CH5424802
(KDGFLJKFZUIJMX-UHFFFAOYSA-N)
Structure
- SMILES
- CCc1cc2C(=O)c3c4ccc(cc4[nH]c3C(c2cc1N1CCC(CC1)N1CCOCC1)(C)C)C#N
- Type(s)
- Approved; Investigational
- ATC code(s)
- L01XE36
- Molecular Formula:
- C30H34N4O2
- Molecular Weight:
- 482.617
- Log P:
- 4.7762
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 1
- TPSA:
- 72.36
- CAS Number(s):
- 1256580-46-7
Synonym(s)
1.
CH5424802
2.
RO5424802
3.
alectinib
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Fatigue | FAERS: 68 | US FAERS | |
| 2 | Constipation | FAERS: 57 | US FAERS | |
| 3 | No adverse event | FAERS: 43 | US FAERS | |
| 4 | Myalgia | FAERS: 30 | US FAERS | |
| 5 | Pneumonia | FAERS: 25 | US FAERS | |
| 6 | Drug ineffective | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 7 | Intentional product use issue | FAERS: 21 | US FAERS | |
| 8 | Peripheral swelling | FAERS: 21 | US FAERS | |
| 9 | Arthralgia | FAERS: 15 | US FAERS | |
| 10 | Asthenia | FAERS: 15 | US FAERS | |
| 11 | Bradycardia | FAERS: 15 | US FAERS | |
| 12 | Pain | FAERS: 14 | US FAERS | |
| 13 | Disease Progression | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 14 | Blood creatine phosphokinase increased | FAERS: 10 | US FAERS | |
| 15 | Nausea | FAERS: 10 | US FAERS | |
| 16 | Pneumonitis | FAERS: 10 | US FAERS | |
| 17 | Headache | FAERS: 9 | US FAERS | |
| 18 | Pericardial effusion | FAERS: 9 | US FAERS | |
| 19 | Product storage error | FAERS: 9 | US FAERS | |
| 20 | Alopecia | FAERS: 8 | US FAERS | |
| 21 | Blood creatinine increased | FAERS: 8 | US FAERS | |
| 22 | Bone pain | FAERS: 7 | US FAERS | |
| 23 | Dizziness | FAERS: 7 | US FAERS | |
| 24 | Dysgeusia | FAERS: 7 | US FAERS | |
| 25 | Pruritus | FAERS: 7 | US FAERS | |
| 26 | Visual Impairment | FAERS: 7 | US FAERS | |
| 27 | Back Pain | FAERS: 6 | US FAERS | |
| 28 | Drug dispensing error | FAERS: 6 | US FAERS | |
| 29 | Fracture | FAERS: 6 | US FAERS | |
| 30 | Intestinal Obstruction | FAERS: 6 | US FAERS | |
| 31 | Joint swelling | FAERS: 6 | US FAERS | |
| 32 | Swelling | FAERS: 6 | US FAERS | |
| 33 | Erythema | FAERS: 5 | US FAERS | |
| 34 | Intercepted product storage error | FAERS: 5 | US FAERS | |
| 35 | Memory impairment | FAERS: 5 | US FAERS | |
| 36 | Transaminases increased | FAERS: 5 | US FAERS | |
| 37 | Vomiting | FAERS: 5 | US FAERS | |
| 38 | Blood glucose increased | FAERS: 4 | US FAERS | |
| 39 | Cerebrovascular accident | FAERS: 4 | US FAERS | |
| 40 | Chest Pain | FAERS: 4 | US FAERS | |
| 41 | Drug dose omission | FAERS: 4 | US FAERS | |
| 42 | Dry skin | FAERS: 4 | US FAERS | |
| 43 | Hypotension | FAERS: 4 | US FAERS | |
| 44 | Influenza | FAERS: 4 | US FAERS | |
| 45 | Ocular icterus | FAERS: 4 | US FAERS | |
| 46 | Pulmonary Embolism | FAERS: 4 | US FAERS | |
| 47 | Therapy cessation | FAERS: 4 | US FAERS | |
| 48 | Thrombosis | FAERS: 4 | US FAERS | |
| 49 | Urticaria | FAERS: 4 | US FAERS | |
| 50 | Abdominal Pain | FAERS: 3 | US FAERS | |
| 51 | Abdominal discomfort | FAERS: 3 | US FAERS | |
| 52 | Amnesia | FAERS: 3 | US FAERS | |
| 53 | Arthritis | FAERS: 3 | US FAERS | |
| 54 | Blood lactate dehydrogenase increased | FAERS: 3 | US FAERS | |
| 55 | Cardiac Tamponade | FAERS: 3 | US FAERS | |
| 56 | Chromaturia | FAERS: 3 | US FAERS | |
| 57 | Circumstance or information capable of leading to medication error | FAERS: 3 | US FAERS | |
| 58 | Epilepsy | FAERS: 3 | US FAERS | |
| 59 | Hepatitis | FAERS: 3 | US FAERS | |
| 60 | Hypoxia | FAERS: 3 | US FAERS | |
| 61 | Incorrect dose administered | FAERS: 3 | US FAERS | |
| 62 | Intercepted medication error | FAERS: 3 | US FAERS | |
| 63 | Lethargy | FAERS: 3 | US FAERS | |
| 64 | Malaise | FAERS: 3 | US FAERS | |
| 65 | Musculoskeletal Pain | FAERS: 3 | US FAERS | |
| 66 | Pregnancy | FAERS: 3 | US FAERS | |
| 67 | Tachycardia | FAERS: 3 | US FAERS | |
| 68 | Therapy non-responder | FAERS: 3 | US FAERS | |
| 69 | Wrong technique in product usage process | FAERS: 3 | US FAERS | |
| 70 | jaundice | FAERS: 3 | US FAERS | |
| 71 | Anxiety | FAERS: 2 | US FAERS | |
| 72 | Appendicitis | FAERS: 2 | US FAERS | |
| 73 | Aspartate Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 74 | Atrial Fibrillation | FAERS: 2 | US FAERS | |
| 75 | Atrioventricular Block | FAERS: 2 | US FAERS | |
| 76 | Bilirubin conjugated increased | FAERS: 2 | US FAERS | |
| 77 | Blood alkaline phosphatase increased | FAERS: 2 | US FAERS | |
| 78 | Blood bilirubin unconjugated increased | FAERS: 2 | US FAERS | |
| 79 | Chills | FAERS: 2 | US FAERS | |
| 80 | Deafness | FAERS: 2 | US FAERS | |
| 81 | Depressed Level of Consciousness | FAERS: 2 | US FAERS | |
| 82 | Disorientation | FAERS: 2 | US FAERS | |
| 83 | Dysgraphia | FAERS: 2 | US FAERS | |
| 84 | Emotional disorder | FAERS: 2 | US FAERS | |
| 85 | Extra dose administered | FAERS: 2 | US FAERS | |
| 86 | Hepatotoxicity | FAERS: 2 | US FAERS | |
| 87 | Incorrect product storage | FAERS: 2 | US FAERS | |
| 88 | Increased tendency to bruise | FAERS: 2 | US FAERS | |
| 89 | Infection | FAERS: 2 | US FAERS | |
| 90 | Intentional product misuse | FAERS: 2 | US FAERS | |
| 91 | Metastatic Neoplasm | FAERS: 2 | US FAERS | |
| 92 | Muscle Fatigue | FAERS: 2 | US FAERS | |
| 93 | Myocardial Infarction | FAERS: 2 | US FAERS | |
| 94 | Myopathy | FAERS: 2 | US FAERS | |
| 95 | Myositis | FAERS: 2 | US FAERS | |
| 96 | Nasopharyngitis | FAERS: 2 | US FAERS | |
| 97 | Necrosis | FAERS: 2 | US FAERS | |
| 98 | Palpitations | FAERS: 2 | US FAERS | |
| 99 | Product dose omission | FAERS: 2 | US FAERS | |
| 100 | Product packaging quantity issue | FAERS: 2 | US FAERS | |
| 101 | Productive Cough | FAERS: 2 | US FAERS | |
| 102 | Respiratory Failure | FAERS: 2 | US FAERS | |
| 103 | Sepsis | FAERS: 2 | US FAERS | |
| 104 | Throat irritation | FAERS: 2 | US FAERS | |
| 105 | Tinnitus | FAERS: 2 | US FAERS | |
| 106 | Urinary tract infection | FAERS: 2 | US FAERS | |
| 107 | Weight decreased | FAERS: 2 | US FAERS | |
| 108 | White blood cell count decreased | FAERS: 2 | US FAERS | |
| 109 | Abasia | FAERS: 1 | US FAERS | |
| 110 | Abscess of eyelid | FAERS: 1 | US FAERS | |
| 111 | Accidental overdose | FAERS: 1 | US FAERS | |
| 112 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 113 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 114 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 115 | Anger | FAERS: 1 | US FAERS | |
| 116 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 117 | Aphasia | FAERS: 1 | US FAERS | |
| 118 | Ascites | FAERS: 1 | US FAERS | |
| 119 | Asthma | FAERS: 1 | US FAERS | |
| 120 | Atelectasis | FAERS: 1 | US FAERS | |
| 121 | Blindness | FAERS: 1 | US FAERS | |
| 122 | Blood count abnormal | FAERS: 1 | US FAERS | |
| 123 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 124 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 125 | Bone lesion | FAERS: 1 | US FAERS | |
| 126 | Brain natriuretic peptide increased | FAERS: 1 | US FAERS | |
| 127 | Burning sensation | FAERS: 1 | US FAERS | |
| 128 | Carcinoembryonic antigen increased | FAERS: 1 | US FAERS | |
| 129 | Cellulitis | FAERS: 1 | US FAERS | |
| 130 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 131 | Chest discomfort | FAERS: 1 | US FAERS | |
| 132 | Choking | FAERS: 1 | US FAERS | |
| 133 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 134 | Coccidioidomycosis | FAERS: 1 | US FAERS | |
| 135 | Colitis | FAERS: 1 | US FAERS | |
| 136 | Contraindicated product administered | FAERS: 1 | US FAERS | |
| 137 | Craniotomy | FAERS: 1 | US FAERS | |
| 138 | Cystitis | FAERS: 1 | US FAERS | |
| 139 | Cytomegalovirus enterocolitis | FAERS: 1 | US FAERS | |
| 140 | Cytopenia | FAERS: 1 | US FAERS | |
| 141 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 142 | Dehydration | FAERS: 1 | US FAERS | |
| 143 | Dementia | FAERS: 1 | US FAERS | |
| 144 | Device related infection | FAERS: 1 | US FAERS | |
| 145 | Disease recurrence | FAERS: 1 | US FAERS | |
| 146 | Diverticulitis | FAERS: 1 | US FAERS | |
| 147 | Dose calculation error | FAERS: 1 | US FAERS | |
| 148 | Drug administration error | FAERS: 1 | US FAERS | |
| 149 | Dyspepsia | FAERS: 1 | US FAERS | |
| 150 | Dysphonia | FAERS: 1 | US FAERS | |
| 151 | Dysuria | FAERS: 1 | US FAERS | |
| 152 | Emotional distress | FAERS: 1 | US FAERS | |
| 153 | Enterocolitis | FAERS: 1 | US FAERS | |
| 154 | Epistaxis | FAERS: 1 | US FAERS | |
| 155 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 156 | Exophthalmos | FAERS: 1 | US FAERS | |
| 157 | Eye Infection | FAERS: 1 | US FAERS | |
| 158 | False positive investigation result | FAERS: 1 | US FAERS | |
| 159 | Feeling Cold | FAERS: 1 | US FAERS | |
| 160 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 161 | Fibrin D dimer increased | FAERS: 1 | US FAERS | |
| 162 | Flatulence | FAERS: 1 | US FAERS | |
| 163 | Flushing | FAERS: 1 | US FAERS | |
| 164 | Foreign body in respiratory tract | FAERS: 1 | US FAERS | |
| 165 | Formication | FAERS: 1 | US FAERS | |
| 166 | Full blood count decreased | FAERS: 1 | US FAERS | |
| 167 | Gamma-Glutamyltransferase Increased | FAERS: 1 | US FAERS | |
| 168 | Gastric Dilatation | FAERS: 1 | US FAERS | |
| 169 | Glaucoma | FAERS: 1 | US FAERS | |
| 170 | Gout | FAERS: 1 | US FAERS | |
| 171 | Haptoglobin Decreased | FAERS: 1 | US FAERS | |
| 172 | Hemiparesis | FAERS: 1 | US FAERS | |
| 173 | Hepatic necrosis | FAERS: 1 | US FAERS | |
| 174 | Hip surgery | FAERS: 1 | US FAERS | |
| 175 | Hydronephrosis | FAERS: 1 | US FAERS | |
| 176 | Hydrothorax | FAERS: 1 | US FAERS | |
| 177 | Hypersensitivity | FAERS: 1 | US FAERS | |
| 178 | Hypersomnia | FAERS: 1 | US FAERS | |
| 179 | Hypertrichosis | FAERS: 1 | US FAERS | |
| 180 | Hypokinesia | FAERS: 1 | US FAERS | |
| 181 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 182 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 183 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 184 | Incorrect product formulation administered | FAERS: 1 | US FAERS | |
| 185 | Infrequent bowel movements | FAERS: 1 | US FAERS | |
| 186 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 187 | Intestinal Perforation | FAERS: 1 | US FAERS | |
| 188 | Iron deficiency | FAERS: 1 | US FAERS | |
| 189 | Large intestine perforation | FAERS: 1 | US FAERS | |
| 190 | Leukocytosis | FAERS: 1 | US FAERS | |
| 191 | Ligament pain | FAERS: 1 | US FAERS | |
| 192 | Lymphangiosis carcinomatosa | FAERS: 1 | US FAERS | |
| 193 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 194 | Malignant neoplasm of thymus | FAERS: 1 | US FAERS | |
| 195 | Medication Error | FAERS: 1 | US FAERS | |
| 196 | Meningitis | FAERS: 1 | US FAERS | |
| 197 | Mental impairment | FAERS: 1 | US FAERS | |
| 198 | Metastases to pelvis | FAERS: 1 | US FAERS | |
| 199 | Metastasis | FAERS: 1 | US FAERS | |
| 200 | Muscle tightness | FAERS: 1 | US FAERS | |
| 201 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 202 | Myocardial necrosis marker increased | FAERS: 1 | US FAERS | |
| 203 | Neck Pain | FAERS: 1 | US FAERS | |
| 204 | Nephritic syndrome | FAERS: 1 | US FAERS | |
| 205 | Nephrotic Syndrome | FAERS: 1 | US FAERS | |
| 206 | Neuritis | FAERS: 1 | US FAERS | |
| 207 | Neutropenia | FAERS: 1 | US FAERS | |
| 208 | Night sweats | FAERS: 1 | US FAERS | |
| 209 | Occupational exposure to product | FAERS: 1 | US FAERS | |
| 210 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 211 | Ovarian enlargement | FAERS: 1 | US FAERS | |
| 212 | Palindromic rheumatism | FAERS: 1 | US FAERS | |
| 213 | Pancreatitis | FAERS: 1 | US FAERS | |
| 214 | Pericarditis | FAERS: 1 | US FAERS | |
| 215 | Peripheral arterial occlusive disease | FAERS: 1 | US FAERS | |
| 216 | Peritonitis | FAERS: 1 | US FAERS | |
| 217 | Pertussis | FAERS: 1 | US FAERS | |
| 218 | Petechiae | FAERS: 1 | US FAERS | |
| 219 | Pneumoperitoneum | FAERS: 1 | US FAERS | |
| 220 | Polymyositis | FAERS: 1 | US FAERS | |
| 221 | Polyuria | FAERS: 1 | US FAERS | |
| 222 | Presyncope | FAERS: 1 | US FAERS | |
| 223 | Product container seal issue | FAERS: 1 | US FAERS | |
| 224 | Product preparation error | FAERS: 1 | US FAERS | |
| 225 | Product use complaint | FAERS: 1 | US FAERS | |
| 226 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 227 | Protein total decreased | FAERS: 1 | US FAERS | |
| 228 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 229 | Pulmonary toxicity | FAERS: 1 | US FAERS | |
| 230 | Radiation Pneumonitis | FAERS: 1 | US FAERS | |
| 231 | Reduced facial expression | FAERS: 1 | US FAERS | |
| 232 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 233 | Rhinalgia | FAERS: 1 | US FAERS | |
| 234 | Sciatica | FAERS: 1 | US FAERS | |
| 235 | Septic Shock | FAERS: 1 | US FAERS | |
| 236 | Sinusitis | FAERS: 1 | US FAERS | |
| 237 | Skin reaction | FAERS: 1 | US FAERS | |
| 238 | Slow speech | FAERS: 1 | US FAERS | |
| 239 | Somnolence | FAERS: 1 | US FAERS | |
| 240 | Stomatitis | FAERS: 1 | US FAERS | |
| 241 | Stress | FAERS: 1 | US FAERS | |
| 242 | Sudden death | FAERS: 1 | US FAERS | |
| 243 | Sunburn | FAERS: 1 | US FAERS | |
| 244 | Thermal burn | FAERS: 1 | US FAERS | |
| 245 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 246 | Ulcer | FAERS: 1 | US FAERS | |
| 247 | Unevaluable event | FAERS: 1 | US FAERS | |
| 248 | Uterine Cancer | FAERS: 1 | US FAERS | |
| 249 | Venous Thrombosis | FAERS: 1 | US FAERS | |
| 250 | Ventricular arrhythmia | FAERS: 1 | US FAERS | |
| 251 | Wheezing | FAERS: 1 | US FAERS | |
| 252 | Wrong dose | FAERS: 1 | US FAERS | |
| 253 | treatment failure | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120295
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.