norethindrone acetate, ethinyl estradiol, ferrous fumarate drug combination
(NAPPWIFDUAHTRY-XYDRQXHOSA-N)
Structure
- SMILES
- C#C[C@]1(O)CC[C@@H]2[C@]1(C)CC[C@H]1[C@H]2CCc2c1ccc(c2)O.C#C[C@]1(O)CC[C@@H]2[C@]1(C)CC[C@H]1[C@H]2CCC2=CC(=O)CC[C@H]12
- Molecular Formula:
- C40H50O4
- Molecular Weight:
- 594.823
- Log P:
- 7.1051
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 3
- TPSA:
- 77.76
- CAS Number(s):
- 37270-71-6
Synonym(s)
1.
norethindrone acetate, ethinyl estradiol, ferrous fumarate drug combination
2.
Anovlar
3.
Binovum
4.
Brevicon
5.
Brevion
6.
Con-fer
7.
DT 5061
8.
DT-5061
9.
Estrostep
10.
LoDose
11.
Loestrin
12.
Loveston
13.
Modicon
14.
Neocon
15.
Netasyn
16.
Norimen
17.
Norinyl 1-35
18.
Norminest
19.
Ortho Novum 7-7-7
20.
Ovyrmen
21.
Primidos
22.
SH 7.1122
23.
SH B 259 AB
24.
Synphase
25.
Tri-norinyl
26.
Triella
27.
Trinovum
28.
Zoran
29.
ethynylestradiol mixture with norethindrone
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Metrorrhagia | FAERS: 30 | 2289388 | CTD US FAERS |
| 2 | Pulmonary Embolism | FAERS: 26 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 3 | Drug exposure during pregnancy | FAERS: 21 | US FAERS | |
| 4 | Pregnancy on oral contraceptive | FAERS: 20 | US FAERS | |
| 5 | Deep Vein Thrombosis | FAERS: 17 | US FAERS | |
| 6 | Headache | FAERS: 14 Canada Vigilance: 1 | 3388464 3446438 8403908 | CTD Canada Vigilance US FAERS |
| 7 | Nausea | FAERS: 11 | 3446438 | CTD US FAERS |
| 8 | Dizziness | FAERS: 9 Canada Vigilance: 1 | 3446438 8403908 | CTD Canada Vigilance US FAERS |
| 9 | Menorrhagia | FAERS: 9 | US FAERS | |
| 10 | Product dose omission | FAERS: 9 | US FAERS | |
| 11 | Product substitution issue | FAERS: 9 | US FAERS | |
| 12 | Product use in unapproved indication | FAERS: 9 | US FAERS | |
| 13 | Cerebrovascular accident | FAERS: 8 | US FAERS | |
| 14 | Pain | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 15 | Pharmaceutical product complaint | FAERS: 8 | US FAERS | |
| 16 | Vomiting | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 17 | Malaise | FAERS: 7 | US FAERS | |
| 18 | Adverse event | FAERS: 6 | US FAERS | |
| 19 | Anxiety | FAERS: 6 | US FAERS | |
| 20 | Drug dose omission | FAERS: 6 | US FAERS | |
| 21 | Myocardial Infarction | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 22 | Product use issue | FAERS: 6 | US FAERS | |
| 23 | Cerebral Infarction | FAERS: 5 | US FAERS | |
| 24 | Drug ineffective | FAERS: 5 | US FAERS | |
| 25 | Thrombophlebitis | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 26 | Aphasia | FAERS: 4 | US FAERS | |
| 27 | Asthenia | FAERS: 4 | US FAERS | |
| 28 | Fatigue | FAERS: 4 | US FAERS | |
| 29 | Product quality issue | FAERS: 4 | US FAERS | |
| 30 | Therapeutic response unexpected with drug substitution | FAERS: 4 | US FAERS | |
| 31 | Thrombosis | FAERS: 4 | US FAERS | |
| 32 | Urticaria | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 33 | Abdominal Pain | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 34 | Alopecia | FAERS: 3 | US FAERS | |
| 35 | Arthralgia | FAERS: 3 | US FAERS | |
| 36 | Breast tenderness | FAERS: 3 | US FAERS | |
| 37 | Budd-Chiari Syndrome | FAERS: 3 | US FAERS | |
| 38 | Chest discomfort | FAERS: 3 | US FAERS | |
| 39 | Hemiplegia | FAERS: 3 | US FAERS | |
| 40 | Hormone level abnormal | FAERS: 3 | US FAERS | |
| 41 | Inappropriate schedule of drug administration | FAERS: 3 | US FAERS | |
| 42 | Mood swings | FAERS: 3 | US FAERS | |
| 43 | No adverse event | FAERS: 3 | US FAERS | |
| 44 | Peripheral swelling | FAERS: 3 | US FAERS | |
| 45 | Pruritus | FAERS: 3 | US FAERS | |
| 46 | Pulmonary thrombosis | FAERS: 3 | US FAERS | |
| 47 | Syncope | FAERS: 3 | US FAERS | |
| 48 | Abdominal discomfort | FAERS: 2 | US FAERS | |
| 49 | Accidental exposure | FAERS: 2 | US FAERS | |
| 50 | Acne | FAERS: 2 | US FAERS | |
| 51 | Acute myocardial infarction | FAERS: 2 | US FAERS | |
| 52 | Agitation | FAERS: 2 | US FAERS | |
| 53 | Burning sensation | FAERS: 2 | US FAERS | |
| 54 | Cardiac enzymes increased | FAERS: 2 | US FAERS | |
| 55 | Chest Pain | FAERS: 2 | US FAERS | |
| 56 | Deafness Neurosensory | FAERS: 2 | US FAERS | |
| 57 | Demyelination | FAERS: 2 | US FAERS | |
| 58 | Diplopia | FAERS: 2 | US FAERS | |
| 59 | Drug administration error | FAERS: 2 | US FAERS | |
| 60 | Drug dispensing error | FAERS: 2 | US FAERS | |
| 61 | Drug prescribing error | FAERS: 2 | US FAERS | |
| 62 | Escherichia urinary tract infection | FAERS: 2 | US FAERS | |
| 63 | Hemiparesis | FAERS: 2 | US FAERS | |
| 64 | Invasive Ductal Breast Carcinoma | FAERS: 2 | US FAERS | |
| 65 | Joint swelling | FAERS: 2 | US FAERS | |
| 66 | Maternal exposure during pregnancy | FAERS: 2 | US FAERS | |
| 67 | Mitochondrial cytopathy | FAERS: 2 | US FAERS | |
| 68 | Multiple Sclerosis | FAERS: 2 | US FAERS | |
| 69 | Muscle tightness | FAERS: 2 | US FAERS | |
| 70 | Neuralgia | FAERS: 2 | US FAERS | |
| 71 | Pregnancy | FAERS: 2 | US FAERS | |
| 72 | Product packaging issue | FAERS: 2 | US FAERS | |
| 73 | Product physical issue | FAERS: 2 | US FAERS | |
| 74 | Protein S Deficiency | FAERS: 2 | US FAERS | |
| 75 | Therapeutic response unexpected | FAERS: 2 | US FAERS | |
| 76 | Tremor | FAERS: 2 | US FAERS | |
| 77 | Troponin increased | FAERS: 2 | US FAERS | |
| 78 | Abasia | FAERS: 1 | US FAERS | |
| 79 | Alexia | FAERS: 1 | US FAERS | |
| 80 | Amnesia | FAERS: 1 | US FAERS | |
| 81 | Anger | FAERS: 1 | US FAERS | |
| 82 | Angioedema | FAERS: 1 | US FAERS | |
| 83 | Antiphospholipid Syndrome | FAERS: 1 | US FAERS | |
| 84 | Back Pain | FAERS: 1 | US FAERS | |
| 85 | Blighted ovum | FAERS: 1 | US FAERS | |
| 86 | Blindness | FAERS: 1 | US FAERS | |
| 87 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 88 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 89 | Bronchospasm | FAERS: 1 | US FAERS | |
| 90 | Bruxism | FAERS: 1 | US FAERS | |
| 91 | Carcinoma | FAERS: 1 | US FAERS | |
| 92 | Carpal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 93 | Cerebral Thrombosis | FAERS: 1 | US FAERS | |
| 94 | Cerebral artery occlusion | FAERS: 1 | US FAERS | |
| 95 | Cholestasis | FAERS: 1 | US FAERS | |
| 96 | Cleft Palate | FAERS: 1 | US FAERS | |
| 97 | Clinically isolated syndrome | FAERS: 1 | US FAERS | |
| 98 | Concomitant disease aggravated | FAERS: 1 | US FAERS | |
| 99 | Constipation | FAERS: 1 | US FAERS | |
| 100 | Contact lens intolerance | FAERS: 1 | US FAERS | |
| 101 | Crying | FAERS: 1 | US FAERS | |
| 102 | Dehydration | FAERS: 1 | US FAERS | |
| 103 | Depressed mood | FAERS: 1 | US FAERS | |
| 104 | Depression suicidal | FAERS: 1 | US FAERS | |
| 105 | Dermatitis | FAERS: 1 | US FAERS | |
| 106 | Device Failure | FAERS: 1 | US FAERS | |
| 107 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 108 | Diffuse alopecia | FAERS: 1 | US FAERS | |
| 109 | Drug exposure before pregnancy | FAERS: 1 | US FAERS | |
| 110 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 111 | Drug withdrawal syndrome | FAERS: 1 | US FAERS | |
| 112 | Dry skin | FAERS: 1 | US FAERS | |
| 113 | Electrocardiogram change | FAERS: 1 | US FAERS | |
| 114 | Exposure during breast feeding | FAERS: 1 | US FAERS | |
| 115 | Extra dose administered | FAERS: 1 | US FAERS | |
| 116 | Facial paralysis | FAERS: 1 | US FAERS | |
| 117 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 118 | Female Orgasmic Disorder | FAERS: 1 | US FAERS | |
| 119 | Fibrin D dimer increased | FAERS: 1 | US FAERS | |
| 120 | Food Allergy | FAERS: 1 | US FAERS | |
| 121 | Full blood count decreased | FAERS: 1 | US FAERS | |
| 122 | Gastritis | FAERS: 1 | US FAERS | |
| 123 | Gestational Diabetes | FAERS: 1 | US FAERS | |
| 124 | Gluten sensitivity | FAERS: 1 | US FAERS | |
| 125 | High density lipoprotein increased | FAERS: 1 | US FAERS | |
| 126 | Hypersensitivity | FAERS: 1 | US FAERS | |
| 127 | Hyperthyroidism | FAERS: 1 | US FAERS | |
| 128 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 129 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 130 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 131 | Infectious Mononucleosis | FAERS: 1 | US FAERS | |
| 132 | Intentional self-injury | FAERS: 1 | US FAERS | |
| 133 | Intrauterine infection | FAERS: 1 | US FAERS | |
| 134 | Left Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 135 | Limb injury | FAERS: 1 | US FAERS | |
| 136 | Lipoprotein (a) increased | FAERS: 1 | US FAERS | |
| 137 | Low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 138 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 139 | Medication Error | FAERS: 1 | US FAERS | |
| 140 | Mesenteric Vascular Occlusion | FAERS: 1 | US FAERS | |
| 141 | Muscle Cramp | FAERS: 1 | US FAERS | |
| 142 | Myalgia | FAERS: 1 | US FAERS | |
| 143 | Otosclerosis | FAERS: 1 | US FAERS | |
| 144 | Ovarian clear cell carcinoma | FAERS: 1 | US FAERS | |
| 145 | Palpitations | FAERS: 1 | US FAERS | |
| 146 | Panic Disorder | FAERS: 1 | US FAERS | |
| 147 | Paranoia | FAERS: 1 | US FAERS | |
| 148 | Peritonitis | FAERS: 1 | US FAERS | |
| 149 | Pharyngolaryngeal Pain | FAERS: 1 | US FAERS | |
| 150 | Physical disability | FAERS: 1 | US FAERS | |
| 151 | Portal Vein Thrombosis | FAERS: 1 | US FAERS | |
| 152 | Pregnancy on contraceptive | FAERS: 1 | US FAERS | |
| 153 | Premenstrual syndrome | FAERS: 1 | US FAERS | |
| 154 | Product blister packaging issue | FAERS: 1 | US FAERS | |
| 155 | Product formulation issue | FAERS: 1 | US FAERS | |
| 156 | Product lot number issue | FAERS: 1 | US FAERS | |
| 157 | Product packaging confusion | FAERS: 1 | US FAERS | |
| 158 | Product size issue | FAERS: 1 | US FAERS | |
| 159 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 160 | Psoriasis | FAERS: 1 | US FAERS | |
| 161 | Pulmonary arterial pressure increased | FAERS: 1 | US FAERS | |
| 162 | Renal pain | FAERS: 1 | US FAERS | |
| 163 | Respiratory distress | FAERS: 1 | US FAERS | |
| 164 | Sluggishness | FAERS: 1 | US FAERS | |
| 165 | Somnolence | FAERS: 1 | US FAERS | |
| 166 | Spastic paralysis | FAERS: 1 | US FAERS | |
| 167 | Stillbirth | FAERS: 1 | US FAERS | |
| 168 | Swelling | FAERS: 1 | US FAERS | |
| 169 | Tachyphrenia | FAERS: 1 | US FAERS | |
| 170 | Talipes | FAERS: 1 | US FAERS | |
| 171 | Thrombectomy | FAERS: 1 | US FAERS | |
| 172 | Tinnitus | FAERS: 1 | US FAERS | |
| 173 | Unevaluable event | FAERS: 1 | US FAERS | |
| 174 | Vaginal Discharge | FAERS: 1 | 3446438 | CTD US FAERS |
| 175 | Vascular stent insertion | FAERS: 1 | US FAERS | |
| 176 | Venous Thrombosis | FAERS: 1 | 11559956 | CTD US FAERS |
| 177 | Venous thrombosis limb | FAERS: 1 | US FAERS | |
| 178 | Ventricular Dysfunction | FAERS: 1 | US FAERS | |
| 179 | Vertigo | FAERS: 1 | US FAERS | |
| 180 | Visual Impairment | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 181 | Visual disturbance | FAERS: 1 | US FAERS | |
| 182 | Vulvovaginal dryness | FAERS: 1 | US FAERS | |
| 183 | Weight decreased | FAERS: 1 | US FAERS | |
| 184 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 185 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 186 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 187 | jaundice | FAERS: 1 | US FAERS | |
| 188 | nervous system disorder | FAERS: 1 | US FAERS | |
| 189 | Amenorrhea | 2289388 8403908 | CTD | |
| 190 | Cervical dysplasia | Canada Vigilance: 1 | Canada Vigilance | |
| 191 | Chemical and Drug Induced Liver Injury | 5416742 | CTD | |
| 192 | Gonadal Disorders | 5416742 | CTD | |
| 193 | Hemianopsia | 3388464 | CTD | |
| 194 | Hernia | 98825 | CTD | |
| 195 | Intracranial Hypertension | 98825 | CTD | |
| 196 | Menstruation Disturbances | 3446438 | CTD | |
| 197 | Paresis | 3388464 | CTD | |
| 198 | Pituitary Neoplasms | 5416742 | CTD | |
| 199 | Sinus Thrombosis, Intracranial | 98825 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.