rasagiline
(JDBJJCWRXSVHOQ-UTONKHPSSA-N)
Structure
- SMILES
- CS(=O)(=O)O.C#CCN[C@@H]1CCc2c1cccc2
- Molecular Formula:
- C13H17NO3S
- Molecular Weight:
- 267.344
- Log P:
- 2.8724
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 2
- TPSA:
- 74.78
- CAS Number(s):
- 161735-79-1
Synonym(s)
1.
rasagiline
2.
2,3-dihydro-N-2-propynyl-1H-inden-1-amine-(1R)-hydrochloride
3.
AGN 1135
4.
AGN-1135
5.
Azilect
6.
N-2-propynyl-1-indanamine
7.
N-propargyl-1-aminoindan mesylate
8.
TVP 101
9.
TVP 1022
10.
TVP-101
11.
TVP-1022
12.
TVP1022
13.
rasagiline hydrochloride
External Link(s)
| MeSH | C031967 |
| PubChem Compound | 3052775 |
| CHEMBL | CHEMBL1201142 |
| KEGG | dr:D02562 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 36 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 2 | Dizziness | FAERS: 33 | US FAERS | |
| 3 | Tremor | FAERS: 24 | US FAERS | |
| 4 | Headache | FAERS: 20 | US FAERS | |
| 5 | Pneumonia | FAERS: 17 | US FAERS | |
| 6 | Somnolence | FAERS: 17 | US FAERS | |
| 7 | Fatigue | FAERS: 16 | US FAERS | |
| 8 | Alopecia | FAERS: 15 | US FAERS | |
| 9 | Weight decreased | FAERS: 15 | US FAERS | |
| 10 | Myocardial Infarction | FAERS: 13 | US FAERS | |
| 11 | Anxiety | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 12 | Constipation | FAERS: 12 | US FAERS | |
| 13 | Malaise | FAERS: 12 | US FAERS | |
| 14 | Arthralgia | FAERS: 11 | US FAERS | |
| 15 | Feeling abnormal | FAERS: 11 | US FAERS | |
| 16 | Nausea | FAERS: 11 | US FAERS | |
| 17 | Musculoskeletal stiffness | FAERS: 8 | US FAERS | |
| 18 | Palpitations | FAERS: 8 | US FAERS | |
| 19 | Adverse event | FAERS: 7 | US FAERS | |
| 20 | Arthropathy | FAERS: 7 | US FAERS | |
| 21 | Asthenia | FAERS: 7 | US FAERS | |
| 22 | Atrial Fibrillation | FAERS: 7 | US FAERS | |
| 23 | Hypotension | FAERS: 7 | US FAERS | |
| 24 | Back Pain | FAERS: 6 | US FAERS | |
| 25 | Joint swelling | FAERS: 5 | US FAERS | |
| 26 | Psoriasis | FAERS: 5 | US FAERS | |
| 27 | Serotonin Syndrome | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 28 | Urinary tract infection | FAERS: 5 | US FAERS | |
| 29 | Blood urine present | FAERS: 4 | US FAERS | |
| 30 | Cerebrovascular accident | FAERS: 4 | US FAERS | |
| 31 | Nasopharyngitis | FAERS: 4 | US FAERS | |
| 32 | Neck Pain | FAERS: 4 | US FAERS | |
| 33 | Oropharyngeal pain | FAERS: 4 | US FAERS | |
| 34 | Pain | FAERS: 4 | US FAERS | |
| 35 | Syncope | FAERS: 4 | US FAERS | |
| 36 | Abasia | FAERS: 3 | US FAERS | |
| 37 | Anger | FAERS: 3 | US FAERS | |
| 38 | Cerebral Infarction | FAERS: 3 | US FAERS | |
| 39 | Dementia | FAERS: 3 | US FAERS | |
| 40 | Depressed mood | FAERS: 3 | US FAERS | |
| 41 | Dysgeusia | FAERS: 3 | US FAERS | |
| 42 | Fracture | FAERS: 3 | US FAERS | |
| 43 | Impaired self-care | FAERS: 3 | US FAERS | |
| 44 | Incorrect dose administered | FAERS: 3 | US FAERS | |
| 45 | Muscle Rigidity | FAERS: 3 | US FAERS | |
| 46 | Myalgia | FAERS: 3 | US FAERS | |
| 47 | Nervousness | FAERS: 3 | US FAERS | |
| 48 | Peripheral swelling | FAERS: 3 | US FAERS | |
| 49 | Renal pain | FAERS: 3 | US FAERS | |
| 50 | Sudden onset of sleep | FAERS: 3 | US FAERS | |
| 51 | Urticaria | FAERS: 3 | US FAERS | |
| 52 | Visual Impairment | FAERS: 3 | US FAERS | |
| 53 | Abdominal Pain | FAERS: 2 | US FAERS | |
| 54 | Abdominal discomfort | FAERS: 2 | US FAERS | |
| 55 | Accidental overdose | FAERS: 2 | US FAERS | |
| 56 | Angina Pectoris | FAERS: 2 | US FAERS | |
| 57 | Apathy | FAERS: 2 | US FAERS | |
| 58 | Aphasia | FAERS: 2 | US FAERS | |
| 59 | Aphonia | FAERS: 2 | US FAERS | |
| 60 | Back disorder | FAERS: 2 | US FAERS | |
| 61 | Blindness | FAERS: 2 | US FAERS | |
| 62 | Burning sensation | FAERS: 2 | US FAERS | |
| 63 | Cerebral hypoperfusion | FAERS: 2 | US FAERS | |
| 64 | Chest Pain | FAERS: 2 | US FAERS | |
| 65 | Chest discomfort | FAERS: 2 | US FAERS | |
| 66 | Cold sweat | FAERS: 2 | US FAERS | |
| 67 | Dental caries | FAERS: 2 | US FAERS | |
| 68 | Drug dose omission | FAERS: 2 | US FAERS | |
| 69 | Drug withdrawal syndrome | FAERS: 2 | US FAERS | |
| 70 | Dysarthria | FAERS: 2 | US FAERS | |
| 71 | Dyspepsia | FAERS: 2 | US FAERS | |
| 72 | Erectile dysfunction | FAERS: 2 | US FAERS | |
| 73 | Erythema | FAERS: 2 | US FAERS | |
| 74 | Flatulence | FAERS: 2 | US FAERS | |
| 75 | Gambling | FAERS: 2 | US FAERS | |
| 76 | Gout | FAERS: 2 | US FAERS | |
| 77 | Hypokinesia | FAERS: 2 | US FAERS | |
| 78 | Impaired driving ability | FAERS: 2 | US FAERS | |
| 79 | Inappropriate schedule of drug administration | FAERS: 2 | US FAERS | |
| 80 | Intestinal Obstruction | FAERS: 2 | US FAERS | |
| 81 | Lymphoma | FAERS: 2 | US FAERS | |
| 82 | Musculoskeletal Pain | FAERS: 2 | US FAERS | |
| 83 | Nephrolithiasis | FAERS: 2 | US FAERS | |
| 84 | Pallor | FAERS: 2 | US FAERS | |
| 85 | Photophobia | FAERS: 2 | US FAERS | |
| 86 | Product prescribing error | FAERS: 2 | US FAERS | |
| 87 | Pruritus | FAERS: 2 | US FAERS | |
| 88 | Respiratory Failure | FAERS: 2 | US FAERS | |
| 89 | Respiratory arrest | FAERS: 2 | US FAERS | |
| 90 | Restless Legs Syndrome | FAERS: 2 | US FAERS | |
| 91 | Vomiting | FAERS: 2 | US FAERS | |
| 92 | Abscess | FAERS: 1 | US FAERS | |
| 93 | Accidental drug intake by child | FAERS: 1 | US FAERS | |
| 94 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 95 | Agitation | FAERS: 1 | US FAERS | |
| 96 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 97 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 98 | Angioedema | FAERS: 1 | US FAERS | |
| 99 | Anorgasmia | FAERS: 1 | US FAERS | |
| 100 | Aphagia | FAERS: 1 | US FAERS | |
| 101 | Arteriosclerosis | FAERS: 1 | US FAERS | |
| 102 | Asterixis | FAERS: 1 | US FAERS | |
| 103 | Asthenopia | FAERS: 1 | US FAERS | |
| 104 | Bedridden | FAERS: 1 | US FAERS | |
| 105 | Blood antidiuretic hormone decreased | FAERS: 1 | US FAERS | |
| 106 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 107 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 108 | Blood testosterone decreased | FAERS: 1 | US FAERS | |
| 109 | Blood urea increased | FAERS: 1 | US FAERS | |
| 110 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 111 | Bronchopulmonary disease | FAERS: 1 | US FAERS | |
| 112 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 113 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 114 | Cheyne-Stokes Respiration | FAERS: 1 | US FAERS | |
| 115 | Chills | FAERS: 1 | US FAERS | |
| 116 | Choking | FAERS: 1 | US FAERS | |
| 117 | Completed Suicide | FAERS: 1 | US FAERS | |
| 118 | Cranial operation | FAERS: 1 | US FAERS | |
| 119 | Crying | FAERS: 1 | US FAERS | |
| 120 | Cytolytic hepatitis | FAERS: 1 | US FAERS | |
| 121 | Dehydration | FAERS: 1 | US FAERS | |
| 122 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 123 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 124 | Discomfort | FAERS: 1 | US FAERS | |
| 125 | Disease Progression | FAERS: 1 | US FAERS | |
| 126 | Disorientation | FAERS: 1 | US FAERS | |
| 127 | Diverticulum | FAERS: 1 | US FAERS | |
| 128 | Drug Dependence | FAERS: 1 | US FAERS | |
| 129 | Drug level increased | FAERS: 1 | US FAERS | |
| 130 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 131 | Dry skin | FAERS: 1 | US FAERS | |
| 132 | Dysgraphia | FAERS: 1 | US FAERS | |
| 133 | Dysphonia | FAERS: 1 | US FAERS | |
| 134 | Dystonia | FAERS: 1 | US FAERS | |
| 135 | Epistaxis | FAERS: 1 | US FAERS | |
| 136 | Eructation | FAERS: 1 | US FAERS | |
| 137 | Expired drug administered | FAERS: 1 | US FAERS | |
| 138 | Eye pain | FAERS: 1 | US FAERS | |
| 139 | Female Orgasmic Disorder | FAERS: 1 | US FAERS | |
| 140 | Flushing | FAERS: 1 | US FAERS | |
| 141 | Formication | FAERS: 1 | US FAERS | |
| 142 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 143 | Head discomfort | FAERS: 1 | US FAERS | |
| 144 | Heat Stroke | FAERS: 1 | US FAERS | |
| 145 | Hepatic Encephalopathy | FAERS: 1 | US FAERS | |
| 146 | Hunger | FAERS: 1 | US FAERS | |
| 147 | Hypersensitivity | FAERS: 1 | US FAERS | |
| 148 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 149 | Hypophagia | FAERS: 1 | US FAERS | |
| 150 | Idiopathic Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 151 | Inability to afford medication | FAERS: 1 | US FAERS | |
| 152 | Incontinence | FAERS: 1 | US FAERS | |
| 153 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 154 | Infarction | FAERS: 1 | US FAERS | |
| 155 | Infection | FAERS: 1 | US FAERS | |
| 156 | Influenza | FAERS: 1 | US FAERS | |
| 157 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 158 | Intervertebral disc disorder | FAERS: 1 | US FAERS | |
| 159 | Irregular sleep phase | FAERS: 1 | US FAERS | |
| 160 | Lacrimation decreased | FAERS: 1 | US FAERS | |
| 161 | Lethargy | FAERS: 1 | US FAERS | |
| 162 | Limb injury | FAERS: 1 | US FAERS | |
| 163 | Limb operation | FAERS: 1 | US FAERS | |
| 164 | Lip swelling | FAERS: 1 | US FAERS | |
| 165 | Malignant melanoma stage II | FAERS: 1 | US FAERS | |
| 166 | Menorrhagia | FAERS: 1 | US FAERS | |
| 167 | Mental impairment | FAERS: 1 | US FAERS | |
| 168 | Moaning | FAERS: 1 | US FAERS | |
| 169 | Neutropenia | FAERS: 1 | US FAERS | |
| 170 | Obsessive-Compulsive Disorder | FAERS: 1 | US FAERS | |
| 171 | Orthodontic procedure | FAERS: 1 | US FAERS | |
| 172 | Orthostatic intolerance | FAERS: 1 | US FAERS | |
| 173 | Overdose | FAERS: 1 | US FAERS | |
| 174 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 175 | Pancreatic enzymes increased | FAERS: 1 | US FAERS | |
| 176 | Paranoia | FAERS: 1 | US FAERS | |
| 177 | Parenteral Nutrition | FAERS: 1 | US FAERS | |
| 178 | Pemphigus | FAERS: 1 | US FAERS | |
| 179 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 180 | Polymyalgia Rheumatica | FAERS: 1 | US FAERS | |
| 181 | Polyuria | FAERS: 1 | US FAERS | |
| 182 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 183 | Post procedural infection | FAERS: 1 | US FAERS | |
| 184 | Postpericardiotomy Syndrome | FAERS: 1 | US FAERS | |
| 185 | Presyncope | FAERS: 1 | US FAERS | |
| 186 | Product quality issue | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 187 | Product substitution issue | FAERS: 1 | US FAERS | |
| 188 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 189 | Product use issue | FAERS: 1 | US FAERS | |
| 190 | Pupil dilation procedure | FAERS: 1 | US FAERS | |
| 191 | Rash erythematous | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 192 | Rhabdomyosarcoma | FAERS: 1 | US FAERS | |
| 193 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 194 | Septic Shock | FAERS: 1 | US FAERS | |
| 195 | Skin laceration | FAERS: 1 | US FAERS | |
| 196 | Skin lesion | FAERS: 1 | US FAERS | |
| 197 | Slow response to stimuli | FAERS: 1 | US FAERS | |
| 198 | Slow speech | FAERS: 1 | US FAERS | |
| 199 | Sneezing | FAERS: 1 | US FAERS | |
| 200 | Somnambulism | FAERS: 1 | US FAERS | |
| 201 | Squamous cell carcinoma of skin | FAERS: 1 | US FAERS | |
| 202 | Staring | FAERS: 1 | US FAERS | |
| 203 | Stomatitis | FAERS: 1 | US FAERS | |
| 204 | Stress | FAERS: 1 | US FAERS | |
| 205 | Sudden death | FAERS: 1 | US FAERS | |
| 206 | Swelling | FAERS: 1 | US FAERS | |
| 207 | Tachyarrhythmia | FAERS: 1 | US FAERS | |
| 208 | Tachycardia | FAERS: 1 | US FAERS | |
| 209 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 210 | Tension | FAERS: 1 | US FAERS | |
| 211 | Thermal burn | FAERS: 1 | US FAERS | |
| 212 | Tinnitus | FAERS: 1 | US FAERS | |
| 213 | Tooth Erosion | FAERS: 1 | US FAERS | |
| 214 | Tyramine reaction | FAERS: 1 | US FAERS | |
| 215 | Ulnar Nerve Palsy | FAERS: 1 | US FAERS | |
| 216 | Unevaluable event | FAERS: 1 | US FAERS | |
| 217 | Urinary Retention | FAERS: 1 | US FAERS | |
| 218 | Vasculitis | FAERS: 1 | US FAERS | |
| 219 | Vertigo | FAERS: 1 | US FAERS | |
| 220 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 221 | colonoscopy | FAERS: 1 | US FAERS | |
| 222 | liposarcoma | FAERS: 1 | US FAERS | |
| 223 | Delirium | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.