Emtricitabine, Tenofovir Disoproxil Fumarate Drug Combination
(VERWQPYQDXWOGT-LVJNJWHOSA-N)
Structure
- SMILES
- Nc1nc(=O)n(cc1F)[C@@H]1CS[C@@H](O1)CO.C[C@H](Cn1cnc2c1ncnc2N)OCP(=O)(OCOC(=O)OC(C)C)OCOC(=O)OC(C)C.OC(=O)/C=C/C(=O)O
- Molecular Formula:
- C31H44FN8O17PS
- Molecular Weight:
- 882.762
- Log P:
- 3.4548
- Hydrogen Bond Acceptor:
- 26
- Hydrogen Bond Donor:
- 5
- TPSA:
- 385.52
- CAS Number(s):
- 731772-45-5
Synonym(s)
1.
Emtricitabine, Tenofovir Disoproxil Fumarate Drug Combination
2.
Emtricitabine Tenofovir Disoproxil Fumarate Drug Combination
3.
Emtricitabine-Tenofovir Disoproxil Fumarate Drug Combination
4.
Truvada
External Link(s)
| MeSH | D000069480 |
| PubChem Compound | 11954236 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Adverse event | FAERS: 7 | US FAERS | |
| 2 | Pneumonia | FAERS: 4 | US FAERS | |
| 3 | Stillbirth | FAERS: 4 | US FAERS | |
| 4 | Anxiety | FAERS: 3 | US FAERS | |
| 5 | Nausea | FAERS: 3 | US FAERS | |
| 6 | Acute HIV infection | FAERS: 2 | US FAERS | |
| 7 | Appendicitis | FAERS: 2 | US FAERS | |
| 8 | Chest Pain | FAERS: 2 | US FAERS | |
| 9 | Gastroenteritis | FAERS: 2 | US FAERS | |
| 10 | Musculoskeletal chest pain | FAERS: 2 | US FAERS | |
| 11 | Sepsis | FAERS: 2 | US FAERS | |
| 12 | Suicide attempt | FAERS: 2 | US FAERS | |
| 13 | Trisomy 21 | FAERS: 2 | US FAERS | |
| 14 | Umbilical hernia | FAERS: 2 | US FAERS | |
| 15 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 16 | Acute hepatitis C | FAERS: 1 | US FAERS | |
| 17 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 18 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 19 | Anal Fistula | FAERS: 1 | US FAERS | |
| 20 | Anal abscess | FAERS: 1 | US FAERS | |
| 21 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 22 | Arthropod sting | FAERS: 1 | US FAERS | |
| 23 | Ascites | FAERS: 1 | US FAERS | |
| 24 | Autoimmune hepatitis | FAERS: 1 | US FAERS | |
| 25 | Bipolar I disorder | FAERS: 1 | US FAERS | |
| 26 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 27 | Chromaturia | FAERS: 1 | US FAERS | |
| 28 | Disability | FAERS: 1 | US FAERS | |
| 29 | Diverticulitis | FAERS: 1 | US FAERS | |
| 30 | Drug dose omission | FAERS: 1 | US FAERS | |
| 31 | Drug ineffective | FAERS: 1 | US FAERS | |
| 32 | Drug resistance | FAERS: 1 | US FAERS | |
| 33 | Ectopic Pregnancy | FAERS: 1 | US FAERS | |
| 34 | Fracture | FAERS: 1 | US FAERS | |
| 35 | Headache | FAERS: 1 | US FAERS | |
| 36 | Hepatitis B | FAERS: 1 | 19731560 | CTD US FAERS |
| 37 | Hepatitis C | FAERS: 1 | US FAERS | |
| 38 | Hepatitis syphilitic | FAERS: 1 | US FAERS | |
| 39 | Hepatitis | FAERS: 1 | US FAERS | |
| 40 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 41 | Hypotension | FAERS: 1 | US FAERS | |
| 42 | Malaria | FAERS: 1 | US FAERS | |
| 43 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 44 | Neurosyphilis | FAERS: 1 | US FAERS | |
| 45 | Palpitations | FAERS: 1 | US FAERS | |
| 46 | Photophobia | FAERS: 1 | US FAERS | |
| 47 | Pneumothorax | FAERS: 1 | US FAERS | |
| 48 | Poisoning | FAERS: 1 | US FAERS | |
| 49 | Pre-Eclampsia | FAERS: 1 | US FAERS | |
| 50 | Prescription drug used without a prescription | FAERS: 1 | US FAERS | |
| 51 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 52 | Renal Artery Stenosis | FAERS: 1 | US FAERS | |
| 53 | Skin lesion | FAERS: 1 | US FAERS | |
| 54 | Syndactyly | FAERS: 1 | US FAERS | |
| 55 | Talipes | FAERS: 1 | US FAERS | |
| 56 | Tinnitus | FAERS: 1 | US FAERS | |
| 57 | Transaminases increased | FAERS: 1 | US FAERS | |
| 58 | Treponema test positive | FAERS: 1 | US FAERS | |
| 59 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 60 | Vasculitis | FAERS: 1 | US FAERS | |
| 61 | Vertigo | FAERS: 1 | US FAERS | |
| 62 | Virologic failure | FAERS: 1 | US FAERS | |
| 63 | jaundice | FAERS: 1 | US FAERS | |
| 64 | HIV Infections | 19731560 | CTD | |
| 65 | Hyperpigmentation | 18156608 | CTD | |
| 66 | Neurologic Manifestations | 18156608 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.