Sofosbuvir
(TTZHDVOVKQGIBA-IQWMDFIBSA-N)
Structure
- SMILES
- CC(OC(=O)[C@@H](N[P@@](=O)(Oc1ccccc1)OC[C@H]1O[C@H]([C@]([C@@H]1O)(C)F)n1ccc(=O)[nH]c1=O)C)C
- Type(s)
- Approved
- ATC code(s)
- J05AP08; J05AP51; J05AP55; J05AP56
- Molecular Formula:
- C22H29FN3O9P
- Molecular Weight:
- 529.453
- Log P:
- 2.0474
- Hydrogen Bond Acceptor:
- 11
- Hydrogen Bond Donor:
- 3
- TPSA:
- 167.99
- CAS Number(s):
- 1064684-44-1; 1190307-88-0
Synonym(s)
1.
Sofosbuvir
2.
2-((5-(2,4-dioxo-3,4-dihydro-2H-pyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyltetrahydrofuran-2-ylmethoxy)phenoxyphosphorylamino)propionic acid isopropyl ester
3.
GS-7977
4.
PSI 7977
5.
PSI-7977
6.
PSI7977
7.
Sovaldi
8.
7977, PSI
9.
GS 7977
10.
GS7977
External Link(s)
| MeSH | D000069474 |
| PubChem Compound | 45375808 |
| ChEBI | 85083 |
| CHEMBL | CHEMBL1259059 |
| DrugBank | DB08934 |
| DrugCentral | 4811 |
| IUPHAR/BPS Guide to PHARMACOLOGY | 7368 |
| KEGG | dr:D10366 |
| Therapeutic Target Database | D0D4YZ |
| ZINC | 100074252 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Fatigue | FAERS: 412 Canada Vigilance: 2 | 25987834 | CTD SIDER Canada Vigilance US FAERS |
| 2 | Headache | FAERS: 310 | 25987834 | CTD SIDER US FAERS |
| 3 | Nausea | FAERS: 171 | SIDER US FAERS | |
| 4 | Drug ineffective | FAERS: 98 Canada Vigilance: 24 | Canada Vigilance US FAERS | |
| 5 | Drug dose omission | FAERS: 62 | US FAERS | |
| 6 | Dizziness | FAERS: 57 | SIDER US FAERS | |
| 7 | Anxiety | FAERS: 51 | SIDER US FAERS | |
| 8 | Pruritus | FAERS: 49 | SIDER US FAERS | |
| 9 | Overdose | FAERS: 42 | US FAERS | |
| 10 | Hepatitis C | FAERS: 41 Canada Vigilance: 5 | 25850880 25937625 26052383 | CTD SIDER Canada Vigilance US FAERS |
| 11 | Vomiting | FAERS: 37 | SIDER US FAERS | |
| 12 | Asthenia | FAERS: 36 | SIDER US FAERS | |
| 13 | Arthralgia | FAERS: 33 | SIDER US FAERS | |
| 14 | Pain | FAERS: 33 | SIDER US FAERS | |
| 15 | Malaise | FAERS: 32 | US FAERS | |
| 16 | Accidental overdose | FAERS: 28 | US FAERS | |
| 17 | Acute kidney injury | FAERS: 26 | US FAERS | |
| 18 | Unevaluable event | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 19 | Abdominal discomfort | FAERS: 23 | SIDER US FAERS | |
| 20 | Constipation | FAERS: 21 | SIDER US FAERS | |
| 21 | treatment failure | FAERS: 21 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 22 | Pneumonia | FAERS: 20 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 23 | Weight decreased | FAERS: 20 | SIDER US FAERS | |
| 24 | Myalgia | FAERS: 19 | SIDER US FAERS | |
| 25 | Back Pain | FAERS: 18 | SIDER US FAERS | |
| 26 | Dry skin | FAERS: 17 | SIDER US FAERS | |
| 27 | Memory impairment | FAERS: 16 | SIDER US FAERS | |
| 28 | Peripheral swelling | FAERS: 16 | US FAERS | |
| 29 | Chest Pain | FAERS: 14 | SIDER US FAERS | |
| 30 | Dyspepsia | FAERS: 13 | SIDER US FAERS | |
| 31 | Myocardial Infarction | FAERS: 13 | US FAERS | |
| 32 | Amnesia | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 33 | Nasopharyngitis | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 34 | Palpitations | FAERS: 11 | US FAERS | |
| 35 | Somnolence | FAERS: 11 | US FAERS | |
| 36 | Flatulence | FAERS: 10 | US FAERS | |
| 37 | Blood glucose increased | FAERS: 9 | US FAERS | |
| 38 | Alopecia | FAERS: 8 | SIDER US FAERS | |
| 39 | Chills | FAERS: 8 | SIDER US FAERS | |
| 40 | Chromaturia | FAERS: 8 | US FAERS | |
| 41 | Nervousness | FAERS: 8 | US FAERS | |
| 42 | Therapy cessation | FAERS: 8 | US FAERS | |
| 43 | Visual Impairment | FAERS: 8 | US FAERS | |
| 44 | Abdominal Pain | FAERS: 7 | US FAERS | |
| 45 | Anger | FAERS: 7 | US FAERS | |
| 46 | Cerebrovascular accident | FAERS: 7 | US FAERS | |
| 47 | Feeling abnormal | FAERS: 7 | US FAERS | |
| 48 | Incorrect dose administered | FAERS: 7 | US FAERS | |
| 49 | Oropharyngeal pain | FAERS: 7 | US FAERS | |
| 50 | Ammonia increased | FAERS: 6 | US FAERS | |
| 51 | Chest discomfort | FAERS: 6 | US FAERS | |
| 52 | Dehydration | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 53 | Emotional disorder | FAERS: 6 | US FAERS | |
| 54 | Hypersensitivity | FAERS: 6 | US FAERS | |
| 55 | Mood swings | FAERS: 6 | US FAERS | |
| 56 | Myocarditis | FAERS: 6 | US FAERS | |
| 57 | Product packaging quantity issue | FAERS: 6 | US FAERS | |
| 58 | Thirst | FAERS: 6 | US FAERS | |
| 59 | Tremor | FAERS: 6 | US FAERS | |
| 60 | Bone pain | FAERS: 5 | US FAERS | |
| 61 | Bronchitis | FAERS: 5 | US FAERS | |
| 62 | Dysgeusia | FAERS: 5 | US FAERS | |
| 63 | Hepatitis C virus test positive | FAERS: 5 | US FAERS | |
| 64 | Hunger | FAERS: 5 | US FAERS | |
| 65 | Influenza | FAERS: 5 | US FAERS | |
| 66 | Joint swelling | FAERS: 5 | US FAERS | |
| 67 | Product quality issue | FAERS: 5 | US FAERS | |
| 68 | Sinusitis | FAERS: 5 | US FAERS | |
| 69 | White blood cell count decreased | FAERS: 5 | US FAERS | |
| 70 | Agitation | FAERS: 4 | SIDER US FAERS | |
| 71 | Aphagia | FAERS: 4 | US FAERS | |
| 72 | Ascites | FAERS: 4 | US FAERS | |
| 73 | Depressed mood | FAERS: 4 | US FAERS | |
| 74 | Diabetes Mellitus | FAERS: 4 | US FAERS | |
| 75 | Epistaxis | FAERS: 4 | US FAERS | |
| 76 | Erythema | FAERS: 4 | US FAERS | |
| 77 | Lymphoma | FAERS: 4 | US FAERS | |
| 78 | Musculoskeletal Pain | FAERS: 4 | US FAERS | |
| 79 | Presyncope | FAERS: 4 | US FAERS | |
| 80 | Psoriasis | FAERS: 4 | US FAERS | |
| 81 | Swelling | FAERS: 4 | US FAERS | |
| 82 | Tinnitus | FAERS: 4 | US FAERS | |
| 83 | jaundice | FAERS: 4 | US FAERS | |
| 84 | Blood count abnormal | FAERS: 3 | US FAERS | |
| 85 | Blood glucose abnormal | FAERS: 3 | US FAERS | |
| 86 | Burning sensation | FAERS: 3 | US FAERS | |
| 87 | Crying | FAERS: 3 | US FAERS | |
| 88 | Depressed Level of Consciousness | FAERS: 3 | US FAERS | |
| 89 | Dysphonia | FAERS: 3 | US FAERS | |
| 90 | Feeling Cold | FAERS: 3 | US FAERS | |
| 91 | Full blood count decreased | FAERS: 3 | US FAERS | |
| 92 | Hepatic Encephalopathy | FAERS: 3 | US FAERS | |
| 93 | Hypotension | FAERS: 3 | US FAERS | |
| 94 | Infection | FAERS: 3 | SIDER US FAERS | |
| 95 | Intentional product misuse | FAERS: 3 | US FAERS | |
| 96 | Lower respiratory tract congestion | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 97 | Middle insomnia | FAERS: 3 | US FAERS | |
| 98 | Pancreatitis | FAERS: 3 | US FAERS | |
| 99 | Restless Legs Syndrome | FAERS: 3 | US FAERS | |
| 100 | Rheumatoid Arthritis | FAERS: 3 | US FAERS | |
| 101 | Stress | FAERS: 3 | US FAERS | |
| 102 | Sunburn | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 103 | Syncope | FAERS: 3 | US FAERS | |
| 104 | Therapeutic response unexpected | FAERS: 3 | US FAERS | |
| 105 | Therapy change | FAERS: 3 | US FAERS | |
| 106 | Thrombocytopenia | FAERS: 3 | US FAERS | |
| 107 | Viral load increased | FAERS: 3 | US FAERS | |
| 108 | Wrong technique in product usage process | FAERS: 3 | US FAERS | |
| 109 | Angina Pectoris | FAERS: 2 | US FAERS | |
| 110 | Arthropathy | FAERS: 2 | US FAERS | |
| 111 | Asthma | FAERS: 2 | US FAERS | |
| 112 | Atrial Fibrillation | FAERS: 2 | US FAERS | |
| 113 | Bipolar Disorder | FAERS: 2 | US FAERS | |
| 114 | Blood glucose fluctuation | FAERS: 2 | US FAERS | |
| 115 | Blood potassium decreased | FAERS: 2 | US FAERS | |
| 116 | Bradycardia | FAERS: 2 | US FAERS | |
| 117 | Choking | FAERS: 2 | US FAERS | |
| 118 | Colitis | FAERS: 2 | US FAERS | |
| 119 | Extra dose administered | FAERS: 2 | US FAERS | |
| 120 | Eye irritation | FAERS: 2 | US FAERS | |
| 121 | Feeling jittery | FAERS: 2 | US FAERS | |
| 122 | Food Poisoning | FAERS: 2 | US FAERS | |
| 123 | Glomerulonephritis | FAERS: 2 | US FAERS | |
| 124 | Hernia | FAERS: 2 | US FAERS | |
| 125 | Hypersomnia | FAERS: 2 | US FAERS | |
| 126 | Inappropriate schedule of drug administration | FAERS: 2 | US FAERS | |
| 127 | Inflammation | FAERS: 2 | US FAERS | |
| 128 | Irritable Bowel Syndrome | FAERS: 2 | US FAERS | |
| 129 | Lethargy | FAERS: 2 | US FAERS | |
| 130 | Leukopenia | FAERS: 2 | US FAERS | |
| 131 | Lipase increased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 132 | Lower respiratory tract infection | FAERS: 2 | US FAERS | |
| 133 | Mental impairment | FAERS: 2 | US FAERS | |
| 134 | Neck Pain | FAERS: 2 | US FAERS | |
| 135 | Nephrolithiasis | FAERS: 2 | US FAERS | |
| 136 | Night sweats | FAERS: 2 | US FAERS | |
| 137 | Ocular icterus | FAERS: 2 | US FAERS | |
| 138 | Oral pain | FAERS: 2 | US FAERS | |
| 139 | Personality Change | FAERS: 2 | US FAERS | |
| 140 | Portal Vein Thrombosis | FAERS: 2 | US FAERS | |
| 141 | Pregnancy of partner | FAERS: 2 | US FAERS | |
| 142 | Product difficult to swallow | FAERS: 2 | US FAERS | |
| 143 | Product label issue | FAERS: 2 | US FAERS | |
| 144 | Product physical issue | FAERS: 2 | US FAERS | |
| 145 | Product use issue | FAERS: 2 | US FAERS | |
| 146 | Productive Cough | FAERS: 2 | US FAERS | |
| 147 | Pulmonary Embolism | FAERS: 2 | US FAERS | |
| 148 | Secretion discharge | FAERS: 2 | US FAERS | |
| 149 | Skin Ulcer | FAERS: 2 | US FAERS | |
| 150 | Suicide attempt | FAERS: 2 | US FAERS | |
| 151 | Tuberculosis | FAERS: 2 | US FAERS | |
| 152 | Ulcer | FAERS: 2 | US FAERS | |
| 153 | Vertigo | FAERS: 2 | US FAERS | |
| 154 | Viral test positive | FAERS: 2 | US FAERS | |
| 155 | Wheezing | FAERS: 2 | US FAERS | |
| 156 | Wrong drug administered | FAERS: 2 | US FAERS | |
| 157 | Wrong technique in drug usage process | FAERS: 2 | US FAERS | |
| 158 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 159 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 160 | Acidosis | FAERS: 1 | US FAERS | |
| 161 | Acne | FAERS: 1 | US FAERS | |
| 162 | Acute Coronary Syndrome | FAERS: 1 | US FAERS | |
| 163 | Adenocarcinoma of appendix | FAERS: 1 | US FAERS | |
| 164 | Ageusia | FAERS: 1 | US FAERS | |
| 165 | Alcohol abuse | FAERS: 1 | US FAERS | |
| 166 | Alcohol interaction | FAERS: 1 | US FAERS | |
| 167 | Allergic respiratory symptom | FAERS: 1 | US FAERS | |
| 168 | Animal bite | FAERS: 1 | US FAERS | |
| 169 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 170 | Anosmia | FAERS: 1 | US FAERS | |
| 171 | Apathy | FAERS: 1 | US FAERS | |
| 172 | Appendicitis | FAERS: 1 | US FAERS | |
| 173 | Arthritis | FAERS: 1 | US FAERS | |
| 174 | Autoimmune hepatitis | FAERS: 1 | US FAERS | |
| 175 | Back disorder | FAERS: 1 | US FAERS | |
| 176 | Bicytopenia | FAERS: 1 | US FAERS | |
| 177 | Blindness | FAERS: 1 | US FAERS | |
| 178 | Blood albumin abnormal | FAERS: 1 | US FAERS | |
| 179 | Blood magnesium decreased | FAERS: 1 | US FAERS | |
| 180 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 181 | Cachexia | FAERS: 1 | US FAERS | |
| 182 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 183 | Cataract | FAERS: 1 | US FAERS | |
| 184 | Cellulitis | FAERS: 1 | US FAERS | |
| 185 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 186 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 187 | Clostridium difficile colitis | FAERS: 1 | US FAERS | |
| 188 | Clostridium difficile infection | FAERS: 1 | US FAERS | |
| 189 | Cold sweat | FAERS: 1 | US FAERS | |
| 190 | Colectomy | FAERS: 1 | US FAERS | |
| 191 | Corneal Infection | FAERS: 1 | US FAERS | |
| 192 | Crystal nephropathy | FAERS: 1 | US FAERS | |
| 193 | Cupulolithiasis | FAERS: 1 | US FAERS | |
| 194 | Cystitis | FAERS: 1 | US FAERS | |
| 195 | Death of relative | FAERS: 1 | US FAERS | |
| 196 | Delirium | FAERS: 1 | US FAERS | |
| 197 | Dementia | FAERS: 1 | US FAERS | |
| 198 | Diabetes mellitus inadequate control | FAERS: 1 | US FAERS | |
| 199 | Diplopia | FAERS: 1 | US FAERS | |
| 200 | Disability | FAERS: 1 | US FAERS | |
| 201 | Discomfort | FAERS: 1 | US FAERS | |
| 202 | Disease complication | FAERS: 1 | US FAERS | |
| 203 | Disseminated Intravascular Coagulation | FAERS: 1 | US FAERS | |
| 204 | Drug abuse | FAERS: 1 | US FAERS | |
| 205 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 206 | Drug withdrawal syndrome | FAERS: 1 | US FAERS | |
| 207 | Dysphemia | FAERS: 1 | US FAERS | |
| 208 | Dysuria | FAERS: 1 | US FAERS | |
| 209 | Economic problem | FAERS: 1 | US FAERS | |
| 210 | Eczema | FAERS: 1 | US FAERS | |
| 211 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 212 | Embolic stroke | FAERS: 1 | US FAERS | |
| 213 | Encephalitis | FAERS: 1 | US FAERS | |
| 214 | Endometriosis | FAERS: 1 | US FAERS | |
| 215 | Endoscopy abnormal | FAERS: 1 | US FAERS | |
| 216 | Enzyme level increased | FAERS: 1 | US FAERS | |
| 217 | Eructation | FAERS: 1 | US FAERS | |
| 218 | Exposure via father | FAERS: 1 | US FAERS | |
| 219 | Extranodal marginal zone B-cell lymphoma (MALT type) | FAERS: 1 | US FAERS | |
| 220 | Eye Infection | FAERS: 1 | US FAERS | |
| 221 | Eye pain | FAERS: 1 | US FAERS | |
| 222 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 223 | Flank Pain | FAERS: 1 | US FAERS | |
| 224 | Flushing | FAERS: 1 | US FAERS | |
| 225 | Formication | FAERS: 1 | US FAERS | |
| 226 | Fracture | FAERS: 1 | US FAERS | |
| 227 | Gastric infection | FAERS: 1 | US FAERS | |
| 228 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 229 | Gastrointestinal Pain | FAERS: 1 | US FAERS | |
| 230 | Gastrointestinal hypermotility | FAERS: 1 | US FAERS | |
| 231 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 232 | Genital Herpes | FAERS: 1 | US FAERS | |
| 233 | Genotype drug resistance test positive | FAERS: 1 | US FAERS | |
| 234 | Hepatic cancer metastatic | FAERS: 1 | US FAERS | |
| 235 | Hepatic cancer stage I | FAERS: 1 | US FAERS | |
| 236 | Hepatitis B virus test positive | FAERS: 1 | US FAERS | |
| 237 | Hepatitis C RNA increased | FAERS: 1 | US FAERS | |
| 238 | Hepatitis C RNA | FAERS: 1 | US FAERS | |
| 239 | Hepatitis | FAERS: 1 | US FAERS | |
| 240 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 241 | Hepatorenal Syndrome | FAERS: 1 | US FAERS | |
| 242 | Hormone level abnormal | FAERS: 1 | US FAERS | |
| 243 | Human T-cell lymphocytic virus type II infection | FAERS: 1 | US FAERS | |
| 244 | Hyperchlorhydria | FAERS: 1 | US FAERS | |
| 245 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 246 | Hypertrophic Cardiomyopathy | FAERS: 1 | US FAERS | |
| 247 | Hypophagia | FAERS: 1 | US FAERS | |
| 248 | Hypoxia | FAERS: 1 | US FAERS | |
| 249 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 250 | Impatience | FAERS: 1 | US FAERS | |
| 251 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 252 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 253 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 254 | Inhibitory drug interaction | FAERS: 1 | US FAERS | |
| 255 | Initial insomnia | FAERS: 1 | US FAERS | |
| 256 | Injection site mass | FAERS: 1 | US FAERS | |
| 257 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 258 | Intra-abdominal fluid collection | FAERS: 1 | US FAERS | |
| 259 | Intracardiac mass | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 260 | Iron deficiency | FAERS: 1 | US FAERS | |
| 261 | Laryngitis | FAERS: 1 | US FAERS | |
| 262 | Limb discomfort | FAERS: 1 | US FAERS | |
| 263 | Lipids abnormal | FAERS: 1 | US FAERS | |
| 264 | Liver transplant rejection | FAERS: 1 | US FAERS | |
| 265 | Localised intraabdominal fluid collection | FAERS: 1 | US FAERS | |
| 266 | Lymphatic system neoplasm | FAERS: 1 | US FAERS | |
| 267 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 268 | Medication Error | FAERS: 1 | US FAERS | |
| 269 | Meningioma | FAERS: 1 | US FAERS | |
| 270 | Menorrhagia | FAERS: 1 | US FAERS | |
| 271 | Mental status changes | FAERS: 1 | US FAERS | |
| 272 | Metastases to adrenals | FAERS: 1 | US FAERS | |
| 273 | Multi-organ disorder | FAERS: 1 | US FAERS | |
| 274 | Multiple allergies | FAERS: 1 | US FAERS | |
| 275 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 276 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 277 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 278 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 279 | Nephrotic Syndrome | FAERS: 1 | US FAERS | |
| 280 | Neutropenia | FAERS: 1 | SIDER US FAERS | |
| 281 | No adverse event | FAERS: 1 | US FAERS | |
| 282 | Nocturia | FAERS: 1 | US FAERS | |
| 283 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 284 | Pancreatic duct obstruction | FAERS: 1 | US FAERS | |
| 285 | Paresis | FAERS: 1 | US FAERS | |
| 286 | Pelvic Inflammatory Disease | FAERS: 1 | US FAERS | |
| 287 | Performance status decreased | FAERS: 1 | US FAERS | |
| 288 | Perihepatic discomfort | FAERS: 1 | US FAERS | |
| 289 | Photodermatosis | FAERS: 1 | US FAERS | |
| 290 | Photophobia | FAERS: 1 | US FAERS | |
| 291 | Physical assault | FAERS: 1 | US FAERS | |
| 292 | Poisoning | FAERS: 1 | US FAERS | |
| 293 | Polymerase chain reaction positive | FAERS: 1 | US FAERS | |
| 294 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 295 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 296 | Pregnancy on contraceptive | FAERS: 1 | US FAERS | |
| 297 | Pregnancy | FAERS: 1 | US FAERS | |
| 298 | Product contamination physical | FAERS: 1 | US FAERS | |
| 299 | Product size issue | FAERS: 1 | US FAERS | |
| 300 | Prostatectomy | FAERS: 1 | US FAERS | |
| 301 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 302 | Pulmonary pain | FAERS: 1 | US FAERS | |
| 303 | Rash erythematous | FAERS: 1 | US FAERS | |
| 304 | Renal Cell Carcinoma | FAERS: 1 | US FAERS | |
| 305 | Renal mass | FAERS: 1 | US FAERS | |
| 306 | Renal pain | FAERS: 1 | US FAERS | |
| 307 | Restlessness | FAERS: 1 | US FAERS | |
| 308 | Retching | FAERS: 1 | US FAERS | |
| 309 | Rosacea | FAERS: 1 | US FAERS | |
| 310 | Sepsis | FAERS: 1 | US FAERS | |
| 311 | Septic Shock | FAERS: 1 | US FAERS | |
| 312 | Skin reaction | FAERS: 1 | US FAERS | |
| 313 | Spinal cord infection | FAERS: 1 | US FAERS | |
| 314 | Squamous cell carcinoma of skin | FAERS: 1 | US FAERS | |
| 315 | Stomatitis | FAERS: 1 | US FAERS | |
| 316 | Subcutaneous Abscess | FAERS: 1 | US FAERS | |
| 317 | Tachycardia | FAERS: 1 | US FAERS | |
| 318 | Therapeutic response delayed | FAERS: 1 | US FAERS | |
| 319 | Therapy responder | FAERS: 1 | US FAERS | |
| 320 | Throat cancer | FAERS: 1 | US FAERS | |
| 321 | Throat irritation | FAERS: 1 | US FAERS | |
| 322 | Thrombosis | FAERS: 1 | US FAERS | |
| 323 | Tooth Extraction | FAERS: 1 | US FAERS | |
| 324 | Toothache | FAERS: 1 | US FAERS | |
| 325 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 326 | Transplant | FAERS: 1 | US FAERS | |
| 327 | Transplant evaluation | FAERS: 1 | US FAERS | |
| 328 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 329 | Urticaria | FAERS: 1 | US FAERS | |
| 330 | Uterine Cancer | FAERS: 1 | US FAERS | |
| 331 | Vascular rupture | FAERS: 1 | US FAERS | |
| 332 | Vasculitis | FAERS: 1 | US FAERS | |
| 333 | Virologic failure | FAERS: 1 | US FAERS | |
| 334 | Adverse event | Canada Vigilance: 1 | Canada Vigilance | |
| 335 | Blood and lymphatic system disorders | SIDER | ||
| 336 | Completed Suicide | SIDER | ||
| 337 | Dermatitis | SIDER | ||
| 338 | HCV coinfection | SIDER | ||
| 339 | Hepatitis C, Chronic | 25987834 26239358 | CTD | |
| 340 | Infestation | SIDER | ||
| 341 | Lymphocyte count decreased | SIDER | ||
| 342 | Malnutrition | SIDER | ||
| 343 | Musculoskeletal discomfort | SIDER | ||
| 344 | Pancytopenia | SIDER | ||
| 345 | Suicide | SIDER | ||
| 346 | Therapy non-responder | Canada Vigilance: 1 | Canada Vigilance | |
| 347 | nervous system disorder | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.