nepafenac
(QEFAQIPZVLVERP-UHFFFAOYSA-N)
Structure
- SMILES
- NC(=O)Cc1cccc(c1N)C(=O)c1ccccc1
- Type(s)
- Approved; Investigational
- ATC code(s)
- S01BC10
- Molecular Formula:
- C15H14N2O2
- Molecular Weight:
- 254.284
- Log P:
- 2.8091
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 2
- TPSA:
- 86.18
- CAS Number(s):
- 78281-72-8
Synonym(s)
1.
nepafenac
2.
2-amino-3-benzoylbenzeneacetamide
3.
Nevanac
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Eye pain | FAERS: 361 | OFFSIDES SIDER US FAERS | |
| 2 | Drug ineffective | FAERS: 215 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 3 | Liquid product physical issue | FAERS: 37 | US FAERS | |
| 4 | Eye irritation | FAERS: 34 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 5 | Product quality issue | FAERS: 27 | US FAERS | |
| 6 | Therapy partial responder | FAERS: 26 | US FAERS | |
| 7 | Visual Impairment | FAERS: 14 | US FAERS | |
| 8 | Incorrect dose administered | FAERS: 13 | US FAERS | |
| 9 | Punctate keratitis | FAERS: 13 | OFFSIDES SIDER US FAERS | |
| 10 | Product packaging quantity issue | FAERS: 12 | US FAERS | |
| 11 | Foreign body sensation in eyes | FAERS: 11 | OFFSIDES SIDER US FAERS | |
| 12 | Product physical consistency issue | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 13 | Ocular Toxicity | FAERS: 10 | US FAERS | |
| 14 | Corneal Opacity | FAERS: 9 | SIDER US FAERS | |
| 15 | Photophobia | FAERS: 9 | SIDER US FAERS | |
| 16 | Product container issue | FAERS: 9 | US FAERS | |
| 17 | Nausea | FAERS: 8 | OFFSIDES SIDER US FAERS | |
| 18 | Ocular discomfort | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 19 | Pain | FAERS: 8 | OFFSIDES US FAERS | |
| 20 | Product dropper issue | FAERS: 8 | US FAERS | |
| 21 | Therapeutic response delayed | FAERS: 8 | US FAERS | |
| 22 | Drug administration error | FAERS: 7 | US FAERS | |
| 23 | Malabsorption from application site | FAERS: 7 | US FAERS | |
| 24 | Eye inflammation | FAERS: 6 | OFFSIDES US FAERS | |
| 25 | Headache | FAERS: 6 | SIDER US FAERS | |
| 26 | Corneal epithelium defect | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 27 | Dizziness | FAERS: 5 | SIDER US FAERS | |
| 28 | Feeling abnormal | FAERS: 5 | OFFSIDES US FAERS | |
| 29 | Hypersensitivity | FAERS: 5 | SIDER US FAERS | |
| 30 | Inflammation | FAERS: 5 | US FAERS | |
| 31 | No adverse event | FAERS: 5 | US FAERS | |
| 32 | Product physical issue | FAERS: 5 | US FAERS | |
| 33 | Abdominal discomfort | FAERS: 4 | US FAERS | |
| 34 | Chest discomfort | FAERS: 4 | US FAERS | |
| 35 | Corneal Perforation | FAERS: 4 | US FAERS | |
| 36 | Drug prescribing error | FAERS: 4 | US FAERS | |
| 37 | Expired product administered | FAERS: 4 | US FAERS | |
| 38 | Eyelid margin crusting | FAERS: 4 | SIDER US FAERS | |
| 39 | Medication residue present | FAERS: 4 | US FAERS | |
| 40 | Palpitations | FAERS: 4 | US FAERS | |
| 41 | Product administration error | FAERS: 4 | US FAERS | |
| 42 | Toxicity to various agents | FAERS: 4 | US FAERS | |
| 43 | Accidental exposure to product | FAERS: 3 | US FAERS | |
| 44 | Blindness | FAERS: 3 | US FAERS | |
| 45 | Cerebrovascular accident | FAERS: 3 | US FAERS | |
| 46 | Corneal Scar | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 47 | Diplopia | FAERS: 3 | US FAERS | |
| 48 | Dyspepsia | FAERS: 3 | US FAERS | |
| 49 | Inappropriate schedule of drug administration | FAERS: 3 | US FAERS | |
| 50 | Malaise | FAERS: 3 | US FAERS | |
| 51 | Poor quality drug administered | FAERS: 3 | US FAERS | |
| 52 | Post procedural complication | FAERS: 3 | OFFSIDES US FAERS | |
| 53 | Product use complaint | FAERS: 3 | US FAERS | |
| 54 | Product use in unapproved indication | FAERS: 3 | US FAERS | |
| 55 | Pruritus | FAERS: 3 | SIDER US FAERS | |
| 56 | Retinal Detachment | FAERS: 3 | US FAERS | |
| 57 | Sinusitis | FAERS: 3 | SIDER US FAERS | |
| 58 | Visual disturbance | FAERS: 3 | OFFSIDES US FAERS | |
| 59 | Atrial Fibrillation | FAERS: 2 | US FAERS | |
| 60 | Blepharospasm | FAERS: 2 | US FAERS | |
| 61 | Cataract | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 62 | Chest Pain | FAERS: 2 | OFFSIDES US FAERS | |
| 63 | Corneal epithelium disorder | FAERS: 2 | OFFSIDES US FAERS | |
| 64 | Corneal erosion | FAERS: 2 | OFFSIDES US FAERS | |
| 65 | Corneal irritation | FAERS: 2 | US FAERS | |
| 66 | Corneal thinning | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 67 | Drug dispensing error | FAERS: 2 | US FAERS | |
| 68 | Endophthalmitis | FAERS: 2 | SIDER US FAERS | |
| 69 | Erythema | FAERS: 2 | US FAERS | |
| 70 | Fatigue | FAERS: 2 | US FAERS | |
| 71 | Glaucoma | FAERS: 2 | OFFSIDES US FAERS | |
| 72 | Hypopyon | FAERS: 2 | US FAERS | |
| 73 | Iritis | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 74 | Keratitis | FAERS: 2 | SIDER US FAERS | |
| 75 | Macular degeneration | FAERS: 2 | US FAERS | |
| 76 | Medication Error | FAERS: 2 | US FAERS | |
| 77 | Muscle strain | FAERS: 2 | US FAERS | |
| 78 | Mydriasis | FAERS: 2 | US FAERS | |
| 79 | Nervousness | FAERS: 2 | US FAERS | |
| 80 | Product package associated injury | FAERS: 2 | US FAERS | |
| 81 | Product packaging issue | FAERS: 2 | US FAERS | |
| 82 | Product use issue | FAERS: 2 | US FAERS | |
| 83 | Urticaria | FAERS: 2 | US FAERS | |
| 84 | Uveitis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 85 | Vitreous floaters | FAERS: 2 | US FAERS | |
| 86 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 87 | Accidental overdose | FAERS: 1 | OFFSIDES US FAERS | |
| 88 | Angioedema | FAERS: 1 | US FAERS | |
| 89 | Angle Closure Glaucoma | FAERS: 1 | US FAERS | |
| 90 | Application site burn | FAERS: 1 | US FAERS | |
| 91 | Arthralgia | FAERS: 1 | US FAERS | |
| 92 | Arthritis | FAERS: 1 | SIDER US FAERS | |
| 93 | Asthenopia | FAERS: 1 | OFFSIDES US FAERS | |
| 94 | Astigmatism | FAERS: 1 | US FAERS | |
| 95 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 96 | Chorioretinitis | FAERS: 1 | US FAERS | |
| 97 | Chromaturia | FAERS: 1 | US FAERS | |
| 98 | Chronic sinusitis | FAERS: 1 | US FAERS | |
| 99 | Ciliary zonular dehiscence | FAERS: 1 | US FAERS | |
| 100 | Cold sweat | FAERS: 1 | US FAERS | |
| 101 | Conjunctival scar | FAERS: 1 | US FAERS | |
| 102 | Consciousness fluctuating | FAERS: 1 | US FAERS | |
| 103 | Constipation | FAERS: 1 | US FAERS | |
| 104 | Contraindicated product administered | FAERS: 1 | US FAERS | |
| 105 | Corneal decompensation | FAERS: 1 | US FAERS | |
| 106 | Corneal defect | FAERS: 1 | US FAERS | |
| 107 | Corneal degeneration | FAERS: 1 | US FAERS | |
| 108 | Corneal exfoliation | FAERS: 1 | US FAERS | |
| 109 | Corneal hypertrophy | FAERS: 1 | US FAERS | |
| 110 | Deafness | FAERS: 1 | US FAERS | |
| 111 | Depressed mood | FAERS: 1 | US FAERS | |
| 112 | Device dislocation | FAERS: 1 | US FAERS | |
| 113 | Discomfort | FAERS: 1 | US FAERS | |
| 114 | Disease Progression | FAERS: 1 | US FAERS | |
| 115 | Drug Tolerance | FAERS: 1 | US FAERS | |
| 116 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 117 | Dysgraphia | FAERS: 1 | US FAERS | |
| 118 | Eczema | FAERS: 1 | US FAERS | |
| 119 | Epistaxis | FAERS: 1 | US FAERS | |
| 120 | Excessive eye blinking | FAERS: 1 | US FAERS | |
| 121 | Eye Infection | FAERS: 1 | US FAERS | |
| 122 | Eye allergy | FAERS: 1 | US FAERS | |
| 123 | Eye operation complication | FAERS: 1 | US FAERS | |
| 124 | Flushing | FAERS: 1 | US FAERS | |
| 125 | Gaze palsy | FAERS: 1 | US FAERS | |
| 126 | Genital rash | FAERS: 1 | US FAERS | |
| 127 | Hemiparesis | FAERS: 1 | US FAERS | |
| 128 | Impaired driving ability | FAERS: 1 | OFFSIDES US FAERS | |
| 129 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 130 | Incorrect product administration duration | FAERS: 1 | US FAERS | |
| 131 | Instillation site pain | FAERS: 1 | US FAERS | |
| 132 | Intraocular pressure test abnormal | FAERS: 1 | US FAERS | |
| 133 | Lip swelling | FAERS: 1 | US FAERS | |
| 134 | Mastication disorder | FAERS: 1 | US FAERS | |
| 135 | Muscle tightness | FAERS: 1 | US FAERS | |
| 136 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 137 | Ocular icterus | FAERS: 1 | US FAERS | |
| 138 | Optic Neuropathy | FAERS: 1 | US FAERS | |
| 139 | Overdose | FAERS: 1 | US FAERS | |
| 140 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 141 | Paranasal sinus discomfort | FAERS: 1 | US FAERS | |
| 142 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 143 | Pharyngeal swelling | FAERS: 1 | US FAERS | |
| 144 | Pinguecula | FAERS: 1 | US FAERS | |
| 145 | Product contamination microbial | FAERS: 1 | US FAERS | |
| 146 | Product deposit | FAERS: 1 | US FAERS | |
| 147 | Product formulation issue | FAERS: 1 | US FAERS | |
| 148 | Product gel formation | FAERS: 1 | US FAERS | |
| 149 | Product residue present | FAERS: 1 | US FAERS | |
| 150 | Product storage error | FAERS: 1 | US FAERS | |
| 151 | Pterygium | FAERS: 1 | US FAERS | |
| 152 | Retching | FAERS: 1 | US FAERS | |
| 153 | Retinal Vascular Disorder | FAERS: 1 | US FAERS | |
| 154 | Retinitis | FAERS: 1 | US FAERS | |
| 155 | Scleritis | FAERS: 1 | OFFSIDES US FAERS | |
| 156 | Skin irritation | FAERS: 1 | US FAERS | |
| 157 | Swelling | FAERS: 1 | US FAERS | |
| 158 | Syncope | FAERS: 1 | US FAERS | |
| 159 | Therapeutic product effect delayed | FAERS: 1 | US FAERS | |
| 160 | Throat irritation | FAERS: 1 | US FAERS | |
| 161 | Toxoplasmosis | FAERS: 1 | US FAERS | |
| 162 | Unevaluable event | FAERS: 1 | OFFSIDES US FAERS | |
| 163 | Vertigo | FAERS: 1 | US FAERS | |
| 164 | Vitreous Detachment | FAERS: 1 | SIDER US FAERS | |
| 165 | Vomiting | FAERS: 1 | SIDER US FAERS | |
| 166 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 167 | Abdominal Pain | OFFSIDES | ||
| 168 | Acanthamoeba Infection | OFFSIDES | ||
| 169 | Acquired diaphragmatic eventration | OFFSIDES | ||
| 170 | Activities of daily living impaired | OFFSIDES | ||
| 171 | Alopecia | OFFSIDES | ||
| 172 | Amnesia | OFFSIDES | ||
| 173 | Angiomyolipoma | OFFSIDES | ||
| 174 | Anhedonia | OFFSIDES | ||
| 175 | Anterior chamber inflammation | OFFSIDES | ||
| 176 | Anxiety | OFFSIDES | ||
| 177 | Apathy | OFFSIDES | ||
| 178 | Asthenia | OFFSIDES | ||
| 179 | Bacillus infection | OFFSIDES | ||
| 180 | Blepharitis | SIDER | ||
| 181 | Blepharoptosis | OFFSIDES | ||
| 182 | Blood Glucose | OFFSIDES | ||
| 183 | Blood creatine increased | OFFSIDES | ||
| 184 | Blood glucose decreased | OFFSIDES | ||
| 185 | Blurred vision | OFFSIDES | ||
| 186 | Cataract operation | OFFSIDES | ||
| 187 | Conjunctival deposit | OFFSIDES | ||
| 188 | Corneal Infection | OFFSIDES | ||
| 189 | Corneal Ulcer | OFFSIDES | ||
| 190 | Culture positive | OFFSIDES | ||
| 191 | Cutis Laxa | SIDER | ||
| 192 | Dehydration | OFFSIDES | ||
| 193 | Dental caries | OFFSIDES | ||
| 194 | Diabetes Mellitus | SIDER | ||
| 195 | Drug toxicity | OFFSIDES | ||
| 196 | Drug withdrawal headache | OFFSIDES | ||
| 197 | Economic problem | OFFSIDES | ||
| 198 | Escherichia infection | OFFSIDES | ||
| 199 | Eyelids pruritus | OFFSIDES | ||
| 200 | Gastroduodenitis | OFFSIDES | ||
| 201 | Glaucoma surgery | OFFSIDES | ||
| 202 | Globulinuria | OFFSIDES | ||
| 203 | Glossitis | OFFSIDES | ||
| 204 | Goiter | OFFSIDES | ||
| 205 | Grip strength | OFFSIDES | ||
| 206 | Hepatitis | OFFSIDES | ||
| 207 | Iatrogenic injury | OFFSIDES | ||
| 208 | Intentional drug misuse | OFFSIDES | ||
| 209 | Intraocular inflammation | OFFSIDES | ||
| 210 | Intraocular pressure fluctuation | OFFSIDES | ||
| 211 | Laboratory test interference | OFFSIDES | ||
| 212 | Lacrimation decreased | SIDER | ||
| 213 | Lacrimation | SIDER | ||
| 214 | Musculoskeletal stiffness | OFFSIDES | ||
| 215 | Nodule | OFFSIDES | ||
| 216 | Non-cardiac chest pain | OFFSIDES | ||
| 217 | Onychoclasis | OFFSIDES | ||
| 218 | Osteopenia | OFFSIDES | ||
| 219 | Pancreatitis | OFFSIDES | ||
| 220 | Pregnancy | SIDER | ||
| 221 | Rales | OFFSIDES | ||
| 222 | Residual urine | OFFSIDES | ||
| 223 | Rheumatoid Arthritis | SIDER | ||
| 224 | Scab | SIDER | ||
| 225 | Skin laceration | OFFSIDES | ||
| 226 | Sleep-related eating disorder | OFFSIDES | ||
| 227 | Stevens-Johnson Syndrome | OFFSIDES | ||
| 228 | Tenosynovitis | OFFSIDES | ||
| 229 | Trabeculectomy | OFFSIDES | ||
| 230 | Ulcer | OFFSIDES | ||
| 231 | Vascular rupture | OFFSIDES | ||
| 232 | nervous system disorder | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.