Loperamide
(PGYPOBZJRVSMDS-UHFFFAOYSA-N)
Structure
- SMILES
- Clc1ccc(cc1)C1(O)CCN(CC1)CCC(C(=O)N(C)C)(c1ccccc1)c1ccccc1.Cl
- Molecular Formula:
- C29H34Cl2N2O2
- Molecular Weight:
- 513.498
- Log P:
- 5.8279
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 2
- TPSA:
- 43.78
- CAS Number(s):
- 34552-83-5
Synonym(s)
1.
Loperamide
2.
Imodium
3.
Loperamide Hydrochloride
4.
Loperamide Monohydrochloride
5.
R-18553
6.
Hydrochloride, Loperamide
7.
Monohydrochloride, Loperamide
8.
R 18553
9.
R18553
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 661 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 2 | Incorrect dose administered | FAERS: 428 | US FAERS | |
| 3 | Expired product administered | FAERS: 268 | US FAERS | |
| 4 | Intentional product use issue | FAERS: 267 | US FAERS | |
| 5 | Overdose | FAERS: 168 | US FAERS | |
| 6 | Inappropriate schedule of drug administration | FAERS: 159 | US FAERS | |
| 7 | Product use issue | FAERS: 139 | US FAERS | |
| 8 | Incorrect drug administration duration | FAERS: 135 | US FAERS | |
| 9 | Constipation | FAERS: 121 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 10 | Product packaging issue | FAERS: 106 | US FAERS | |
| 11 | Intentional product misuse | FAERS: 103 | US FAERS | |
| 12 | Drug abuse | FAERS: 102 | US FAERS | |
| 13 | Incorrect product administration duration | FAERS: 76 | US FAERS | |
| 14 | Wrong technique in drug usage process | FAERS: 65 | US FAERS | |
| 15 | Vomiting | FAERS: 55 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 16 | Wrong technique in product usage process | FAERS: 55 | US FAERS | |
| 17 | Product use complaint | FAERS: 52 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 18 | Product use in unapproved indication | FAERS: 47 | US FAERS | |
| 19 | Nausea | FAERS: 43 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 20 | Cardiac Arrest | FAERS: 41 | US FAERS | |
| 21 | Therapeutic response unexpected | FAERS: 40 | US FAERS | |
| 22 | Product label issue | FAERS: 37 | US FAERS | |
| 23 | Drug administration error | FAERS: 36 | US FAERS | |
| 24 | Dysgeusia | FAERS: 35 | US FAERS | |
| 25 | Syncope | FAERS: 35 | US FAERS | |
| 26 | Dizziness | FAERS: 31 | US FAERS | |
| 27 | Abdominal discomfort | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 28 | Product size issue | FAERS: 29 | US FAERS | |
| 29 | Product quality issue | FAERS: 27 | US FAERS | |
| 30 | Abdominal Pain | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 31 | Drug ineffective for unapproved indication | FAERS: 26 | US FAERS | |
| 32 | No adverse event | FAERS: 26 | US FAERS | |
| 33 | Malaise | FAERS: 24 | US FAERS | |
| 34 | Somnolence | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 35 | Adverse event | FAERS: 23 | US FAERS | |
| 36 | Product taste abnormal | FAERS: 23 | US FAERS | |
| 37 | Drug prescribing error | FAERS: 22 | US FAERS | |
| 38 | Flatulence | FAERS: 22 | US FAERS | |
| 39 | Infrequent bowel movements | FAERS: 22 | US FAERS | |
| 40 | Product package associated injury | FAERS: 22 | US FAERS | |
| 41 | Intestinal Obstruction | FAERS: 20 | US FAERS | |
| 42 | Product blister packaging issue | FAERS: 20 | US FAERS | |
| 43 | Drug Dependence | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 44 | Retching | FAERS: 19 | US FAERS | |
| 45 | Fatigue | FAERS: 17 | US FAERS | |
| 46 | Dehydration | FAERS: 16 | US FAERS | |
| 47 | Product difficult to swallow | FAERS: 16 | US FAERS | |
| 48 | Toxicity to various agents | FAERS: 16 | US FAERS | |
| 49 | Choking | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 50 | Medication Error | FAERS: 15 | US FAERS | |
| 51 | Product physical issue | FAERS: 15 | US FAERS | |
| 52 | Drug effect delayed | FAERS: 14 | US FAERS | |
| 53 | Pruritus | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 54 | Urinary Retention | FAERS: 14 | US FAERS | |
| 55 | Drug effect incomplete | FAERS: 13 | US FAERS | |
| 56 | Therapeutic response delayed | FAERS: 13 | US FAERS | |
| 57 | Urticaria | FAERS: 13 | US FAERS | |
| 58 | Ventricular Fibrillation | FAERS: 13 | US FAERS | |
| 59 | Bradycardia | FAERS: 12 | US FAERS | |
| 60 | Physical product label issue | FAERS: 12 | US FAERS | |
| 61 | Throat irritation | FAERS: 12 | US FAERS | |
| 62 | Pain | FAERS: 11 | US FAERS | |
| 63 | Asthenia | FAERS: 10 | US FAERS | |
| 64 | Dyspepsia | FAERS: 10 | US FAERS | |
| 65 | Hypersensitivity | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 66 | Inappropriate schedule of product administration | FAERS: 10 | US FAERS | |
| 67 | Incorrect product storage | FAERS: 10 | US FAERS | |
| 68 | Ventricular arrhythmia | FAERS: 10 | US FAERS | |
| 69 | Cardiotoxicity | FAERS: 9 | US FAERS | |
| 70 | Drug withdrawal syndrome | FAERS: 9 | US FAERS | |
| 71 | Headache | FAERS: 9 | US FAERS | |
| 72 | Intentional drug misuse | FAERS: 9 | US FAERS | |
| 73 | Product availability issue | FAERS: 9 | US FAERS | |
| 74 | Product outer packaging issue | FAERS: 9 | US FAERS | |
| 75 | Tachycardia | FAERS: 9 | US FAERS | |
| 76 | Accidental drug intake by child | FAERS: 8 | US FAERS | |
| 77 | Accidental exposure to product by child | FAERS: 8 | US FAERS | |
| 78 | Accidental overdose | FAERS: 8 | US FAERS | |
| 79 | Bowel movement irregularity | FAERS: 8 | US FAERS | |
| 80 | Electrolyte imbalance | FAERS: 8 | US FAERS | |
| 81 | Product coating issue | FAERS: 8 | US FAERS | |
| 82 | Product storage error | FAERS: 8 | US FAERS | |
| 83 | Blood glucose increased | FAERS: 7 | US FAERS | |
| 84 | Chest Pain | FAERS: 7 | US FAERS | |
| 85 | Contraindicated product administered | FAERS: 7 | US FAERS | |
| 86 | Drug exposure during pregnancy | FAERS: 7 | US FAERS | |
| 87 | Lethargy | FAERS: 7 | US FAERS | |
| 88 | Palpitations | FAERS: 7 | US FAERS | |
| 89 | Respiratory Depression | FAERS: 7 | US FAERS | |
| 90 | Anxiety | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 91 | Dependence | FAERS: 6 | US FAERS | |
| 92 | Depressed mood | FAERS: 6 | US FAERS | |
| 93 | Dysuria | FAERS: 6 | US FAERS | |
| 94 | Electrocardiogram abnormal | FAERS: 6 | US FAERS | |
| 95 | Hypotension | FAERS: 6 | US FAERS | |
| 96 | Peripheral swelling | FAERS: 6 | US FAERS | |
| 97 | Product administration error | FAERS: 6 | US FAERS | |
| 98 | Product formulation issue | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 99 | Suicide attempt | FAERS: 6 | US FAERS | |
| 100 | Tremor | FAERS: 6 | US FAERS | |
| 101 | Unresponsive to stimuli | FAERS: 6 | US FAERS | |
| 102 | Wrong drug administered | FAERS: 6 | US FAERS | |
| 103 | Acute kidney injury | FAERS: 5 | US FAERS | |
| 104 | Amnesia | FAERS: 5 | US FAERS | |
| 105 | Anaphylactic shock | FAERS: 5 | US FAERS | |
| 106 | Arthralgia | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 107 | Blood potassium increased | FAERS: 5 | US FAERS | |
| 108 | Chest discomfort | FAERS: 5 | US FAERS | |
| 109 | Drug effective for unapproved indication | FAERS: 5 | US FAERS | |
| 110 | Dystonia | FAERS: 5 | US FAERS | |
| 111 | Feeling abnormal | FAERS: 5 | US FAERS | |
| 112 | Gastrointestinal Pain | FAERS: 5 | US FAERS | |
| 113 | Ileus | FAERS: 5 | US FAERS | |
| 114 | Incorrect route of drug administration | FAERS: 5 | US FAERS | |
| 115 | Laceration | FAERS: 5 | US FAERS | |
| 116 | Onychoclasis | FAERS: 5 | US FAERS | |
| 117 | Product prescribing error | FAERS: 5 | US FAERS | |
| 118 | Respiratory arrest | FAERS: 5 | US FAERS | |
| 119 | Rhabdomyolysis | FAERS: 5 | US FAERS | |
| 120 | Sinus bradycardia | FAERS: 5 | US FAERS | |
| 121 | Altered state of consciousness | FAERS: 4 | US FAERS | |
| 122 | Back Pain | FAERS: 4 | US FAERS | |
| 123 | Choking sensation | FAERS: 4 | US FAERS | |
| 124 | Chromaturia | FAERS: 4 | US FAERS | |
| 125 | Dementia | FAERS: 4 | US FAERS | |
| 126 | Depressed Level of Consciousness | FAERS: 4 | US FAERS | |
| 127 | Drug Tolerance | FAERS: 4 | US FAERS | |
| 128 | Drug level above therapeutic | FAERS: 4 | US FAERS | |
| 129 | Euphoric mood | FAERS: 4 | US FAERS | |
| 130 | Expired drug administered | FAERS: 4 | US FAERS | |
| 131 | Lip swelling | FAERS: 4 | US FAERS | |
| 132 | Liquid product physical issue | FAERS: 4 | US FAERS | |
| 133 | Long QT Syndrome | FAERS: 4 | US FAERS | |
| 134 | Megacolon | FAERS: 4 | US FAERS | |
| 135 | Myocardial Infarction | FAERS: 4 | US FAERS | |
| 136 | Product lot number issue | FAERS: 4 | US FAERS | |
| 137 | Prostate examination abnormal | FAERS: 4 | US FAERS | |
| 138 | Swelling | FAERS: 4 | US FAERS | |
| 139 | Weight decreased | FAERS: 4 | US FAERS | |
| 140 | Accidental exposure to product | FAERS: 3 | US FAERS | |
| 141 | Acidosis | FAERS: 3 | US FAERS | |
| 142 | Agitation | FAERS: 3 | US FAERS | |
| 143 | Angina Pectoris | FAERS: 3 | US FAERS | |
| 144 | Angioedema | FAERS: 3 | US FAERS | |
| 145 | Cyanosis | FAERS: 3 | US FAERS | |
| 146 | Cytopenia | FAERS: 3 | US FAERS | |
| 147 | Discomfort | FAERS: 3 | US FAERS | |
| 148 | Drug abuser | FAERS: 3 | US FAERS | |
| 149 | Drug administered to patient of inappropriate age | FAERS: 3 | US FAERS | |
| 150 | Drug screen positive | FAERS: 3 | US FAERS | |
| 151 | Dysgraphia | FAERS: 3 | US FAERS | |
| 152 | Gait inability | FAERS: 3 | US FAERS | |
| 153 | Gamma-Glutamyltransferase Increased | FAERS: 3 | US FAERS | |
| 154 | Hypokinesia | FAERS: 3 | US FAERS | |
| 155 | Intentional self-injury | FAERS: 3 | US FAERS | |
| 156 | Intestinal Perforation | FAERS: 3 | US FAERS | |
| 157 | Joint swelling | FAERS: 3 | US FAERS | |
| 158 | Nocturia | FAERS: 3 | US FAERS | |
| 159 | Pneumonia | FAERS: 3 | US FAERS | |
| 160 | Portal venous gas | FAERS: 3 | US FAERS | |
| 161 | Prescribed overdose | FAERS: 3 | US FAERS | |
| 162 | Product complaint | FAERS: 3 | US FAERS | |
| 163 | Product container issue | FAERS: 3 | US FAERS | |
| 164 | Product packaging difficult to open | FAERS: 3 | US FAERS | |
| 165 | Sepsis | FAERS: 3 | US FAERS | |
| 166 | Urine flow decreased | FAERS: 3 | US FAERS | |
| 167 | Alopecia | FAERS: 2 | US FAERS | |
| 168 | Anorectal discomfort | FAERS: 2 | US FAERS | |
| 169 | Aspartate Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 170 | Blood potassium decreased | FAERS: 2 | US FAERS | |
| 171 | Blood urine present | FAERS: 2 | US FAERS | |
| 172 | Catatonia | FAERS: 2 | US FAERS | |
| 173 | Completed Suicide | FAERS: 2 | US FAERS | |
| 174 | Disorientation | FAERS: 2 | US FAERS | |
| 175 | Drug effect variable | FAERS: 2 | US FAERS | |
| 176 | Dysphonia | FAERS: 2 | US FAERS | |
| 177 | Ejection Fraction Decreased | FAERS: 2 | US FAERS | |
| 178 | Electrocardiogram ST-T change | FAERS: 2 | US FAERS | |
| 179 | Epilepsy | FAERS: 2 | US FAERS | |
| 180 | Erectile dysfunction | FAERS: 2 | US FAERS | |
| 181 | Eructation | FAERS: 2 | US FAERS | |
| 182 | Erythema | FAERS: 2 | US FAERS | |
| 183 | Exposure to unspecified agent | FAERS: 2 | US FAERS | |
| 184 | Extra dose administered | FAERS: 2 | US FAERS | |
| 185 | Foreign body in respiratory tract | FAERS: 2 | US FAERS | |
| 186 | Foreign body trauma | FAERS: 2 | US FAERS | |
| 187 | Gastrointestinal infection | FAERS: 2 | US FAERS | |
| 188 | Gastrointestinal motility disorder | FAERS: 2 | US FAERS | |
| 189 | Histiocytosis haematophagic | FAERS: 2 | US FAERS | |
| 190 | Hypoxia | FAERS: 2 | US FAERS | |
| 191 | Impaired gastric emptying | FAERS: 2 | US FAERS | |
| 192 | Infectious peritonitis | FAERS: 2 | US FAERS | |
| 193 | Intentional misuse | FAERS: 2 | US FAERS | |
| 194 | Lactose Intolerance | FAERS: 2 | US FAERS | |
| 195 | Maternal exposure during pregnancy | FAERS: 2 | US FAERS | |
| 196 | Mechanical urticaria | FAERS: 2 | US FAERS | |
| 197 | Medication residue present | FAERS: 2 | US FAERS | |
| 198 | Myoclonus | FAERS: 2 | US FAERS | |
| 199 | Nasopharyngitis | FAERS: 2 | US FAERS | |
| 200 | Nephrolithiasis | FAERS: 2 | US FAERS | |
| 201 | Neutropenia | FAERS: 2 | US FAERS | |
| 202 | Packaging design issue | FAERS: 2 | US FAERS | |
| 203 | Pallor | FAERS: 2 | US FAERS | |
| 204 | Pancreatitis | FAERS: 2 | US FAERS | |
| 205 | Panic Disorder | FAERS: 2 | US FAERS | |
| 206 | Poor quality drug administered | FAERS: 2 | US FAERS | |
| 207 | Post lumbar puncture syndrome | FAERS: 2 | US FAERS | |
| 208 | Product expiration date issue | FAERS: 2 | US FAERS | |
| 209 | Product packaging quantity issue | FAERS: 2 | US FAERS | |
| 210 | Product solubility abnormal | FAERS: 2 | US FAERS | |
| 211 | Product tampering | FAERS: 2 | US FAERS | |
| 212 | Protein-losing gastroenteropathy | FAERS: 2 | US FAERS | |
| 213 | Reaction to drug excipients | FAERS: 2 | US FAERS | |
| 214 | Seizure like phenomena | FAERS: 2 | US FAERS | |
| 215 | Suspected product tampering | FAERS: 2 | US FAERS | |
| 216 | Transaminases increased | FAERS: 2 | US FAERS | |
| 217 | Unevaluable event | FAERS: 2 | US FAERS | |
| 218 | Unintentional use for unapproved indication | FAERS: 2 | US FAERS | |
| 219 | Vaginal Discharge | FAERS: 2 | US FAERS | |
| 220 | Yawning | FAERS: 2 | US FAERS | |
| 221 | Accelerated Idioventricular Rhythm | FAERS: 1 | US FAERS | |
| 222 | Accidental exposure | FAERS: 1 | US FAERS | |
| 223 | Acne | FAERS: 1 | US FAERS | |
| 224 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 225 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 226 | Amylase increased | FAERS: 1 | US FAERS | |
| 227 | Anal Fissure | FAERS: 1 | US FAERS | |
| 228 | Anal spasm | FAERS: 1 | US FAERS | |
| 229 | Anoxic Encephalopathy | FAERS: 1 | US FAERS | |
| 230 | Anuria | FAERS: 1 | US FAERS | |
| 231 | Aphagia | FAERS: 1 | US FAERS | |
| 232 | Arthritis | FAERS: 1 | US FAERS | |
| 233 | Asthma | FAERS: 1 | US FAERS | |
| 234 | Autonomic nervous system imbalance | FAERS: 1 | US FAERS | |
| 235 | Azoospermia | FAERS: 1 | US FAERS | |
| 236 | Blood albumin decreased | FAERS: 1 | US FAERS | |
| 237 | Blood elastase increased | FAERS: 1 | US FAERS | |
| 238 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 239 | Blood glucose fluctuation | FAERS: 1 | US FAERS | |
| 240 | Blood phosphorus increased | FAERS: 1 | US FAERS | |
| 241 | Blood sodium increased | FAERS: 1 | US FAERS | |
| 242 | Bone pain | FAERS: 1 | US FAERS | |
| 243 | Bruxism | FAERS: 1 | US FAERS | |
| 244 | Burning sensation | FAERS: 1 | US FAERS | |
| 245 | Cardiac Death | FAERS: 1 | US FAERS | |
| 246 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 247 | Cataract | FAERS: 1 | US FAERS | |
| 248 | Catheter related complication | FAERS: 1 | US FAERS | |
| 249 | Catheter related infection | FAERS: 1 | US FAERS | |
| 250 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 251 | Chills | FAERS: 1 | US FAERS | |
| 252 | Cholangitis | FAERS: 1 | US FAERS | |
| 253 | Choreoathetosis | FAERS: 1 | US FAERS | |
| 254 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 255 | Cold sweat | FAERS: 1 | US FAERS | |
| 256 | Coma scale abnormal | FAERS: 1 | US FAERS | |
| 257 | Congenital absence of cranial vault | FAERS: 1 | US FAERS | |
| 258 | Conjunctivitis | FAERS: 1 | US FAERS | |
| 259 | Contraindicated drug administered | FAERS: 1 | US FAERS | |
| 260 | Decorticate posture | FAERS: 1 | US FAERS | |
| 261 | Diverticulitis | FAERS: 1 | US FAERS | |
| 262 | Drug administered in wrong device | FAERS: 1 | US FAERS | |
| 263 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 264 | Dry skin | FAERS: 1 | US FAERS | |
| 265 | Dysentery | FAERS: 1 | US FAERS | |
| 266 | Dyslexia | FAERS: 1 | US FAERS | |
| 267 | Ear discomfort | FAERS: 1 | US FAERS | |
| 268 | Electrocardiogram QT interval abnormal | FAERS: 1 | US FAERS | |
| 269 | Electrocardiogram change | FAERS: 1 | US FAERS | |
| 270 | Emergency Care | FAERS: 1 | US FAERS | |
| 271 | Empyema | FAERS: 1 | US FAERS | |
| 272 | Enteritis | FAERS: 1 | US FAERS | |
| 273 | Epistaxis | FAERS: 1 | US FAERS | |
| 274 | Escherichia urinary tract infection | FAERS: 1 | US FAERS | |
| 275 | Exposure during breast feeding | FAERS: 1 | US FAERS | |
| 276 | Eye irritation | FAERS: 1 | US FAERS | |
| 277 | Facial Paresis | FAERS: 1 | US FAERS | |
| 278 | Feeling Cold | FAERS: 1 | US FAERS | |
| 279 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 280 | Food Poisoning | FAERS: 1 | US FAERS | |
| 281 | Gastric Dilatation | FAERS: 1 | US FAERS | |
| 282 | Gastric Lavage | FAERS: 1 | US FAERS | |
| 283 | Gastrointestinal carcinoma | FAERS: 1 | US FAERS | |
| 284 | Gastrointestinal hypomotility | FAERS: 1 | US FAERS | |
| 285 | Gastrointestinal inflammation | FAERS: 1 | US FAERS | |
| 286 | Gastrointestinal obstruction | FAERS: 1 | US FAERS | |
| 287 | Genital pain | FAERS: 1 | US FAERS | |
| 288 | Gingivitis | FAERS: 1 | US FAERS | |
| 289 | Glaucoma | FAERS: 1 | US FAERS | |
| 290 | Hernia | FAERS: 1 | US FAERS | |
| 291 | Hydronephrosis | FAERS: 1 | US FAERS | |
| 292 | Hyperreflexia | FAERS: 1 | US FAERS | |
| 293 | Incoherent | FAERS: 1 | US FAERS | |
| 294 | Infection | FAERS: 1 | US FAERS | |
| 295 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 296 | Joint injury | FAERS: 1 | US FAERS | |
| 297 | Large intestine perforation | FAERS: 1 | US FAERS | |
| 298 | Laziness | FAERS: 1 | US FAERS | |
| 299 | Leukocytoclastic vasculitis | FAERS: 1 | US FAERS | |
| 300 | Ligament injury | FAERS: 1 | US FAERS | |
| 301 | Lipase increased | FAERS: 1 | US FAERS | |
| 302 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 303 | Lymphoma | FAERS: 1 | US FAERS | |
| 304 | Lymphopenia | FAERS: 1 | US FAERS | |
| 305 | Mastectomy | FAERS: 1 | US FAERS | |
| 306 | Memory impairment | FAERS: 1 | US FAERS | |
| 307 | Mental status changes | FAERS: 1 | US FAERS | |
| 308 | Mouth swelling | FAERS: 1 | US FAERS | |
| 309 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 310 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 311 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 312 | Myalgia | FAERS: 1 | US FAERS | |
| 313 | Neck Pain | FAERS: 1 | US FAERS | |
| 314 | Nervousness | FAERS: 1 | US FAERS | |
| 315 | Neuropsychiatric syndrome | FAERS: 1 | US FAERS | |
| 316 | Nutritional condition abnormal | FAERS: 1 | US FAERS | |
| 317 | Opiates positive | FAERS: 1 | US FAERS | |
| 318 | Opisthotonus | FAERS: 1 | US FAERS | |
| 319 | Oral pain | FAERS: 1 | US FAERS | |
| 320 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 321 | Oropharyngeal spasm | FAERS: 1 | US FAERS | |
| 322 | Pancreatic enzymes increased | FAERS: 1 | US FAERS | |
| 323 | Pancytopenia | FAERS: 1 | US FAERS | |
| 324 | Paroxysmal arrhythmia | FAERS: 1 | US FAERS | |
| 325 | Perianal erythema | FAERS: 1 | US FAERS | |
| 326 | Peripheral paralysis | FAERS: 1 | US FAERS | |
| 327 | Peritonitis | FAERS: 1 | US FAERS | |
| 328 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 329 | Pharmaceutical product counterfeit | FAERS: 1 | US FAERS | |
| 330 | Piloerection | FAERS: 1 | US FAERS | |
| 331 | Poisoning | FAERS: 1 | US FAERS | |
| 332 | Poor quality product administered | FAERS: 1 | US FAERS | |
| 333 | Product closure removal difficult | FAERS: 1 | US FAERS | |
| 334 | Product commingling | FAERS: 1 | US FAERS | |
| 335 | Product contamination | FAERS: 1 | US FAERS | |
| 336 | Product contamination physical | FAERS: 1 | US FAERS | |
| 337 | Product dispensing error | FAERS: 1 | US FAERS | |
| 338 | Product physical consistency issue | FAERS: 1 | US FAERS | |
| 339 | Product shape issue | FAERS: 1 | US FAERS | |
| 340 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 341 | Purpura | FAERS: 1 | US FAERS | |
| 342 | Rebound effect | FAERS: 1 | US FAERS | |
| 343 | Rectal tenesmus | FAERS: 1 | US FAERS | |
| 344 | Renal cyst | FAERS: 1 | US FAERS | |
| 345 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 346 | Respiratory distress | FAERS: 1 | US FAERS | |
| 347 | Secretion discharge | FAERS: 1 | US FAERS | |
| 348 | Septic Shock | FAERS: 1 | US FAERS | |
| 349 | Shock | FAERS: 1 | US FAERS | |
| 350 | Skin irritation | FAERS: 1 | US FAERS | |
| 351 | Skin laceration | FAERS: 1 | US FAERS | |
| 352 | Skin test positive | FAERS: 1 | US FAERS | |
| 353 | Sneezing | FAERS: 1 | US FAERS | |
| 354 | Stress | FAERS: 1 | US FAERS | |
| 355 | Suspected counterfeit product | FAERS: 1 | US FAERS | |
| 356 | Tachyarrhythmia | FAERS: 1 | US FAERS | |
| 357 | Thermal burn | FAERS: 1 | US FAERS | |
| 358 | Thirst | FAERS: 1 | US FAERS | |
| 359 | Tongue discomfort | FAERS: 1 | US FAERS | |
| 360 | Tooth Avulsion | FAERS: 1 | US FAERS | |
| 361 | Tooth Loss | FAERS: 1 | US FAERS | |
| 362 | Ulcer | FAERS: 1 | US FAERS | |
| 363 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 364 | Ventricular hypokinesia | FAERS: 1 | US FAERS | |
| 365 | Vertigo | FAERS: 1 | US FAERS | |
| 366 | Visual Impairment | FAERS: 1 | US FAERS | |
| 367 | Visual disturbance | FAERS: 1 | US FAERS | |
| 368 | Wheezing | FAERS: 1 | US FAERS | |
| 369 | Wrong product administered | FAERS: 1 | US FAERS | |
| 370 | nervous system disorder | FAERS: 1 | US FAERS | |
| 371 | treatment failure | FAERS: 1 | US FAERS | |
| 372 | Joint stiffness | Canada Vigilance: 2 | Canada Vigilance | |
| 373 | Pre-Eclampsia | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.