Anoro Ellipta
(MDHKCIIEVIPVLU-JERHFGHZSA-M)
Structure
- SMILES
- OC(C12CC[N+](CC1)(CC2)CCOCc1ccccc1)(c1ccccc1)c1ccccc1.OCc1cc(ccc1O)[C@H](CNCCCCCCOCCOCc1c(Cl)cccc1Cl)O.[Br-]
- Molecular Formula:
- C53H67BrCl2N2O7
- Molecular Weight:
- 994.918
- Log P:
- 7.1018
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 5
- TPSA:
- 120.64
- CAS Number(s):
- N/A
Synonym(s)
1.
Anoro Ellipta
External Link(s)
| PubChem Compound | 71300746 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug dispensing error | FAERS: 501 | US FAERS | |
| 2 | Wrong technique in device usage process | FAERS: 424 | US FAERS | |
| 3 | Drug dose omission | FAERS: 350 | US FAERS | |
| 4 | Drug ineffective | FAERS: 282 | US FAERS | |
| 5 | Device use error | FAERS: 271 | US FAERS | |
| 6 | Product quality issue | FAERS: 271 | US FAERS | |
| 7 | Product packaging confusion | FAERS: 214 | US FAERS | |
| 8 | Circumstance or information capable of leading to medication error | FAERS: 165 | US FAERS | |
| 9 | Product label confusion | FAERS: 139 | US FAERS | |
| 10 | Product dose omission | FAERS: 137 | US FAERS | |
| 11 | Wrong technique in product usage process | FAERS: 123 | US FAERS | |
| 12 | Product complaint | FAERS: 112 | US FAERS | |
| 13 | Overdose | FAERS: 88 | US FAERS | |
| 14 | Dizziness | FAERS: 69 | US FAERS | |
| 15 | Oropharyngeal pain | FAERS: 65 | US FAERS | |
| 16 | Malaise | FAERS: 64 | US FAERS | |
| 17 | Product use in unapproved indication | FAERS: 60 | US FAERS | |
| 18 | Pneumonia | FAERS: 58 | US FAERS | |
| 19 | Headache | FAERS: 56 | US FAERS | |
| 20 | Urinary Retention | FAERS: 55 | US FAERS | |
| 21 | Medication Error | FAERS: 48 | US FAERS | |
| 22 | Prescribed overdose | FAERS: 47 | US FAERS | |
| 23 | Productive Cough | FAERS: 45 | US FAERS | |
| 24 | Chest Pain | FAERS: 44 | US FAERS | |
| 25 | Drug prescribing error | FAERS: 43 | US FAERS | |
| 26 | Intentional product misuse | FAERS: 43 | US FAERS | |
| 27 | Extra dose administered | FAERS: 41 | US FAERS | |
| 28 | Tremor | FAERS: 41 | US FAERS | |
| 29 | Throat irritation | FAERS: 38 | US FAERS | |
| 30 | Wheezing | FAERS: 38 | US FAERS | |
| 31 | Dysgeusia | FAERS: 36 | US FAERS | |
| 32 | Dysphonia | FAERS: 35 | US FAERS | |
| 33 | Inappropriate schedule of drug administration | FAERS: 35 | US FAERS | |
| 34 | Nausea | FAERS: 35 | US FAERS | |
| 35 | Nasopharyngitis | FAERS: 33 | US FAERS | |
| 36 | Product use issue | FAERS: 32 | US FAERS | |
| 37 | Visual Impairment | FAERS: 31 | US FAERS | |
| 38 | Chest discomfort | FAERS: 30 | US FAERS | |
| 39 | Palpitations | FAERS: 29 | US FAERS | |
| 40 | Urticaria | FAERS: 28 | US FAERS | |
| 41 | Drug effect incomplete | FAERS: 27 | US FAERS | |
| 42 | Pain | FAERS: 27 | US FAERS | |
| 43 | Expired product administered | FAERS: 26 | US FAERS | |
| 44 | Peripheral swelling | FAERS: 26 | US FAERS | |
| 45 | Fatigue | FAERS: 25 | US FAERS | |
| 46 | Myocardial Infarction | FAERS: 25 | US FAERS | |
| 47 | Constipation | FAERS: 24 | US FAERS | |
| 48 | Feeling abnormal | FAERS: 24 | US FAERS | |
| 49 | Neck Pain | FAERS: 24 | US FAERS | |
| 50 | Nervousness | FAERS: 23 | US FAERS | |
| 51 | Product storage error | FAERS: 23 | US FAERS | |
| 52 | Dysuria | FAERS: 22 | US FAERS | |
| 53 | Eye pain | FAERS: 22 | US FAERS | |
| 54 | Therapeutic response unexpected | FAERS: 21 | US FAERS | |
| 55 | Product dispensing error | FAERS: 20 | US FAERS | |
| 56 | Arthralgia | FAERS: 19 | US FAERS | |
| 57 | Choking sensation | FAERS: 19 | US FAERS | |
| 58 | Hypersensitivity | FAERS: 19 | US FAERS | |
| 59 | Inability to afford medication | FAERS: 18 | US FAERS | |
| 60 | Retching | FAERS: 18 | US FAERS | |
| 61 | Tachycardia | FAERS: 18 | US FAERS | |
| 62 | Bronchitis | FAERS: 17 | US FAERS | |
| 63 | Stomatitis | FAERS: 17 | US FAERS | |
| 64 | Anxiety | FAERS: 16 | US FAERS | |
| 65 | Asthenia | FAERS: 16 | US FAERS | |
| 66 | Pruritus | FAERS: 16 | US FAERS | |
| 67 | Vomiting | FAERS: 16 | US FAERS | |
| 68 | Adverse event | FAERS: 15 | US FAERS | |
| 69 | Blood glucose increased | FAERS: 15 | US FAERS | |
| 70 | Choking | FAERS: 15 | US FAERS | |
| 71 | Lip swelling | FAERS: 15 | US FAERS | |
| 72 | Abdominal discomfort | FAERS: 14 | US FAERS | |
| 73 | Feeling jittery | FAERS: 14 | US FAERS | |
| 74 | Sinusitis | FAERS: 14 | US FAERS | |
| 75 | Circumstance or information capable of leading to device use error | FAERS: 13 | US FAERS | |
| 76 | Epistaxis | FAERS: 13 | US FAERS | |
| 77 | Influenza | FAERS: 13 | US FAERS | |
| 78 | Intercepted medication error | FAERS: 13 | US FAERS | |
| 79 | Cerebrovascular accident | FAERS: 12 | US FAERS | |
| 80 | Asthma | FAERS: 11 | US FAERS | |
| 81 | Atrial Fibrillation | FAERS: 11 | US FAERS | |
| 82 | Back Pain | FAERS: 11 | US FAERS | |
| 83 | Bronchospasm | FAERS: 11 | US FAERS | |
| 84 | Drug administration error | FAERS: 11 | US FAERS | |
| 85 | Glaucoma | FAERS: 11 | US FAERS | |
| 86 | Intentional dose omission | FAERS: 11 | US FAERS | |
| 87 | Lower respiratory tract infection | FAERS: 11 | US FAERS | |
| 88 | Myalgia | FAERS: 11 | US FAERS | |
| 89 | Accidental overdose | FAERS: 10 | US FAERS | |
| 90 | Joint swelling | FAERS: 10 | US FAERS | |
| 91 | Product taste abnormal | FAERS: 10 | US FAERS | |
| 92 | Secretion discharge | FAERS: 10 | US FAERS | |
| 93 | Weight decreased | FAERS: 10 | US FAERS | |
| 94 | Dyspepsia | FAERS: 9 | US FAERS | |
| 95 | Intentional product use issue | FAERS: 9 | US FAERS | |
| 96 | Intercepted drug prescribing error | FAERS: 9 | US FAERS | |
| 97 | Memory impairment | FAERS: 9 | US FAERS | |
| 98 | Oral pain | FAERS: 9 | US FAERS | |
| 99 | Alopecia | FAERS: 8 | US FAERS | |
| 100 | Drug ineffective for unapproved indication | FAERS: 8 | US FAERS | |
| 101 | Product communication issue | FAERS: 8 | US FAERS | |
| 102 | Stress | FAERS: 8 | US FAERS | |
| 103 | Angioedema | FAERS: 7 | US FAERS | |
| 104 | Device malfunction | FAERS: 7 | US FAERS | |
| 105 | Exposure via skin contact | FAERS: 7 | US FAERS | |
| 106 | Incorrect product storage | FAERS: 7 | US FAERS | |
| 107 | Intercepted drug administration error | FAERS: 7 | US FAERS | |
| 108 | Mouth swelling | FAERS: 7 | US FAERS | |
| 109 | Rehabilitation therapy | FAERS: 7 | US FAERS | |
| 110 | Tongue discomfort | FAERS: 7 | US FAERS | |
| 111 | Aphonia | FAERS: 6 | US FAERS | |
| 112 | Apparent death | FAERS: 6 | US FAERS | |
| 113 | Burning sensation | FAERS: 6 | US FAERS | |
| 114 | Cataract | FAERS: 6 | US FAERS | |
| 115 | Eye irritation | FAERS: 6 | US FAERS | |
| 116 | Ocular discomfort | FAERS: 6 | US FAERS | |
| 117 | Product prescribing error | FAERS: 6 | US FAERS | |
| 118 | Somnolence | FAERS: 6 | US FAERS | |
| 119 | Swelling | FAERS: 6 | US FAERS | |
| 120 | Therapeutic product effect incomplete | FAERS: 6 | US FAERS | |
| 121 | Urinary tract infection | FAERS: 6 | US FAERS | |
| 122 | Agitation | FAERS: 5 | US FAERS | |
| 123 | Blindness | FAERS: 5 | US FAERS | |
| 124 | Cataract operation | FAERS: 5 | US FAERS | |
| 125 | Diabetes Mellitus | FAERS: 5 | US FAERS | |
| 126 | Foreign body in respiratory tract | FAERS: 5 | US FAERS | |
| 127 | Hypotension | FAERS: 5 | US FAERS | |
| 128 | Inappropriate schedule of product administration | FAERS: 5 | US FAERS | |
| 129 | Incorrect dose administered by device | FAERS: 5 | US FAERS | |
| 130 | Incorrect route of drug administration | FAERS: 5 | US FAERS | |
| 131 | Macular degeneration | FAERS: 5 | US FAERS | |
| 132 | Musculoskeletal discomfort | FAERS: 5 | US FAERS | |
| 133 | Therapy cessation | FAERS: 5 | US FAERS | |
| 134 | Unevaluable event | FAERS: 5 | US FAERS | |
| 135 | Accidental exposure to product | FAERS: 4 | US FAERS | |
| 136 | Ageusia | FAERS: 4 | US FAERS | |
| 137 | Amnesia | FAERS: 4 | US FAERS | |
| 138 | Angina Pectoris | FAERS: 4 | US FAERS | |
| 139 | Chills | FAERS: 4 | US FAERS | |
| 140 | Emergency care examination | FAERS: 4 | US FAERS | |
| 141 | Erythema | FAERS: 4 | US FAERS | |
| 142 | Eye Infection | FAERS: 4 | US FAERS | |
| 143 | Feeling Cold | FAERS: 4 | US FAERS | |
| 144 | Increased upper airway secretion | FAERS: 4 | US FAERS | |
| 145 | Intentional device misuse | FAERS: 4 | US FAERS | |
| 146 | Intercepted drug dispensing error | FAERS: 4 | US FAERS | |
| 147 | Lower respiratory tract congestion | FAERS: 4 | US FAERS | |
| 148 | Medication residue present | FAERS: 4 | US FAERS | |
| 149 | Nocturia | FAERS: 4 | US FAERS | |
| 150 | Product dosage form confusion | FAERS: 4 | US FAERS | |
| 151 | Pulmonary pain | FAERS: 4 | US FAERS | |
| 152 | Rash erythematous | FAERS: 4 | US FAERS | |
| 153 | Sepsis | FAERS: 4 | US FAERS | |
| 154 | Sneezing | FAERS: 4 | US FAERS | |
| 155 | Syncope | FAERS: 4 | US FAERS | |
| 156 | Upper-airway cough syndrome | FAERS: 4 | US FAERS | |
| 157 | Urine flow decreased | FAERS: 4 | US FAERS | |
| 158 | colonoscopy | FAERS: 4 | US FAERS | |
| 159 | Abdominal Pain | FAERS: 3 | US FAERS | |
| 160 | Acute kidney injury | FAERS: 3 | US FAERS | |
| 161 | Altered state of consciousness | FAERS: 3 | US FAERS | |
| 162 | Anaphylactic shock | FAERS: 3 | US FAERS | |
| 163 | Arthritis | FAERS: 3 | US FAERS | |
| 164 | Back disorder | FAERS: 3 | US FAERS | |
| 165 | Bone pain | FAERS: 3 | US FAERS | |
| 166 | Cardiac Arrest | FAERS: 3 | US FAERS | |
| 167 | Cholelithiasis | FAERS: 3 | US FAERS | |
| 168 | Device difficult to use | FAERS: 3 | US FAERS | |
| 169 | Diplopia | FAERS: 3 | US FAERS | |
| 170 | Discomfort | FAERS: 3 | US FAERS | |
| 171 | Emotional distress | FAERS: 3 | US FAERS | |
| 172 | Epilepsy | FAERS: 3 | US FAERS | |
| 173 | Fibromyalgia | FAERS: 3 | US FAERS | |
| 174 | General physical health deterioration | FAERS: 3 | US FAERS | |
| 175 | Implantable defibrillator insertion | FAERS: 3 | US FAERS | |
| 176 | Incorrect dose administered | FAERS: 3 | US FAERS | |
| 177 | Infection | FAERS: 3 | US FAERS | |
| 178 | Loss of personal independence in daily activities | FAERS: 3 | US FAERS | |
| 179 | Middle insomnia | FAERS: 3 | US FAERS | |
| 180 | Musculoskeletal Pain | FAERS: 3 | US FAERS | |
| 181 | Musculoskeletal chest pain | FAERS: 3 | US FAERS | |
| 182 | Musculoskeletal stiffness | FAERS: 3 | US FAERS | |
| 183 | Nonspecific reaction | FAERS: 3 | US FAERS | |
| 184 | Oral candidiasis | FAERS: 3 | US FAERS | |
| 185 | Osteoporosis | FAERS: 3 | US FAERS | |
| 186 | Pneumothorax | FAERS: 3 | US FAERS | |
| 187 | Prescribed underdose | FAERS: 3 | US FAERS | |
| 188 | Product availability issue | FAERS: 3 | US FAERS | |
| 189 | Pulmonary Hypertension | FAERS: 3 | US FAERS | |
| 190 | Respiratory Failure | FAERS: 3 | US FAERS | |
| 191 | Sinus pain | FAERS: 3 | US FAERS | |
| 192 | Skin neoplasm excision | FAERS: 3 | US FAERS | |
| 193 | Thirst | FAERS: 3 | US FAERS | |
| 194 | Upper respiratory tract congestion | FAERS: 3 | US FAERS | |
| 195 | Urinary Incontinence | FAERS: 3 | US FAERS | |
| 196 | Vertigo | FAERS: 3 | US FAERS | |
| 197 | Viral upper respiratory tract infection | FAERS: 3 | US FAERS | |
| 198 | intensive care | FAERS: 3 | US FAERS | |
| 199 | Accidental exposure to product packaging | FAERS: 2 | US FAERS | |
| 200 | Accidental underdose | FAERS: 2 | US FAERS | |
| 201 | Amphetamines positive | FAERS: 2 | US FAERS | |
| 202 | Aneurysm | FAERS: 2 | US FAERS | |
| 203 | Anger | FAERS: 2 | US FAERS | |
| 204 | Angle Closure Glaucoma | FAERS: 2 | US FAERS | |
| 205 | Arthropathy | FAERS: 2 | US FAERS | |
| 206 | Atypical pneumonia | FAERS: 2 | US FAERS | |
| 207 | Benign Prostatic Hyperplasia | FAERS: 2 | US FAERS | |
| 208 | Blood potassium decreased | FAERS: 2 | US FAERS | |
| 209 | Blood pressure fluctuation | FAERS: 2 | US FAERS | |
| 210 | Cardiac assistance device user | FAERS: 2 | US FAERS | |
| 211 | Cardiac discomfort | FAERS: 2 | US FAERS | |
| 212 | Cholelithotomy | FAERS: 2 | US FAERS | |
| 213 | Chromaturia | FAERS: 2 | US FAERS | |
| 214 | Cold sweat | FAERS: 2 | US FAERS | |
| 215 | Colitis | FAERS: 2 | US FAERS | |
| 216 | Dehydration | FAERS: 2 | US FAERS | |
| 217 | Dementia | FAERS: 2 | US FAERS | |
| 218 | Device use issue | FAERS: 2 | US FAERS | |
| 219 | Disability | FAERS: 2 | US FAERS | |
| 220 | Drug screen false positive | FAERS: 2 | US FAERS | |
| 221 | Dry skin | FAERS: 2 | US FAERS | |
| 222 | Ear discomfort | FAERS: 2 | US FAERS | |
| 223 | Escherichia infection | FAERS: 2 | US FAERS | |
| 224 | Extranodal marginal zone B-cell lymphoma (MALT type) | FAERS: 2 | US FAERS | |
| 225 | Eye laser surgery | FAERS: 2 | US FAERS | |
| 226 | False positive investigation result | FAERS: 2 | US FAERS | |
| 227 | Food Allergy | FAERS: 2 | US FAERS | |
| 228 | Gait inability | FAERS: 2 | US FAERS | |
| 229 | General symptom | FAERS: 2 | US FAERS | |
| 230 | Glossitis | FAERS: 2 | US FAERS | |
| 231 | Hemiplegia | FAERS: 2 | US FAERS | |
| 232 | Hyperventilation | FAERS: 2 | US FAERS | |
| 233 | Hypoxia | FAERS: 2 | US FAERS | |
| 234 | Impaired work ability | FAERS: 2 | US FAERS | |
| 235 | Increased bronchial secretion | FAERS: 2 | US FAERS | |
| 236 | Limb discomfort | FAERS: 2 | US FAERS | |
| 237 | Meniscus injury | FAERS: 2 | US FAERS | |
| 238 | Mental status changes | FAERS: 2 | US FAERS | |
| 239 | Nasal discomfort | FAERS: 2 | US FAERS | |
| 240 | Nephrolithiasis | FAERS: 2 | US FAERS | |
| 241 | Night sweats | FAERS: 2 | US FAERS | |
| 242 | No adverse event | FAERS: 2 | US FAERS | |
| 243 | Oral mucosal eruption | FAERS: 2 | US FAERS | |
| 244 | Oropharyngeal discomfort | FAERS: 2 | US FAERS | |
| 245 | Pallor | FAERS: 2 | US FAERS | |
| 246 | Pharyngitis | FAERS: 2 | US FAERS | |
| 247 | Photophobia | FAERS: 2 | US FAERS | |
| 248 | Poor quality sleep | FAERS: 2 | US FAERS | |
| 249 | Presyncope | FAERS: 2 | US FAERS | |
| 250 | Product administration error | FAERS: 2 | US FAERS | |
| 251 | Product expiration date issue | FAERS: 2 | US FAERS | |
| 252 | Product lot number issue | FAERS: 2 | US FAERS | |
| 253 | Product name confusion | FAERS: 2 | US FAERS | |
| 254 | Product physical consistency issue | FAERS: 2 | US FAERS | |
| 255 | Product preparation error | FAERS: 2 | US FAERS | |
| 256 | Product residue present | FAERS: 2 | US FAERS | |
| 257 | Pulmonary congestion | FAERS: 2 | US FAERS | |
| 258 | Pulmonary thrombosis | FAERS: 2 | US FAERS | |
| 259 | Respiratory distress | FAERS: 2 | US FAERS | |
| 260 | Sinus Tachycardia | FAERS: 2 | US FAERS | |
| 261 | Skin irritation | FAERS: 2 | US FAERS | |
| 262 | Sluggishness | FAERS: 2 | US FAERS | |
| 263 | Stevens-Johnson Syndrome | FAERS: 2 | US FAERS | |
| 264 | Thrombocytopenia | FAERS: 2 | US FAERS | |
| 265 | Toothache | FAERS: 2 | US FAERS | |
| 266 | Tracheal pain | FAERS: 2 | US FAERS | |
| 267 | Vitreous floaters | FAERS: 2 | US FAERS | |
| 268 | Vulvovaginal mycotic infection | FAERS: 2 | US FAERS | |
| 269 | Wrong drug administered | FAERS: 2 | US FAERS | |
| 270 | Wrong patient received medication | FAERS: 2 | US FAERS | |
| 271 | Abscess | FAERS: 1 | US FAERS | |
| 272 | Acne | FAERS: 1 | US FAERS | |
| 273 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 274 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 275 | Alcohol test false positive | FAERS: 1 | US FAERS | |
| 276 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 277 | Anosmia | FAERS: 1 | US FAERS | |
| 278 | Aphagia | FAERS: 1 | US FAERS | |
| 279 | Aphasia | FAERS: 1 | US FAERS | |
| 280 | Arthropod bite | FAERS: 1 | US FAERS | |
| 281 | Artificial crown procedure | FAERS: 1 | US FAERS | |
| 282 | Asthenopia | FAERS: 1 | US FAERS | |
| 283 | Ataxia | FAERS: 1 | US FAERS | |
| 284 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 285 | Atrophic vulvovaginitis | FAERS: 1 | US FAERS | |
| 286 | Autoscopy | FAERS: 1 | US FAERS | |
| 287 | Bedridden | FAERS: 1 | US FAERS | |
| 288 | Benign neoplasm of skin | FAERS: 1 | US FAERS | |
| 289 | Bladder pain | FAERS: 1 | US FAERS | |
| 290 | Blepharospasm | FAERS: 1 | US FAERS | |
| 291 | Blood iron abnormal | FAERS: 1 | US FAERS | |
| 292 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 293 | Bradycardia | FAERS: 1 | US FAERS | |
| 294 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 295 | Breast tenderness | FAERS: 1 | US FAERS | |
| 296 | Breath alcohol test positive | FAERS: 1 | US FAERS | |
| 297 | Bronchial secretion retention | FAERS: 1 | US FAERS | |
| 298 | Bullous lung disease | FAERS: 1 | US FAERS | |
| 299 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 300 | Cardiac ablation | FAERS: 1 | US FAERS | |
| 301 | Cardiac dysfunction | FAERS: 1 | US FAERS | |
| 302 | Catheter placement | FAERS: 1 | US FAERS | |
| 303 | Cellulitis | FAERS: 1 | US FAERS | |
| 304 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 305 | Cheilitis | FAERS: 1 | US FAERS | |
| 306 | Chemotherapy | FAERS: 1 | US FAERS | |
| 307 | Cholecystitis infective | FAERS: 1 | US FAERS | |
| 308 | Chronic throat clearing | FAERS: 1 | US FAERS | |
| 309 | Colectomy | FAERS: 1 | US FAERS | |
| 310 | Complication associated with device | FAERS: 1 | US FAERS | |
| 311 | Contraindicated product administered | FAERS: 1 | US FAERS | |
| 312 | Contraindicated product prescribed | FAERS: 1 | US FAERS | |
| 313 | Corneal cyst | FAERS: 1 | US FAERS | |
| 314 | Crying | FAERS: 1 | US FAERS | |
| 315 | Cystitis | FAERS: 1 | US FAERS | |
| 316 | Cyst | FAERS: 1 | US FAERS | |
| 317 | Dark circles under eyes | FAERS: 1 | US FAERS | |
| 318 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 319 | Delirium | FAERS: 1 | US FAERS | |
| 320 | Dental caries | FAERS: 1 | US FAERS | |
| 321 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 322 | Device breakage | FAERS: 1 | US FAERS | |
| 323 | Device dispensing error | FAERS: 1 | US FAERS | |
| 324 | Device inappropriate shock delivery | FAERS: 1 | US FAERS | |
| 325 | Device ineffective | FAERS: 1 | US FAERS | |
| 326 | Device leakage | FAERS: 1 | US FAERS | |
| 327 | Device used for unapproved schedule | FAERS: 1 | US FAERS | |
| 328 | Diabetes mellitus inadequate control | FAERS: 1 | US FAERS | |
| 329 | Discontinued product administered | FAERS: 1 | US FAERS | |
| 330 | Disease recurrence | FAERS: 1 | US FAERS | |
| 331 | Disorientation | FAERS: 1 | US FAERS | |
| 332 | Diverticulitis | FAERS: 1 | US FAERS | |
| 333 | Drug effective for unapproved indication | FAERS: 1 | US FAERS | |
| 334 | Drug implantation | FAERS: 1 | US FAERS | |
| 335 | Drug screen positive | FAERS: 1 | US FAERS | |
| 336 | Dry age-related macular degeneration | FAERS: 1 | US FAERS | |
| 337 | Ear congestion | FAERS: 1 | US FAERS | |
| 338 | Eating disorder symptom | FAERS: 1 | US FAERS | |
| 339 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 340 | Electroencephalogram | FAERS: 1 | US FAERS | |
| 341 | Emergency Care | FAERS: 1 | US FAERS | |
| 342 | Emotional disorder | FAERS: 1 | US FAERS | |
| 343 | Endodontic procedure | FAERS: 1 | US FAERS | |
| 344 | Eructation | FAERS: 1 | US FAERS | |
| 345 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 346 | Essential Tremor | FAERS: 1 | US FAERS | |
| 347 | Exposure to body fluid | FAERS: 1 | US FAERS | |
| 348 | Exposure via direct contact | FAERS: 1 | US FAERS | |
| 349 | Exposure via ingestion | FAERS: 1 | US FAERS | |
| 350 | Eye allergy | FAERS: 1 | US FAERS | |
| 351 | Eye symptom | FAERS: 1 | US FAERS | |
| 352 | Eyelid pain | FAERS: 1 | US FAERS | |
| 353 | Facial Pain | FAERS: 1 | US FAERS | |
| 354 | Facial paralysis | FAERS: 1 | US FAERS | |
| 355 | Flatulence | FAERS: 1 | US FAERS | |
| 356 | Food Poisoning | FAERS: 1 | US FAERS | |
| 357 | Foreign body aspiration | FAERS: 1 | US FAERS | |
| 358 | Gastrectomy | FAERS: 1 | US FAERS | |
| 359 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 360 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 361 | Genital discomfort | FAERS: 1 | US FAERS | |
| 362 | Head titubation | FAERS: 1 | US FAERS | |
| 363 | Hearing aid user | FAERS: 1 | US FAERS | |
| 364 | Heart valve stenosis | FAERS: 1 | US FAERS | |
| 365 | Heat Exhaustion | FAERS: 1 | US FAERS | |
| 366 | Hospice Care | FAERS: 1 | US FAERS | |
| 367 | Hunger | FAERS: 1 | US FAERS | |
| 368 | Hypersomnia | FAERS: 1 | US FAERS | |
| 369 | Hysterectomy | FAERS: 1 | US FAERS | |
| 370 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 371 | Inappropriate release of product for distribution | FAERS: 1 | US FAERS | |
| 372 | Incontinence | FAERS: 1 | US FAERS | |
| 373 | Incorrect disposal of product | FAERS: 1 | US FAERS | |
| 374 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 375 | Increased viscosity of bronchial secretion | FAERS: 1 | US FAERS | |
| 376 | Increased viscosity of nasal secretion | FAERS: 1 | US FAERS | |
| 377 | Initial insomnia | FAERS: 1 | US FAERS | |
| 378 | Insurance issue | FAERS: 1 | US FAERS | |
| 379 | Intercepted product storage error | FAERS: 1 | US FAERS | |
| 380 | Intra-abdominal fluid collection | FAERS: 1 | US FAERS | |
| 381 | Investigation abnormal | FAERS: 1 | US FAERS | |
| 382 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 383 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 384 | Joint injury | FAERS: 1 | US FAERS | |
| 385 | Lactose Intolerance | FAERS: 1 | US FAERS | |
| 386 | Laryngitis | FAERS: 1 | US FAERS | |
| 387 | Lesion excision | FAERS: 1 | US FAERS | |
| 388 | Limb injury | FAERS: 1 | US FAERS | |
| 389 | Limb operation | FAERS: 1 | US FAERS | |
| 390 | Lip and/or oral cavity cancer | FAERS: 1 | US FAERS | |
| 391 | Living in residential institution | FAERS: 1 | US FAERS | |
| 392 | Lung carcinoma cell type unspecified stage I | FAERS: 1 | US FAERS | |
| 393 | Lung neoplasm surgery | FAERS: 1 | US FAERS | |
| 394 | Lung volume reduction surgery | FAERS: 1 | US FAERS | |
| 395 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 396 | Malignant neoplasm of thorax | FAERS: 1 | US FAERS | |
| 397 | Mastectomy | FAERS: 1 | US FAERS | |
| 398 | Metamorphopsia | FAERS: 1 | US FAERS | |
| 399 | Metastatic Neoplasm | FAERS: 1 | US FAERS | |
| 400 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 401 | Multiple allergies | FAERS: 1 | US FAERS | |
| 402 | Muscle strain | FAERS: 1 | US FAERS | |
| 403 | Muscle tightness | FAERS: 1 | US FAERS | |
| 404 | Musculoskeletal complication associated with device | FAERS: 1 | US FAERS | |
| 405 | Mydriasis | FAERS: 1 | US FAERS | |
| 406 | Nasal pruritus | FAERS: 1 | US FAERS | |
| 407 | Nipple pain | FAERS: 1 | US FAERS | |
| 408 | Nodule | FAERS: 1 | US FAERS | |
| 409 | Obsessive-Compulsive Disorder | FAERS: 1 | US FAERS | |
| 410 | Ocular Hypertension | FAERS: 1 | US FAERS | |
| 411 | Oculogyric crisis | FAERS: 1 | US FAERS | |
| 412 | Oral contusion | FAERS: 1 | US FAERS | |
| 413 | Oral papule | FAERS: 1 | US FAERS | |
| 414 | Oral pruritus | FAERS: 1 | US FAERS | |
| 415 | Pancreaticoduodenectomy | FAERS: 1 | US FAERS | |
| 416 | Paranasal sinus discomfort | FAERS: 1 | US FAERS | |
| 417 | Paranasal sinus hypersecretion | FAERS: 1 | US FAERS | |
| 418 | Paranasal sinus hyposecretion | FAERS: 1 | US FAERS | |
| 419 | Patient-device incompatibility | FAERS: 1 | US FAERS | |
| 420 | Pelvic abscess | FAERS: 1 | US FAERS | |
| 421 | Penile size reduced | FAERS: 1 | US FAERS | |
| 422 | Performance status decreased | FAERS: 1 | US FAERS | |
| 423 | Perioral Dermatitis | FAERS: 1 | US FAERS | |
| 424 | Pneumonitis | FAERS: 1 | US FAERS | |
| 425 | Portal shunt procedure | FAERS: 1 | US FAERS | |
| 426 | Prescription drug used without a prescription | FAERS: 1 | US FAERS | |
| 427 | Procedural complication | FAERS: 1 | US FAERS | |
| 428 | Procedural shock | FAERS: 1 | US FAERS | |
| 429 | Product appearance confusion | FAERS: 1 | US FAERS | |
| 430 | Product cleaning inadequate | FAERS: 1 | US FAERS | |
| 431 | Product design confusion | FAERS: 1 | US FAERS | |
| 432 | Product packaging issue | FAERS: 1 | US FAERS | |
| 433 | Product physical issue | FAERS: 1 | US FAERS | |
| 434 | Product substitution issue | FAERS: 1 | US FAERS | |
| 435 | Product use complaint | FAERS: 1 | US FAERS | |
| 436 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 437 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 438 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 439 | Respiratory tract irritation | FAERS: 1 | US FAERS | |
| 440 | Rheumatic disorder | FAERS: 1 | US FAERS | |
| 441 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 442 | Right ventricular failure | FAERS: 1 | US FAERS | |
| 443 | Ruptured cerebral aneurysm | FAERS: 1 | US FAERS | |
| 444 | Sciatica | FAERS: 1 | US FAERS | |
| 445 | Sensation of blood flow | FAERS: 1 | US FAERS | |
| 446 | Sense of oppression | FAERS: 1 | US FAERS | |
| 447 | Sensitivity to weather change | FAERS: 1 | US FAERS | |
| 448 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 449 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 450 | Skin reaction | FAERS: 1 | US FAERS | |
| 451 | Sleep Talking | FAERS: 1 | US FAERS | |
| 452 | Spinal column stenosis | FAERS: 1 | US FAERS | |
| 453 | Spinal fusion surgery | FAERS: 1 | US FAERS | |
| 454 | Sputum retention | FAERS: 1 | US FAERS | |
| 455 | Stridor | FAERS: 1 | US FAERS | |
| 456 | Sudden death | FAERS: 1 | US FAERS | |
| 457 | Sunburn | FAERS: 1 | US FAERS | |
| 458 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 459 | Suture insertion | FAERS: 1 | US FAERS | |
| 460 | Suture related complication | FAERS: 1 | US FAERS | |
| 461 | Therapeutic product effect decreased | FAERS: 1 | US FAERS | |
| 462 | Throat cancer | FAERS: 1 | US FAERS | |
| 463 | Throat clearing | FAERS: 1 | US FAERS | |
| 464 | Thrombosis | FAERS: 1 | US FAERS | |
| 465 | Tobacco user | FAERS: 1 | US FAERS | |
| 466 | Tongue biting | FAERS: 1 | US FAERS | |
| 467 | Tongue blistering | FAERS: 1 | US FAERS | |
| 468 | Tongue erythema | FAERS: 1 | US FAERS | |
| 469 | Ulcer | FAERS: 1 | US FAERS | |
| 470 | Urethritis noninfective | FAERS: 1 | US FAERS | |
| 471 | Urinary hesitation | FAERS: 1 | US FAERS | |
| 472 | Vascular occlusion | FAERS: 1 | US FAERS | |
| 473 | Vascular test | FAERS: 1 | US FAERS | |
| 474 | Venous Thrombosis | FAERS: 1 | US FAERS | |
| 475 | Walking aid user | FAERS: 1 | US FAERS | |
| 476 | Wheelchair user | FAERS: 1 | US FAERS | |
| 477 | Wrong device used | FAERS: 1 | US FAERS | |
| 478 | Wrong patient received product | FAERS: 1 | US FAERS | |
| 479 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 480 | Yawning | FAERS: 1 | US FAERS | |
| 481 | gallbladder neoplasm | FAERS: 1 | US FAERS | |
| 482 | nervous system disorder | FAERS: 1 | US FAERS | |
| 483 | treatment failure | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.