: 2 | US FAERS | |
| 205 | Tumour haemorrhage | FAERS: 2 | US FAERS | |
| 206 | Unevaluable event | FAERS: 2 | US FAERS | |
| 207 | Unresponsive to stimuli | FAERS: 2 | US FAERS | |
| 208 | Urinary Incontinence | FAERS: 2 | US FAERS | |
| 209 | Urinary tract infection | FAERS: 2 | US FAERS | |
| 210 | Walking aid user | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 211 | Wound Complication | FAERS: 2 | US FAERS | |
| 212 | Abdominal Infection | FAERS: 1 | US FAERS | |
| 213 | Abdominal adhesions | FAERS: 1 | US FAERS | |
| 214 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 215 | Accidental exposure | FAERS: 1 | US FAERS | |
| 216 | Acute prerenal failure | FAERS: 1 | US FAERS | |
| 217 | Agitation | FAERS: 1 | US FAERS | |
| 218 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 219 | Amputation | FAERS: 1 | US FAERS | |
| 220 | Anorexia | FAERS: 1 | US FAERS | |
| 221 | Anoxia | FAERS: 1 | US FAERS | |
| 222 | Aphonia | FAERS: 1 | US FAERS | |
| 223 | Arterial thrombosis | FAERS: 1 | US FAERS | |
| 224 | Arteriosclerosis | FAERS: 1 | US FAERS | |
| 225 | Arteriovenous fistula thrombosis | FAERS: 1 | US FAERS | |
| 226 | Arteriovenous graft thrombosis | FAERS: 1 | US FAERS | |
| 227 | Ascites | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 228 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 229 | Asthma | FAERS: 1 | US FAERS | |
| 230 | Bile Duct Stenosis | FAERS: 1 | US FAERS | |
| 231 | Biopsy lung abnormal | FAERS: 1 | US FAERS | |
| 232 | Biopsy skin abnormal | FAERS: 1 | US FAERS | |
| 233 | Bladder discomfort | FAERS: 1 | US FAERS | |
| 234 | Blood albumin increased | FAERS: 1 | US FAERS | |
| 235 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 236 | Blood count abnormal | FAERS: 1 | US FAERS | |
| 237 | Blood phosphorus increased | FAERS: 1 | US FAERS | |
| 238 | Brain Death | FAERS: 1 | US FAERS | |
| 239 | Bronchial secretion retention | FAERS: 1 | US FAERS | |
| 240 | Calciphylaxis | FAERS: 1 | US FAERS | |
| 241 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 242 | Catheter related infection | FAERS: 1 | US FAERS | |
| 243 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 244 | Cerebral Thrombosis | FAERS: 1 | US FAERS | |
| 245 | Choking sensation | FAERS: 1 | US FAERS | |
| 246 | Contrast media allergy | FAERS: 1 | US FAERS | |
| 247 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 248 | Cystitis | FAERS: 1 | US FAERS | |
| 249 | Deafness | FAERS: 1 | US FAERS | |
| 250 | Deformity | FAERS: 1 | US FAERS | |
| 251 | Dependence on oxygen therapy | FAERS: 1 | US FAERS | |
| 252 | Device occlusion | FAERS: 1 | US FAERS | |
| 253 | Diabetic Nephropathy | FAERS: 1 | US FAERS | |
| 254 | Diverticular perforation | FAERS: 1 | US FAERS | |
| 255 | Drug administration error | FAERS: 1 | US FAERS | |
| 256 | Drug level increased | FAERS: 1 | US FAERS | |
| 257 | Duodenal Ulcer | FAERS: 1 | US FAERS | |
| 258 | Dyspepsia | FAERS: 1 | US FAERS | |
| 259 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 260 | Emotional disorder | FAERS: 1 | US FAERS | |
| 261 | Endocarditis | FAERS: 1 | US FAERS | |
| 262 | Endotracheal intubation complication | FAERS: 1 | US FAERS | |
| 263 | Enterococcal infection | FAERS: 1 | US FAERS | |
| 264 | Eosinophilic Fasciitis | FAERS: 1 | US FAERS | |
| 265 | Eructation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 266 | Escherichia infection | FAERS: 1 | US FAERS | |
| 267 | Exposure to toxic agent | FAERS: 1 | US FAERS | |
| 268 | Extravasation | FAERS: 1 | US FAERS | |
| 269 | Extremity contracture | FAERS: 1 | US FAERS | |
| 270 | Facial paralysis | FAERS: 1 | US FAERS | |
| 271 | Foaming at mouth | FAERS: 1 | US FAERS | |
| 272 | Foreign body sensation in eyes | FAERS: 1 | US FAERS | |
| 273 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 274 | Gaze palsy | FAERS: 1 | US FAERS | |
| 275 | Head discomfort | FAERS: 1 | US FAERS | |
| 276 | Hemiparesis | FAERS: 1 | US FAERS | |
| 277 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 278 | Hyperacusis | FAERS: 1 | US FAERS | |
| 279 | Hypercapnia | FAERS: 1 | US FAERS | |
| 280 | Hyperkeratosis | FAERS: 1 | US FAERS | |
| 281 | Hypertrophic Cardiomyopathy | FAERS: 1 | US FAERS | |
| 282 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 283 | Immobilization prolonged | FAERS: 1 | US FAERS | |
| 284 | Impaired self-care | FAERS: 1 | US FAERS | |
| 285 | Incontinence | FAERS: 1 | US FAERS | |
| 286 | Increased tendency to bruise | FAERS: 1 | US FAERS | |
| 287 | Injection site burning | FAERS: 1 | US FAERS | |
| 288 | Injection site erythema | FAERS: 1 | US FAERS | |
| 289 | Injection site extravasation | FAERS: 1 | US FAERS | |
| 290 | Injection site pruritus | FAERS: 1 | US FAERS | |
| 291 | Intestinal Fistula | FAERS: 1 | US FAERS | |
| 292 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 293 | Intestinal Perforation | FAERS: 1 | US FAERS | |
| 294 | Intestinal infarction | FAERS: 1 | US FAERS | |
| 295 | Laceration | FAERS: 1 | US FAERS | |
| 296 | Lethargy | FAERS: 1 | US FAERS | |
| 297 | Ligament pain | FAERS: 1 | US FAERS | |
| 298 | Lipoma | FAERS: 1 | US FAERS | |
| 299 | Localised intraabdominal fluid collection | FAERS: 1 | US FAERS | |
| 300 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 301 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 302 | Lung adenocarcinoma stage 0 | FAERS: 1 | US FAERS | |
| 303 | Lung squamous cell carcinoma stage I | FAERS: 1 | US FAERS | |
| 304 | Lupus Nephritis | FAERS: 1 | US FAERS | |
| 305 | Lupus encephalitis | FAERS: 1 | US FAERS | |
| 306 | Lymphocele | FAERS: 1 | US FAERS | |
| 307 | Lymphocytic infiltration | FAERS: 1 | US FAERS | |
| 308 | Male sexual dysfunction | FAERS: 1 | US FAERS | |
| 309 | Mass excision | FAERS: 1 | US FAERS | |
| 310 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 311 | Mechanical ventilation | FAERS: 1 | US FAERS | |
| 312 | Meningeal disorder | FAERS: 1 | US FAERS | |
| 313 | Mental status changes | FAERS: 1 | US FAERS | |
| 314 | Mood swings | FAERS: 1 | US FAERS | |
| 315 | Multi-organ disorder | FAERS: 1 | US FAERS | |
| 316 | Muscle Cramp | FAERS: 1 | US FAERS | |
| 317 | Muscle necrosis | FAERS: 1 | US FAERS | |
| 318 | Myosclerosis | FAERS: 1 | US FAERS | |
| 319 | Nasal discomfort | FAERS: 1 | US FAERS | |
| 320 | Necrosis | FAERS: 1 | US FAERS | |
| 321 | Nephroangiosclerosis | FAERS: 1 | US FAERS | |
| 322 | Nephrocalcinosis | FAERS: 1 | US FAERS | |
| 323 | No reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 324 | Nodule | FAERS: 1 | US FAERS | |
| 325 | Occupational exposure to product | FAERS: 1 | US FAERS | |
| 326 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 327 | Ocular icterus | FAERS: 1 | US FAERS | |
| 328 | Open wound | FAERS: 1 | US FAERS | |
| 329 | Oral pain | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 330 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 331 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 332 | Pelvic Pain | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 333 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 334 | Peripheral artery dissection | FAERS: 1 | US FAERS | |
| 335 | Photophobia | FAERS: 1 | US FAERS | |
| 336 | Plasmapheresis | FAERS: 1 | US FAERS | |
| 337 | Pleuritic pain | FAERS: 1 | US FAERS | |
| 338 | Portal Vein Thrombosis | FAERS: 1 | US FAERS | |
| 339 | Posterior reversible encephalopathy syndrome | FAERS: 1 | US FAERS | |
| 340 | Postoperative renal failure | FAERS: 1 | US FAERS | |
| 341 | Posturing | FAERS: 1 | US FAERS | |
| 342 | Product label issue | FAERS: 1 | US FAERS | |
| 343 | Protein total decreased | FAERS: 1 | US FAERS | |
| 344 | Psoriasis | FAERS: 1 | US FAERS | |
| 345 | Quadriplegia | FAERS: 1 | US FAERS | |
| 346 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 347 | Restlessness | FAERS: 1 | US FAERS | |
| 348 | Restrictive pulmonary disease | FAERS: 1 | US FAERS | |
| 349 | Retroperitoneal fibrosis | FAERS: 1 | US FAERS | |
| 350 | Schirmer's test abnormal | FAERS: 1 | US FAERS | |
| 351 | Secretion discharge | FAERS: 1 | US FAERS | |
| 352 | Sense of oppression | FAERS: 1 | US FAERS | |
| 353 | Shunt occlusion | FAERS: 1 | US FAERS | |
| 354 | Sigmoiditis | FAERS: 1 | US FAERS | |
| 355 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 356 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 357 | Skin irritation | FAERS: 1 | US FAERS | |
| 358 | Skin necrosis | FAERS: 1 | US FAERS | |
| 359 | Skin reaction | FAERS: 1 | US FAERS | |
| 360 | Skin texture abnormal | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 361 | Skin toxicity | FAERS: 1 | US FAERS | |
| 362 | Splenomegaly | FAERS: 1 | US FAERS | |
| 363 | Splinter | FAERS: 1 | US FAERS | |
| 364 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 365 | Stridor | FAERS: 1 | US FAERS | |
| 366 | Stupor | FAERS: 1 | US FAERS | |
| 367 | Subileus | FAERS: 1 | US FAERS | |
| 368 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 369 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 370 | Thrombocytosis | FAERS: 1 | US FAERS | |
| 371 | Tinnitus | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 372 | Tongue pruritus | FAERS: 1 | US FAERS | |
| 373 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 374 | Ulcer | FAERS: 1 | US FAERS | |
| 375 | Varicocele | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 376 | Vascular calcification | FAERS: 1 | US FAERS | |
| 377 | Vascular stenosis | FAERS: 1 | US FAERS | |
| 378 | Vasculitis | FAERS: 1 | US FAERS | |
| 379 | Vertigo | FAERS: 1 | US FAERS | |
| 380 | Wound dehiscence | FAERS: 1 | US FAERS | |
| 381 | Wound infection bacterial | FAERS: 1 | US FAERS | |
| 382 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 383 | Xerosis | FAERS: 1 | US FAERS | |
| 384 | Yawning | FAERS: 1 | US FAERS | |
| 385 | jaundice | FAERS: 1 | US FAERS | |
| 386 | Blood creatine decreased | Canada Vigilance: 1 | Canada Vigilance | |
| 387 | Peripheral swelling | Canada Vigilance: 1 | Canada Vigilance | |
| 388 | Pharyngeal swelling | Canada Vigilance: 1 | Canada Vigilance | |
| 389 | Protein S decreased | Canada Vigilance: 1 | Canada Vigilance | |
| 390 | Wheezing | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.