aclidinium bromide
(XLAKJQPTOJHYDR-QTQXQZBYSA-M)
Structure
- SMILES
- O=C(C(c1cccs1)(c1cccs1)O)O[C@H]1C[N+]2(CCCOc3ccccc3)CCC1CC2.[Br-]
- Molecular Formula:
- C26H30BrNO4S2
- Molecular Weight:
- 564.555
- Log P:
- 1.6296
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 1
- TPSA:
- 112.24
- CAS Number(s):
- 320345-99-1
Synonym(s)
1.
aclidinium bromide
2.
(3R)-3-((hydroxy(di-2-thienyl)acetyl)oxy)-1-(3-phenoxypropyl)-1-azoniabicyclo(2.2.2)octane bromide
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Device malfunction | FAERS: 548 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 2 | Drug dose omission | FAERS: 498 | US FAERS | |
| 3 | Product quality issue | FAERS: 435 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 4 | Intentional product misuse | FAERS: 312 | US FAERS | |
| 5 | Intentional device misuse | FAERS: 143 | US FAERS | |
| 6 | Device Failure | FAERS: 119 | US FAERS | |
| 7 | Malaise | FAERS: 82 | US FAERS | |
| 8 | Product use issue | FAERS: 78 | US FAERS | |
| 9 | Circumstance or information capable of leading to medication error | FAERS: 74 | US FAERS | |
| 10 | Memory impairment | FAERS: 71 | US FAERS | |
| 11 | Pneumonia | FAERS: 65 | US FAERS | |
| 12 | Product use in unapproved indication | FAERS: 65 | US FAERS | |
| 13 | Visual Impairment | FAERS: 59 | US FAERS | |
| 14 | Product dose omission | FAERS: 58 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 15 | Fatigue | FAERS: 55 | US FAERS | |
| 16 | Feeling abnormal | FAERS: 46 | US FAERS | |
| 17 | Drug ineffective | FAERS: 45 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 18 | Dysgeusia | FAERS: 43 | US FAERS | |
| 19 | Dysphonia | FAERS: 43 | US FAERS | |
| 20 | Dizziness | FAERS: 41 | US FAERS | |
| 21 | Wrong technique in product usage process | FAERS: 39 | US FAERS | |
| 22 | Asthma | FAERS: 34 | US FAERS | |
| 23 | Device defective | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 24 | Product taste abnormal | FAERS: 33 | US FAERS | |
| 25 | Wrong technique in device usage process | FAERS: 32 | US FAERS | |
| 26 | Asthenia | FAERS: 28 | US FAERS | |
| 27 | Anxiety | FAERS: 27 | US FAERS | |
| 28 | Weight decreased | FAERS: 27 | US FAERS | |
| 29 | Headache | FAERS: 24 | US FAERS | |
| 30 | Incorrect dose administered | FAERS: 24 | US FAERS | |
| 31 | Nasopharyngitis | FAERS: 23 | US FAERS | |
| 32 | Cataract | FAERS: 21 | US FAERS | |
| 33 | Bronchitis | FAERS: 20 | US FAERS | |
| 34 | Wheezing | FAERS: 20 | US FAERS | |
| 35 | Intentional product use issue | FAERS: 19 | US FAERS | |
| 36 | Frustration tolerance decreased | FAERS: 17 | US FAERS | |
| 37 | Nervousness | FAERS: 17 | US FAERS | |
| 38 | Stress | FAERS: 17 | US FAERS | |
| 39 | Cerebrovascular accident | FAERS: 16 | US FAERS | |
| 40 | Oropharyngeal pain | FAERS: 15 | US FAERS | |
| 41 | Atrial Fibrillation | FAERS: 13 | US FAERS | |
| 42 | Dementia | FAERS: 13 | US FAERS | |
| 43 | Pain | FAERS: 13 | US FAERS | |
| 44 | Chest discomfort | FAERS: 12 | US FAERS | |
| 45 | Nausea | FAERS: 12 | US FAERS | |
| 46 | Aphonia | FAERS: 11 | US FAERS | |
| 47 | Diabetes Mellitus | FAERS: 11 | US FAERS | |
| 48 | Laryngitis | FAERS: 11 | US FAERS | |
| 49 | Palpitations | FAERS: 11 | US FAERS | |
| 50 | Throat irritation | FAERS: 11 | US FAERS | |
| 51 | Chest Pain | FAERS: 10 | US FAERS | |
| 52 | Medication Error | FAERS: 10 | US FAERS | |
| 53 | Productive Cough | FAERS: 10 | US FAERS | |
| 54 | Abdominal discomfort | FAERS: 9 | US FAERS | |
| 55 | Adverse event | FAERS: 9 | US FAERS | |
| 56 | Amnesia | FAERS: 9 | US FAERS | |
| 57 | Extra dose administered | FAERS: 9 | US FAERS | |
| 58 | Tremor | FAERS: 9 | US FAERS | |
| 59 | Urinary Retention | FAERS: 9 | US FAERS | |
| 60 | Vomiting | FAERS: 9 | US FAERS | |
| 61 | Blindness | FAERS: 8 | US FAERS | |
| 62 | Drug dose omission by device | FAERS: 8 | US FAERS | |
| 63 | Hypersensitivity | FAERS: 7 | US FAERS | |
| 64 | Myocardial Infarction | FAERS: 7 | US FAERS | |
| 65 | Respiratory tract congestion | FAERS: 7 | US FAERS | |
| 66 | Sepsis | FAERS: 7 | US FAERS | |
| 67 | Activities of daily living impaired | FAERS: 6 | US FAERS | |
| 68 | Agitation | FAERS: 6 | US FAERS | |
| 69 | Anger | FAERS: 6 | US FAERS | |
| 70 | Circumstance or information capable of leading to device use error | FAERS: 6 | US FAERS | |
| 71 | Dehydration | FAERS: 6 | US FAERS | |
| 72 | Depressed mood | FAERS: 6 | US FAERS | |
| 73 | Device use issue | FAERS: 6 | US FAERS | |
| 74 | Dysuria | FAERS: 6 | US FAERS | |
| 75 | General physical health deterioration | FAERS: 6 | US FAERS | |
| 76 | Influenza | FAERS: 6 | US FAERS | |
| 77 | Mental impairment | FAERS: 6 | US FAERS | |
| 78 | Overdose | FAERS: 6 | US FAERS | |
| 79 | Product label issue | FAERS: 6 | US FAERS | |
| 80 | Pruritus | FAERS: 6 | US FAERS | |
| 81 | Sinusitis | FAERS: 6 | US FAERS | |
| 82 | Therapy cessation | FAERS: 6 | US FAERS | |
| 83 | Arthralgia | FAERS: 5 | US FAERS | |
| 84 | Deafness | FAERS: 5 | US FAERS | |
| 85 | Device difficult to use | FAERS: 5 | US FAERS | |
| 86 | Disability | FAERS: 5 | US FAERS | |
| 87 | Loss of personal independence in daily activities | FAERS: 5 | US FAERS | |
| 88 | Macular degeneration | FAERS: 5 | US FAERS | |
| 89 | Pulmonary Hypertension | FAERS: 5 | US FAERS | |
| 90 | Somnolence | FAERS: 5 | US FAERS | |
| 91 | Stomatitis | FAERS: 5 | US FAERS | |
| 92 | Syncope | FAERS: 5 | US FAERS | |
| 93 | Urticaria | FAERS: 5 | US FAERS | |
| 94 | Arthritis | FAERS: 4 | US FAERS | |
| 95 | Back disorder | FAERS: 4 | US FAERS | |
| 96 | Choking | FAERS: 4 | US FAERS | |
| 97 | Epistaxis | FAERS: 4 | US FAERS | |
| 98 | Hernia | FAERS: 4 | US FAERS | |
| 99 | Oral pain | FAERS: 4 | US FAERS | |
| 100 | Pneumothorax | FAERS: 4 | US FAERS | |
| 101 | Product physical issue | FAERS: 4 | US FAERS | |
| 102 | Pulmonary congestion | FAERS: 4 | US FAERS | |
| 103 | Respiratory Failure | FAERS: 4 | US FAERS | |
| 104 | Respiratory distress | FAERS: 4 | US FAERS | |
| 105 | Secretion discharge | FAERS: 4 | US FAERS | |
| 106 | Throat cancer | FAERS: 4 | US FAERS | |
| 107 | Accidental overdose | FAERS: 3 | US FAERS | |
| 108 | Ageusia | FAERS: 3 | US FAERS | |
| 109 | Back Pain | FAERS: 3 | US FAERS | |
| 110 | Bronchospasm | FAERS: 3 | US FAERS | |
| 111 | Clostridium difficile colitis | FAERS: 3 | US FAERS | |
| 112 | Clostridium difficile infection | FAERS: 3 | US FAERS | |
| 113 | Drug Dependence | FAERS: 3 | US FAERS | |
| 114 | Eye pain | FAERS: 3 | US FAERS | |
| 115 | Feeling jittery | FAERS: 3 | US FAERS | |
| 116 | Gastrointestinal infection | FAERS: 3 | US FAERS | |
| 117 | Gastrointestinal perforation | FAERS: 3 | US FAERS | |
| 118 | Glaucoma | FAERS: 3 | US FAERS | |
| 119 | Joint swelling | FAERS: 3 | US FAERS | |
| 120 | Lip swelling | FAERS: 3 | US FAERS | |
| 121 | Lower respiratory tract infection | FAERS: 3 | US FAERS | |
| 122 | Multiple Sclerosis | FAERS: 3 | US FAERS | |
| 123 | Neck Pain | FAERS: 3 | US FAERS | |
| 124 | Osteoporosis | FAERS: 3 | US FAERS | |
| 125 | Overweight | FAERS: 3 | US FAERS | |
| 126 | Pulmonary function test decreased | FAERS: 3 | US FAERS | |
| 127 | Pulmonary pain | FAERS: 3 | US FAERS | |
| 128 | Rheumatoid Arthritis | FAERS: 3 | US FAERS | |
| 129 | Sleep disorder due to general medical condition, insomnia type | FAERS: 3 | US FAERS | |
| 130 | Sneezing | FAERS: 3 | US FAERS | |
| 131 | Swelling | FAERS: 3 | US FAERS | |
| 132 | Tachycardia | FAERS: 3 | US FAERS | |
| 133 | Unevaluable event | FAERS: 3 | US FAERS | |
| 134 | Urinary tract infection | FAERS: 3 | US FAERS | |
| 135 | Vertigo | FAERS: 3 | US FAERS | |
| 136 | Viral upper respiratory tract infection | FAERS: 3 | US FAERS | |
| 137 | Alopecia | FAERS: 2 | US FAERS | |
| 138 | Anal abscess | FAERS: 2 | US FAERS | |
| 139 | Angioedema | FAERS: 2 | US FAERS | |
| 140 | Arthropathy | FAERS: 2 | US FAERS | |
| 141 | Atypical pneumonia | FAERS: 2 | US FAERS | |
| 142 | Basal cell carcinoma | FAERS: 2 | US FAERS | |
| 143 | Blood cholesterol increased | FAERS: 2 | US FAERS | |
| 144 | Carbon dioxide abnormal | FAERS: 2 | US FAERS | |
| 145 | Chemical eye injury | FAERS: 2 | US FAERS | |
| 146 | Choking sensation | FAERS: 2 | US FAERS | |
| 147 | Cholelithiasis | FAERS: 2 | US FAERS | |
| 148 | Colitis | FAERS: 2 | US FAERS | |
| 149 | Constipation | FAERS: 2 | US FAERS | |
| 150 | Discomfort | FAERS: 2 | US FAERS | |
| 151 | Dyspepsia | FAERS: 2 | US FAERS | |
| 152 | Ear discomfort | FAERS: 2 | US FAERS | |
| 153 | Eructation | FAERS: 2 | US FAERS | |
| 154 | Expired product administered | FAERS: 2 | US FAERS | |
| 155 | Gastrointestinal obstruction | FAERS: 2 | US FAERS | |
| 156 | General physical condition abnormal | FAERS: 2 | US FAERS | |
| 157 | Head discomfort | FAERS: 2 | US FAERS | |
| 158 | Hyperkeratosis | FAERS: 2 | US FAERS | |
| 159 | Hyperventilation | FAERS: 2 | US FAERS | |
| 160 | Hypotension | FAERS: 2 | US FAERS | |
| 161 | Infection | FAERS: 2 | US FAERS | |
| 162 | Instillation site foreign body sensation | FAERS: 2 | US FAERS | |
| 163 | Insurance issue | FAERS: 2 | US FAERS | |
| 164 | Intracranial Aneurysm | FAERS: 2 | US FAERS | |
| 165 | Limb discomfort | FAERS: 2 | US FAERS | |
| 166 | MYELODYSPLASTIC SYNDROME | FAERS: 2 | US FAERS | |
| 167 | Multimorbidity | FAERS: 2 | US FAERS | |
| 168 | Musculoskeletal Pain | FAERS: 2 | US FAERS | |
| 169 | Musculoskeletal discomfort | FAERS: 2 | US FAERS | |
| 170 | Myalgia | FAERS: 2 | US FAERS | |
| 171 | Non-cardiac chest pain | FAERS: 2 | US FAERS | |
| 172 | Obsessive-Compulsive Disorder | FAERS: 2 | US FAERS | |
| 173 | Panic Disorder | FAERS: 2 | US FAERS | |
| 174 | Peripheral swelling | FAERS: 2 | US FAERS | |
| 175 | Pharyngitis | FAERS: 2 | US FAERS | |
| 176 | Pleurisy | FAERS: 2 | US FAERS | |
| 177 | Poor peripheral circulation | FAERS: 2 | US FAERS | |
| 178 | Product packaging quantity issue | FAERS: 2 | US FAERS | |
| 179 | Product physical consistency issue | FAERS: 2 | US FAERS | |
| 180 | Product substitution issue | FAERS: 2 | US FAERS | |
| 181 | Product use complaint | FAERS: 2 | US FAERS | |
| 182 | Pulmonary Fibrosis | FAERS: 2 | US FAERS | |
| 183 | Respiratory tract irritation | FAERS: 2 | US FAERS | |
| 184 | Retching | FAERS: 2 | US FAERS | |
| 185 | Rotator cuff syndrome | FAERS: 2 | US FAERS | |
| 186 | Slow speech | FAERS: 2 | US FAERS | |
| 187 | Spinal column stenosis | FAERS: 2 | US FAERS | |
| 188 | Tension | FAERS: 2 | US FAERS | |
| 189 | Tongue discomfort | FAERS: 2 | US FAERS | |
| 190 | Upper-airway cough syndrome | FAERS: 2 | US FAERS | |
| 191 | Vocal Cord Paralysis | FAERS: 2 | US FAERS | |
| 192 | Walking aid user | FAERS: 2 | US FAERS | |
| 193 | kyphosis | FAERS: 2 | US FAERS | |
| 194 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 195 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 196 | Anal Fissure | FAERS: 1 | US FAERS | |
| 197 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 198 | Aortic Valve Stenosis | FAERS: 1 | US FAERS | |
| 199 | Asphyxia | FAERS: 1 | US FAERS | |
| 200 | Bedridden | FAERS: 1 | US FAERS | |
| 201 | Bladder Neoplasm | FAERS: 1 | US FAERS | |
| 202 | Blood urine present | FAERS: 1 | US FAERS | |
| 203 | Body fat disorder | FAERS: 1 | US FAERS | |
| 204 | Bronchiectasis | FAERS: 1 | US FAERS | |
| 205 | Burning sensation | FAERS: 1 | US FAERS | |
| 206 | Cancer Pain | FAERS: 1 | US FAERS | |
| 207 | Capillary Fragility | FAERS: 1 | US FAERS | |
| 208 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 209 | Chills | FAERS: 1 | US FAERS | |
| 210 | Complication associated with device | FAERS: 1 | US FAERS | |
| 211 | Contraindicated product administered | FAERS: 1 | US FAERS | |
| 212 | Device occlusion | FAERS: 1 | US FAERS | |
| 213 | Device related infection | FAERS: 1 | US FAERS | |
| 214 | Disease Progression | FAERS: 1 | US FAERS | |
| 215 | Disorientation | FAERS: 1 | US FAERS | |
| 216 | Diverticulitis | FAERS: 1 | US FAERS | |
| 217 | Drug administration error | FAERS: 1 | US FAERS | |
| 218 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 219 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 220 | Drug screen false positive | FAERS: 1 | US FAERS | |
| 221 | Dysarthria | FAERS: 1 | US FAERS | |
| 222 | Eye allergy | FAERS: 1 | US FAERS | |
| 223 | Eye irritation | FAERS: 1 | US FAERS | |
| 224 | Feeling Cold | FAERS: 1 | US FAERS | |
| 225 | Feelings of worthlessness | FAERS: 1 | US FAERS | |
| 226 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 227 | Flatulence | FAERS: 1 | US FAERS | |
| 228 | Flushing | FAERS: 1 | US FAERS | |
| 229 | Gait inability | FAERS: 1 | US FAERS | |
| 230 | Gastrointestinal carcinoma | FAERS: 1 | US FAERS | |
| 231 | Glossitis | FAERS: 1 | US FAERS | |
| 232 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 233 | Incoherent | FAERS: 1 | US FAERS | |
| 234 | Incorrect dose administered by device | FAERS: 1 | US FAERS | |
| 235 | Incorrect dose administered by product | FAERS: 1 | US FAERS | |
| 236 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 237 | Inspiratory capacity decreased | FAERS: 1 | US FAERS | |
| 238 | Intentional device use issue | FAERS: 1 | US FAERS | |
| 239 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 240 | Intraocular pressure test abnormal | FAERS: 1 | US FAERS | |
| 241 | Intraocular pressure test | FAERS: 1 | US FAERS | |
| 242 | Lethargy | FAERS: 1 | US FAERS | |
| 243 | Limb injury | FAERS: 1 | US FAERS | |
| 244 | Lymphoma | FAERS: 1 | US FAERS | |
| 245 | Malignant neoplasm progression | FAERS: 1 | US FAERS | |
| 246 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 247 | Metastases to reproductive organ | FAERS: 1 | US FAERS | |
| 248 | Micturition frequency decreased | FAERS: 1 | US FAERS | |
| 249 | Middle insomnia | FAERS: 1 | US FAERS | |
| 250 | Nasal discomfort | FAERS: 1 | US FAERS | |
| 251 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 252 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 253 | Ovarian cancer stage III | FAERS: 1 | US FAERS | |
| 254 | Ovarian enlargement | FAERS: 1 | US FAERS | |
| 255 | Oxygen saturation abnormal | FAERS: 1 | US FAERS | |
| 256 | Oxygen saturation increased | FAERS: 1 | US FAERS | |
| 257 | Packaging design issue | FAERS: 1 | US FAERS | |
| 258 | Post procedural infection | FAERS: 1 | US FAERS | |
| 259 | Product outer packaging issue | FAERS: 1 | US FAERS | |
| 260 | Product packaging issue | FAERS: 1 | US FAERS | |
| 261 | Product residue present | FAERS: 1 | US FAERS | |
| 262 | Product storage error | FAERS: 1 | US FAERS | |
| 263 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 264 | Rhinitis | FAERS: 1 | US FAERS | |
| 265 | Rosacea | FAERS: 1 | US FAERS | |
| 266 | Shock | FAERS: 1 | US FAERS | |
| 267 | Sinus headache | FAERS: 1 | US FAERS | |
| 268 | Skin irritation | FAERS: 1 | US FAERS | |
| 269 | Sluggishness | FAERS: 1 | US FAERS | |
| 270 | Staring | FAERS: 1 | US FAERS | |
| 271 | Status Asthmaticus | FAERS: 1 | US FAERS | |
| 272 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 273 | Terminal state | FAERS: 1 | US FAERS | |
| 274 | Therapeutic response changed | FAERS: 1 | US FAERS | |
| 275 | Thrombosis | FAERS: 1 | US FAERS | |
| 276 | Tinnitus | FAERS: 1 | US FAERS | |
| 277 | Tongue blistering | FAERS: 1 | US FAERS | |
| 278 | Tooth Extraction | FAERS: 1 | US FAERS | |
| 279 | Urinary hesitation | FAERS: 1 | US FAERS | |
| 280 | Urine flow decreased | FAERS: 1 | US FAERS | |
| 281 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 282 | Wrong dose | FAERS: 1 | US FAERS | |
| 283 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 284 | Yawning | FAERS: 1 | US FAERS | |
| 285 | skin abrasion | FAERS: 1 | US FAERS | |
| 286 | Diplopia | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120236
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.