saxagliptin
(QGJUIPDUBHWZPV-SGTAVMJGSA-N)
Structure
- SMILES
- N#C[C@@H]1C[C@H]2[C@@H](N1C(=O)[C@H](C13CC4CC(C1)CC(C3)(C4)O)N)C2
- Type(s)
- Approved
- ATC code(s)
- A10BD10; A10BD21; A10BD25; A10BH03
- Molecular Formula:
- C18H25N3O2
- Molecular Weight:
- 315.410
- Log P:
- 1.7962
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 2
- TPSA:
- 90.35
- CAS Number(s):
- 361442-04-8
Synonym(s)
1.
saxagliptin
2.
3-hydroxyadamantylglycine-4,5-methanoprolinenitrile hydrate
3.
BMS 477118
4.
BMS-477118
5.
BMS477118
6.
Onglyza
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Pancreatitis | FAERS: 102 | SIDER US FAERS | |
| 2 | Nausea | FAERS: 75 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 3 | Drug ineffective | FAERS: 59 | US FAERS | |
| 4 | Headache | FAERS: 52 | SIDER US FAERS | |
| 5 | Blood glucose increased | FAERS: 46 | US FAERS | |
| 6 | Dizziness | FAERS: 39 | OFFSIDES SIDER US FAERS | |
| 7 | Drug dose omission | FAERS: 32 | US FAERS | |
| 8 | Pruritus | FAERS: 28 | SIDER US FAERS | |
| 9 | Vomiting | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 10 | Weight decreased | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 11 | Abdominal Pain | FAERS: 23 | SIDER US FAERS | |
| 12 | Urticaria | FAERS: 22 | SIDER US FAERS | |
| 13 | Adverse event | FAERS: 21 | US FAERS | |
| 14 | Angioedema | FAERS: 21 | SIDER US FAERS | |
| 15 | Malaise | FAERS: 21 | US FAERS | |
| 16 | Medication Error | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 17 | Pancreatic carcinoma | FAERS: 19 | US FAERS | |
| 18 | Fatigue | FAERS: 18 | SIDER US FAERS | |
| 19 | Chest Pain | FAERS: 17 | OFFSIDES US FAERS | |
| 20 | Abdominal discomfort | FAERS: 15 | US FAERS | |
| 21 | Constipation | FAERS: 15 | US FAERS | |
| 22 | Arthralgia | FAERS: 14 | SIDER US FAERS | |
| 23 | Urinary tract infection | FAERS: 14 | SIDER US FAERS | |
| 24 | Myalgia | FAERS: 13 | SIDER US FAERS | |
| 25 | Swelling | FAERS: 13 | US FAERS | |
| 26 | Back Pain | FAERS: 12 | US FAERS | |
| 27 | Lip swelling | FAERS: 12 | US FAERS | |
| 28 | Nasopharyngitis | FAERS: 11 | SIDER US FAERS | |
| 29 | Blood creatinine increased | FAERS: 10 | OFFSIDES SIDER US FAERS | |
| 30 | Cerebrovascular accident | FAERS: 10 | US FAERS | |
| 31 | Hypersensitivity | FAERS: 10 | SIDER US FAERS | |
| 32 | Palpitations | FAERS: 10 | US FAERS | |
| 33 | Asthenia | FAERS: 9 | SIDER US FAERS | |
| 34 | Cholelithiasis | FAERS: 9 | US FAERS | |
| 35 | Pain | FAERS: 9 | US FAERS | |
| 36 | Alanine Aminotransferase Increased | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 37 | Alopecia | FAERS: 8 | US FAERS | |
| 38 | Anaphylactic shock | FAERS: 8 | SIDER US FAERS | |
| 39 | Blood glucose abnormal | FAERS: 8 | US FAERS | |
| 40 | Myocardial Infarction | FAERS: 8 | US FAERS | |
| 41 | Overdose | FAERS: 8 | US FAERS | |
| 42 | Somnolence | FAERS: 8 | US FAERS | |
| 43 | Wrong technique in drug usage process | FAERS: 8 | US FAERS | |
| 44 | Burning sensation | FAERS: 7 | US FAERS | |
| 45 | Chest discomfort | FAERS: 7 | US FAERS | |
| 46 | Dyspepsia | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 47 | Lipase increased | FAERS: 7 | US FAERS | |
| 48 | Oropharyngeal pain | FAERS: 7 | US FAERS | |
| 49 | Tremor | FAERS: 7 | US FAERS | |
| 50 | Anxiety | FAERS: 6 | US FAERS | |
| 51 | Blood glucose decreased | FAERS: 6 | US FAERS | |
| 52 | Erythema | FAERS: 6 | US FAERS | |
| 53 | Feeling abnormal | FAERS: 6 | US FAERS | |
| 54 | Intentional product misuse | FAERS: 6 | US FAERS | |
| 55 | Nervousness | FAERS: 6 | US FAERS | |
| 56 | Aspartate Aminotransferase Increased | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 57 | Atrial Fibrillation | FAERS: 5 | US FAERS | |
| 58 | Cardiac Flutter | FAERS: 5 | US FAERS | |
| 59 | Dehydration | FAERS: 5 | US FAERS | |
| 60 | Diabetes Mellitus | FAERS: 5 | US FAERS | |
| 61 | Dysgeusia | FAERS: 5 | US FAERS | |
| 62 | Sinusitis | FAERS: 5 | SIDER US FAERS | |
| 63 | Therapeutic response unexpected | FAERS: 5 | US FAERS | |
| 64 | Amylase increased | FAERS: 4 | US FAERS | |
| 65 | Angina Pectoris | FAERS: 4 | US FAERS | |
| 66 | Blindness | FAERS: 4 | US FAERS | |
| 67 | Cardiac Arrest | FAERS: 4 | US FAERS | |
| 68 | Cerebral Infarction | FAERS: 4 | US FAERS | |
| 69 | Circumstance or information capable of leading to medication error | FAERS: 4 | US FAERS | |
| 70 | Diabetes mellitus inadequate control | FAERS: 4 | US FAERS | |
| 71 | Dysphonia | FAERS: 4 | US FAERS | |
| 72 | Gout | FAERS: 4 | US FAERS | |
| 73 | Medication residue present | FAERS: 4 | US FAERS | |
| 74 | Pneumonia | FAERS: 4 | US FAERS | |
| 75 | Pyelonephritis | FAERS: 4 | US FAERS | |
| 76 | Rheumatoid Arthritis | FAERS: 4 | US FAERS | |
| 77 | Skin Ulcer | FAERS: 4 | US FAERS | |
| 78 | Sudden death | FAERS: 4 | OFFSIDES US FAERS | |
| 79 | Suicide attempt | FAERS: 4 | US FAERS | |
| 80 | Visual Impairment | FAERS: 4 | US FAERS | |
| 81 | Acute Coronary Syndrome | FAERS: 3 | US FAERS | |
| 82 | Agitation | FAERS: 3 | US FAERS | |
| 83 | Anosmia | FAERS: 3 | US FAERS | |
| 84 | Chills | FAERS: 3 | US FAERS | |
| 85 | Crying | FAERS: 3 | US FAERS | |
| 86 | Cystitis | FAERS: 3 | US FAERS | |
| 87 | Deafness | FAERS: 3 | US FAERS | |
| 88 | Dysuria | FAERS: 3 | US FAERS | |
| 89 | Ear congestion | FAERS: 3 | US FAERS | |
| 90 | Erectile dysfunction | FAERS: 3 | SIDER US FAERS | |
| 91 | Flushing | FAERS: 3 | US FAERS | |
| 92 | Gamma-Glutamyltransferase Increased | FAERS: 3 | US FAERS | |
| 93 | Hypotension | FAERS: 3 | US FAERS | |
| 94 | Laceration | FAERS: 3 | US FAERS | |
| 95 | Pancreatic enzymes increased | FAERS: 3 | US FAERS | |
| 96 | Pulmonary Embolism | FAERS: 3 | US FAERS | |
| 97 | Renal pain | FAERS: 3 | US FAERS | |
| 98 | Skin reaction | FAERS: 3 | US FAERS | |
| 99 | Tachycardia | FAERS: 3 | US FAERS | |
| 100 | Thrombocytopenia | FAERS: 3 | SIDER US FAERS | |
| 101 | Urinary Retention | FAERS: 3 | US FAERS | |
| 102 | Accidental overdose | FAERS: 2 | US FAERS | |
| 103 | Acute myocardial infarction | FAERS: 2 | US FAERS | |
| 104 | Agranulocytosis | FAERS: 2 | US FAERS | |
| 105 | Anger | FAERS: 2 | US FAERS | |
| 106 | Ascites | FAERS: 2 | US FAERS | |
| 107 | Bladder pain | FAERS: 2 | US FAERS | |
| 108 | Blood glucose fluctuation | FAERS: 2 | US FAERS | |
| 109 | Blood urine present | FAERS: 2 | US FAERS | |
| 110 | Bradycardia | FAERS: 2 | US FAERS | |
| 111 | Bronchitis | FAERS: 2 | US FAERS | |
| 112 | Carpal Tunnel Syndrome | FAERS: 2 | US FAERS | |
| 113 | Cellulitis | FAERS: 2 | US FAERS | |
| 114 | Creatinine renal clearance decreased | FAERS: 2 | US FAERS | |
| 115 | Diplopia | FAERS: 2 | US FAERS | |
| 116 | Discomfort | FAERS: 2 | US FAERS | |
| 117 | Drug administration error | FAERS: 2 | US FAERS | |
| 118 | Drug prescribing error | FAERS: 2 | US FAERS | |
| 119 | Emotional disorder | FAERS: 2 | US FAERS | |
| 120 | Feeling Cold | FAERS: 2 | US FAERS | |
| 121 | Flank Pain | FAERS: 2 | US FAERS | |
| 122 | Flatulence | FAERS: 2 | SIDER US FAERS | |
| 123 | Gastrointestinal carcinoma | FAERS: 2 | US FAERS | |
| 124 | General physical health deterioration | FAERS: 2 | US FAERS | |
| 125 | Hepatitis | FAERS: 2 | US FAERS | |
| 126 | Hunger | FAERS: 2 | US FAERS | |
| 127 | Infarction | FAERS: 2 | US FAERS | |
| 128 | Infection | FAERS: 2 | SIDER US FAERS | |
| 129 | Lethargy | FAERS: 2 | US FAERS | |
| 130 | Leukopenia | FAERS: 2 | US FAERS | |
| 131 | Macular degeneration | FAERS: 2 | US FAERS | |
| 132 | Medication residue | FAERS: 2 | US FAERS | |
| 133 | Microalbuminuria | FAERS: 2 | US FAERS | |
| 134 | Mood swings | FAERS: 2 | US FAERS | |
| 135 | Muscle tightness | FAERS: 2 | US FAERS | |
| 136 | Musculoskeletal Pain | FAERS: 2 | US FAERS | |
| 137 | Nephritis | FAERS: 2 | US FAERS | |
| 138 | Pancreatic Neoplasm | FAERS: 2 | US FAERS | |
| 139 | Pregnancy | FAERS: 2 | US FAERS | |
| 140 | Product quality issue | FAERS: 2 | US FAERS | |
| 141 | Psoriasis | FAERS: 2 | OFFSIDES US FAERS | |
| 142 | Pulmonary congestion | FAERS: 2 | OFFSIDES US FAERS | |
| 143 | Rash erythematous | FAERS: 2 | US FAERS | |
| 144 | Rhabdomyolysis | FAERS: 2 | OFFSIDES US FAERS | |
| 145 | Rhinitis | FAERS: 2 | US FAERS | |
| 146 | Septic Shock | FAERS: 2 | US FAERS | |
| 147 | Skin irritation | FAERS: 2 | US FAERS | |
| 148 | Skin lesion | FAERS: 2 | US FAERS | |
| 149 | Syncope | FAERS: 2 | US FAERS | |
| 150 | Therapy cessation | FAERS: 2 | US FAERS | |
| 151 | Throat irritation | FAERS: 2 | US FAERS | |
| 152 | Tinnitus | FAERS: 2 | US FAERS | |
| 153 | Transaminases increased | FAERS: 2 | US FAERS | |
| 154 | Vertigo | FAERS: 2 | US FAERS | |
| 155 | Abscess | FAERS: 1 | US FAERS | |
| 156 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 157 | Ageusia | FAERS: 1 | US FAERS | |
| 158 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 159 | Amputation | FAERS: 1 | US FAERS | |
| 160 | Amyotrophic Lateral Sclerosis | FAERS: 1 | US FAERS | |
| 161 | Anion Gap | FAERS: 1 | US FAERS | |
| 162 | Anorgasmia | FAERS: 1 | US FAERS | |
| 163 | Aphonia | FAERS: 1 | US FAERS | |
| 164 | Arthropathy | FAERS: 1 | US FAERS | |
| 165 | Asthma | FAERS: 1 | US FAERS | |
| 166 | Benign Neoplasm | FAERS: 1 | US FAERS | |
| 167 | Blepharospasm | FAERS: 1 | US FAERS | |
| 168 | Blood amylase increased | FAERS: 1 | US FAERS | |
| 169 | Blood calcitonin increased | FAERS: 1 | US FAERS | |
| 170 | Blood creatine increased | FAERS: 1 | OFFSIDES US FAERS | |
| 171 | Blood creatine phosphokinase decreased | FAERS: 1 | US FAERS | |
| 172 | Blood creatine phosphokinase increased | FAERS: 1 | SIDER US FAERS | |
| 173 | Blood ketone body increased | FAERS: 1 | US FAERS | |
| 174 | Blood triglycerides increased | FAERS: 1 | SIDER US FAERS | |
| 175 | Blood urea increased | FAERS: 1 | OFFSIDES US FAERS | |
| 176 | Blue Toe Syndrome | FAERS: 1 | US FAERS | |
| 177 | Brain Death | FAERS: 1 | US FAERS | |
| 178 | Cachexia | FAERS: 1 | US FAERS | |
| 179 | Cataract | FAERS: 1 | US FAERS | |
| 180 | Cell Death | FAERS: 1 | US FAERS | |
| 181 | Cerebellar infarction | FAERS: 1 | US FAERS | |
| 182 | Cholestasis | FAERS: 1 | US FAERS | |
| 183 | Chromaturia | FAERS: 1 | US FAERS | |
| 184 | Completed Suicide | FAERS: 1 | US FAERS | |
| 185 | Compression fracture | FAERS: 1 | US FAERS | |
| 186 | Creatinine renal clearance increased | FAERS: 1 | US FAERS | |
| 187 | Cytolytic hepatitis | FAERS: 1 | US FAERS | |
| 188 | Decreased immune responsiveness | FAERS: 1 | US FAERS | |
| 189 | Dermatitis | FAERS: 1 | SIDER US FAERS | |
| 190 | Disorientation | FAERS: 1 | US FAERS | |
| 191 | Drug level increased | FAERS: 1 | US FAERS | |
| 192 | Duodenal ulcer perforation | FAERS: 1 | US FAERS | |
| 193 | Dysphemia | FAERS: 1 | US FAERS | |
| 194 | Ear discomfort | FAERS: 1 | US FAERS | |
| 195 | Economic problem | FAERS: 1 | US FAERS | |
| 196 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 197 | Endometrial disorder | FAERS: 1 | US FAERS | |
| 198 | Epididymitis | FAERS: 1 | US FAERS | |
| 199 | Epistaxis | FAERS: 1 | US FAERS | |
| 200 | Eructation | FAERS: 1 | US FAERS | |
| 201 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 202 | Exfoliative rash | FAERS: 1 | US FAERS | |
| 203 | Expired drug administered | FAERS: 1 | US FAERS | |
| 204 | Expired product administered | FAERS: 1 | US FAERS | |
| 205 | Feeling jittery | FAERS: 1 | US FAERS | |
| 206 | Fluid overload | FAERS: 1 | US FAERS | |
| 207 | Gastric infection | FAERS: 1 | US FAERS | |
| 208 | Gastritis | FAERS: 1 | SIDER US FAERS | |
| 209 | Gastrointestinal Pain | FAERS: 1 | SIDER US FAERS | |
| 210 | Gestational Diabetes | FAERS: 1 | US FAERS | |
| 211 | Graft dysfunction | FAERS: 1 | US FAERS | |
| 212 | Hemiplegia | FAERS: 1 | US FAERS | |
| 213 | Hepatitis C | FAERS: 1 | US FAERS | |
| 214 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 215 | Incoherent | FAERS: 1 | US FAERS | |
| 216 | Incontinence | FAERS: 1 | US FAERS | |
| 217 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 218 | Insurance issue | FAERS: 1 | US FAERS | |
| 219 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 220 | Intestinal infarction | FAERS: 1 | US FAERS | |
| 221 | Intraductal papillary mucinous neoplasm | FAERS: 1 | US FAERS | |
| 222 | Joint stiffness | FAERS: 1 | US FAERS | |
| 223 | Joint swelling | FAERS: 1 | US FAERS | |
| 224 | Low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 225 | Lymphocyte count decreased | FAERS: 1 | US FAERS | |
| 226 | Lymphoma | FAERS: 1 | US FAERS | |
| 227 | Macular fibrosis | FAERS: 1 | US FAERS | |
| 228 | Malignant ascites | FAERS: 1 | US FAERS | |
| 229 | Malignant mesenteric neoplasm | FAERS: 1 | US FAERS | |
| 230 | Memory impairment | FAERS: 1 | US FAERS | |
| 231 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 232 | Muscle strain | FAERS: 1 | US FAERS | |
| 233 | Nephrocalcinosis | FAERS: 1 | US FAERS | |
| 234 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 235 | Nephrotic Syndrome | FAERS: 1 | US FAERS | |
| 236 | Neuralgia | FAERS: 1 | US FAERS | |
| 237 | Neurodermatitis | FAERS: 1 | US FAERS | |
| 238 | No adverse event | FAERS: 1 | US FAERS | |
| 239 | Nocturia | FAERS: 1 | US FAERS | |
| 240 | Obesity | FAERS: 1 | US FAERS | |
| 241 | Onychoclasis | FAERS: 1 | US FAERS | |
| 242 | Optic nerve infarction | FAERS: 1 | US FAERS | |
| 243 | Oral pain | FAERS: 1 | US FAERS | |
| 244 | Overweight | FAERS: 1 | US FAERS | |
| 245 | Pain of skin | FAERS: 1 | US FAERS | |
| 246 | Pallor | FAERS: 1 | US FAERS | |
| 247 | Pancreatic Pseudocyst | FAERS: 1 | US FAERS | |
| 248 | Pancytopenia | FAERS: 1 | US FAERS | |
| 249 | Peripheral arthritis | FAERS: 1 | US FAERS | |
| 250 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 251 | Pharyngitis | FAERS: 1 | US FAERS | |
| 252 | Physical deconditioning | FAERS: 1 | US FAERS | |
| 253 | Pneumothorax | FAERS: 1 | US FAERS | |
| 254 | Polyarthritis | FAERS: 1 | US FAERS | |
| 255 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 256 | Postoperative ileus | FAERS: 1 | US FAERS | |
| 257 | Precancerous mucosal lesion | FAERS: 1 | US FAERS | |
| 258 | Product counterfeit | FAERS: 1 | US FAERS | |
| 259 | Product dose omission | FAERS: 1 | US FAERS | |
| 260 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 261 | Product use issue | FAERS: 1 | US FAERS | |
| 262 | Renal cyst | FAERS: 1 | US FAERS | |
| 263 | Respiratory Failure | FAERS: 1 | OFFSIDES US FAERS | |
| 264 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 265 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 266 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 267 | Sciatica | FAERS: 1 | US FAERS | |
| 268 | Sepsis | FAERS: 1 | US FAERS | |
| 269 | Skin necrosis | FAERS: 1 | US FAERS | |
| 270 | Somnambulism | FAERS: 1 | US FAERS | |
| 271 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 272 | Stomatitis | FAERS: 1 | US FAERS | |
| 273 | Stress | FAERS: 1 | US FAERS | |
| 274 | Therapeutic response changed | FAERS: 1 | US FAERS | |
| 275 | Thermal burn | FAERS: 1 | US FAERS | |
| 276 | Thrombosis | FAERS: 1 | US FAERS | |
| 277 | Toxic Epidermal Necrolysis | FAERS: 1 | US FAERS | |
| 278 | Upper respiratory tract congestion | FAERS: 1 | US FAERS | |
| 279 | Vasculitis | FAERS: 1 | US FAERS | |
| 280 | Vocal Cord Paralysis | FAERS: 1 | US FAERS | |
| 281 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 282 | jaundice | FAERS: 1 | US FAERS | |
| 283 | treatment failure | FAERS: 1 | US FAERS | |
| 284 | Adenocarcinoma | OFFSIDES | ||
| 285 | Alveolitis | OFFSIDES | ||
| 286 | Arteriovenous fistula site complication | OFFSIDES | ||
| 287 | Arteriovenous fistula thrombosis | OFFSIDES | ||
| 288 | Blood uric acid | OFFSIDES | ||
| 289 | Chronic left ventricular failure | OFFSIDES | ||
| 290 | Erosive gastritis | OFFSIDES | ||
| 291 | Fracture | SIDER | ||
| 292 | Gastric Dilatation | OFFSIDES | ||
| 293 | Gastroenteritis | SIDER | ||
| 294 | Generalized urticaria | SIDER | ||
| 295 | Inappropriate schedule of drug administration | OFFSIDES | ||
| 296 | Infestation | SIDER | ||
| 297 | Lymphopenia | SIDER | ||
| 298 | Malnutrition | SIDER | ||
| 299 | Mental status changes | OFFSIDES | ||
| 300 | Motor Skills Disorders | 25446674 | CTD | |
| 301 | Muscle Rigidity | 25446674 | CTD | |
| 302 | Musculoskeletal discomfort | SIDER | ||
| 303 | Pericardial effusion | OFFSIDES | ||
| 304 | Polymyalgia Rheumatica | OFFSIDES | ||
| 305 | Procedural complication | OFFSIDES | ||
| 306 | Purpura | SIDER | ||
| 307 | QRS axis abnormal | OFFSIDES | ||
| 308 | Salmonella sepsis | SIDER | ||
| 309 | Snoring | Canada Vigilance: 1 | Canada Vigilance | |
| 310 | Sudden Cardiac Death | OFFSIDES | ||
| 311 | Thrombosis in device | OFFSIDES | ||
| 312 | Tuberculosis | SIDER | ||
| 313 | VIIth nerve paralysis | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120329
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.