Linagliptin
(LTXREWYXXSTFRX-QGZVFWFLSA-N)
Structure
- SMILES
- CC#CCn1c(nc2c1c(=O)n(Cc1nc(C)c3c(n1)cccc3)c(=O)n2C)N1CCC[C@H](C1)N
- Type(s)
- Approved
- ATC code(s)
- A10BD11; A10BD19; A10BH05
- Molecular Formula:
- C25H28N8O2
- Molecular Weight:
- 472.542
- Log P:
- 1.9127
- Hydrogen Bond Acceptor:
- 10
- Hydrogen Bond Donor:
- 1
- TPSA:
- 116.86
- CAS Number(s):
- 668270-12-0
Synonym(s)
1.
Linagliptin
2.
(R)-8-(3-amino-piperidin-1-yl)-7-but-2-ynyl-3-methyl-1-(4-methyl-quinazolin-2-ylmethyl)-3,7-dihydro-purine-2,6-dione
3.
1H-purine-2,6-dione, 8-((3r)-3-amino-1-piperidinyl)-7-(2-butynyl)-3,7-dihydro-3-methyl-1-((4-methyl-2-quinazolinyl)methyl)-
4.
BI 1356
5.
BI-1356
6.
BI1356
7.
Tradjenta
8.
Trajenta
9.
1356, BI
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Pancreatitis | FAERS: 196 Canada Vigilance: 10 | Canada Vigilance SIDER US FAERS | |
| 2 | Blood glucose increased | FAERS: 143 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 3 | Nausea | FAERS: 110 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 4 | Drug ineffective | FAERS: 93 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 5 | Dizziness | FAERS: 75 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 6 | Abdominal Pain | FAERS: 59 | US FAERS | |
| 7 | Pruritus | FAERS: 57 | US FAERS | |
| 8 | Urticaria | FAERS: 51 | SIDER US FAERS | |
| 9 | Headache | FAERS: 49 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 10 | Abdominal discomfort | FAERS: 46 | US FAERS | |
| 11 | Cerebrovascular accident | FAERS: 41 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 12 | Vomiting | FAERS: 41 | US FAERS | |
| 13 | Malaise | FAERS: 37 | US FAERS | |
| 14 | Blood glucose abnormal | FAERS: 35 | US FAERS | |
| 15 | Arthralgia | FAERS: 31 | SIDER US FAERS | |
| 16 | Asthenia | FAERS: 31 | US FAERS | |
| 17 | Pneumonia | FAERS: 30 | US FAERS | |
| 18 | Weight decreased | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 19 | Pancreatic carcinoma | FAERS: 25 | US FAERS | |
| 20 | Lip swelling | FAERS: 24 | US FAERS | |
| 21 | Urinary tract infection | FAERS: 24 | SIDER US FAERS | |
| 22 | Back Pain | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 23 | Hypersensitivity | FAERS: 23 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 24 | Myocardial Infarction | FAERS: 21 | US FAERS | |
| 25 | Unevaluable event | FAERS: 21 | US FAERS | |
| 26 | Oropharyngeal pain | FAERS: 20 | US FAERS | |
| 27 | Chest Pain | FAERS: 19 | US FAERS | |
| 28 | Constipation | FAERS: 19 | SIDER US FAERS | |
| 29 | Fatigue | FAERS: 19 | US FAERS | |
| 30 | Blood glucose decreased | FAERS: 18 | US FAERS | |
| 31 | Feeling abnormal | FAERS: 18 | US FAERS | |
| 32 | Pain | FAERS: 18 | US FAERS | |
| 33 | Lipase increased | FAERS: 17 | US FAERS | |
| 34 | Peripheral swelling | FAERS: 17 | US FAERS | |
| 35 | Palpitations | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 36 | Tremor | FAERS: 15 | US FAERS | |
| 37 | Sepsis | FAERS: 14 | US FAERS | |
| 38 | Somnolence | FAERS: 14 | US FAERS | |
| 39 | Swelling | FAERS: 14 | US FAERS | |
| 40 | Angioedema | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 41 | Blood creatinine increased | FAERS: 13 | US FAERS | |
| 42 | Dyspepsia | FAERS: 12 | US FAERS | |
| 43 | Myalgia | FAERS: 12 | SIDER US FAERS | |
| 44 | Nasopharyngitis | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 45 | Accidental overdose | FAERS: 11 | US FAERS | |
| 46 | Anxiety | FAERS: 11 | US FAERS | |
| 47 | Pancreatic enzymes increased | FAERS: 11 | US FAERS | |
| 48 | Alopecia | FAERS: 10 | US FAERS | |
| 49 | Rash erythematous | FAERS: 10 | US FAERS | |
| 50 | Skin Ulcer | FAERS: 10 | US FAERS | |
| 51 | jaundice | FAERS: 10 | US FAERS | |
| 52 | Amylase increased | FAERS: 9 | US FAERS | |
| 53 | Diabetes mellitus inadequate control | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 54 | Flatulence | FAERS: 9 | US FAERS | |
| 55 | Overdose | FAERS: 9 | US FAERS | |
| 56 | Blood glucose fluctuation | FAERS: 8 | US FAERS | |
| 57 | Cholelithiasis | FAERS: 8 | US FAERS | |
| 58 | Dysphonia | FAERS: 8 | US FAERS | |
| 59 | Erythema | FAERS: 8 | US FAERS | |
| 60 | Influenza | FAERS: 8 | US FAERS | |
| 61 | Alanine Aminotransferase Increased | FAERS: 7 | US FAERS | |
| 62 | Dehydration | FAERS: 7 | US FAERS | |
| 63 | Drug dose omission | FAERS: 7 | US FAERS | |
| 64 | Gout | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 65 | Lethargy | FAERS: 7 | US FAERS | |
| 66 | Memory impairment | FAERS: 7 | US FAERS | |
| 67 | Musculoskeletal stiffness | FAERS: 7 | US FAERS | |
| 68 | Sinusitis | FAERS: 7 | US FAERS | |
| 69 | Tachycardia | FAERS: 7 | US FAERS | |
| 70 | Amnesia | FAERS: 6 | US FAERS | |
| 71 | Arthritis | FAERS: 6 | US FAERS | |
| 72 | Aspartate Aminotransferase Increased | FAERS: 6 | US FAERS | |
| 73 | Atrial Fibrillation | FAERS: 6 | US FAERS | |
| 74 | Cellulitis | FAERS: 6 | US FAERS | |
| 75 | Intestinal Obstruction | FAERS: 6 | US FAERS | |
| 76 | Product quality issue | FAERS: 6 | US FAERS | |
| 77 | Cerebral Infarction | FAERS: 5 | US FAERS | |
| 78 | Chest discomfort | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 79 | Chills | FAERS: 5 | US FAERS | |
| 80 | Dementia | FAERS: 5 | US FAERS | |
| 81 | Diabetes Mellitus | FAERS: 5 | SIDER US FAERS | |
| 82 | Eye pain | FAERS: 5 | US FAERS | |
| 83 | Nephrolithiasis | FAERS: 5 | US FAERS | |
| 84 | Respiratory Failure | FAERS: 5 | US FAERS | |
| 85 | Retinal migraine | FAERS: 5 | US FAERS | |
| 86 | Rhabdomyolysis | FAERS: 5 | US FAERS | |
| 87 | Stevens-Johnson Syndrome | FAERS: 5 | US FAERS | |
| 88 | Stomatitis | FAERS: 5 | US FAERS | |
| 89 | Thrombosis | FAERS: 5 | US FAERS | |
| 90 | Vertigo | FAERS: 5 | US FAERS | |
| 91 | Blood triglycerides increased | FAERS: 4 | SIDER US FAERS | |
| 92 | Blood urea increased | FAERS: 4 | US FAERS | |
| 93 | Bronchitis | FAERS: 4 | US FAERS | |
| 94 | Cardiac Arrest | FAERS: 4 | US FAERS | |
| 95 | Cystitis | FAERS: 4 | US FAERS | |
| 96 | Dysgeusia | FAERS: 4 | US FAERS | |
| 97 | Epistaxis | FAERS: 4 | US FAERS | |
| 98 | Feeling jittery | FAERS: 4 | US FAERS | |
| 99 | Flushing | FAERS: 4 | US FAERS | |
| 100 | Fracture | FAERS: 4 | US FAERS | |
| 101 | Hydronephrosis | FAERS: 4 | US FAERS | |
| 102 | Ileus | FAERS: 4 | US FAERS | |
| 103 | Immune thrombocytopenic purpura | FAERS: 4 | US FAERS | |
| 104 | Incorrect dose administered | FAERS: 4 | US FAERS | |
| 105 | Infection | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 106 | Joint swelling | FAERS: 4 | US FAERS | |
| 107 | Lymphoma | FAERS: 4 | US FAERS | |
| 108 | Medication residue present | FAERS: 4 | US FAERS | |
| 109 | Stress | FAERS: 4 | US FAERS | |
| 110 | Therapeutic response unexpected | FAERS: 4 | US FAERS | |
| 111 | Wheezing | FAERS: 4 | US FAERS | |
| 112 | Abasia | FAERS: 3 | US FAERS | |
| 113 | Acute kidney injury | FAERS: 3 | US FAERS | |
| 114 | Adverse event | FAERS: 3 | US FAERS | |
| 115 | Agranulocytosis | FAERS: 3 | US FAERS | |
| 116 | Burning sensation | FAERS: 3 | US FAERS | |
| 117 | Cataract | FAERS: 3 | US FAERS | |
| 118 | Cheilitis | FAERS: 3 | US FAERS | |
| 119 | Cholecystitis | FAERS: 3 | US FAERS | |
| 120 | Creatinine renal clearance increased | FAERS: 3 | US FAERS | |
| 121 | Depressed mood | FAERS: 3 | US FAERS | |
| 122 | Dermatitis | FAERS: 3 | SIDER US FAERS | |
| 123 | Discomfort | FAERS: 3 | US FAERS | |
| 124 | Drug administration error | FAERS: 3 | US FAERS | |
| 125 | Dysuria | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 126 | Eczema | FAERS: 3 | US FAERS | |
| 127 | Eructation | FAERS: 3 | US FAERS | |
| 128 | Hepatitis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 129 | Hypotension | FAERS: 3 | US FAERS | |
| 130 | Inappropriate schedule of drug administration | FAERS: 3 | US FAERS | |
| 131 | Incorrect route of drug administration | FAERS: 3 | US FAERS | |
| 132 | Limb discomfort | FAERS: 3 | US FAERS | |
| 133 | Limb injury | FAERS: 3 | US FAERS | |
| 134 | Macular degeneration | FAERS: 3 | US FAERS | |
| 135 | Musculoskeletal Pain | FAERS: 3 | US FAERS | |
| 136 | Musculoskeletal discomfort | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 137 | Nervousness | FAERS: 3 | US FAERS | |
| 138 | Polyarthritis | FAERS: 3 | US FAERS | |
| 139 | Renal pain | FAERS: 3 | US FAERS | |
| 140 | Retching | FAERS: 3 | US FAERS | |
| 141 | Rhinitis | FAERS: 3 | US FAERS | |
| 142 | Schizophrenia | FAERS: 3 | US FAERS | |
| 143 | Syncope | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 144 | Visual Impairment | FAERS: 3 | US FAERS | |
| 145 | Wrong technique in drug usage process | FAERS: 3 | US FAERS | |
| 146 | Accidental exposure to product by child | FAERS: 2 | US FAERS | |
| 147 | Acute myocardial infarction | FAERS: 2 | US FAERS | |
| 148 | Albuminuria | FAERS: 2 | US FAERS | |
| 149 | Anaphylactic shock | FAERS: 2 | SIDER US FAERS | |
| 150 | Angina Pectoris | FAERS: 2 | US FAERS | |
| 151 | Ascites | FAERS: 2 | US FAERS | |
| 152 | Atrioventricular Block | FAERS: 2 | US FAERS | |
| 153 | Biliary sepsis | FAERS: 2 | US FAERS | |
| 154 | Blindness | FAERS: 2 | US FAERS | |
| 155 | Blood cholesterol increased | FAERS: 2 | US FAERS | |
| 156 | Blood creatine increased | FAERS: 2 | US FAERS | |
| 157 | Blood creatinine abnormal | FAERS: 2 | US FAERS | |
| 158 | Blood urine present | FAERS: 2 | US FAERS | |
| 159 | Bone pain | FAERS: 2 | US FAERS | |
| 160 | Bronchopneumonia | FAERS: 2 | US FAERS | |
| 161 | Carotid artery occlusion | FAERS: 2 | US FAERS | |
| 162 | Cholangitis | FAERS: 2 | US FAERS | |
| 163 | Chromaturia | FAERS: 2 | US FAERS | |
| 164 | Device damage | FAERS: 2 | US FAERS | |
| 165 | Diabetic Ketoacidosis | FAERS: 2 | US FAERS | |
| 166 | Drug effect incomplete | FAERS: 2 | US FAERS | |
| 167 | Drug prescribing error | FAERS: 2 | US FAERS | |
| 168 | Dry skin | FAERS: 2 | US FAERS | |
| 169 | Ear discomfort | FAERS: 2 | US FAERS | |
| 170 | Emotional disorder | FAERS: 2 | US FAERS | |
| 171 | Erectile dysfunction | FAERS: 2 | US FAERS | |
| 172 | Extra dose administered | FAERS: 2 | US FAERS | |
| 173 | Facial paralysis | FAERS: 2 | US FAERS | |
| 174 | Flank Pain | FAERS: 2 | US FAERS | |
| 175 | Formication | FAERS: 2 | US FAERS | |
| 176 | Gastritis | FAERS: 2 | US FAERS | |
| 177 | Gastroenteritis | FAERS: 2 | US FAERS | |
| 178 | General physical health deterioration | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 179 | Glaucoma | FAERS: 2 | US FAERS | |
| 180 | Hunger | FAERS: 2 | US FAERS | |
| 181 | Hyperchlorhydria | FAERS: 2 | US FAERS | |
| 182 | Infarction | FAERS: 2 | US FAERS | |
| 183 | Joint stiffness | FAERS: 2 | US FAERS | |
| 184 | Malignant neoplasm progression | FAERS: 2 | US FAERS | |
| 185 | Medication Error | FAERS: 2 | US FAERS | |
| 186 | Metastasis | FAERS: 2 | US FAERS | |
| 187 | Mood swings | FAERS: 2 | US FAERS | |
| 188 | Musculoskeletal chest pain | FAERS: 2 | US FAERS | |
| 189 | Neck Pain | FAERS: 2 | US FAERS | |
| 190 | Neuralgia | FAERS: 2 | US FAERS | |
| 191 | Neutropenia | FAERS: 2 | US FAERS | |
| 192 | No adverse event | FAERS: 2 | US FAERS | |
| 193 | Pericardial effusion | FAERS: 2 | US FAERS | |
| 194 | Portal Vein Thrombosis | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 195 | Post procedural infection | FAERS: 2 | US FAERS | |
| 196 | Productive Cough | FAERS: 2 | US FAERS | |
| 197 | Rheumatoid Arthritis | FAERS: 2 | US FAERS | |
| 198 | Sciatica | FAERS: 2 | US FAERS | |
| 199 | Skin lesion | FAERS: 2 | US FAERS | |
| 200 | Sneezing | FAERS: 2 | US FAERS | |
| 201 | Throat irritation | FAERS: 2 | US FAERS | |
| 202 | Thrombocytopenia | FAERS: 2 | US FAERS | |
| 203 | Tinea cruris | FAERS: 2 | US FAERS | |
| 204 | Tinnitus | FAERS: 2 | US FAERS | |
| 205 | Transaminases increased | FAERS: 2 | US FAERS | |
| 206 | Troponin increased | FAERS: 2 | US FAERS | |
| 207 | Urinary Retention | FAERS: 2 | US FAERS | |
| 208 | Vasculitis | FAERS: 2 | US FAERS | |
| 209 | Vulvovaginal mycotic infection | FAERS: 2 | US FAERS | |
| 210 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 211 | Abscess | FAERS: 1 | US FAERS | |
| 212 | Accidental exposure | FAERS: 1 | US FAERS | |
| 213 | Acidosis | FAERS: 1 | US FAERS | |
| 214 | Actinic keratosis | FAERS: 1 | US FAERS | |
| 215 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 216 | Acute prerenal failure | FAERS: 1 | US FAERS | |
| 217 | Acute respiratory failure | FAERS: 1 | US FAERS | |
| 218 | Agitation | FAERS: 1 | US FAERS | |
| 219 | Agoraphobia | FAERS: 1 | US FAERS | |
| 220 | Alcohol interaction | FAERS: 1 | US FAERS | |
| 221 | Allergy to chemicals | FAERS: 1 | US FAERS | |
| 222 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 223 | Amylase abnormal | FAERS: 1 | US FAERS | |
| 224 | Anal sphincter atony | FAERS: 1 | US FAERS | |
| 225 | Anger | FAERS: 1 | US FAERS | |
| 226 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 227 | Anorectal discomfort | FAERS: 1 | US FAERS | |
| 228 | Anosmia | FAERS: 1 | US FAERS | |
| 229 | Aortic Aneurysm | FAERS: 1 | US FAERS | |
| 230 | Aortic Valve Stenosis | FAERS: 1 | US FAERS | |
| 231 | Aortic occlusion | FAERS: 1 | US FAERS | |
| 232 | Aphasia | FAERS: 1 | US FAERS | |
| 233 | Aphonia | FAERS: 1 | US FAERS | |
| 234 | Arthropathy | FAERS: 1 | US FAERS | |
| 235 | Asthma | FAERS: 1 | US FAERS | |
| 236 | Bedridden | FAERS: 1 | US FAERS | |
| 237 | Bladder pain | FAERS: 1 | US FAERS | |
| 238 | Blood Glucose | FAERS: 1 | US FAERS | |
| 239 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 240 | Blood amylase increased | FAERS: 1 | US FAERS | |
| 241 | Blood blister | FAERS: 1 | US FAERS | |
| 242 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 243 | Blood lactate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 244 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 245 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 246 | Breast cancer recurrent | FAERS: 1 | US FAERS | |
| 247 | Bronchospasm | FAERS: 1 | US FAERS | |
| 248 | Bursitis | FAERS: 1 | US FAERS | |
| 249 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 250 | Cardiac enzymes increased | FAERS: 1 | US FAERS | |
| 251 | Cataract operation | FAERS: 1 | US FAERS | |
| 252 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 253 | Colitis | FAERS: 1 | US FAERS | |
| 254 | Conjunctivitis | FAERS: 1 | US FAERS | |
| 255 | Contraindicated product administered | FAERS: 1 | US FAERS | |
| 256 | Crying | FAERS: 1 | US FAERS | |
| 257 | Deafness | FAERS: 1 | US FAERS | |
| 258 | Delirium | FAERS: 1 | US FAERS | |
| 259 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 260 | Device occlusion | FAERS: 1 | US FAERS | |
| 261 | Device related infection | FAERS: 1 | US FAERS | |
| 262 | Diabetic Nephropathy | FAERS: 1 | US FAERS | |
| 263 | Diabetic Retinopathy | FAERS: 1 | US FAERS | |
| 264 | Diabetic metabolic decompensation | FAERS: 1 | US FAERS | |
| 265 | Disability | FAERS: 1 | US FAERS | |
| 266 | Disorientation | FAERS: 1 | US FAERS | |
| 267 | Diverticular perforation | FAERS: 1 | US FAERS | |
| 268 | Drooling | FAERS: 1 | US FAERS | |
| 269 | Drowning | FAERS: 1 | US FAERS | |
| 270 | Dysarthria | FAERS: 1 | US FAERS | |
| 271 | Ear congestion | FAERS: 1 | US FAERS | |
| 272 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 273 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 274 | Embolism | FAERS: 1 | US FAERS | |
| 275 | Emotional distress | FAERS: 1 | US FAERS | |
| 276 | Enzyme level increased | FAERS: 1 | US FAERS | |
| 277 | Eosinophilia | FAERS: 1 | US FAERS | |
| 278 | Epidermolysis Bullosa | FAERS: 1 | US FAERS | |
| 279 | Epilepsy | FAERS: 1 | US FAERS | |
| 280 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 281 | Extraocular Muscle Paresis | FAERS: 1 | US FAERS | |
| 282 | Eye irritation | FAERS: 1 | US FAERS | |
| 283 | Failure to Thrive | FAERS: 1 | US FAERS | |
| 284 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 285 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 286 | Gastrectomy | FAERS: 1 | US FAERS | |
| 287 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 288 | Gastrointestinal Pain | FAERS: 1 | US FAERS | |
| 289 | Gastrointestinal infection | FAERS: 1 | US FAERS | |
| 290 | Gastrointestinal lymphoma | FAERS: 1 | US FAERS | |
| 291 | Gastrointestinal wall thickening | FAERS: 1 | US FAERS | |
| 292 | Gingival Recession | FAERS: 1 | US FAERS | |
| 293 | Gingivitis | FAERS: 1 | US FAERS | |
| 294 | Grief reaction | FAERS: 1 | US FAERS | |
| 295 | Head discomfort | FAERS: 1 | US FAERS | |
| 296 | Hemiparesis | FAERS: 1 | US FAERS | |
| 297 | Hemiplegia | FAERS: 1 | US FAERS | |
| 298 | Hepatic Encephalopathy | FAERS: 1 | US FAERS | |
| 299 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 300 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 301 | Hernia | FAERS: 1 | US FAERS | |
| 302 | Hyperphagia | FAERS: 1 | US FAERS | |
| 303 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 304 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 305 | Impaired work ability | FAERS: 1 | US FAERS | |
| 306 | Incision site pain | FAERS: 1 | US FAERS | |
| 307 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 308 | Inflammation | FAERS: 1 | US FAERS | |
| 309 | Intentional drug misuse | FAERS: 1 | US FAERS | |
| 310 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 311 | Intercepted medication error | FAERS: 1 | US FAERS | |
| 312 | Intrusive thoughts | FAERS: 1 | US FAERS | |
| 313 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 314 | Joint injury | FAERS: 1 | US FAERS | |
| 315 | Ketoacidosis | FAERS: 1 | US FAERS | |
| 316 | Laceration | FAERS: 1 | US FAERS | |
| 317 | Laryngeal discomfort | FAERS: 1 | US FAERS | |
| 318 | Leukopenia | FAERS: 1 | US FAERS | |
| 319 | Limb operation | FAERS: 1 | US FAERS | |
| 320 | Lip and/or oral cavity cancer | FAERS: 1 | US FAERS | |
| 321 | Lipase abnormal | FAERS: 1 | US FAERS | |
| 322 | Lipoma | FAERS: 1 | US FAERS | |
| 323 | Loose tooth | FAERS: 1 | US FAERS | |
| 324 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 325 | Lower respiratory tract congestion | FAERS: 1 | US FAERS | |
| 326 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 327 | Macular fibrosis | FAERS: 1 | US FAERS | |
| 328 | Medication residue | FAERS: 1 | US FAERS | |
| 329 | Meningitis | FAERS: 1 | US FAERS | |
| 330 | Meniscus injury | FAERS: 1 | US FAERS | |
| 331 | Mental impairment | FAERS: 1 | US FAERS | |
| 332 | Micturition frequency decreased | FAERS: 1 | US FAERS | |
| 333 | Mitral Valve Stenosis | FAERS: 1 | US FAERS | |
| 334 | Mole excision | FAERS: 1 | US FAERS | |
| 335 | Monoplegia | FAERS: 1 | US FAERS | |
| 336 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 337 | Myoclonus | FAERS: 1 | US FAERS | |
| 338 | Nasal discomfort | FAERS: 1 | US FAERS | |
| 339 | Night sweats | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 340 | Nocturia | FAERS: 1 | US FAERS | |
| 341 | Nodule | FAERS: 1 | US FAERS | |
| 342 | Obesity surgery | FAERS: 1 | US FAERS | |
| 343 | Obesity | FAERS: 1 | US FAERS | |
| 344 | Ophthalmologic treatment | FAERS: 1 | US FAERS | |
| 345 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 346 | Oral mucosal erythema | FAERS: 1 | US FAERS | |
| 347 | Oral pain | FAERS: 1 | US FAERS | |
| 348 | Osteoporosis | FAERS: 1 | US FAERS | |
| 349 | Pain of skin | FAERS: 1 | US FAERS | |
| 350 | Palatal swelling | FAERS: 1 | US FAERS | |
| 351 | Pallor | FAERS: 1 | US FAERS | |
| 352 | Pancreatic Cyst | FAERS: 1 | US FAERS | |
| 353 | Pancreatic Neoplasm | FAERS: 1 | US FAERS | |
| 354 | Pancreatic carcinoma recurrent | FAERS: 1 | US FAERS | |
| 355 | Pancreatic enzymes abnormal | FAERS: 1 | US FAERS | |
| 356 | Paranasal sinus discomfort | FAERS: 1 | US FAERS | |
| 357 | Paranoia | FAERS: 1 | US FAERS | |
| 358 | Paraplegia | FAERS: 1 | US FAERS | |
| 359 | Percutaneous Coronary Intervention | FAERS: 1 | US FAERS | |
| 360 | Peripheral artery occlusion | FAERS: 1 | US FAERS | |
| 361 | Personality Change | FAERS: 1 | US FAERS | |
| 362 | Pharyngitis | FAERS: 1 | US FAERS | |
| 363 | Pneumonitis | FAERS: 1 | US FAERS | |
| 364 | Polymyalgia Rheumatica | FAERS: 1 | US FAERS | |
| 365 | Portal venous gas | FAERS: 1 | US FAERS | |
| 366 | Post procedural complication | FAERS: 1 | US FAERS | |
| 367 | Presyncope | FAERS: 1 | US FAERS | |
| 368 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 369 | Psoriasis | FAERS: 1 | US FAERS | |
| 370 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 371 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 372 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 373 | Purpura | FAERS: 1 | US FAERS | |
| 374 | Purulence | FAERS: 1 | US FAERS | |
| 375 | Pyelonephritis | FAERS: 1 | US FAERS | |
| 376 | Rehabilitation therapy | FAERS: 1 | US FAERS | |
| 377 | Renal artery stent placement | FAERS: 1 | US FAERS | |
| 378 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 379 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 380 | Rhinalgia | FAERS: 1 | US FAERS | |
| 381 | Seronegative arthritis | FAERS: 1 | US FAERS | |
| 382 | Sinus operation | FAERS: 1 | US FAERS | |
| 383 | Skin Erosion | FAERS: 1 | US FAERS | |
| 384 | Skin reaction | FAERS: 1 | US FAERS | |
| 385 | Sluggishness | FAERS: 1 | US FAERS | |
| 386 | Spinal cord infection | FAERS: 1 | US FAERS | |
| 387 | Subcutaneous Abscess | FAERS: 1 | US FAERS | |
| 388 | Sudden Cardiac Death | FAERS: 1 | US FAERS | |
| 389 | Sudden death | FAERS: 1 | US FAERS | |
| 390 | Suicide attempt | FAERS: 1 | US FAERS | |
| 391 | Sunburn | FAERS: 1 | US FAERS | |
| 392 | Therapeutic product effect incomplete | FAERS: 1 | US FAERS | |
| 393 | Therapeutic response delayed | FAERS: 1 | US FAERS | |
| 394 | Therapy cessation | FAERS: 1 | US FAERS | |
| 395 | Thermal burn | FAERS: 1 | US FAERS | |
| 396 | Thirst | FAERS: 1 | US FAERS | |
| 397 | Tongue eruption | FAERS: 1 | US FAERS | |
| 398 | Typhoid Fever | FAERS: 1 | US FAERS | |
| 399 | Ulcer | FAERS: 1 | US FAERS | |
| 400 | Upper respiratory tract congestion | FAERS: 1 | US FAERS | |
| 401 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 402 | Urine ketone body present | FAERS: 1 | US FAERS | |
| 403 | Urticarial vasculitis | FAERS: 1 | US FAERS | |
| 404 | Vocal Cord Paralysis | FAERS: 1 | US FAERS | |
| 405 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 406 | Wound Infection | FAERS: 1 | US FAERS | |
| 407 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 408 | Anovulation | 28619389 | CTD | |
| 409 | Bronchial Hyperreactivity | SIDER | ||
| 410 | Demyelinating Diseases | 29864483 | CTD | |
| 411 | Diabetic | SIDER | ||
| 412 | Infestation | SIDER | ||
| 413 | Malnutrition | SIDER | ||
| 414 | Motor Disorders | 29864483 | CTD | |
| 415 | Neurobehavioral Manifestations | 29864483 | CTD | |
| 416 | Ovarian Cysts | 28619389 | CTD | |
| 417 | Protein total abnormal | Canada Vigilance: 1 | Canada Vigilance | |
| 418 | Skin irritation | Canada Vigilance: 1 | Canada Vigilance | |
| 419 | Weight Gain | 28619389 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120236
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.