Methylprednisolone Hemisuccinate
(IMBXEJJVJRTNOW-XYMSELFBSA-N)
Structure
- SMILES
- OC(=O)CCC(=O)OCC(=O)[C@@]1(O)CC[C@@H]2[C@]1(C)C[C@H](O)[C@H]1[C@H]2C[C@@H](C2=CC(=O)C=C[C@]12C)C
- Type(s)
- Approved
- Molecular Formula:
- C26H34O8
- Molecular Weight:
- 474.543
- Log P:
- 2.2193
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 3
- TPSA:
- 138.2
- CAS Number(s):
- 2921-57-5
Synonym(s)
1.
Methylprednisolone Hemisuccinate
2.
Methylprednisolone Succinate
3.
6 alpha-Methylprednisolone Sodium Hemisuccinate
4.
A-MethaPred
5.
Methylprednisolone Hemisuccinate Monosodium Salt
6.
Methylprednisolone Sodium Hemisuccinate
7.
Methylprednisolone Sodium Succinate
8.
Solu-Medrol
9.
Solumedrol
10.
Urbason-Soluble
11.
Hemisuccinate, Methylprednisolone
12.
Sodium Hemisuccinate, Methylprednisolone
13.
Sodium Succinate, Methylprednisolone
14.
Succinate, Methylprednisolone
15.
UrbasonSoluble
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Hypersensitivity | FAERS: 31 | US FAERS | |
| 2 | Urticaria | FAERS: 28 | US FAERS | |
| 3 | Pruritus | FAERS: 27 | US FAERS | |
| 4 | Erythema | FAERS: 24 | 12921496 | CTD US FAERS |
| 5 | Anaphylactic shock | FAERS: 22 | US FAERS | |
| 6 | Asthenia | FAERS: 18 | US FAERS | |
| 7 | Flushing | FAERS: 17 | US FAERS | |
| 8 | Blood glucose increased | FAERS: 15 | US FAERS | |
| 9 | Pain | FAERS: 15 | US FAERS | |
| 10 | Shock | FAERS: 13 | US FAERS | |
| 11 | Tachycardia | FAERS: 13 | US FAERS | |
| 12 | Dizziness | FAERS: 12 | US FAERS | |
| 13 | Asthma | FAERS: 11 | US FAERS | |
| 14 | Injection site pain | FAERS: 11 | US FAERS | |
| 15 | Malaise | FAERS: 10 | US FAERS | |
| 16 | Vomiting | FAERS: 10 | 3542325 12921496 | CTD US FAERS |
| 17 | Cardiac Arrest | FAERS: 9 | US FAERS | |
| 18 | Chest Pain | FAERS: 9 | US FAERS | |
| 19 | Anxiety | FAERS: 8 | US FAERS | |
| 20 | Chills | FAERS: 8 | 12921496 | CTD US FAERS |
| 21 | Fatigue | FAERS: 8 | US FAERS | |
| 22 | Respiratory distress | FAERS: 8 | US FAERS | |
| 23 | Agitation | FAERS: 7 | US FAERS | |
| 24 | Hypotension | FAERS: 7 | 12921496 | CTD US FAERS |
| 25 | Product quality issue | FAERS: 7 | US FAERS | |
| 26 | Burning sensation | FAERS: 6 | US FAERS | |
| 27 | Diabetes Mellitus | FAERS: 6 | US FAERS | |
| 28 | Drug ineffective | FAERS: 6 | US FAERS | |
| 29 | Nervousness | FAERS: 6 | US FAERS | |
| 30 | Palpitations | FAERS: 6 | US FAERS | |
| 31 | Pancreatitis | FAERS: 6 | US FAERS | |
| 32 | Pharmaceutical product complaint | FAERS: 6 | US FAERS | |
| 33 | Respiratory Failure | FAERS: 6 | US FAERS | |
| 34 | Tremor | FAERS: 6 | US FAERS | |
| 35 | Wheezing | FAERS: 6 | US FAERS | |
| 36 | Dysgeusia | FAERS: 5 | US FAERS | |
| 37 | Injection site abscess | FAERS: 5 | US FAERS | |
| 38 | Intestinal Perforation | FAERS: 5 | US FAERS | |
| 39 | Medication Error | FAERS: 5 | US FAERS | |
| 40 | Rash erythematous | FAERS: 5 | US FAERS | |
| 41 | Respiratory arrest | FAERS: 5 | US FAERS | |
| 42 | Syncope | FAERS: 5 | US FAERS | |
| 43 | Angioedema | FAERS: 4 | US FAERS | |
| 44 | Back Pain | FAERS: 4 | US FAERS | |
| 45 | Blindness | FAERS: 4 | US FAERS | |
| 46 | Bradycardia | FAERS: 4 | US FAERS | |
| 47 | Bronchospasm | FAERS: 4 | US FAERS | |
| 48 | Chest discomfort | FAERS: 4 | US FAERS | |
| 49 | Disseminated Intravascular Coagulation | FAERS: 4 | US FAERS | |
| 50 | Initial insomnia | FAERS: 4 | US FAERS | |
| 51 | Multiple Sclerosis | FAERS: 4 | 8326337 | CTD US FAERS |
| 52 | Nausea | FAERS: 4 | 3542325 | CTD US FAERS |
| 53 | Restlessness | FAERS: 4 | US FAERS | |
| 54 | Anaphylactoid Reaction | FAERS: 3 | US FAERS | |
| 55 | Arthritis | FAERS: 3 | US FAERS | |
| 56 | Blood creatinine increased | FAERS: 3 | US FAERS | |
| 57 | Bone density decreased | FAERS: 3 | US FAERS | |
| 58 | Cerebral Infarction | FAERS: 3 | US FAERS | |
| 59 | Cold sweat | FAERS: 3 | US FAERS | |
| 60 | Depressed Level of Consciousness | FAERS: 3 | US FAERS | |
| 61 | Gastric ulcer | FAERS: 3 | US FAERS | |
| 62 | Incorrect dose administered | FAERS: 3 | US FAERS | |
| 63 | Injection site movement impairment | FAERS: 3 | US FAERS | |
| 64 | Meningitis | FAERS: 3 | US FAERS | |
| 65 | Myalgia | FAERS: 3 | US FAERS | |
| 66 | Myocardial Infarction | FAERS: 3 | 3527810 | CTD US FAERS |
| 67 | Pallor | FAERS: 3 | US FAERS | |
| 68 | Pneumonia | FAERS: 3 | US FAERS | |
| 69 | Reaction to drug excipients | FAERS: 3 | US FAERS | |
| 70 | Skin test positive | FAERS: 3 | US FAERS | |
| 71 | Sneezing | FAERS: 3 | US FAERS | |
| 72 | Swelling | FAERS: 3 | US FAERS | |
| 73 | Therapy non-responder | FAERS: 3 | US FAERS | |
| 74 | Thrombocytopenia | FAERS: 3 | US FAERS | |
| 75 | Urinary Incontinence | FAERS: 3 | US FAERS | |
| 76 | nervous system disorder | FAERS: 3 | US FAERS | |
| 77 | Abasia | FAERS: 2 | US FAERS | |
| 78 | Abdominal Pain | FAERS: 2 | US FAERS | |
| 79 | Angina Pectoris | FAERS: 2 | US FAERS | |
| 80 | Anuria | FAERS: 2 | US FAERS | |
| 81 | Arthralgia | FAERS: 2 | 12921496 | CTD US FAERS |
| 82 | Aspartate Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 83 | Atrial Fibrillation | FAERS: 2 | 12921496 | CTD US FAERS |
| 84 | Blood pressure immeasurable | FAERS: 2 | US FAERS | |
| 85 | Cataract | FAERS: 2 | US FAERS | |
| 86 | Cerebral Thrombosis | FAERS: 2 | US FAERS | |
| 87 | Cyanosis | FAERS: 2 | US FAERS | |
| 88 | Cytolytic hepatitis | FAERS: 2 | US FAERS | |
| 89 | Delirium | FAERS: 2 | US FAERS | |
| 90 | Drug effect delayed | FAERS: 2 | US FAERS | |
| 91 | Embolism | FAERS: 2 | US FAERS | |
| 92 | Epilepsy | FAERS: 2 | US FAERS | |
| 93 | Erysipelas | FAERS: 2 | US FAERS | |
| 94 | Euphoric mood | FAERS: 2 | US FAERS | |
| 95 | Eye pain | FAERS: 2 | US FAERS | |
| 96 | Eyelids pruritus | FAERS: 2 | US FAERS | |
| 97 | Feeling abnormal | FAERS: 2 | US FAERS | |
| 98 | Headache | FAERS: 2 | US FAERS | |
| 99 | Hemiplegia | FAERS: 2 | US FAERS | |
| 100 | Impaired work ability | FAERS: 2 | US FAERS | |
| 101 | Incoherent | FAERS: 2 | US FAERS | |
| 102 | Incorrect route of drug administration | FAERS: 2 | US FAERS | |
| 103 | Increased upper airway secretion | FAERS: 2 | US FAERS | |
| 104 | Injection site infection | FAERS: 2 | US FAERS | |
| 105 | Lip swelling | FAERS: 2 | US FAERS | |
| 106 | Lymphadenopathy | FAERS: 2 | US FAERS | |
| 107 | Myasthenic Syndrome | FAERS: 2 | US FAERS | |
| 108 | Myositis | FAERS: 2 | US FAERS | |
| 109 | Nerve injury | FAERS: 2 | US FAERS | |
| 110 | Nystagmus | FAERS: 2 | US FAERS | |
| 111 | Ocular Hypertension | FAERS: 2 | US FAERS | |
| 112 | Osteomyelitis | FAERS: 2 | US FAERS | |
| 113 | Overdose | FAERS: 2 | US FAERS | |
| 114 | Pancreatic Insufficiency | FAERS: 2 | US FAERS | |
| 115 | Pharyngolaryngeal Pain | FAERS: 2 | US FAERS | |
| 116 | Post procedural infection | FAERS: 2 | US FAERS | |
| 117 | Presyncope | FAERS: 2 | US FAERS | |
| 118 | Product container issue | FAERS: 2 | US FAERS | |
| 119 | Protein total decreased | FAERS: 2 | US FAERS | |
| 120 | Psychiatric symptom | FAERS: 2 | US FAERS | |
| 121 | Pulmonary Embolism | FAERS: 2 | US FAERS | |
| 122 | Retinal infarction | FAERS: 2 | US FAERS | |
| 123 | Rheumatoid Arthritis | FAERS: 2 | US FAERS | |
| 124 | Schizophrenia | FAERS: 2 | US FAERS | |
| 125 | Skin Ulcer | FAERS: 2 | US FAERS | |
| 126 | Somnolence | FAERS: 2 | US FAERS | |
| 127 | Throat irritation | FAERS: 2 | US FAERS | |
| 128 | Unresponsive to stimuli | FAERS: 2 | US FAERS | |
| 129 | Upper airway obstruction | FAERS: 2 | US FAERS | |
| 130 | Urinary Retention | FAERS: 2 | US FAERS | |
| 131 | Urinary tract infection | FAERS: 2 | US FAERS | |
| 132 | Venous thrombosis limb | FAERS: 2 | US FAERS | |
| 133 | Ventricular Fibrillation | FAERS: 2 | US FAERS | |
| 134 | Visual Impairment | FAERS: 2 | US FAERS | |
| 135 | Wound dehiscence | FAERS: 2 | US FAERS | |
| 136 | Abscess | FAERS: 1 | US FAERS | |
| 137 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 138 | Alanine aminotransferase decreased | FAERS: 1 | US FAERS | |
| 139 | Alopecia | FAERS: 1 | US FAERS | |
| 140 | Anger | FAERS: 1 | US FAERS | |
| 141 | Anorectal discomfort | FAERS: 1 | US FAERS | |
| 142 | Application site discomfort | FAERS: 1 | US FAERS | |
| 143 | Aspartate aminotransferase decreased | FAERS: 1 | US FAERS | |
| 144 | Autoimmune hepatitis | FAERS: 1 | US FAERS | |
| 145 | Biopsy heart abnormal | FAERS: 1 | US FAERS | |
| 146 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 147 | Blood albumin decreased | FAERS: 1 | US FAERS | |
| 148 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 149 | Blood lactate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 150 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 151 | Blood urea increased | FAERS: 1 | US FAERS | |
| 152 | Blood urine present | FAERS: 1 | US FAERS | |
| 153 | Bronchitis | FAERS: 1 | US FAERS | |
| 154 | Carbon dioxide increased | FAERS: 1 | US FAERS | |
| 155 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 156 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 157 | Cholestasis | FAERS: 1 | US FAERS | |
| 158 | Colitis | FAERS: 1 | US FAERS | |
| 159 | Complement factor C3 decreased | FAERS: 1 | US FAERS | |
| 160 | Complement factor C4 decreased | FAERS: 1 | US FAERS | |
| 161 | Complement factor abnormal | FAERS: 1 | US FAERS | |
| 162 | Completed Suicide | FAERS: 1 | US FAERS | |
| 163 | Constipation | FAERS: 1 | US FAERS | |
| 164 | Contrast media reaction | FAERS: 1 | US FAERS | |
| 165 | Corneal dystrophy | FAERS: 1 | US FAERS | |
| 166 | Crying | FAERS: 1 | US FAERS | |
| 167 | Cystitis | FAERS: 1 | US FAERS | |
| 168 | Cytomegalovirus test positive | FAERS: 1 | US FAERS | |
| 169 | Deafness | FAERS: 1 | US FAERS | |
| 170 | Depressed mood | FAERS: 1 | US FAERS | |
| 171 | Device Failure | FAERS: 1 | US FAERS | |
| 172 | Diabetic Ketoacidosis | FAERS: 1 | US FAERS | |
| 173 | Discomfort | FAERS: 1 | US FAERS | |
| 174 | Disease Progression | FAERS: 1 | US FAERS | |
| 175 | Disease recurrence | FAERS: 1 | US FAERS | |
| 176 | Dissociative disorder | FAERS: 1 | US FAERS | |
| 177 | Drug administration error | FAERS: 1 | US FAERS | |
| 178 | Dyschezia | FAERS: 1 | US FAERS | |
| 179 | Dyspepsia | FAERS: 1 | US FAERS | |
| 180 | Dysphonia | FAERS: 1 | US FAERS | |
| 181 | Dysuria | FAERS: 1 | US FAERS | |
| 182 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 183 | Endocarditis enterococcal | FAERS: 1 | US FAERS | |
| 184 | Epidermolysis Bullosa | FAERS: 1 | US FAERS | |
| 185 | Erythrosis | FAERS: 1 | US FAERS | |
| 186 | Feeling Cold | FAERS: 1 | US FAERS | |
| 187 | Fracture | FAERS: 1 | US FAERS | |
| 188 | Gastrointestinal perforation | FAERS: 1 | US FAERS | |
| 189 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 190 | Hepatic necrosis | FAERS: 1 | US FAERS | |
| 191 | Hepatic vein occlusion | FAERS: 1 | US FAERS | |
| 192 | Hepatitis B | FAERS: 1 | US FAERS | |
| 193 | Hepatitis | FAERS: 1 | US FAERS | |
| 194 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 195 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 196 | Hyperthyroidism | FAERS: 1 | US FAERS | |
| 197 | Hyperventilation | FAERS: 1 | US FAERS | |
| 198 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 199 | Hypoventilation | FAERS: 1 | US FAERS | |
| 200 | Hypoxia | FAERS: 1 | US FAERS | |
| 201 | Incorrect storage of drug | FAERS: 1 | US FAERS | |
| 202 | Infection | FAERS: 1 | US FAERS | |
| 203 | Infrequent bowel movements | FAERS: 1 | US FAERS | |
| 204 | Infusion site pain | FAERS: 1 | US FAERS | |
| 205 | Infusion site pruritus | FAERS: 1 | US FAERS | |
| 206 | Infusion site reaction | FAERS: 1 | US FAERS | |
| 207 | Injection site erythema | FAERS: 1 | US FAERS | |
| 208 | Injection site necrosis | FAERS: 1 | US FAERS | |
| 209 | Injection site phlebitis | FAERS: 1 | US FAERS | |
| 210 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 211 | Lactose Intolerance | FAERS: 1 | US FAERS | |
| 212 | Laryngospasm | FAERS: 1 | US FAERS | |
| 213 | Leukocytosis | FAERS: 1 | US FAERS | |
| 214 | Leukopenia | FAERS: 1 | US FAERS | |
| 215 | Lung consolidation | FAERS: 1 | US FAERS | |
| 216 | Lupus Nephritis | FAERS: 1 | US FAERS | |
| 217 | Lymphangitis | FAERS: 1 | US FAERS | |
| 218 | Lymphocyte stimulation test positive | FAERS: 1 | US FAERS | |
| 219 | Lymphocytic infiltration | FAERS: 1 | US FAERS | |
| 220 | Lymphopenia | FAERS: 1 | US FAERS | |
| 221 | Markedly reduced dietary intake | FAERS: 1 | US FAERS | |
| 222 | Mechanical ventilation | FAERS: 1 | US FAERS | |
| 223 | Medical device complication | FAERS: 1 | US FAERS | |
| 224 | Medication dilution | FAERS: 1 | US FAERS | |
| 225 | Mental status changes | FAERS: 1 | US FAERS | |
| 226 | Multiple sclerosis relapse | FAERS: 1 | US FAERS | |
| 227 | Muscle necrosis | FAERS: 1 | US FAERS | |
| 228 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 229 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 230 | Myopathy | FAERS: 1 | US FAERS | |
| 231 | Necrosis | FAERS: 1 | US FAERS | |
| 232 | No adverse event | FAERS: 1 | US FAERS | |
| 233 | Optic Atrophy | FAERS: 1 | US FAERS | |
| 234 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 235 | Osteoporosis | FAERS: 1 | US FAERS | |
| 236 | Pancreatic enlargement | FAERS: 1 | US FAERS | |
| 237 | Pancytopenia | FAERS: 1 | US FAERS | |
| 238 | Paraparesis | FAERS: 1 | US FAERS | |
| 239 | Pneumothorax | FAERS: 1 | US FAERS | |
| 240 | Poisoning | FAERS: 1 | US FAERS | |
| 241 | Postoperative infection | FAERS: 1 | US FAERS | |
| 242 | Procedural complication | FAERS: 1 | US FAERS | |
| 243 | Product lot number issue | FAERS: 1 | US FAERS | |
| 244 | Rash scaly | FAERS: 1 | US FAERS | |
| 245 | Red man syndrome | FAERS: 1 | US FAERS | |
| 246 | Renal pain | FAERS: 1 | US FAERS | |
| 247 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 248 | Retinal Vasculitis | FAERS: 1 | US FAERS | |
| 249 | Sciatica | FAERS: 1 | US FAERS | |
| 250 | Scleroderma renal crisis | FAERS: 1 | US FAERS | |
| 251 | Sepsis | FAERS: 1 | US FAERS | |
| 252 | Septic Shock | FAERS: 1 | US FAERS | |
| 253 | Sinus Arrhythmia | FAERS: 1 | US FAERS | |
| 254 | Sluggishness | FAERS: 1 | US FAERS | |
| 255 | Spastic Paraplegia | FAERS: 1 | US FAERS | |
| 256 | Status Asthmaticus | FAERS: 1 | US FAERS | |
| 257 | Stomatitis | FAERS: 1 | US FAERS | |
| 258 | Stridor | FAERS: 1 | US FAERS | |
| 259 | Stupor | FAERS: 1 | US FAERS | |
| 260 | Sudden infant death syndrome | FAERS: 1 | US FAERS | |
| 261 | Thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 262 | Tooth Loss | FAERS: 1 | US FAERS | |
| 263 | Tuberculosis | FAERS: 1 | US FAERS | |
| 264 | Unevaluable event | FAERS: 1 | US FAERS | |
| 265 | Urine ketone body present | FAERS: 1 | US FAERS | |
| 266 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 267 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 268 | Chemical and Drug Induced Liver Injury | 3800520 | CTD | |
| 269 | Dyspnea | 12921496 | CTD | |
| 270 | Fever | 12921496 | CTD | |
| 271 | Optic Neuritis | 14552184 | CTD | |
| 272 | Paraplegia | 23452429 | CTD | |
| 273 | Pemphigus | 7657447 | CTD | |
| 274 | Pyelonephritis | 2256750 | CTD | |
| 275 | Respiratory Syncytial Virus Infections | 15262687 | CTD | |
| 276 | Rhabdomyolysis | 12921496 | CTD | |
| 277 | Spinal Cord Injuries | 17184187 23452429 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120295
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.