Ivermectin
(SPBDXSGPUHCETR-VHJJIYNUSA-N)
Structure
- SMILES
- CO[C@H]1C[C@H](O[C@H]2[C@@H](C)/C=C/C=C/3\CO[C@H]4[C@]3(O)[C@@H](C=C([C@H]4O)C)C(=O)OC3C[C@@H](C/C=C/2\C)O[C@]2(C3)CC[C@@H]([C@H](O2)C(CC)C)C)O[C@H]([C@@H]1OC1C[C@H](OC)[C@H]([C@@H](O1)C)O)C.CO[C@H]1C[C@@H](O[C@H]([C@@H]1OC1C[C@H](OC)[C@H]([C@@H](O1)C)O)C)O[C@H]1[C@@H](C)/C=C/C=C/2\CO[C@H]3[C@]2(O)[C@@H](C=C([C@H]3O)C)C(=O)OC2C[C@@H](C/C=C/1\C)O[C@]1(C2)CC[C@@H]([C@H](O1)C(C)C)C
- Molecular Formula:
- C95H146O28
- Molecular Weight:
- 1736.160
- Log P:
- 10.8127
- Hydrogen Bond Acceptor:
- 28
- Hydrogen Bond Donor:
- 6
- TPSA:
- 340.12
- CAS Number(s):
- N/A
Synonym(s)
1.
Ivermectin
2.
Eqvalan
3.
Ivomec
4.
MK-933
5.
Mectizan
6.
Stromectol
7.
MK 933
8.
MK933
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Asthenia | FAERS: 562 | US FAERS | |
| 2 | Headache | FAERS: 537 | US FAERS | |
| 3 | Back Pain | FAERS: 222 | US FAERS | |
| 4 | Vertigo | FAERS: 219 | US FAERS | |
| 5 | Arthralgia | FAERS: 158 | US FAERS | |
| 6 | Urinary Incontinence | FAERS: 138 | US FAERS | |
| 7 | Pruritus | FAERS: 124 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 8 | Myalgia | FAERS: 107 | US FAERS | |
| 9 | Depressed Level of Consciousness | FAERS: 100 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 10 | Vomiting | FAERS: 89 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 11 | Chills | FAERS: 83 | US FAERS | |
| 12 | Agitation | FAERS: 61 | US FAERS | |
| 13 | Pain | FAERS: 59 | US FAERS | |
| 14 | Malaria | FAERS: 57 | US FAERS | |
| 15 | Hypotension | FAERS: 51 | US FAERS | |
| 16 | Neck Pain | FAERS: 46 | US FAERS | |
| 17 | Abdominal Pain | FAERS: 44 | US FAERS | |
| 18 | Anorexia | FAERS: 43 | US FAERS | |
| 19 | No adverse event | FAERS: 42 | US FAERS | |
| 20 | Adverse event | FAERS: 41 | US FAERS | |
| 21 | Drug ineffective | FAERS: 31 | US FAERS | |
| 22 | Disorientation | FAERS: 30 | US FAERS | |
| 23 | Inappropriate schedule of drug administration | FAERS: 29 | US FAERS | |
| 24 | Product use in unapproved indication | FAERS: 28 | US FAERS | |
| 25 | Aphasia | FAERS: 27 | US FAERS | |
| 26 | Stupor | FAERS: 27 | US FAERS | |
| 27 | Fatigue | FAERS: 25 | US FAERS | |
| 28 | Chest Pain | FAERS: 23 | US FAERS | |
| 29 | Musculoskeletal stiffness | FAERS: 23 | US FAERS | |
| 30 | Nuchal Rigidity | FAERS: 23 | US FAERS | |
| 31 | Somnolence | FAERS: 19 | US FAERS | |
| 32 | Urinary Retention | FAERS: 18 | US FAERS | |
| 33 | Dehydration | FAERS: 17 | US FAERS | |
| 34 | Abasia | FAERS: 15 | US FAERS | |
| 35 | Nausea | FAERS: 15 | US FAERS | |
| 36 | Accidental exposure | FAERS: 13 | US FAERS | |
| 37 | Incoherent | FAERS: 13 | US FAERS | |
| 38 | Feeling Cold | FAERS: 12 | US FAERS | |
| 39 | Sepsis | FAERS: 12 | US FAERS | |
| 40 | Eye pain | FAERS: 10 | US FAERS | |
| 41 | Filariasis | FAERS: 10 | US FAERS | |
| 42 | Mental status changes | FAERS: 10 | US FAERS | |
| 43 | Mutism | FAERS: 10 | US FAERS | |
| 44 | Paresis | FAERS: 10 | US FAERS | |
| 45 | Strongyloidiasis | FAERS: 10 | US FAERS | |
| 46 | Urticaria | FAERS: 10 | US FAERS | |
| 47 | nervous system disorder | FAERS: 10 | US FAERS | |
| 48 | Product use issue | FAERS: 9 | US FAERS | |
| 49 | Delirium | FAERS: 8 | US FAERS | |
| 50 | Dizziness | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 51 | Drug ineffective for unapproved indication | FAERS: 8 | US FAERS | |
| 52 | Meningitis | FAERS: 8 | US FAERS | |
| 53 | Cerebral disorder | FAERS: 7 | US FAERS | |
| 54 | Disability | FAERS: 7 | US FAERS | |
| 55 | Drug administration error | FAERS: 7 | US FAERS | |
| 56 | Joint stiffness | FAERS: 7 | US FAERS | |
| 57 | Monoparesis | FAERS: 7 | US FAERS | |
| 58 | Paraparesis | FAERS: 7 | US FAERS | |
| 59 | Pneumonia | FAERS: 7 | US FAERS | |
| 60 | Tachycardia | FAERS: 7 | US FAERS | |
| 61 | White blood cell count decreased | FAERS: 7 | US FAERS | |
| 62 | Acarodermatitis | FAERS: 6 | US FAERS | |
| 63 | Altered state of consciousness | FAERS: 6 | US FAERS | |
| 64 | Amnesia | FAERS: 6 | US FAERS | |
| 65 | Blood smear test abnormal | FAERS: 6 | US FAERS | |
| 66 | Constipation | FAERS: 6 | US FAERS | |
| 67 | Drug exposure during pregnancy | FAERS: 6 | US FAERS | |
| 68 | Eosinophilia | FAERS: 6 | US FAERS | |
| 69 | Hepatitis | FAERS: 6 | US FAERS | |
| 70 | Ocular icterus | FAERS: 6 | US FAERS | |
| 71 | Overdose | FAERS: 6 | US FAERS | |
| 72 | Palpitations | FAERS: 6 | US FAERS | |
| 73 | Toxic Epidermal Necrolysis | FAERS: 6 | US FAERS | |
| 74 | Anal sphincter atony | FAERS: 5 | US FAERS | |
| 75 | Coma scale | FAERS: 5 | US FAERS | |
| 76 | Erythema Multiforme | FAERS: 5 | US FAERS | |
| 77 | Hemiplegia | FAERS: 5 | US FAERS | |
| 78 | Malaise | FAERS: 5 | US FAERS | |
| 79 | Pallor | FAERS: 5 | US FAERS | |
| 80 | Photophobia | FAERS: 5 | US FAERS | |
| 81 | Poisoning | FAERS: 5 | US FAERS | |
| 82 | Respiratory Failure | FAERS: 5 | US FAERS | |
| 83 | Tremor | FAERS: 5 | US FAERS | |
| 84 | Vitreous floaters | FAERS: 5 | US FAERS | |
| 85 | Weight decreased | FAERS: 5 | US FAERS | |
| 86 | Angioedema | FAERS: 4 | US FAERS | |
| 87 | Ataxia | FAERS: 4 | US FAERS | |
| 88 | Bedridden | FAERS: 4 | US FAERS | |
| 89 | Diet refusal | FAERS: 4 | US FAERS | |
| 90 | Diplegia | FAERS: 4 | US FAERS | |
| 91 | Drug effect incomplete | FAERS: 4 | US FAERS | |
| 92 | Drug prescribing error | FAERS: 4 | US FAERS | |
| 93 | General physical health deterioration | FAERS: 4 | US FAERS | |
| 94 | Glasgow coma scale abnormal | FAERS: 4 | US FAERS | |
| 95 | Hepatomegaly | FAERS: 4 | US FAERS | |
| 96 | Hypersensitivity | FAERS: 4 | US FAERS | |
| 97 | Incontinence | FAERS: 4 | US FAERS | |
| 98 | Lethargy | FAERS: 4 | US FAERS | |
| 99 | Lymphadenopathy | FAERS: 4 | US FAERS | |
| 100 | Muscle Rigidity | FAERS: 4 | US FAERS | |
| 101 | Onchocerciasis | FAERS: 4 | US FAERS | |
| 102 | Alanine Aminotransferase Increased | FAERS: 3 | US FAERS | |
| 103 | Aphonia | FAERS: 3 | US FAERS | |
| 104 | Ascites | FAERS: 3 | US FAERS | |
| 105 | Body fat disorder | FAERS: 3 | US FAERS | |
| 106 | Bradycardia | FAERS: 3 | US FAERS | |
| 107 | Bradyphrenia | FAERS: 3 | US FAERS | |
| 108 | Cerebrovascular accident | FAERS: 3 | US FAERS | |
| 109 | Coma scale abnormal | FAERS: 3 | US FAERS | |
| 110 | Discomfort | FAERS: 3 | US FAERS | |
| 111 | Drug dose omission | FAERS: 3 | US FAERS | |
| 112 | Dysarthria | FAERS: 3 | US FAERS | |
| 113 | General symptom | FAERS: 3 | US FAERS | |
| 114 | Hypertensive Encephalopathy | FAERS: 3 | US FAERS | |
| 115 | Inappropriate schedule of product administration | FAERS: 3 | US FAERS | |
| 116 | Limb discomfort | FAERS: 3 | US FAERS | |
| 117 | Prescribed overdose | FAERS: 3 | US FAERS | |
| 118 | Pulmonary congestion | FAERS: 3 | US FAERS | |
| 119 | Rales | FAERS: 3 | US FAERS | |
| 120 | Respiratory arrest | FAERS: 3 | US FAERS | |
| 121 | Respiratory tract congestion | FAERS: 3 | US FAERS | |
| 122 | Septic Shock | FAERS: 3 | US FAERS | |
| 123 | Shock | FAERS: 3 | US FAERS | |
| 124 | Splenomegaly | FAERS: 3 | US FAERS | |
| 125 | Transaminases increased | FAERS: 3 | US FAERS | |
| 126 | Visual disturbance | FAERS: 3 | US FAERS | |
| 127 | jaundice | FAERS: 3 | US FAERS | |
| 128 | Abdominal discomfort | FAERS: 2 | US FAERS | |
| 129 | Abdominal tenderness | FAERS: 2 | US FAERS | |
| 130 | Accidental overdose | FAERS: 2 | US FAERS | |
| 131 | Aspartate Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 132 | Bladder sphincter atony | FAERS: 2 | US FAERS | |
| 133 | Blighted ovum | FAERS: 2 | US FAERS | |
| 134 | Cluster Headache | FAERS: 2 | US FAERS | |
| 135 | Colitis | FAERS: 2 | US FAERS | |
| 136 | Diabetic Ketoacidosis | FAERS: 2 | US FAERS | |
| 137 | Disseminated Intravascular Coagulation | FAERS: 2 | US FAERS | |
| 138 | Drug effective for unapproved indication | FAERS: 2 | US FAERS | |
| 139 | Eczema | FAERS: 2 | US FAERS | |
| 140 | Enophthalmos | FAERS: 2 | US FAERS | |
| 141 | Gastritis | FAERS: 2 | US FAERS | |
| 142 | Gastroenteritis | FAERS: 2 | US FAERS | |
| 143 | Hemisensory Neglect | FAERS: 2 | US FAERS | |
| 144 | Hyperreflexia | FAERS: 2 | US FAERS | |
| 145 | Hyperventilation | FAERS: 2 | US FAERS | |
| 146 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 147 | Incorrect route of drug administration | FAERS: 2 | US FAERS | |
| 148 | Infection | FAERS: 2 | US FAERS | |
| 149 | Inflammation | FAERS: 2 | US FAERS | |
| 150 | Lymphadenitis | FAERS: 2 | US FAERS | |
| 151 | Malnutrition | FAERS: 2 | US FAERS | |
| 152 | Mazzotti reaction | FAERS: 2 | US FAERS | |
| 153 | Medication Error | FAERS: 2 | US FAERS | |
| 154 | Mental impairment | FAERS: 2 | US FAERS | |
| 155 | Mydriasis | FAERS: 2 | US FAERS | |
| 156 | Oliguria | FAERS: 2 | US FAERS | |
| 157 | Paraplegia | FAERS: 2 | US FAERS | |
| 158 | Physical disability | FAERS: 2 | US FAERS | |
| 159 | Pregnancy | FAERS: 2 | US FAERS | |
| 160 | Product prescribing error | FAERS: 2 | US FAERS | |
| 161 | Productive Cough | FAERS: 2 | US FAERS | |
| 162 | Proteinuria | FAERS: 2 | US FAERS | |
| 163 | Psychotic disorder due to a general medical condition | FAERS: 2 | US FAERS | |
| 164 | Pulmonary Embolism | FAERS: 2 | US FAERS | |
| 165 | Purpura | FAERS: 2 | US FAERS | |
| 166 | Stevens-Johnson Syndrome | FAERS: 2 | US FAERS | |
| 167 | Superinfection bacterial | FAERS: 2 | US FAERS | |
| 168 | Therapeutic response unexpected | FAERS: 2 | US FAERS | |
| 169 | Thirst | FAERS: 2 | US FAERS | |
| 170 | Unresponsive to stimuli | FAERS: 2 | US FAERS | |
| 171 | Urinary tract infection | FAERS: 2 | US FAERS | |
| 172 | treatment failure | FAERS: 2 | US FAERS | |
| 173 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 174 | Acne | FAERS: 1 | US FAERS | |
| 175 | Anxiety | FAERS: 1 | US FAERS | |
| 176 | Application site swelling | FAERS: 1 | US FAERS | |
| 177 | Arthropod bite | FAERS: 1 | US FAERS | |
| 178 | Autoimmune hepatitis | FAERS: 1 | US FAERS | |
| 179 | Back disorder | FAERS: 1 | US FAERS | |
| 180 | Bacterial culture positive | FAERS: 1 | US FAERS | |
| 181 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 182 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 183 | Blood immunoglobulin G increased | FAERS: 1 | US FAERS | |
| 184 | Blood urine present | FAERS: 1 | US FAERS | |
| 185 | Body height abnormal | FAERS: 1 | US FAERS | |
| 186 | Bone density abnormal | FAERS: 1 | US FAERS | |
| 187 | Bone pain | FAERS: 1 | US FAERS | |
| 188 | Breath Holding | FAERS: 1 | US FAERS | |
| 189 | Brief psychotic disorder with marked stressors | FAERS: 1 | US FAERS | |
| 190 | Bronchopneumonia | FAERS: 1 | US FAERS | |
| 191 | Cachexia | FAERS: 1 | US FAERS | |
| 192 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 193 | Cellulitis | FAERS: 1 | US FAERS | |
| 194 | Chest discomfort | FAERS: 1 | US FAERS | |
| 195 | Cholestasis | FAERS: 1 | US FAERS | |
| 196 | Chromaturia | FAERS: 1 | US FAERS | |
| 197 | Complication associated with device | FAERS: 1 | US FAERS | |
| 198 | Conjunctivitis | FAERS: 1 | US FAERS | |
| 199 | Crying | FAERS: 1 | US FAERS | |
| 200 | Delusional disorder, unspecified type | FAERS: 1 | US FAERS | |
| 201 | Device related infection | FAERS: 1 | US FAERS | |
| 202 | Diplopia | FAERS: 1 | US FAERS | |
| 203 | Disease Progression | FAERS: 1 | US FAERS | |
| 204 | Drug toxicity | FAERS: 1 | US FAERS | |
| 205 | Dysphasia | FAERS: 1 | US FAERS | |
| 206 | Encephalitis | FAERS: 1 | US FAERS | |
| 207 | Enteritis | FAERS: 1 | US FAERS | |
| 208 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 209 | Epistaxis | FAERS: 1 | US FAERS | |
| 210 | Erythema | FAERS: 1 | US FAERS | |
| 211 | Exposure via eye contact | FAERS: 1 | US FAERS | |
| 212 | Eye Redness | FAERS: 1 | US FAERS | |
| 213 | Eye irritation | FAERS: 1 | US FAERS | |
| 214 | Facial asymmetry | FAERS: 1 | US FAERS | |
| 215 | Flat affect | FAERS: 1 | US FAERS | |
| 216 | Flatulence | FAERS: 1 | US FAERS | |
| 217 | Foreign body sensation in eyes | FAERS: 1 | US FAERS | |
| 218 | Functional residual capacity abnormal | FAERS: 1 | US FAERS | |
| 219 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 220 | Gingivitis | FAERS: 1 | US FAERS | |
| 221 | Heart sounds abnormal | FAERS: 1 | US FAERS | |
| 222 | Hepatic necrosis | FAERS: 1 | US FAERS | |
| 223 | Hepatosplenomegaly | FAERS: 1 | US FAERS | |
| 224 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 225 | Hydrocephalus | FAERS: 1 | US FAERS | |
| 226 | Hyperplasia | FAERS: 1 | US FAERS | |
| 227 | Hyperpyrexia | FAERS: 1 | US FAERS | |
| 228 | Hypokinesia | FAERS: 1 | US FAERS | |
| 229 | Hyporeflexia | FAERS: 1 | US FAERS | |
| 230 | Ileus | FAERS: 1 | US FAERS | |
| 231 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 232 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 233 | Infestation | FAERS: 1 | US FAERS | |
| 234 | Influenza | FAERS: 1 | US FAERS | |
| 235 | Injection site pain | FAERS: 1 | US FAERS | |
| 236 | Intention tremor | FAERS: 1 | US FAERS | |
| 237 | Intentional drug misuse | FAERS: 1 | US FAERS | |
| 238 | Joint swelling | FAERS: 1 | US FAERS | |
| 239 | Kernig's sign | FAERS: 1 | US FAERS | |
| 240 | Leukocytosis | FAERS: 1 | US FAERS | |
| 241 | Limb operation | FAERS: 1 | US FAERS | |
| 242 | Lipase increased | FAERS: 1 | US FAERS | |
| 243 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 244 | Malabsorption | FAERS: 1 | US FAERS | |
| 245 | Marasmus | FAERS: 1 | US FAERS | |
| 246 | Maternal exposure before pregnancy | FAERS: 1 | US FAERS | |
| 247 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 248 | Mechanical ventilation | FAERS: 1 | US FAERS | |
| 249 | Memory impairment | FAERS: 1 | US FAERS | |
| 250 | Meningism | FAERS: 1 | US FAERS | |
| 251 | Metrorrhagia | FAERS: 1 | US FAERS | |
| 252 | Moaning | FAERS: 1 | US FAERS | |
| 253 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 254 | Muscle tightness | FAERS: 1 | US FAERS | |
| 255 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 256 | Nervousness | FAERS: 1 | US FAERS | |
| 257 | Neuropathy | FAERS: 1 | US FAERS | |
| 258 | No adverse effect | FAERS: 1 | US FAERS | |
| 259 | Nodule | FAERS: 1 | US FAERS | |
| 260 | Oral discharge | FAERS: 1 | US FAERS | |
| 261 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 262 | Pain of skin | FAERS: 1 | US FAERS | |
| 263 | Pancreatitis | FAERS: 1 | US FAERS | |
| 264 | Panophthalmitis | FAERS: 1 | US FAERS | |
| 265 | Peripheral nerve palsy | FAERS: 1 | US FAERS | |
| 266 | Petechiae | FAERS: 1 | US FAERS | |
| 267 | Physical assault | FAERS: 1 | US FAERS | |
| 268 | Pneumocystis jiroveci pneumonia | FAERS: 1 | US FAERS | |
| 269 | Polyuria | FAERS: 1 | US FAERS | |
| 270 | Poor personal hygiene | FAERS: 1 | US FAERS | |
| 271 | Post procedural complication | FAERS: 1 | US FAERS | |
| 272 | Product availability issue | FAERS: 1 | US FAERS | |
| 273 | Product blister packaging issue | FAERS: 1 | US FAERS | |
| 274 | Product dose omission | FAERS: 1 | US FAERS | |
| 275 | Product quality issue | FAERS: 1 | US FAERS | |
| 276 | Punctate keratitis | FAERS: 1 | US FAERS | |
| 277 | Pyomyositis | FAERS: 1 | US FAERS | |
| 278 | Pyuria | FAERS: 1 | US FAERS | |
| 279 | Rectal tenesmus | FAERS: 1 | US FAERS | |
| 280 | Relapsing Fever | FAERS: 1 | US FAERS | |
| 281 | Respiratory distress | FAERS: 1 | US FAERS | |
| 282 | Retrograde amnesia | FAERS: 1 | US FAERS | |
| 283 | Schistosomiasis | FAERS: 1 | US FAERS | |
| 284 | Skin Erosion | FAERS: 1 | US FAERS | |
| 285 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 286 | Skin irritation | FAERS: 1 | US FAERS | |
| 287 | Skin lesion | FAERS: 1 | US FAERS | |
| 288 | Skinfold measurement | FAERS: 1 | US FAERS | |
| 289 | Sluggishness | FAERS: 1 | US FAERS | |
| 290 | Sudden death | FAERS: 1 | US FAERS | |
| 291 | Suicide attempt | FAERS: 1 | US FAERS | |
| 292 | Talipes | FAERS: 1 | US FAERS | |
| 293 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 294 | Therapeutic product ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 295 | Therapeutic response delayed | FAERS: 1 | US FAERS | |
| 296 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 297 | Tinnitus | FAERS: 1 | US FAERS | |
| 298 | Tuberculosis | FAERS: 1 | US FAERS | |
| 299 | Unevaluable event | FAERS: 1 | US FAERS | |
| 300 | Ventricular hypertrophy | FAERS: 1 | US FAERS | |
| 301 | Vocal Cord Paralysis | FAERS: 1 | US FAERS | |
| 302 | Wheezing | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.