Vancomycin
(LCTORFDMHNKUSG-XTTLPDOESA-N)
Structure
- SMILES
- OC[C@H]1O[C@@H](Oc2c3cc4cc2Oc2ccc(cc2Cl)[C@@H](O)[C@@H]2NC(=O)[C@H](NC(=O)[C@@H]4NC(=O)[C@H](CC(=O)N)NC(=O)[C@@H]([C@@H](c4ccc(O3)c(Cl)c4)O)NC(=O)[C@@H](CC(C)C)NC)c3ccc(c(c3)c3c(O)cc(cc3[C@H](NC2=O)C(=O)O)O)O)[C@@H]([C@H]([C@@H]1O)O)O[C@@H]1O[C@@H](C)[C@H]([C@@](C1)(C)N)O.Cl
- Molecular Formula:
- C66H76Cl3N9O24
- Molecular Weight:
- 1485.710
- Log P:
- 4.7346
- Hydrogen Bond Acceptor:
- 33
- Hydrogen Bond Donor:
- 20
- TPSA:
- 530.49
- CAS Number(s):
- 1404-93-9; 197638-25-8
Synonym(s)
1.
Vancomycin
2.
AB-Vancomycin
3.
Diatracin
4.
VANCO-cell
5.
Vanco Azupharma
6.
Vanco-saar
7.
Vancocin
8.
Vancocin HCl
9.
Vancocine
10.
Vancomicina Abbott
11.
Vancomicina Chiesi
12.
Vancomicina Combino Phar
13.
Vancomicina Norman
14.
Vancomycin Hexal
15.
Vancomycin Hydrochloride
16.
Vancomycin Lilly
17.
Vancomycin Phosphate (1:2)
18.
Vancomycin Phosphate (1:2), Decahydrate
19.
Vancomycin Sulfate
20.
Vancomycin-ratiopharm
21.
Vancomycine Dakota
22.
Hydrochloride, Vancomycin
23.
Sulfate, Vancomycin
External Link(s)
| MeSH | D014640 |
| PubChem Compound | 11947756 6420023 |
| CHEMBL | CHEMBL1200628 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Red man syndrome | FAERS: 94 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 2 | Pruritus | FAERS: 86 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 3 | Thrombocytopenia | FAERS: 77 | US FAERS | |
| 4 | Drug ineffective | FAERS: 61 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 5 | Urticaria | FAERS: 40 | US FAERS | |
| 6 | Erythema | FAERS: 37 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 7 | Acute kidney injury | FAERS: 32 | US FAERS | |
| 8 | Hypotension | FAERS: 27 | US FAERS | |
| 9 | Drug level increased | FAERS: 26 | US FAERS | |
| 10 | Hypersensitivity | FAERS: 24 | US FAERS | |
| 11 | Vomiting | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 12 | Blood creatinine increased | FAERS: 19 | US FAERS | |
| 13 | Nausea | FAERS: 15 | US FAERS | |
| 14 | Renal tubular necrosis | FAERS: 15 | US FAERS | |
| 15 | Swelling | FAERS: 15 | US FAERS | |
| 16 | Antibiotic level above therapeutic | FAERS: 14 | US FAERS | |
| 17 | Chills | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 18 | Incorrect dose administered | FAERS: 13 | US FAERS | |
| 19 | Retinal Vasculitis | FAERS: 13 | US FAERS | |
| 20 | Retinal vascular occlusion | FAERS: 13 | US FAERS | |
| 21 | Tachycardia | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 22 | Dizziness | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 23 | Flushing | FAERS: 12 | US FAERS | |
| 24 | Cardiac Arrest | FAERS: 11 | US FAERS | |
| 25 | Product quality issue | FAERS: 11 | US FAERS | |
| 26 | Respiratory arrest | FAERS: 11 | US FAERS | |
| 27 | Toxic Epidermal Necrolysis | FAERS: 11 | US FAERS | |
| 28 | Asthenia | FAERS: 8 | US FAERS | |
| 29 | Deafness | FAERS: 8 | US FAERS | |
| 30 | Feeling abnormal | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 31 | Leukopenia | FAERS: 8 | US FAERS | |
| 32 | Lip swelling | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 33 | Neutropenia | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 34 | No adverse event | FAERS: 8 | US FAERS | |
| 35 | treatment failure | FAERS: 8 | US FAERS | |
| 36 | Abdominal Pain | FAERS: 7 | US FAERS | |
| 37 | Angioedema | FAERS: 7 | US FAERS | |
| 38 | Drug dispensing error | FAERS: 7 | US FAERS | |
| 39 | Headache | FAERS: 7 | US FAERS | |
| 40 | Malaise | FAERS: 7 | US FAERS | |
| 41 | Medication Error | FAERS: 7 | US FAERS | |
| 42 | Overdose | FAERS: 7 | US FAERS | |
| 43 | Peripheral swelling | FAERS: 7 | US FAERS | |
| 44 | Product use issue | FAERS: 7 | US FAERS | |
| 45 | Toxicity to various agents | FAERS: 7 | US FAERS | |
| 46 | Blindness | FAERS: 6 | US FAERS | |
| 47 | Clostridium difficile colitis | FAERS: 6 | US FAERS | |
| 48 | Incorrect drug administration rate | FAERS: 6 | US FAERS | |
| 49 | Pain | FAERS: 6 | US FAERS | |
| 50 | Rash erythematous | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 51 | Sepsis | FAERS: 6 | US FAERS | |
| 52 | Stevens-Johnson Syndrome | FAERS: 6 | US FAERS | |
| 53 | Tremor | FAERS: 6 | US FAERS | |
| 54 | Arthralgia | FAERS: 5 | US FAERS | |
| 55 | Clostridium difficile infection | FAERS: 5 | US FAERS | |
| 56 | Drug level below therapeutic | FAERS: 5 | US FAERS | |
| 57 | Flatulence | FAERS: 5 | US FAERS | |
| 58 | Incorrect route of drug administration | FAERS: 5 | US FAERS | |
| 59 | Infection | FAERS: 5 | US FAERS | |
| 60 | Leukocytoclastic vasculitis | FAERS: 5 | US FAERS | |
| 61 | Pathogen resistance | FAERS: 5 | US FAERS | |
| 62 | Product deposit | FAERS: 5 | US FAERS | |
| 63 | Respiratory Failure | FAERS: 5 | US FAERS | |
| 64 | Somnolence | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 65 | Tinnitus | FAERS: 5 | US FAERS | |
| 66 | Abdominal discomfort | FAERS: 4 | US FAERS | |
| 67 | Accidental overdose | FAERS: 4 | US FAERS | |
| 68 | Back Pain | FAERS: 4 | US FAERS | |
| 69 | Blood potassium decreased | FAERS: 4 | US FAERS | |
| 70 | Bronchospasm | FAERS: 4 | US FAERS | |
| 71 | Burning sensation | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 72 | Chest discomfort | FAERS: 4 | US FAERS | |
| 73 | Cholestasis | FAERS: 4 | US FAERS | |
| 74 | Crystal urine present | FAERS: 4 | US FAERS | |
| 75 | Deafness Neurosensory | FAERS: 4 | US FAERS | |
| 76 | Dehydration | FAERS: 4 | US FAERS | |
| 77 | Drug level decreased | FAERS: 4 | US FAERS | |
| 78 | Enterococcal infection | FAERS: 4 | US FAERS | |
| 79 | Fatigue | FAERS: 4 | US FAERS | |
| 80 | Pallor | FAERS: 4 | US FAERS | |
| 81 | Pancytopenia | FAERS: 4 | US FAERS | |
| 82 | Petechiae | FAERS: 4 | US FAERS | |
| 83 | Product container issue | FAERS: 4 | US FAERS | |
| 84 | Product use in unapproved indication | FAERS: 4 | US FAERS | |
| 85 | Septic Shock | FAERS: 4 | US FAERS | |
| 86 | Unevaluable event | FAERS: 4 | US FAERS | |
| 87 | Wrong technique in product usage process | FAERS: 4 | US FAERS | |
| 88 | Acute myocardial infarction | FAERS: 3 | US FAERS | |
| 89 | Anaphylactic shock | FAERS: 3 | US FAERS | |
| 90 | Anuria | FAERS: 3 | US FAERS | |
| 91 | Blood urea increased | FAERS: 3 | US FAERS | |
| 92 | Cellulitis | FAERS: 3 | US FAERS | |
| 93 | Chest Pain | FAERS: 3 | US FAERS | |
| 94 | Cyanosis | FAERS: 3 | US FAERS | |
| 95 | Disseminated Intravascular Coagulation | FAERS: 3 | US FAERS | |
| 96 | Drug administration error | FAERS: 3 | US FAERS | |
| 97 | Eosinophilia | FAERS: 3 | US FAERS | |
| 98 | Erythema Multiforme | FAERS: 3 | US FAERS | |
| 99 | Infusion site pain | FAERS: 3 | US FAERS | |
| 100 | Injection site vesicles | FAERS: 3 | US FAERS | |
| 101 | Joint stiffness | FAERS: 3 | US FAERS | |
| 102 | Myocarditis | FAERS: 3 | US FAERS | |
| 103 | Necrosis | FAERS: 3 | US FAERS | |
| 104 | Oliguria | FAERS: 3 | US FAERS | |
| 105 | Pneumonia | FAERS: 3 | US FAERS | |
| 106 | Product solubility abnormal | FAERS: 3 | US FAERS | |
| 107 | Respiratory distress | FAERS: 3 | US FAERS | |
| 108 | Serum Sickness | FAERS: 3 | US FAERS | |
| 109 | Tetanus | FAERS: 3 | US FAERS | |
| 110 | Trismus | FAERS: 3 | US FAERS | |
| 111 | Unresponsive to stimuli | FAERS: 3 | US FAERS | |
| 112 | Weight decreased | FAERS: 3 | US FAERS | |
| 113 | White blood cell count decreased | FAERS: 3 | US FAERS | |
| 114 | Anti-platelet antibody positive | FAERS: 2 | US FAERS | |
| 115 | Asthma | FAERS: 2 | US FAERS | |
| 116 | Atrial Fibrillation | FAERS: 2 | US FAERS | |
| 117 | Autonomic nervous system imbalance | FAERS: 2 | US FAERS | |
| 118 | Blood creatine increased | FAERS: 2 | US FAERS | |
| 119 | Cardiac valve vegetation | FAERS: 2 | US FAERS | |
| 120 | Circumstance or information capable of leading to medication error | FAERS: 2 | US FAERS | |
| 121 | Colitis | FAERS: 2 | US FAERS | |
| 122 | Constipation | FAERS: 2 | US FAERS | |
| 123 | Device malfunction | FAERS: 2 | US FAERS | |
| 124 | Diplopia | FAERS: 2 | US FAERS | |
| 125 | Discomfort | FAERS: 2 | US FAERS | |
| 126 | Documented hypersensitivity to administered drug | FAERS: 2 | US FAERS | |
| 127 | Drug dose omission | FAERS: 2 | US FAERS | |
| 128 | Drug effect incomplete | FAERS: 2 | US FAERS | |
| 129 | Drug level above therapeutic | FAERS: 2 | US FAERS | |
| 130 | Drug monitoring procedure incorrectly performed | FAERS: 2 | US FAERS | |
| 131 | Dysgeusia | FAERS: 2 | US FAERS | |
| 132 | Dysuria | FAERS: 2 | US FAERS | |
| 133 | Endocarditis | FAERS: 2 | US FAERS | |
| 134 | Expired product administered | FAERS: 2 | US FAERS | |
| 135 | Extravasation | FAERS: 2 | US FAERS | |
| 136 | Foaming at mouth | FAERS: 2 | US FAERS | |
| 137 | General physical health deterioration | FAERS: 2 | US FAERS | |
| 138 | Injection site erythema | FAERS: 2 | US FAERS | |
| 139 | Injection site extravasation | FAERS: 2 | US FAERS | |
| 140 | Kounis Syndrome | FAERS: 2 | US FAERS | |
| 141 | Lethargy | FAERS: 2 | US FAERS | |
| 142 | Limb discomfort | FAERS: 2 | US FAERS | |
| 143 | Lymphadenopathy | FAERS: 2 | US FAERS | |
| 144 | Mental status changes | FAERS: 2 | US FAERS | |
| 145 | Muscle Rigidity | FAERS: 2 | US FAERS | |
| 146 | Occupational exposure to product | FAERS: 2 | US FAERS | |
| 147 | Oropharyngeal pain | FAERS: 2 | US FAERS | |
| 148 | Panniculitis | FAERS: 2 | US FAERS | |
| 149 | Peritonitis | FAERS: 2 | US FAERS | |
| 150 | Pharmaceutical product complaint | FAERS: 2 | US FAERS | |
| 151 | Product administration error | FAERS: 2 | US FAERS | |
| 152 | Product dispensing error | FAERS: 2 | US FAERS | |
| 153 | Product lot number issue | FAERS: 2 | US FAERS | |
| 154 | Product storage error | FAERS: 2 | US FAERS | |
| 155 | Retinal Vascular Disorder | FAERS: 2 | US FAERS | |
| 156 | Rubber sensitivity | FAERS: 2 | US FAERS | |
| 157 | Septic embolus | FAERS: 2 | US FAERS | |
| 158 | Therapeutic drug monitoring analysis not performed | FAERS: 2 | US FAERS | |
| 159 | Vertigo | FAERS: 2 | US FAERS | |
| 160 | Wheezing | FAERS: 2 | US FAERS | |
| 161 | Wound infection staphylococcal | FAERS: 2 | US FAERS | |
| 162 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 163 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 164 | Acute respiratory failure | FAERS: 1 | US FAERS | |
| 165 | Agitation | FAERS: 1 | US FAERS | |
| 166 | Agonal death struggle | FAERS: 1 | US FAERS | |
| 167 | Alanine Aminotransferase Increased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 168 | Allergic eosinophilia | FAERS: 1 | US FAERS | |
| 169 | Alopecia | FAERS: 1 | US FAERS | |
| 170 | Amnesia | FAERS: 1 | US FAERS | |
| 171 | Anaphylactoid Reaction | FAERS: 1 | US FAERS | |
| 172 | Anhedonia | FAERS: 1 | US FAERS | |
| 173 | Anxiety | FAERS: 1 | US FAERS | |
| 174 | Aphasia | FAERS: 1 | US FAERS | |
| 175 | Aphonia | FAERS: 1 | US FAERS | |
| 176 | Autoimmune thrombocytopenia | FAERS: 1 | US FAERS | |
| 177 | Bedridden | FAERS: 1 | US FAERS | |
| 178 | Blood alkaline phosphatase increased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 179 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 180 | Blood urine present | FAERS: 1 | US FAERS | |
| 181 | Bradycardia | FAERS: 1 | US FAERS | |
| 182 | Brain Hypoxia | FAERS: 1 | US FAERS | |
| 183 | Catheter related infection | FAERS: 1 | US FAERS | |
| 184 | Cavernous Sinus Thrombosis | FAERS: 1 | US FAERS | |
| 185 | Cell Death | FAERS: 1 | US FAERS | |
| 186 | Choking | FAERS: 1 | US FAERS | |
| 187 | Cholangitis | FAERS: 1 | US FAERS | |
| 188 | Choroidal Detachment | FAERS: 1 | US FAERS | |
| 189 | Cold sweat | FAERS: 1 | US FAERS | |
| 190 | Contraindicated drug administered | FAERS: 1 | US FAERS | |
| 191 | Deformity | FAERS: 1 | US FAERS | |
| 192 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 193 | Depressed mood | FAERS: 1 | US FAERS | |
| 194 | Device computer issue | FAERS: 1 | US FAERS | |
| 195 | Disease Progression | FAERS: 1 | US FAERS | |
| 196 | Disorientation | FAERS: 1 | US FAERS | |
| 197 | Distributive shock | FAERS: 1 | US FAERS | |
| 198 | Drug abuse | FAERS: 1 | US FAERS | |
| 199 | Drug exposure during pregnancy | FAERS: 1 | US FAERS | |
| 200 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 201 | Drug resistance | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 202 | Drug toxicity | FAERS: 1 | US FAERS | |
| 203 | Economic problem | FAERS: 1 | US FAERS | |
| 204 | Electrocardiogram ST-T segment elevation | FAERS: 1 | US FAERS | |
| 205 | Encephalitis | FAERS: 1 | US FAERS | |
| 206 | Endotracheal intubation complication | FAERS: 1 | US FAERS | |
| 207 | Escherichia infection | FAERS: 1 | US FAERS | |
| 208 | Feeling jittery | FAERS: 1 | US FAERS | |
| 209 | Gamma-Glutamyltransferase Increased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 210 | Gastrointestinal Pain | FAERS: 1 | US FAERS | |
| 211 | Glossitis | FAERS: 1 | US FAERS | |
| 212 | Hearing aid user | FAERS: 1 | US FAERS | |
| 213 | Hemiplegia | FAERS: 1 | US FAERS | |
| 214 | Hepatic Encephalopathy | FAERS: 1 | US FAERS | |
| 215 | Hepatitis | FAERS: 1 | US FAERS | |
| 216 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 217 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 218 | Hypercapnia | FAERS: 1 | US FAERS | |
| 219 | Hyperphagia | FAERS: 1 | US FAERS | |
| 220 | Hypertransaminasaemia | FAERS: 1 | US FAERS | |
| 221 | Hypophagia | FAERS: 1 | US FAERS | |
| 222 | Hypoxia | FAERS: 1 | US FAERS | |
| 223 | Immune thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 224 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 225 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 226 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 227 | Incorrect route of product administration | FAERS: 1 | US FAERS | |
| 228 | Infusion Site Extravasation | FAERS: 1 | US FAERS | |
| 229 | Infusion site swelling | FAERS: 1 | US FAERS | |
| 230 | Infusion site thrombosis | FAERS: 1 | US FAERS | |
| 231 | Infusion site urticaria | FAERS: 1 | US FAERS | |
| 232 | Injection related reaction | FAERS: 1 | US FAERS | |
| 233 | Injection site pain | FAERS: 1 | US FAERS | |
| 234 | Injection site pruritus | FAERS: 1 | US FAERS | |
| 235 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 236 | Intercepted drug administration error | FAERS: 1 | US FAERS | |
| 237 | Intercepted medication error | FAERS: 1 | US FAERS | |
| 238 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 239 | Intracardiac mass | FAERS: 1 | US FAERS | |
| 240 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 241 | Joint swelling | FAERS: 1 | US FAERS | |
| 242 | Klebsiella sepsis | FAERS: 1 | US FAERS | |
| 243 | Lactobacillus infection | FAERS: 1 | US FAERS | |
| 244 | Limb injury | FAERS: 1 | US FAERS | |
| 245 | Lip erythema | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 246 | Lupus Nephritis | FAERS: 1 | US FAERS | |
| 247 | Medication residue present | FAERS: 1 | US FAERS | |
| 248 | Meningitis enterococcal | FAERS: 1 | US FAERS | |
| 249 | Meningitis | FAERS: 1 | US FAERS | |
| 250 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 251 | Myalgia | FAERS: 1 | US FAERS | |
| 252 | Mydriasis | FAERS: 1 | US FAERS | |
| 253 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 254 | Neck Pain | FAERS: 1 | US FAERS | |
| 255 | Neonatal hypotension | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 256 | Nephritis | FAERS: 1 | US FAERS | |
| 257 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 258 | Onychoclasis | FAERS: 1 | US FAERS | |
| 259 | Optic Atrophy | FAERS: 1 | US FAERS | |
| 260 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 261 | Osteomyelitis | FAERS: 1 | US FAERS | |
| 262 | Ototoxicity | FAERS: 1 | US FAERS | |
| 263 | Pharyngeal swelling | FAERS: 1 | US FAERS | |
| 264 | Photophobia | FAERS: 1 | US FAERS | |
| 265 | Piloerection | FAERS: 1 | US FAERS | |
| 266 | Poisoning | FAERS: 1 | US FAERS | |
| 267 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 268 | Poor quality product administered | FAERS: 1 | US FAERS | |
| 269 | Post procedural complication | FAERS: 1 | US FAERS | |
| 270 | Product complaint | FAERS: 1 | US FAERS | |
| 271 | Product contamination physical | FAERS: 1 | US FAERS | |
| 272 | Product dose omission | FAERS: 1 | US FAERS | |
| 273 | Product monitoring error | FAERS: 1 | US FAERS | |
| 274 | Product packaging difficult to open | FAERS: 1 | US FAERS | |
| 275 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 276 | Product physical issue | FAERS: 1 | US FAERS | |
| 277 | Product preparation error | FAERS: 1 | US FAERS | |
| 278 | Product substitution issue | FAERS: 1 | US FAERS | |
| 279 | Product use complaint | FAERS: 1 | US FAERS | |
| 280 | Psoriasis | FAERS: 1 | US FAERS | |
| 281 | Rebound effect | FAERS: 1 | US FAERS | |
| 282 | Renal pain | FAERS: 1 | US FAERS | |
| 283 | Restlessness | FAERS: 1 | US FAERS | |
| 284 | Retinal Artery Occlusion | FAERS: 1 | US FAERS | |
| 285 | Retinal Vein Occlusion | FAERS: 1 | US FAERS | |
| 286 | Secretion discharge | FAERS: 1 | US FAERS | |
| 287 | Shock | FAERS: 1 | US FAERS | |
| 288 | Skin reaction | FAERS: 1 | US FAERS | |
| 289 | Skin toxicity | FAERS: 1 | US FAERS | |
| 290 | Slow response to stimuli | FAERS: 1 | US FAERS | |
| 291 | Symmetrical drug-related intertriginous and flexural exanthema | FAERS: 1 | US FAERS | |
| 292 | Tension Headache | FAERS: 1 | US FAERS | |
| 293 | Terminal state | FAERS: 1 | US FAERS | |
| 294 | Therapeutic drug monitoring analysis incorrectly performed | FAERS: 1 | US FAERS | |
| 295 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 296 | Therapy cessation | FAERS: 1 | US FAERS | |
| 297 | Therapy change | FAERS: 1 | US FAERS | |
| 298 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 299 | Thrombosis in device | FAERS: 1 | US FAERS | |
| 300 | Thrombosis | FAERS: 1 | US FAERS | |
| 301 | Tongue biting | FAERS: 1 | US FAERS | |
| 302 | Toxic anterior segment syndrome | FAERS: 1 | US FAERS | |
| 303 | Toxicologic test abnormal | FAERS: 1 | US FAERS | |
| 304 | Transaminases increased | FAERS: 1 | US FAERS | |
| 305 | Transcription medication error | FAERS: 1 | US FAERS | |
| 306 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 307 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 308 | Visual Impairment | FAERS: 1 | US FAERS | |
| 309 | Wheelchair user | FAERS: 1 | US FAERS | |
| 310 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 311 | furuncle | FAERS: 1 | US FAERS | |
| 312 | nervous system disorder | FAERS: 1 | US FAERS | |
| 313 | pseudomembranous colitis | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.