2-[(E)-[1-(2-Amino-1,3-thiazol-4-yl)-2-[[(2S,3S)-2-methyl-4-oxo-1-sulfoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid;(2S)-2,6-diaminohexanoic acid
(KPPBAEVZLDHCOK-LUCHLUFKSA-N)
Structure
- SMILES
- C[C@H]1[C@H](NC(=O)/C(=N/OC(C(=O)O)(C)C)/c2csc(n2)N)C(=O)N1S(=O)(=O)O.NCCCC[C@@H](C(=O)O)N
- Molecular Formula:
- C19H31N7O10S2
- Molecular Weight:
- 581.620
- Log P:
- 1.7462
- Hydrogen Bond Acceptor:
- 18
- Hydrogen Bond Donor:
- 7
- TPSA:
- 327.54
- CAS Number(s):
- N/A
Synonym(s)
1.
2-[(E)-[1-(2-Amino-1,3-thiazol-4-yl)-2-[[(2S,3S)-2-methyl-4-oxo-1-sulfoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid;(2S)-2,6-diaminohexanoic acid
External Link(s)
| PubChem Compound | 139033238 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Cystic Fibrosis | FAERS: 897 Canada Vigilance: 21 | Canada Vigilance US FAERS | |
| 2 | Pneumonia | FAERS: 296 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 3 | Infection | FAERS: 204 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 4 | Infective pulmonary exacerbation of cystic fibrosis | FAERS: 171 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 5 | Cystic fibrosis respiratory infection suppression | FAERS: 164 | US FAERS | |
| 6 | Malaise | FAERS: 156 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 7 | Pulmonary function test decreased | FAERS: 100 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 8 | Influenza | FAERS: 85 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 9 | Respiratory Failure | FAERS: 71 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 10 | Pneumothorax | FAERS: 49 | US FAERS | |
| 11 | Unevaluable event | FAERS: 46 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 12 | Drug dose omission | FAERS: 45 | US FAERS | |
| 13 | Nasopharyngitis | FAERS: 30 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 14 | Sinus operation | FAERS: 28 | US FAERS | |
| 15 | Drug ineffective | FAERS: 27 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 16 | Weight decreased | FAERS: 23 | US FAERS | |
| 17 | Intentional dose omission | FAERS: 22 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 18 | Transplant | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 19 | Antibiotic therapy | FAERS: 20 | US FAERS | |
| 20 | Intestinal Obstruction | FAERS: 20 | US FAERS | |
| 21 | Bronchiectasis | FAERS: 19 | US FAERS | |
| 22 | Transplant evaluation | FAERS: 19 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 23 | Dehydration | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 24 | Pancreatitis | FAERS: 14 | US FAERS | |
| 25 | Intentional product use issue | FAERS: 13 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 26 | Nephrolithiasis | FAERS: 13 | US FAERS | |
| 27 | Rhinovirus infection | FAERS: 13 | US FAERS | |
| 28 | Bronchitis | FAERS: 12 | US FAERS | |
| 29 | Product use issue | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 30 | Sepsis | FAERS: 12 | US FAERS | |
| 31 | Asthma | FAERS: 11 | US FAERS | |
| 32 | Lower respiratory tract infection bacterial | FAERS: 11 | US FAERS | |
| 33 | Product dose omission | FAERS: 11 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 34 | Sinusitis | FAERS: 11 | US FAERS | |
| 35 | Chest Pain | FAERS: 10 | US FAERS | |
| 36 | Maternal exposure during pregnancy | FAERS: 10 | US FAERS | |
| 37 | General physical health deterioration | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 38 | Hypersensitivity | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 39 | Lung transplant rejection | FAERS: 9 | US FAERS | |
| 40 | Mechanical ventilation | FAERS: 9 | US FAERS | |
| 41 | Vomiting | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 42 | Wheezing | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 43 | Acute respiratory failure | FAERS: 8 | US FAERS | |
| 44 | Chest discomfort | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 45 | Choking | FAERS: 8 | US FAERS | |
| 46 | Clostridium difficile infection | FAERS: 8 | US FAERS | |
| 47 | Nausea | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 48 | Pain | FAERS: 8 | US FAERS | |
| 49 | Thrombosis | FAERS: 8 | US FAERS | |
| 50 | Catheter placement | FAERS: 7 | US FAERS | |
| 51 | Constipation | FAERS: 7 | US FAERS | |
| 52 | Device related infection | FAERS: 7 | US FAERS | |
| 53 | Dysphonia | FAERS: 7 | US FAERS | |
| 54 | Gastrostomy | FAERS: 7 | US FAERS | |
| 55 | Headache | FAERS: 7 | US FAERS | |
| 56 | Infective exacerbation of bronchiectasis | FAERS: 7 | US FAERS | |
| 57 | Oropharyngeal pain | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 58 | Productive Cough | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 59 | Drug resistance | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 60 | Intentional product misuse | FAERS: 6 | US FAERS | |
| 61 | Septic Shock | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 62 | Bronchoscopy | FAERS: 5 | US FAERS | |
| 63 | Fatigue | FAERS: 5 | US FAERS | |
| 64 | Feeling abnormal | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 65 | Inappropriate schedule of drug administration | FAERS: 5 | US FAERS | |
| 66 | Lower respiratory tract infection | FAERS: 5 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 67 | Lung infection pseudomonal | FAERS: 5 | US FAERS | |
| 68 | Retching | FAERS: 5 | US FAERS | |
| 69 | Abdominal Pain | FAERS: 4 | US FAERS | |
| 70 | Asthenia | FAERS: 4 | US FAERS | |
| 71 | Atrial Fibrillation | FAERS: 4 | US FAERS | |
| 72 | Bronchial secretion retention | FAERS: 4 | US FAERS | |
| 73 | Bronchospasm | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 74 | Burkholderia cepacia complex infection | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 75 | Cystic fibrosis related diabetes | FAERS: 4 | US FAERS | |
| 76 | Diabetes Mellitus | FAERS: 4 | US FAERS | |
| 77 | Dizziness | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 78 | Memory impairment | FAERS: 4 | US FAERS | |
| 79 | Myalgia | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 80 | Post procedural complication | FAERS: 4 | US FAERS | |
| 81 | Product package associated injury | FAERS: 4 | US FAERS | |
| 82 | Secretion discharge | FAERS: 4 | US FAERS | |
| 83 | Therapy cessation | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 84 | Throat irritation | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 85 | Urinary tract infection | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 86 | Viral upper respiratory tract infection | FAERS: 4 | US FAERS | |
| 87 | Acute kidney injury | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 88 | Blood glucose increased | FAERS: 3 | US FAERS | |
| 89 | Chills | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 90 | Depressed mood | FAERS: 3 | US FAERS | |
| 91 | Disease Progression | FAERS: 3 | US FAERS | |
| 92 | Disease complication | FAERS: 3 | US FAERS | |
| 93 | Diverticulitis | FAERS: 3 | US FAERS | |
| 94 | Drug administered in wrong device | FAERS: 3 | US FAERS | |
| 95 | Dyspepsia | FAERS: 3 | US FAERS | |
| 96 | Escherichia infection | FAERS: 3 | US FAERS | |
| 97 | Flatulence | FAERS: 3 | US FAERS | |
| 98 | Frustration | FAERS: 3 | US FAERS | |
| 99 | Gastric infection | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 100 | Hypoxia | FAERS: 3 | US FAERS | |
| 101 | Inflammation | FAERS: 3 | US FAERS | |
| 102 | Lymphoma | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 103 | Malnutrition | FAERS: 3 | US FAERS | |
| 104 | Myocardial Infarction | FAERS: 3 | US FAERS | |
| 105 | Oxygen saturation abnormal | FAERS: 3 | US FAERS | |
| 106 | Pleurisy | FAERS: 3 | US FAERS | |
| 107 | Pneumonitis | FAERS: 3 | US FAERS | |
| 108 | Product container issue | FAERS: 3 | US FAERS | |
| 109 | Pulmonary Embolism | FAERS: 3 | US FAERS | |
| 110 | Pulmonary congestion | FAERS: 3 | US FAERS | |
| 111 | Rales | FAERS: 3 | US FAERS | |
| 112 | Respiratory distress | FAERS: 3 | US FAERS | |
| 113 | Transplantation complication | FAERS: 3 | US FAERS | |
| 114 | Vascular device infection | FAERS: 3 | US FAERS | |
| 115 | colonoscopy | FAERS: 3 | US FAERS | |
| 116 | Abdominal discomfort | FAERS: 2 | US FAERS | |
| 117 | Abscess | FAERS: 2 | US FAERS | |
| 118 | Arthralgia | FAERS: 2 | US FAERS | |
| 119 | Atypical pneumonia | FAERS: 2 | US FAERS | |
| 120 | Back Pain | FAERS: 2 | US FAERS | |
| 121 | Bacterial disease carrier | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 122 | Bacterial test positive | FAERS: 2 | US FAERS | |
| 123 | Blindness | FAERS: 2 | US FAERS | |
| 124 | Blood count abnormal | FAERS: 2 | US FAERS | |
| 125 | Blood sodium decreased | FAERS: 2 | US FAERS | |
| 126 | Brain Abscess | FAERS: 2 | US FAERS | |
| 127 | Bronchopleural Fistula | FAERS: 2 | US FAERS | |
| 128 | Bronchopulmonary Aspergillosis | FAERS: 2 | US FAERS | |
| 129 | Carbon dioxide increased | FAERS: 2 | US FAERS | |
| 130 | Cardiac Arrest | FAERS: 2 | US FAERS | |
| 131 | Cerebral disorder | FAERS: 2 | US FAERS | |
| 132 | Chemotherapy | FAERS: 2 | US FAERS | |
| 133 | Chromaturia | FAERS: 2 | US FAERS | |
| 134 | Chronic respiratory failure | FAERS: 2 | US FAERS | |
| 135 | Dementia | FAERS: 2 | US FAERS | |
| 136 | Diabetes mellitus inadequate control | FAERS: 2 | US FAERS | |
| 137 | Embolism | FAERS: 2 | US FAERS | |
| 138 | Forced expiratory volume abnormal | FAERS: 2 | US FAERS | |
| 139 | Gastrointestinal infection | FAERS: 2 | US FAERS | |
| 140 | Gastrointestinal obstruction | FAERS: 2 | US FAERS | |
| 141 | General physical condition abnormal | FAERS: 2 | US FAERS | |
| 142 | Hepatitis C | FAERS: 2 | US FAERS | |
| 143 | Hernia | FAERS: 2 | US FAERS | |
| 144 | Lethargy | FAERS: 2 | US FAERS | |
| 145 | Liquid product physical issue | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 146 | Lower respiratory tract inflammation | FAERS: 2 | US FAERS | |
| 147 | Muscle strain | FAERS: 2 | US FAERS | |
| 148 | Musculoskeletal chest pain | FAERS: 2 | US FAERS | |
| 149 | Nasal Polyps | FAERS: 2 | US FAERS | |
| 150 | Obstruction | FAERS: 2 | US FAERS | |
| 151 | Oropharyngeal discomfort | FAERS: 2 | US FAERS | |
| 152 | Pathogen resistance | FAERS: 2 | US FAERS | |
| 153 | Respiratory Therapy | FAERS: 2 | US FAERS | |
| 154 | Respiratory arrest | FAERS: 2 | US FAERS | |
| 155 | Respiratory fume inhalation disorder | FAERS: 2 | US FAERS | |
| 156 | Skin lesion | FAERS: 2 | US FAERS | |
| 157 | Stenotrophomonas infection | FAERS: 2 | US FAERS | |
| 158 | Superinfection bacterial | FAERS: 2 | US FAERS | |
| 159 | Swelling | FAERS: 2 | US FAERS | |
| 160 | Tachycardia | FAERS: 2 | US FAERS | |
| 161 | Accidental underdose | FAERS: 1 | US FAERS | |
| 162 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 163 | Acute sinusitis | FAERS: 1 | US FAERS | |
| 164 | Administration site irritation | FAERS: 1 | US FAERS | |
| 165 | Agranulocytosis | FAERS: 1 | US FAERS | |
| 166 | Alcohol withdrawal syndrome | FAERS: 1 | US FAERS | |
| 167 | Alopecia | FAERS: 1 | US FAERS | |
| 168 | Anal abscess | FAERS: 1 | US FAERS | |
| 169 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 170 | Aneurysm | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 171 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 172 | Anuria | FAERS: 1 | US FAERS | |
| 173 | Anxiety | FAERS: 1 | US FAERS | |
| 174 | Appendicitis | FAERS: 1 | US FAERS | |
| 175 | Atelectasis | FAERS: 1 | US FAERS | |
| 176 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 177 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 178 | Blood iron decreased | FAERS: 1 | US FAERS | |
| 179 | Blood potassium abnormal | FAERS: 1 | US FAERS | |
| 180 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 181 | Blood sodium abnormal | FAERS: 1 | US FAERS | |
| 182 | Bronchial Obstruction | FAERS: 1 | US FAERS | |
| 183 | Bronchial polyp | FAERS: 1 | US FAERS | |
| 184 | Bronchiolitis | FAERS: 1 | US FAERS | |
| 185 | Bronchoalveolar Lavage | FAERS: 1 | US FAERS | |
| 186 | Bronchopneumonia | FAERS: 1 | US FAERS | |
| 187 | Carbon dioxide abnormal | FAERS: 1 | US FAERS | |
| 188 | Cataract | FAERS: 1 | US FAERS | |
| 189 | Catheter management | FAERS: 1 | US FAERS | |
| 190 | Cellulitis | FAERS: 1 | US FAERS | |
| 191 | Cerebral Palsy | FAERS: 1 | US FAERS | |
| 192 | Cerebral cyst | FAERS: 1 | US FAERS | |
| 193 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 194 | Cholecystitis | FAERS: 1 | US FAERS | |
| 195 | Chronic sinusitis | FAERS: 1 | US FAERS | |
| 196 | Colitis | FAERS: 1 | US FAERS | |
| 197 | Completed Suicide | FAERS: 1 | US FAERS | |
| 198 | Complication associated with device | FAERS: 1 | US FAERS | |
| 199 | Cranial operation | FAERS: 1 | US FAERS | |
| 200 | Critical Illness | FAERS: 1 | US FAERS | |
| 201 | Crossmatch incompatible | FAERS: 1 | US FAERS | |
| 202 | Culture positive | FAERS: 1 | US FAERS | |
| 203 | Cystic fibrosis hepatic disease | FAERS: 1 | US FAERS | |
| 204 | Diabetic Ketoacidosis | FAERS: 1 | US FAERS | |
| 205 | Dialysis related complication | FAERS: 1 | US FAERS | |
| 206 | Disability | FAERS: 1 | US FAERS | |
| 207 | Drug abuse | FAERS: 1 | US FAERS | |
| 208 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 209 | Drug withdrawal syndrome | FAERS: 1 | US FAERS | |
| 210 | Dry skin | FAERS: 1 | US FAERS | |
| 211 | Dysarthria | FAERS: 1 | US FAERS | |
| 212 | Dysgeusia | FAERS: 1 | US FAERS | |
| 213 | Emotional disorder | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 214 | Enterovirus test positive | FAERS: 1 | US FAERS | |
| 215 | Epistaxis | FAERS: 1 | US FAERS | |
| 216 | Exsanguination | FAERS: 1 | US FAERS | |
| 217 | Feeding tube complication | FAERS: 1 | US FAERS | |
| 218 | Feeding tube user | FAERS: 1 | US FAERS | |
| 219 | Food Poisoning | FAERS: 1 | US FAERS | |
| 220 | Foreign body in respiratory tract | FAERS: 1 | US FAERS | |
| 221 | Fracture treatment | FAERS: 1 | US FAERS | |
| 222 | Gastrointestinal bacterial infection | FAERS: 1 | US FAERS | |
| 223 | Gastrointestinal bacterial overgrowth | FAERS: 1 | US FAERS | |
| 224 | Head discomfort | FAERS: 1 | US FAERS | |
| 225 | Heat Exhaustion | FAERS: 1 | US FAERS | |
| 226 | Hepatitis | FAERS: 1 | US FAERS | |
| 227 | Hypersomnia | FAERS: 1 | US FAERS | |
| 228 | Hypertrophic Cardiomyopathy | FAERS: 1 | US FAERS | |
| 229 | Hypophagia | FAERS: 1 | US FAERS | |
| 230 | Hypotension | FAERS: 1 | US FAERS | |
| 231 | Hysterectomy | FAERS: 1 | US FAERS | |
| 232 | Incoherent | FAERS: 1 | US FAERS | |
| 233 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 234 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 235 | Incorrect route of product administration | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 236 | Infection reactivation | FAERS: 1 | US FAERS | |
| 237 | Infectious Mononucleosis | FAERS: 1 | US FAERS | |
| 238 | Infectious colitis | FAERS: 1 | US FAERS | |
| 239 | Infusion site bruising | FAERS: 1 | US FAERS | |
| 240 | Infusion site pain | FAERS: 1 | US FAERS | |
| 241 | Infusion site swelling | FAERS: 1 | US FAERS | |
| 242 | Intestinal Perforation | FAERS: 1 | US FAERS | |
| 243 | Intestinal scarring | FAERS: 1 | US FAERS | |
| 244 | Intracranial Aneurysm | FAERS: 1 | US FAERS | |
| 245 | Intussusception | FAERS: 1 | US FAERS | |
| 246 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 247 | Large intestine perforation | FAERS: 1 | US FAERS | |
| 248 | Laryngitis | FAERS: 1 | US FAERS | |
| 249 | Liver transplant rejection | FAERS: 1 | US FAERS | |
| 250 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 251 | Lower respiratory tract congestion | FAERS: 1 | US FAERS | |
| 252 | Lower respiratory tract infection viral | FAERS: 1 | US FAERS | |
| 253 | Lung perforation | FAERS: 1 | US FAERS | |
| 254 | Lymphadenopathy | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 255 | Maternal exposure before pregnancy | FAERS: 1 | US FAERS | |
| 256 | Medical induction of coma | FAERS: 1 | US FAERS | |
| 257 | Mental status changes | FAERS: 1 | US FAERS | |
| 258 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 259 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 260 | Mycobacterium abscessus Infection | FAERS: 1 | US FAERS | |
| 261 | Mycobacterium test | FAERS: 1 | US FAERS | |
| 262 | Neck Pain | FAERS: 1 | US FAERS | |
| 263 | No adverse event | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 264 | Osteoporosis | FAERS: 1 | US FAERS | |
| 265 | Overdose | FAERS: 1 | US FAERS | |
| 266 | Pancreatic Insufficiency | FAERS: 1 | US FAERS | |
| 267 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 268 | Pericarditis | FAERS: 1 | US FAERS | |
| 269 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 270 | Pharyngitis | FAERS: 1 | US FAERS | |
| 271 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 272 | Posterior reversible encephalopathy syndrome | FAERS: 1 | US FAERS | |
| 273 | Primary Ciliary Dyskinesia | FAERS: 1 | US FAERS | |
| 274 | Product administration error | FAERS: 1 | US FAERS | |
| 275 | Product closure removal difficult | FAERS: 1 | US FAERS | |
| 276 | Product complaint | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 277 | Product container seal issue | FAERS: 1 | US FAERS | |
| 278 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 279 | Pseudomonal sepsis | FAERS: 1 | US FAERS | |
| 280 | Pseudomonas test positive | FAERS: 1 | US FAERS | |
| 281 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 282 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 283 | Pulmonary artery occlusion | FAERS: 1 | US FAERS | |
| 284 | Pulmonary function test increased | FAERS: 1 | US FAERS | |
| 285 | Pulmonary sepsis | FAERS: 1 | US FAERS | |
| 286 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 287 | Pulmonary vascular disorder | FAERS: 1 | US FAERS | |
| 288 | Purulent discharge | FAERS: 1 | US FAERS | |
| 289 | Regurgitation | FAERS: 1 | US FAERS | |
| 290 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 291 | Respiratory tract infection bacterial | FAERS: 1 | US FAERS | |
| 292 | Respiratory tract irritation | FAERS: 1 | US FAERS | |
| 293 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 294 | Rhinitis | FAERS: 1 | US FAERS | |
| 295 | Single functional kidney | FAERS: 1 | US FAERS | |
| 296 | Sinus polyp | FAERS: 1 | US FAERS | |
| 297 | Sjogren's Syndrome | FAERS: 1 | US FAERS | |
| 298 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 299 | Spinal support | FAERS: 1 | US FAERS | |
| 300 | Splenomegaly | FAERS: 1 | US FAERS | |
| 301 | Sputum retention | FAERS: 1 | US FAERS | |
| 302 | Stress | FAERS: 1 | US FAERS | |
| 303 | Suicide attempt | FAERS: 1 | US FAERS | |
| 304 | Superinfection viral | FAERS: 1 | US FAERS | |
| 305 | Surgical vascular shunt | FAERS: 1 | US FAERS | |
| 306 | Sweat test abnormal | FAERS: 1 | US FAERS | |
| 307 | Syncope | FAERS: 1 | US FAERS | |
| 308 | Terminal state | FAERS: 1 | US FAERS | |
| 309 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 310 | Therapy change | FAERS: 1 | US FAERS | |
| 311 | Thrombosis in device | FAERS: 1 | US FAERS | |
| 312 | Thyroidectomy | FAERS: 1 | US FAERS | |
| 313 | Tracheitis | FAERS: 1 | US FAERS | |
| 314 | Tracheostomy infection | FAERS: 1 | US FAERS | |
| 315 | Tracheostomy malfunction | FAERS: 1 | US FAERS | |
| 316 | Tremor | FAERS: 1 | US FAERS | |
| 317 | Ulcer | FAERS: 1 | US FAERS | |
| 318 | Underweight | FAERS: 1 | US FAERS | |
| 319 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 320 | Urticaria | FAERS: 1 | US FAERS | |
| 321 | Vasculitis | FAERS: 1 | US FAERS | |
| 322 | Viral test positive | FAERS: 1 | US FAERS | |
| 323 | Wheelchair user | FAERS: 1 | US FAERS | |
| 324 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 325 | jaundice | FAERS: 1 | US FAERS | |
| 326 | treatment failure | FAERS: 1 | US FAERS | |
| 327 | Frustration tolerance decreased | Canada Vigilance: 1 | Canada Vigilance | |
| 328 | Portal Hypertension | Canada Vigilance: 1 | Canada Vigilance | |
| 329 | Product storage error | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120329
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.