Fentanyl
(IVLVTNPOHDFFCJ-UHFFFAOYSA-N)
Structure
- SMILES
- OC(=O)C(CC(=O)O)(CC(=O)O)O.CCC(=O)N(c1ccccc1)C1CCN(CC1)CCc1ccccc1
- Molecular Formula:
- C28H36N2O8
- Molecular Weight:
- 528.594
- Log P:
- 2.8261
- Hydrogen Bond Acceptor:
- 10
- Hydrogen Bond Donor:
- 4
- TPSA:
- 155.68
- CAS Number(s):
- 990-73-8
Synonym(s)
1.
Fentanyl
2.
Phentanyl
3.
Duragesic
4.
Durogesic
5.
Fentanest
6.
Fentanyl Citrate
7.
Fentora
8.
R-4263
9.
Sublimaze
10.
Transmucosal Oral Fentanyl Citrate
11.
R 4263
12.
R4263
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Toxicity to various agents | FAERS: 597 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 2 | Accidental overdose | FAERS: 380 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 3 | Overdose | FAERS: 284 Canada Vigilance: 26 | Canada Vigilance US FAERS | |
| 4 | Drug abuse | FAERS: 188 Canada Vigilance: 12 | Canada Vigilance US FAERS | |
| 5 | Wrong technique in drug usage process | FAERS: 169 | US FAERS | |
| 6 | Accidental drug intake by child | FAERS: 149 | US FAERS | |
| 7 | Somnolence | FAERS: 143 | US FAERS | |
| 8 | Pain | FAERS: 140 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 9 | Drug ineffective | FAERS: 139 Canada Vigilance: 11 | Canada Vigilance US FAERS | |
| 10 | Product quality issue | FAERS: 117 | US FAERS | |
| 11 | Drug prescribing error | FAERS: 108 | US FAERS | |
| 12 | Vomiting | FAERS: 77 | US FAERS | |
| 13 | Respiratory arrest | FAERS: 74 | US FAERS | |
| 14 | Lethargy | FAERS: 62 | US FAERS | |
| 15 | Cardiac Arrest | FAERS: 57 | US FAERS | |
| 16 | Incorrect route of drug administration | FAERS: 57 | US FAERS | |
| 17 | Malaise | FAERS: 57 | US FAERS | |
| 18 | Nausea | FAERS: 57 | US FAERS | |
| 19 | Accidental exposure | FAERS: 54 | US FAERS | |
| 20 | Respiratory Depression | FAERS: 49 Canada Vigilance: 11 | Canada Vigilance US FAERS | |
| 21 | Inappropriate schedule of drug administration | FAERS: 43 | US FAERS | |
| 22 | Dental caries | FAERS: 42 | US FAERS | |
| 23 | Drug withdrawal syndrome | FAERS: 41 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 24 | Intentional drug misuse | FAERS: 40 | US FAERS | |
| 25 | Muscle Rigidity | FAERS: 40 | US FAERS | |
| 26 | Adverse event | FAERS: 38 | US FAERS | |
| 27 | Drug toxicity | FAERS: 37 | US FAERS | |
| 28 | Product adhesion issue | FAERS: 37 | US FAERS | |
| 29 | Drug Dependence | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 30 | Narcotic intoxication | FAERS: 35 | US FAERS | |
| 31 | Sedation complication | FAERS: 33 | US FAERS | |
| 32 | Depressed Level of Consciousness | FAERS: 32 Canada Vigilance: 12 | Canada Vigilance US FAERS | |
| 33 | Drug administration error | FAERS: 30 | US FAERS | |
| 34 | Tooth Loss | FAERS: 30 | US FAERS | |
| 35 | Inadequate analgesia | FAERS: 29 | US FAERS | |
| 36 | Coma scale abnormal | FAERS: 25 Canada Vigilance: 23 | Canada Vigilance US FAERS | |
| 37 | Drug administered at inappropriate site | FAERS: 24 | US FAERS | |
| 38 | Medication Error | FAERS: 24 | US FAERS | |
| 39 | Disease Progression | FAERS: 21 | US FAERS | |
| 40 | Incorrect dose administered | FAERS: 20 | US FAERS | |
| 41 | Malignant neoplasm progression | FAERS: 20 | US FAERS | |
| 42 | Pruritus | FAERS: 20 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 43 | Dizziness | FAERS: 19 | US FAERS | |
| 44 | Hypotension | FAERS: 19 | US FAERS | |
| 45 | Agitation | FAERS: 17 | US FAERS | |
| 46 | Completed Suicide | FAERS: 17 | US FAERS | |
| 47 | Headache | FAERS: 17 | US FAERS | |
| 48 | Poisoning | FAERS: 17 | US FAERS | |
| 49 | Tachycardia | FAERS: 17 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 50 | Unresponsive to stimuli | FAERS: 17 | US FAERS | |
| 51 | Drug dose omission | FAERS: 16 | US FAERS | |
| 52 | Fatigue | FAERS: 15 | US FAERS | |
| 53 | Feeling abnormal | FAERS: 15 | US FAERS | |
| 54 | Product use issue | FAERS: 15 | US FAERS | |
| 55 | Suicide attempt | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 56 | Incorrect route of product administration | FAERS: 14 | US FAERS | |
| 57 | Product use in unapproved indication | FAERS: 14 | US FAERS | |
| 58 | Tremor | FAERS: 14 | US FAERS | |
| 59 | Drug abuser | FAERS: 13 | US FAERS | |
| 60 | Product preparation error | FAERS: 12 | US FAERS | |
| 61 | Product tampering | FAERS: 12 | US FAERS | |
| 62 | Weight decreased | FAERS: 12 | US FAERS | |
| 63 | Cyanosis | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 64 | Drug diversion | FAERS: 11 | US FAERS | |
| 65 | Anxiety | FAERS: 10 | US FAERS | |
| 66 | Back Pain | FAERS: 10 | US FAERS | |
| 67 | Hypersensitivity | FAERS: 10 | US FAERS | |
| 68 | Abdominal discomfort | FAERS: 9 | US FAERS | |
| 69 | Application site erythema | FAERS: 9 | US FAERS | |
| 70 | Application site pruritus | FAERS: 9 | US FAERS | |
| 71 | Application site rash | FAERS: 9 | US FAERS | |
| 72 | Constipation | FAERS: 9 | US FAERS | |
| 73 | Drug ineffective for unapproved indication | FAERS: 9 | US FAERS | |
| 74 | Pharmaceutical product complaint | FAERS: 9 | US FAERS | |
| 75 | Product substitution issue | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 76 | Application site reaction | FAERS: 8 | US FAERS | |
| 77 | Asthenia | FAERS: 8 | US FAERS | |
| 78 | Bradycardia | FAERS: 8 | US FAERS | |
| 79 | Chest Pain | FAERS: 8 | US FAERS | |
| 80 | Pneumonia | FAERS: 8 | US FAERS | |
| 81 | Respiratory Failure | FAERS: 8 | US FAERS | |
| 82 | Tooth Erosion | FAERS: 8 | US FAERS | |
| 83 | Altered state of consciousness | FAERS: 7 | US FAERS | |
| 84 | Bedridden | FAERS: 7 | US FAERS | |
| 85 | Delirium | FAERS: 7 | US FAERS | |
| 86 | Dependence | FAERS: 7 | US FAERS | |
| 87 | Hypoxia | FAERS: 7 | US FAERS | |
| 88 | Intentional product misuse | FAERS: 7 | US FAERS | |
| 89 | Mental status changes | FAERS: 7 | US FAERS | |
| 90 | No adverse event | FAERS: 7 | US FAERS | |
| 91 | Abdominal Pain | FAERS: 6 | US FAERS | |
| 92 | Accidental exposure to product | FAERS: 6 | US FAERS | |
| 93 | Anger | FAERS: 6 | US FAERS | |
| 94 | Dehydration | FAERS: 6 | US FAERS | |
| 95 | Disorientation | FAERS: 6 | US FAERS | |
| 96 | Dysgeusia | FAERS: 6 | US FAERS | |
| 97 | Hospice Care | FAERS: 6 | US FAERS | |
| 98 | Intercepted drug dispensing error | FAERS: 6 | US FAERS | |
| 99 | Intercepted medication error | FAERS: 6 | US FAERS | |
| 100 | Nervousness | FAERS: 6 | US FAERS | |
| 101 | Peripheral swelling | FAERS: 6 | US FAERS | |
| 102 | Product solubility abnormal | FAERS: 6 | US FAERS | |
| 103 | Product taste abnormal | FAERS: 6 | US FAERS | |
| 104 | Syncope | FAERS: 6 | US FAERS | |
| 105 | Acidosis | FAERS: 5 | US FAERS | |
| 106 | Application site pain | FAERS: 5 | US FAERS | |
| 107 | Arthralgia | FAERS: 5 | US FAERS | |
| 108 | Crying | FAERS: 5 | US FAERS | |
| 109 | Diabetes Mellitus | FAERS: 5 | US FAERS | |
| 110 | Drug Tolerance | FAERS: 5 | US FAERS | |
| 111 | Mydriasis | FAERS: 5 | US FAERS | |
| 112 | Prescription drug used without a prescription | FAERS: 5 | US FAERS | |
| 113 | Product packaging issue | FAERS: 5 | US FAERS | |
| 114 | Serotonin Syndrome | FAERS: 5 | US FAERS | |
| 115 | Swelling | FAERS: 5 | US FAERS | |
| 116 | Unevaluable event | FAERS: 5 | US FAERS | |
| 117 | Visual Impairment | FAERS: 5 | US FAERS | |
| 118 | Abasia | FAERS: 4 | US FAERS | |
| 119 | Accidental exposure to product by child | FAERS: 4 | US FAERS | |
| 120 | Amnesia | FAERS: 4 | US FAERS | |
| 121 | Application site vesicles | FAERS: 4 | US FAERS | |
| 122 | Cerebrovascular accident | FAERS: 4 | US FAERS | |
| 123 | Chills | FAERS: 4 | US FAERS | |
| 124 | Choking | FAERS: 4 | US FAERS | |
| 125 | Device Failure | FAERS: 4 | US FAERS | |
| 126 | Discomfort | FAERS: 4 | US FAERS | |
| 127 | Drug dispensing error | FAERS: 4 | US FAERS | |
| 128 | Drug screen positive | FAERS: 4 | US FAERS | |
| 129 | Dysarthria | FAERS: 4 | US FAERS | |
| 130 | Emotional distress | FAERS: 4 | US FAERS | |
| 131 | Flushing | FAERS: 4 | US FAERS | |
| 132 | General physical health deterioration | FAERS: 4 | US FAERS | |
| 133 | Hypersomnia | FAERS: 4 | US FAERS | |
| 134 | Hypokinesia | FAERS: 4 | US FAERS | |
| 135 | Incorrect drug administration rate | FAERS: 4 | US FAERS | |
| 136 | Infection | FAERS: 4 | US FAERS | |
| 137 | Inflammation | FAERS: 4 | US FAERS | |
| 138 | Influenza | FAERS: 4 | US FAERS | |
| 139 | Intentional product use issue | FAERS: 4 | US FAERS | |
| 140 | Laceration | FAERS: 4 | US FAERS | |
| 141 | Metastatic Neoplasm | FAERS: 4 | US FAERS | |
| 142 | No adverse effect | FAERS: 4 | US FAERS | |
| 143 | Occupational exposure to product | FAERS: 4 | US FAERS | |
| 144 | Oral pain | FAERS: 4 | US FAERS | |
| 145 | Palpitations | FAERS: 4 | US FAERS | |
| 146 | Product physical issue | FAERS: 4 | US FAERS | |
| 147 | Stress | FAERS: 4 | US FAERS | |
| 148 | Tooth Extraction | FAERS: 4 | US FAERS | |
| 149 | Vertigo | FAERS: 4 | US FAERS | |
| 150 | Alanine Aminotransferase Increased | FAERS: 3 | US FAERS | |
| 151 | Aphasia | FAERS: 3 | US FAERS | |
| 152 | Apparent death | FAERS: 3 | US FAERS | |
| 153 | Application site erosion | FAERS: 3 | US FAERS | |
| 154 | Application site irritation | FAERS: 3 | US FAERS | |
| 155 | Aspartate Aminotransferase Increased | FAERS: 3 | US FAERS | |
| 156 | Asthma | FAERS: 3 | US FAERS | |
| 157 | Back disorder | FAERS: 3 | US FAERS | |
| 158 | Breakthrough Pain | FAERS: 3 | US FAERS | |
| 159 | Burning sensation | FAERS: 3 | US FAERS | |
| 160 | Cardiomegaly | FAERS: 3 | US FAERS | |
| 161 | Deafness Neurosensory | FAERS: 3 | US FAERS | |
| 162 | Device leakage | FAERS: 3 | US FAERS | |
| 163 | Drug effect incomplete | FAERS: 3 | US FAERS | |
| 164 | Drug exposure during pregnancy | FAERS: 3 | US FAERS | |
| 165 | Electrolyte imbalance | FAERS: 3 | US FAERS | |
| 166 | Erythema | FAERS: 3 | US FAERS | |
| 167 | Impaired driving ability | FAERS: 3 | US FAERS | |
| 168 | Incorrect drug administration duration | FAERS: 3 | US FAERS | |
| 169 | Malabsorption | FAERS: 3 | US FAERS | |
| 170 | Mastication disorder | FAERS: 3 | US FAERS | |
| 171 | Memory impairment | FAERS: 3 | US FAERS | |
| 172 | Muscle strain | FAERS: 3 | US FAERS | |
| 173 | Myocardial Infarction | FAERS: 3 | US FAERS | |
| 174 | Nerve injury | FAERS: 3 | US FAERS | |
| 175 | PCO2 increased | FAERS: 3 | US FAERS | |
| 176 | Pancreatic carcinoma | FAERS: 3 | US FAERS | |
| 177 | Pancreatitis | FAERS: 3 | US FAERS | |
| 178 | Product container issue | FAERS: 3 | US FAERS | |
| 179 | Product size issue | FAERS: 3 | US FAERS | |
| 180 | Pyogenic granuloma | FAERS: 3 | US FAERS | |
| 181 | Sepsis | FAERS: 3 | US FAERS | |
| 182 | Stomatitis | FAERS: 3 | US FAERS | |
| 183 | Terminal state | FAERS: 3 | US FAERS | |
| 184 | Thrombosis | FAERS: 3 | US FAERS | |
| 185 | Ventricular Fibrillation | FAERS: 3 | US FAERS | |
| 186 | Yawning | FAERS: 3 | US FAERS | |
| 187 | Accidental death | FAERS: 2 | US FAERS | |
| 188 | Activities of daily living impaired | FAERS: 2 | US FAERS | |
| 189 | Alcohol poisoning | FAERS: 2 | US FAERS | |
| 190 | Amnestic Disorder | FAERS: 2 | US FAERS | |
| 191 | Analgesic drug level increased | FAERS: 2 | US FAERS | |
| 192 | Anoxia | FAERS: 2 | US FAERS | |
| 193 | Aphagia | FAERS: 2 | US FAERS | |
| 194 | Aphthous Stomatitis | FAERS: 2 | US FAERS | |
| 195 | Arachnoiditis | FAERS: 2 | US FAERS | |
| 196 | Arthropathy | FAERS: 2 | US FAERS | |
| 197 | Blood creatine phosphokinase increased | FAERS: 2 | US FAERS | |
| 198 | Blood creatinine increased | FAERS: 2 | US FAERS | |
| 199 | Blood glucose abnormal | FAERS: 2 | US FAERS | |
| 200 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 201 | Blood pressure fluctuation | FAERS: 2 | US FAERS | |
| 202 | Cancer Pain | FAERS: 2 | US FAERS | |
| 203 | Cholestasis | FAERS: 2 | US FAERS | |
| 204 | Circumstance or information capable of leading to medication error | FAERS: 2 | US FAERS | |
| 205 | Cold sweat | FAERS: 2 | US FAERS | |
| 206 | Contraindicated product administered | FAERS: 2 | US FAERS | |
| 207 | Device malfunction | FAERS: 2 | US FAERS | |
| 208 | Disability | FAERS: 2 | US FAERS | |
| 209 | Disease recurrence | FAERS: 2 | US FAERS | |
| 210 | Drug effect variable | FAERS: 2 | US FAERS | |
| 211 | Drug level increased | FAERS: 2 | US FAERS | |
| 212 | Dysphonia | FAERS: 2 | US FAERS | |
| 213 | Euphoric mood | FAERS: 2 | US FAERS | |
| 214 | Facial Pain | FAERS: 2 | US FAERS | |
| 215 | Facial paralysis | FAERS: 2 | US FAERS | |
| 216 | Failure to Thrive | FAERS: 2 | US FAERS | |
| 217 | Feeling jittery | FAERS: 2 | US FAERS | |
| 218 | Fibromyalgia | FAERS: 2 | US FAERS | |
| 219 | Flatulence | FAERS: 2 | US FAERS | |
| 220 | Formication | FAERS: 2 | US FAERS | |
| 221 | Head discomfort | FAERS: 2 | US FAERS | |
| 222 | Hyperplasia | FAERS: 2 | US FAERS | |
| 223 | Hyperventilation | FAERS: 2 | US FAERS | |
| 224 | Hypoventilation | FAERS: 2 | US FAERS | |
| 225 | Intentional misuse | FAERS: 2 | US FAERS | |
| 226 | Intercepted drug prescribing error | FAERS: 2 | US FAERS | |
| 227 | Laryngospasm | FAERS: 2 | US FAERS | |
| 228 | Malnutrition | FAERS: 2 | US FAERS | |
| 229 | Malocclusion | FAERS: 2 | US FAERS | |
| 230 | Metastasis | FAERS: 2 | US FAERS | |
| 231 | Multiple drug overdose accidental | FAERS: 2 | US FAERS | |
| 232 | Nasal discomfort | FAERS: 2 | US FAERS | |
| 233 | Nasopharyngitis | FAERS: 2 | US FAERS | |
| 234 | Neck Pain | FAERS: 2 | US FAERS | |
| 235 | Oral infection | FAERS: 2 | US FAERS | |
| 236 | PO2 decreased | FAERS: 2 | US FAERS | |
| 237 | Pallor | FAERS: 2 | US FAERS | |
| 238 | Pancreatic Neoplasm | FAERS: 2 | US FAERS | |
| 239 | Pneumothorax | FAERS: 2 | US FAERS | |
| 240 | Poor quality drug administered | FAERS: 2 | US FAERS | |
| 241 | Postoperative ileus | FAERS: 2 | US FAERS | |
| 242 | Procedural complication | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 243 | Product availability issue | FAERS: 2 | US FAERS | |
| 244 | Product contamination physical | FAERS: 2 | US FAERS | |
| 245 | Product label issue | FAERS: 2 | US FAERS | |
| 246 | Product measured potency issue | FAERS: 2 | US FAERS | |
| 247 | Product packaging quantity issue | FAERS: 2 | US FAERS | |
| 248 | Pulmonary Embolism | FAERS: 2 | US FAERS | |
| 249 | Pulmonary congestion | FAERS: 2 | US FAERS | |
| 250 | Renal Cell Carcinoma | FAERS: 2 | US FAERS | |
| 251 | Respiratory distress | FAERS: 2 | US FAERS | |
| 252 | Restlessness | FAERS: 2 | US FAERS | |
| 253 | Sinus Tachycardia | FAERS: 2 | US FAERS | |
| 254 | Staring | FAERS: 2 | US FAERS | |
| 255 | Surgical failure | FAERS: 2 | US FAERS | |
| 256 | Teeth brittle | FAERS: 2 | US FAERS | |
| 257 | Therapeutic response unexpected with drug substitution | FAERS: 2 | US FAERS | |
| 258 | Therapy cessation | FAERS: 2 | US FAERS | |
| 259 | Therapy regimen changed | FAERS: 2 | US FAERS | |
| 260 | Thirst | FAERS: 2 | US FAERS | |
| 261 | Throat irritation | FAERS: 2 | US FAERS | |
| 262 | Toxicologic test abnormal | FAERS: 2 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 263 | Troponin increased | FAERS: 2 | US FAERS | |
| 264 | Urinary Incontinence | FAERS: 2 | US FAERS | |
| 265 | Urinary Retention | FAERS: 2 | US FAERS | |
| 266 | X-ray abnormal | FAERS: 2 | US FAERS | |
| 267 | Acute respiratory failure | FAERS: 1 | US FAERS | |
| 268 | Alcohol abuse | FAERS: 1 | US FAERS | |
| 269 | Alcohol interaction | FAERS: 1 | US FAERS | |
| 270 | Anal cancer metastatic | FAERS: 1 | US FAERS | |
| 271 | Anaplastic large cell lymphoma T- and null-cell types | FAERS: 1 | US FAERS | |
| 272 | Aneurysm | FAERS: 1 | US FAERS | |
| 273 | Angioedema | FAERS: 1 | US FAERS | |
| 274 | Application site exfoliation | FAERS: 1 | US FAERS | |
| 275 | Application site scar | FAERS: 1 | US FAERS | |
| 276 | Application site ulcer | FAERS: 1 | US FAERS | |
| 277 | Application site urticaria | FAERS: 1 | US FAERS | |
| 278 | Arterial therapeutic procedure | FAERS: 1 | US FAERS | |
| 279 | Ascites | FAERS: 1 | US FAERS | |
| 280 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 281 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 282 | Autoimmune Pancreatitis | FAERS: 1 | US FAERS | |
| 283 | Blindness | FAERS: 1 | US FAERS | |
| 284 | Blood magnesium decreased | FAERS: 1 | US FAERS | |
| 285 | Blood pH decreased | FAERS: 1 | US FAERS | |
| 286 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 287 | Blood pressure immeasurable | FAERS: 1 | US FAERS | |
| 288 | Blood testosterone decreased | FAERS: 1 | US FAERS | |
| 289 | Blood urea increased | FAERS: 1 | US FAERS | |
| 290 | Blood urine present | FAERS: 1 | US FAERS | |
| 291 | Bone pain | FAERS: 1 | US FAERS | |
| 292 | Bradykinesia | FAERS: 1 | US FAERS | |
| 293 | Bronchopneumonia | FAERS: 1 | US FAERS | |
| 294 | Bronchospasm | FAERS: 1 | US FAERS | |
| 295 | Carbon Monoxide Poisoning | FAERS: 1 | US FAERS | |
| 296 | Cardiovascular insufficiency | FAERS: 1 | US FAERS | |
| 297 | Central pain syndrome | FAERS: 1 | US FAERS | |
| 298 | Cerebral hygroma | FAERS: 1 | US FAERS | |
| 299 | Cervix carcinoma stage IV | FAERS: 1 | US FAERS | |
| 300 | Chest discomfort | FAERS: 1 | US FAERS | |
| 301 | Clostridium test positive | FAERS: 1 | US FAERS | |
| 302 | Complications of transplant surgery | FAERS: 1 | US FAERS | |
| 303 | Conversion disorder | FAERS: 1 | US FAERS | |
| 304 | Culture wound positive | FAERS: 1 | US FAERS | |
| 305 | Deafness | FAERS: 1 | US FAERS | |
| 306 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 307 | Dementia | FAERS: 1 | US FAERS | |
| 308 | Dental examination abnormal | FAERS: 1 | US FAERS | |
| 309 | Dental prosthesis user | FAERS: 1 | US FAERS | |
| 310 | Device alarm issue | FAERS: 1 | US FAERS | |
| 311 | Diverticulitis | FAERS: 1 | US FAERS | |
| 312 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 313 | Drug label confusion | FAERS: 1 | US FAERS | |
| 314 | Economic problem | FAERS: 1 | US FAERS | |
| 315 | Electrocardiogram T wave peaked | FAERS: 1 | US FAERS | |
| 316 | Electroencephalogram abnormal | FAERS: 1 | US FAERS | |
| 317 | Emotional disorder | FAERS: 1 | US FAERS | |
| 318 | Endodontic procedure | FAERS: 1 | US FAERS | |
| 319 | Enterococcus test positive | FAERS: 1 | US FAERS | |
| 320 | Escherichia test positive | FAERS: 1 | US FAERS | |
| 321 | Expired drug administered | FAERS: 1 | US FAERS | |
| 322 | Expired product administered | FAERS: 1 | US FAERS | |
| 323 | Exposure via direct contact | FAERS: 1 | US FAERS | |
| 324 | Exposure via skin contact | FAERS: 1 | US FAERS | |
| 325 | Extra dose administered | FAERS: 1 | US FAERS | |
| 326 | Extravasation | FAERS: 1 | US FAERS | |
| 327 | Eye Infection | FAERS: 1 | US FAERS | |
| 328 | Eye irritation | FAERS: 1 | US FAERS | |
| 329 | Eye pain | FAERS: 1 | US FAERS | |
| 330 | Eyeball rupture | FAERS: 1 | US FAERS | |
| 331 | Feeling Cold | FAERS: 1 | US FAERS | |
| 332 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 333 | Feelings of worthlessness | FAERS: 1 | US FAERS | |
| 334 | Flank Pain | FAERS: 1 | US FAERS | |
| 335 | Fluid overload | FAERS: 1 | US FAERS | |
| 336 | Foaming at mouth | FAERS: 1 | US FAERS | |
| 337 | Foreign body trauma | FAERS: 1 | US FAERS | |
| 338 | Frustration tolerance decreased | FAERS: 1 | US FAERS | |
| 339 | Full blood count decreased | FAERS: 1 | US FAERS | |
| 340 | Gait inability | FAERS: 1 | US FAERS | |
| 341 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 342 | Gingivitis | FAERS: 1 | US FAERS | |
| 343 | Glasgow coma scale abnormal | FAERS: 1 | US FAERS | |
| 344 | Hyperacusis | FAERS: 1 | US FAERS | |
| 345 | Hyperthyroidism | FAERS: 1 | US FAERS | |
| 346 | Hypophagia | FAERS: 1 | US FAERS | |
| 347 | Hyporeflexia | FAERS: 1 | US FAERS | |
| 348 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 349 | Impaired quality of life | FAERS: 1 | US FAERS | |
| 350 | Impaired work ability | FAERS: 1 | US FAERS | |
| 351 | Incorrect dose administered by device | FAERS: 1 | US FAERS | |
| 352 | Incorrect storage of drug | FAERS: 1 | US FAERS | |
| 353 | Infusion site granuloma | FAERS: 1 | US FAERS | |
| 354 | Intervertebral disc disorder | FAERS: 1 | US FAERS | |
| 355 | Intestinal Perforation | FAERS: 1 | US FAERS | |
| 356 | Intracranial Aneurysm | FAERS: 1 | US FAERS | |
| 357 | Intubation | FAERS: 1 | US FAERS | |
| 358 | Labyrinthitis | FAERS: 1 | US FAERS | |
| 359 | Leukocytosis | FAERS: 1 | US FAERS | |
| 360 | Liquid product physical issue | FAERS: 1 | US FAERS | |
| 361 | Loose tooth | FAERS: 1 | US FAERS | |
| 362 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 363 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 364 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 365 | Markedly reduced dietary intake | FAERS: 1 | US FAERS | |
| 366 | Mastoiditis | FAERS: 1 | US FAERS | |
| 367 | Maternal exposure during delivery | FAERS: 1 | US FAERS | |
| 368 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 369 | Maxillofacial operation | FAERS: 1 | US FAERS | |
| 370 | Mechanical ventilation | FAERS: 1 | US FAERS | |
| 371 | Menopause | FAERS: 1 | US FAERS | |
| 372 | Mental impairment | FAERS: 1 | US FAERS | |
| 373 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 374 | Morbid thoughts | FAERS: 1 | US FAERS | |
| 375 | Multiple Myeloma | FAERS: 1 | US FAERS | |
| 376 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 377 | Multiple drug overdose | FAERS: 1 | US FAERS | |
| 378 | Muscle tightness | FAERS: 1 | US FAERS | |
| 379 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 380 | Myoclonic Epilepsy | FAERS: 1 | US FAERS | |
| 381 | Myoclonus | FAERS: 1 | US FAERS | |
| 382 | Neonatal disorder | FAERS: 1 | US FAERS | |
| 383 | Neonatal respiratory failure | FAERS: 1 | US FAERS | |
| 384 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 385 | Night sweats | FAERS: 1 | US FAERS | |
| 386 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 387 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 388 | Osteomyelitis | FAERS: 1 | US FAERS | |
| 389 | Osteonecrosis of Jaw | FAERS: 1 | US FAERS | |
| 390 | Oxygen Consumption | FAERS: 1 | US FAERS | |
| 391 | Oxygen consumption increased | FAERS: 1 | US FAERS | |
| 392 | Pancreatectomy | FAERS: 1 | US FAERS | |
| 393 | Paraparesis | FAERS: 1 | US FAERS | |
| 394 | Parenteral Nutrition | FAERS: 1 | US FAERS | |
| 395 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 396 | Pericarditis | FAERS: 1 | US FAERS | |
| 397 | Personality Change | FAERS: 1 | US FAERS | |
| 398 | Personality change due to a general medical condition | FAERS: 1 | US FAERS | |
| 399 | Phantom pain | FAERS: 1 | US FAERS | |
| 400 | Photophobia | FAERS: 1 | US FAERS | |
| 401 | Physical disability | FAERS: 1 | US FAERS | |
| 402 | Pneumonitis | FAERS: 1 | US FAERS | |
| 403 | Poor personal hygiene | FAERS: 1 | US FAERS | |
| 404 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 405 | Post procedural complication | FAERS: 1 | US FAERS | |
| 406 | Posturing | FAERS: 1 | US FAERS | |
| 407 | Poverty of speech | FAERS: 1 | US FAERS | |
| 408 | Presyncope | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 409 | Procedural hypotension | FAERS: 1 | US FAERS | |
| 410 | Product blister packaging issue | FAERS: 1 | US FAERS | |
| 411 | Product closure issue | FAERS: 1 | US FAERS | |
| 412 | Product contamination | FAERS: 1 | US FAERS | |
| 413 | Product counterfeit | FAERS: 1 | US FAERS | |
| 414 | Product dose omission | FAERS: 1 | US FAERS | |
| 415 | Product formulation issue | FAERS: 1 | US FAERS | |
| 416 | Product friable | FAERS: 1 | US FAERS | |
| 417 | Product label on wrong product | FAERS: 1 | US FAERS | |
| 418 | Product monitoring error | FAERS: 1 | US FAERS | |
| 419 | Product outer packaging issue | FAERS: 1 | US FAERS | |
| 420 | Product used for unknown indication | FAERS: 1 | US FAERS | |
| 421 | Productive Cough | FAERS: 1 | US FAERS | |
| 422 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 423 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 424 | Pyelonephritis | FAERS: 1 | US FAERS | |
| 425 | Radiation associated pain | FAERS: 1 | US FAERS | |
| 426 | Rebound psychosis | FAERS: 1 | US FAERS | |
| 427 | Rectocele | FAERS: 1 | US FAERS | |
| 428 | Refusal of treatment by relative | FAERS: 1 | US FAERS | |
| 429 | Renal cancer metastatic | FAERS: 1 | US FAERS | |
| 430 | Renal mass | FAERS: 1 | US FAERS | |
| 431 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 432 | Retching | FAERS: 1 | US FAERS | |
| 433 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 434 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 435 | Screaming | FAERS: 1 | US FAERS | |
| 436 | Septic Shock | FAERS: 1 | US FAERS | |
| 437 | Shock | FAERS: 1 | US FAERS | |
| 438 | Sluggishness | FAERS: 1 | US FAERS | |
| 439 | Snoring | FAERS: 1 | US FAERS | |
| 440 | Sopor | FAERS: 1 | US FAERS | |
| 441 | Sphincter of Oddi Dysfunction | FAERS: 1 | US FAERS | |
| 442 | Spinal column injury | FAERS: 1 | US FAERS | |
| 443 | Splenectomy | FAERS: 1 | US FAERS | |
| 444 | Staphylococcus test positive | FAERS: 1 | US FAERS | |
| 445 | Status Epilepticus | FAERS: 1 | US FAERS | |
| 446 | Streptococcus test positive | FAERS: 1 | US FAERS | |
| 447 | Tablet issue | FAERS: 1 | US FAERS | |
| 448 | Tardive Dyskinesia | FAERS: 1 | US FAERS | |
| 449 | Tension | FAERS: 1 | US FAERS | |
| 450 | Theft | FAERS: 1 | US FAERS | |
| 451 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 452 | Throat cancer | FAERS: 1 | US FAERS | |
| 453 | Toothache | FAERS: 1 | US FAERS | |
| 454 | Toxic leukoencephalopathy | FAERS: 1 | US FAERS | |
| 455 | Ulcer | FAERS: 1 | US FAERS | |
| 456 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 457 | Urticaria | FAERS: 1 | US FAERS | |
| 458 | Uterine Cancer | FAERS: 1 | US FAERS | |
| 459 | Vascular Access Complication | FAERS: 1 | US FAERS | |
| 460 | Vital functions abnormal | FAERS: 1 | US FAERS | |
| 461 | Weaning failure | FAERS: 1 | US FAERS | |
| 462 | Wheelchair user | FAERS: 1 | US FAERS | |
| 463 | Wrong technique in product usage process | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 464 | muscle injury | FAERS: 1 | US FAERS | |
| 465 | Bruxism | Canada Vigilance: 1 | Canada Vigilance | |
| 466 | Product administration error | Canada Vigilance: 1 | Canada Vigilance | |
| 467 | Product complaint | Canada Vigilance: 1 | Canada Vigilance | |
| 468 | Supraventricular tachycardia | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120329
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.