Rosiglitazone
(SUFUKZSWUHZXAV-BTJKTKAUSA-N)
Structure
- SMILES
- O=C1NC(=O)C(S1)Cc1ccc(cc1)OCCN(c1ccccn1)C.OC(=O)/C=C\C(=O)O
- Molecular Formula:
- C22H23N3O7S
- Molecular Weight:
- 473.499
- Log P:
- 2.5315
- Hydrogen Bond Acceptor:
- 11
- Hydrogen Bond Donor:
- 3
- TPSA:
- 171.43
- CAS Number(s):
- 155141-29-0
Synonym(s)
1.
Rosiglitazone
2.
5-((4-(2-Methyl-2-(pyridinylamino)ethoxy)phenyl)methyl)-2,4-thiazolidinedione-2-butenedioate
3.
Avandia
4.
BRL 49653
5.
BRL-49653
6.
BRL49653
7.
Rosiglitazone Maleate
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Myocardial Infarction | FAERS: 771 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 2 | Cerebrovascular accident | FAERS: 393 | US FAERS | |
| 3 | Coronary Artery Disease | FAERS: 95 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 4 | Chest Pain | FAERS: 55 | US FAERS | |
| 5 | Cardiac Arrest | FAERS: 39 | US FAERS | |
| 6 | Atrial Fibrillation | FAERS: 36 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 7 | Acute myocardial infarction | FAERS: 25 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 8 | Pain | FAERS: 24 | US FAERS | |
| 9 | Adverse event | FAERS: 23 | US FAERS | |
| 10 | Arteriosclerosis | FAERS: 23 | US FAERS | |
| 11 | Amnesia | FAERS: 19 | US FAERS | |
| 12 | Thrombosis | FAERS: 14 | US FAERS | |
| 13 | Cardiac Death | FAERS: 12 | US FAERS | |
| 14 | Fluid overload | FAERS: 12 | US FAERS | |
| 15 | Pulmonary Hypertension | FAERS: 12 | US FAERS | |
| 16 | Swelling | FAERS: 12 | US FAERS | |
| 17 | Blindness | FAERS: 11 | US FAERS | |
| 18 | Dizziness | FAERS: 11 | US FAERS | |
| 19 | Fatigue | FAERS: 10 | US FAERS | |
| 20 | Hepatic Encephalopathy | FAERS: 10 | US FAERS | |
| 21 | Implantable defibrillator insertion | FAERS: 9 | US FAERS | |
| 22 | Angina Pectoris | FAERS: 8 | US FAERS | |
| 23 | Anxiety | FAERS: 8 | US FAERS | |
| 24 | Cardiac assistance device user | FAERS: 8 | US FAERS | |
| 25 | Oxygen supplementation | FAERS: 8 | US FAERS | |
| 26 | Respiratory Failure | FAERS: 8 | US FAERS | |
| 27 | Asthenia | FAERS: 7 | US FAERS | |
| 28 | Electrocardiogram abnormal | FAERS: 7 | US FAERS | |
| 29 | Palpitations | FAERS: 7 | US FAERS | |
| 30 | Cardiomegaly | FAERS: 6 | US FAERS | |
| 31 | Diabetes Mellitus | FAERS: 6 | US FAERS | |
| 32 | Hemiparesis | FAERS: 6 | US FAERS | |
| 33 | Sudden Cardiac Death | FAERS: 6 | US FAERS | |
| 34 | Visual Impairment | FAERS: 6 | US FAERS | |
| 35 | Obstruction | FAERS: 5 | US FAERS | |
| 36 | Pneumonia | FAERS: 5 | US FAERS | |
| 37 | Pulmonary Embolism | FAERS: 5 | US FAERS | |
| 38 | Sepsis | FAERS: 5 | US FAERS | |
| 39 | Tachycardia | FAERS: 5 | US FAERS | |
| 40 | Economic problem | FAERS: 4 | US FAERS | |
| 41 | Fracture | FAERS: 4 | US FAERS | |
| 42 | Hepatic necrosis | FAERS: 4 | US FAERS | |
| 43 | Hepatotoxicity | FAERS: 4 | US FAERS | |
| 44 | Malaise | FAERS: 4 | US FAERS | |
| 45 | Pancreatitis | FAERS: 4 | US FAERS | |
| 46 | Pulmonary arterial hypertension | FAERS: 4 | US FAERS | |
| 47 | Syncope | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 48 | Thrombocytopenia | FAERS: 4 | US FAERS | |
| 49 | Weight decreased | FAERS: 4 | US FAERS | |
| 50 | Abasia | FAERS: 3 | US FAERS | |
| 51 | Acute Coronary Syndrome | FAERS: 3 | US FAERS | |
| 52 | Ankle Fracture | FAERS: 3 | US FAERS | |
| 53 | Aphasia | FAERS: 3 | US FAERS | |
| 54 | Arthralgia | FAERS: 3 | US FAERS | |
| 55 | Blood cholesterol increased | FAERS: 3 | US FAERS | |
| 56 | Blood triglycerides increased | FAERS: 3 | US FAERS | |
| 57 | Chest discomfort | FAERS: 3 | US FAERS | |
| 58 | Deep Vein Thrombosis | FAERS: 3 | US FAERS | |
| 59 | Diastolic dysfunction | FAERS: 3 | US FAERS | |
| 60 | Disability | FAERS: 3 | US FAERS | |
| 61 | Eosinophilia | FAERS: 3 | US FAERS | |
| 62 | Headache | FAERS: 3 | US FAERS | |
| 63 | Hypertensive heart disease | FAERS: 3 | US FAERS | |
| 64 | Infarction | FAERS: 3 | US FAERS | |
| 65 | Monoplegia | FAERS: 3 | US FAERS | |
| 66 | Silent myocardial infarction | FAERS: 3 | US FAERS | |
| 67 | Activities of daily living impaired | FAERS: 2 | US FAERS | |
| 68 | Angioplasty | FAERS: 2 | US FAERS | |
| 69 | Arthropathy | FAERS: 2 | US FAERS | |
| 70 | Bedridden | FAERS: 2 | US FAERS | |
| 71 | Blood count abnormal | FAERS: 2 | US FAERS | |
| 72 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 73 | Cholestasis | FAERS: 2 | US FAERS | |
| 74 | Coronary artery embolism | FAERS: 2 | US FAERS | |
| 75 | Deformity | FAERS: 2 | US FAERS | |
| 76 | Dementia | FAERS: 2 | US FAERS | |
| 77 | Diabetes mellitus inadequate control | FAERS: 2 | US FAERS | |
| 78 | Diplopia | FAERS: 2 | US FAERS | |
| 79 | Emotional distress | FAERS: 2 | US FAERS | |
| 80 | Erectile dysfunction | FAERS: 2 | US FAERS | |
| 81 | Gangrene | FAERS: 2 | US FAERS | |
| 82 | General physical health deterioration | FAERS: 2 | US FAERS | |
| 83 | Inflammation | FAERS: 2 | US FAERS | |
| 84 | Male sexual dysfunction | FAERS: 2 | US FAERS | |
| 85 | Memory impairment | FAERS: 2 | US FAERS | |
| 86 | Necrosis | FAERS: 2 | US FAERS | |
| 87 | Nerve injury | FAERS: 2 | US FAERS | |
| 88 | Osteoporosis | FAERS: 2 | US FAERS | |
| 89 | Pericardial effusion | FAERS: 2 | US FAERS | |
| 90 | Physical disability | FAERS: 2 | US FAERS | |
| 91 | Procedural complication | FAERS: 2 | US FAERS | |
| 92 | Pulmonary thrombosis | FAERS: 2 | US FAERS | |
| 93 | Retinal telangiectasia | FAERS: 2 | US FAERS | |
| 94 | Stress | FAERS: 2 | US FAERS | |
| 95 | Tremor | FAERS: 2 | US FAERS | |
| 96 | Vertigo | FAERS: 2 | US FAERS | |
| 97 | Vomiting | FAERS: 2 | US FAERS | |
| 98 | jaundice | FAERS: 2 | US FAERS | |
| 99 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 100 | Acute respiratory failure | FAERS: 1 | US FAERS | |
| 101 | Alopecia | FAERS: 1 | US FAERS | |
| 102 | Amputation | FAERS: 1 | US FAERS | |
| 103 | Anal cancer metastatic | FAERS: 1 | US FAERS | |
| 104 | Aneurysm | FAERS: 1 | US FAERS | |
| 105 | Anger | FAERS: 1 | US FAERS | |
| 106 | Anhedonia | FAERS: 1 | US FAERS | |
| 107 | Anoxic Encephalopathy | FAERS: 1 | US FAERS | |
| 108 | Anticoagulant therapy | FAERS: 1 | US FAERS | |
| 109 | Aortic Injury | FAERS: 1 | US FAERS | |
| 110 | Aphagia | FAERS: 1 | US FAERS | |
| 111 | Arterial therapeutic procedure | FAERS: 1 | US FAERS | |
| 112 | Ascites | FAERS: 1 | US FAERS | |
| 113 | Atrial Flutter | FAERS: 1 | US FAERS | |
| 114 | Back Pain | FAERS: 1 | US FAERS | |
| 115 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 116 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 117 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 118 | Cardiac Hypertrophy | FAERS: 1 | US FAERS | |
| 119 | Cardiac Tamponade | FAERS: 1 | US FAERS | |
| 120 | Carpal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 121 | Cataract operation | FAERS: 1 | US FAERS | |
| 122 | Cataract | FAERS: 1 | US FAERS | |
| 123 | Catheter placement | FAERS: 1 | US FAERS | |
| 124 | Cellulitis | FAERS: 1 | US FAERS | |
| 125 | Cerebellar infarction | FAERS: 1 | US FAERS | |
| 126 | Chondromatosis | FAERS: 1 | US FAERS | |
| 127 | Chromaturia | FAERS: 1 | US FAERS | |
| 128 | Clostridium difficile sepsis | FAERS: 1 | US FAERS | |
| 129 | Cold sweat | FAERS: 1 | US FAERS | |
| 130 | Cor pulmonale | FAERS: 1 | US FAERS | |
| 131 | Deafness | FAERS: 1 | US FAERS | |
| 132 | Dehydration | FAERS: 1 | US FAERS | |
| 133 | Dependence on enabling machine or device | FAERS: 1 | US FAERS | |
| 134 | Diabetic Ketoacidosis | FAERS: 1 | US FAERS | |
| 135 | Diabetic Retinopathy | FAERS: 1 | US FAERS | |
| 136 | Discomfort | FAERS: 1 | US FAERS | |
| 137 | Disease Progression | FAERS: 1 | US FAERS | |
| 138 | Drug ineffective | FAERS: 1 | US FAERS | |
| 139 | Drug toxicity | FAERS: 1 | US FAERS | |
| 140 | Dyspepsia | FAERS: 1 | US FAERS | |
| 141 | Dyspnoea exacerbated | FAERS: 1 | US FAERS | |
| 142 | Dysuria | FAERS: 1 | US FAERS | |
| 143 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 144 | Emergency care examination | FAERS: 1 | US FAERS | |
| 145 | Emotional disorder | FAERS: 1 | US FAERS | |
| 146 | Eye pain | FAERS: 1 | US FAERS | |
| 147 | Glaucoma | FAERS: 1 | US FAERS | |
| 148 | Hemiplegia | FAERS: 1 | US FAERS | |
| 149 | Hepatic congestion | FAERS: 1 | US FAERS | |
| 150 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 151 | Hypotension | FAERS: 1 | US FAERS | |
| 152 | Hypoxia | FAERS: 1 | US FAERS | |
| 153 | Increased tendency to bruise | FAERS: 1 | US FAERS | |
| 154 | Intervertebral disc compression | FAERS: 1 | US FAERS | |
| 155 | Joint swelling | FAERS: 1 | US FAERS | |
| 156 | Left Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 157 | Left atrial dilatation | FAERS: 1 | US FAERS | |
| 158 | Leriche Syndrome | FAERS: 1 | US FAERS | |
| 159 | Limb discomfort | FAERS: 1 | US FAERS | |
| 160 | Macular degeneration | FAERS: 1 | US FAERS | |
| 161 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 162 | Myalgia | FAERS: 1 | US FAERS | |
| 163 | Nausea | FAERS: 1 | US FAERS | |
| 164 | Neck Pain | FAERS: 1 | US FAERS | |
| 165 | Osteogenesis Imperfecta | FAERS: 1 | US FAERS | |
| 166 | Osteomyelitis | FAERS: 1 | US FAERS | |
| 167 | Pancreatic calcification | FAERS: 1 | US FAERS | |
| 168 | Penile swelling | FAERS: 1 | US FAERS | |
| 169 | Pneumothorax | FAERS: 1 | US FAERS | |
| 170 | Post procedural complication | FAERS: 1 | US FAERS | |
| 171 | Pulmonary arteriopathy | FAERS: 1 | US FAERS | |
| 172 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 173 | Shock | FAERS: 1 | US FAERS | |
| 174 | Spinal cord infection | FAERS: 1 | US FAERS | |
| 175 | Sudden death | FAERS: 1 | US FAERS | |
| 176 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 177 | Systolic dysfunction | FAERS: 1 | US FAERS | |
| 178 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 179 | Terminal state | FAERS: 1 | US FAERS | |
| 180 | Traumatic Brain Injury | FAERS: 1 | US FAERS | |
| 181 | Troponin I increased | FAERS: 1 | US FAERS | |
| 182 | Unevaluable event | FAERS: 1 | US FAERS | |
| 183 | Vascular occlusion | FAERS: 1 | US FAERS | |
| 184 | Ventricular Dysfunction | FAERS: 1 | US FAERS | |
| 185 | Wheezing | FAERS: 1 | US FAERS | |
| 186 | nervous system disorder | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.