Albendazole
(HXHWSAZORRCQMX-UHFFFAOYSA-N)
Structure
- SMILES
- CCCSc1ccc2c(c1)[nH]c(n2)NC(=O)OC
- Type(s)
- Approved; Vet_approved
- ATC code(s)
- P02CA03
- Molecular Formula:
- C12H15N3O2S
- Molecular Weight:
- 265.331
- Log P:
- 3.3163
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 2
- TPSA:
- 92.31
- CAS Number(s):
- 54965-21-8
Synonym(s)
1.
Albendazole
2.
Albendazole Monohydrochloride
3.
Albendoral
4.
Albenza
5.
Andazol
6.
Bendapar
7.
Bilutac
8.
Digezanol
9.
Disthelm
10.
Endoplus
11.
Eskazole
12.
Gascop
13.
Lurdex
14.
Mediamix V Disthelm
15.
Metiazol
16.
SK&F-62979
17.
SKF-62979
18.
Valbazen
19.
Zentel
20.
Monohydrochloride, Albendazole
21.
SK&F 62979
22.
SK&F62979
23.
SKF 62979
24.
SKF62979
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Vomiting | FAERS: 47 | 9724010 18955802 | CTD SIDER US FAERS |
| 2 | Drug ineffective | FAERS: 22 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 3 | Drug exposure during pregnancy | FAERS: 21 | OFFSIDES US FAERS | |
| 4 | Abdominal Pain | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 5 | Headache | FAERS: 17 Canada Vigilance: 1 | CTD SIDER Canada Vigilance US FAERS | |
| 6 | Nausea | FAERS: 17 | 18955802 | CTD OFFSIDES SIDER US FAERS |
| 7 | Drug ineffective for unapproved indication | FAERS: 15 | US FAERS | |
| 8 | Gastritis | FAERS: 15 | US FAERS | |
| 9 | Asthenia | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 10 | Somnolence | FAERS: 14 | US FAERS | |
| 11 | Alanine Aminotransferase Increased | FAERS: 12 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 12 | Transaminases increased | FAERS: 12 | OFFSIDES US FAERS | |
| 13 | Alopecia | FAERS: 11 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 14 | Aspartate Aminotransferase Increased | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 15 | Product use in unapproved indication | FAERS: 11 | US FAERS | |
| 16 | Pruritus | FAERS: 11 | 18955802 | CTD US FAERS |
| 17 | Encephalitis | FAERS: 10 | OFFSIDES US FAERS | |
| 18 | Fatigue | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 19 | Hepatitis | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 20 | Overdose | FAERS: 9 | US FAERS | |
| 21 | Urticaria | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 22 | Discomfort | FAERS: 8 | US FAERS | |
| 23 | Erythema | FAERS: 8 | OFFSIDES US FAERS | |
| 24 | jaundice | FAERS: 8 | US FAERS | |
| 25 | Contraindicated product administered | FAERS: 7 | US FAERS | |
| 26 | Chromaturia | FAERS: 6 | OFFSIDES US FAERS | |
| 27 | Pancytopenia | FAERS: 6 | SIDER US FAERS | |
| 28 | Aphasia | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 29 | Hepatotoxicity | FAERS: 5 | US FAERS | |
| 30 | Hypersensitivity | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 31 | Pallor | FAERS: 5 | OFFSIDES US FAERS | |
| 32 | Product taste abnormal | FAERS: 5 | US FAERS | |
| 33 | Abdominal discomfort | FAERS: 4 | US FAERS | |
| 34 | Disease recurrence | FAERS: 4 | US FAERS | |
| 35 | Dizziness | FAERS: 4 Canada Vigilance: 3 | 18955802 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 36 | Leukopenia | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 37 | Neutropenia | FAERS: 4 | SIDER US FAERS | |
| 38 | Ocular icterus | FAERS: 4 | OFFSIDES US FAERS | |
| 39 | Chills | FAERS: 3 | US FAERS | |
| 40 | Cyanosis | FAERS: 3 | OFFSIDES US FAERS | |
| 41 | Dehydration | FAERS: 3 | US FAERS | |
| 42 | Drug toxicity | FAERS: 3 | US FAERS | |
| 43 | General physical health deterioration | FAERS: 3 | US FAERS | |
| 44 | Infection | FAERS: 3 | US FAERS | |
| 45 | Malaise | FAERS: 3 | US FAERS | |
| 46 | Medication Error | FAERS: 3 | US FAERS | |
| 47 | Palpitations | FAERS: 3 | US FAERS | |
| 48 | Product use issue | FAERS: 3 | US FAERS | |
| 49 | Tremor | FAERS: 3 | US FAERS | |
| 50 | Urinary Incontinence | FAERS: 3 | US FAERS | |
| 51 | White blood cell count decreased | FAERS: 3 | US FAERS | |
| 52 | Agitation | FAERS: 2 | US FAERS | |
| 53 | Agranulocytosis | FAERS: 2 | SIDER US FAERS | |
| 54 | Anaphylactoid Reaction | FAERS: 2 | US FAERS | |
| 55 | Anorexia | FAERS: 2 | US FAERS | |
| 56 | Autoimmune hepatitis | FAERS: 2 | US FAERS | |
| 57 | Back Pain | FAERS: 2 | US FAERS | |
| 58 | Blood alkaline phosphatase increased | FAERS: 2 | US FAERS | |
| 59 | Blood glucose decreased | FAERS: 2 | US FAERS | |
| 60 | Blood lactate dehydrogenase increased | FAERS: 2 | US FAERS | |
| 61 | Cardiac Arrest | FAERS: 2 | US FAERS | |
| 62 | Constipation | FAERS: 2 | 18955802 | CTD US FAERS |
| 63 | Crying | FAERS: 2 | US FAERS | |
| 64 | Depressed Level of Consciousness | FAERS: 2 | US FAERS | |
| 65 | Disorientation | FAERS: 2 | US FAERS | |
| 66 | Drug effect incomplete | FAERS: 2 | US FAERS | |
| 67 | Epilepsy | FAERS: 2 | OFFSIDES US FAERS | |
| 68 | Feeling abnormal | FAERS: 2 | US FAERS | |
| 69 | Feeling of body temperature change | FAERS: 2 | OFFSIDES US FAERS | |
| 70 | Gastroenteritis | FAERS: 2 | OFFSIDES US FAERS | |
| 71 | Hip Dysplasia | FAERS: 2 | OFFSIDES US FAERS | |
| 72 | Inability to afford medication | FAERS: 2 | US FAERS | |
| 73 | Inappropriate schedule of drug administration | FAERS: 2 | US FAERS | |
| 74 | Incorrect drug administration duration | FAERS: 2 | US FAERS | |
| 75 | Liver Abscess | FAERS: 2 | OFFSIDES US FAERS | |
| 76 | Mental impairment | FAERS: 2 | US FAERS | |
| 77 | Neutrophil count decreased | FAERS: 2 | US FAERS | |
| 78 | Pneumonia | FAERS: 2 | US FAERS | |
| 79 | Polyneuropathy | FAERS: 2 | US FAERS | |
| 80 | Pregnancy | FAERS: 2 | US FAERS | |
| 81 | Rash erythematous | FAERS: 2 | US FAERS | |
| 82 | Restlessness | FAERS: 2 | US FAERS | |
| 83 | Septic Shock | FAERS: 2 | US FAERS | |
| 84 | Somatoform disorder cardiovascular | FAERS: 2 | US FAERS | |
| 85 | Superinfection | FAERS: 2 | US FAERS | |
| 86 | Suspected counterfeit product | FAERS: 2 | US FAERS | |
| 87 | Thrombocytopenia | FAERS: 2 | SIDER US FAERS | |
| 88 | Toxocariasis | FAERS: 2 | 24922534 | CTD US FAERS |
| 89 | Abasia | FAERS: 1 | US FAERS | |
| 90 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 91 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 92 | Acute tonsillitis | FAERS: 1 | US FAERS | |
| 93 | Adams-Stokes Syndrome | FAERS: 1 | US FAERS | |
| 94 | Albumin globulin ratio decreased | FAERS: 1 | US FAERS | |
| 95 | Ammonia increased | FAERS: 1 | US FAERS | |
| 96 | Aneurysm | FAERS: 1 | US FAERS | |
| 97 | Angioedema | FAERS: 1 | US FAERS | |
| 98 | Anxiety | FAERS: 1 | US FAERS | |
| 99 | Aphthous Stomatitis | FAERS: 1 | OFFSIDES US FAERS | |
| 100 | Asphyxia | FAERS: 1 | OFFSIDES US FAERS | |
| 101 | Auricular swelling | FAERS: 1 | US FAERS | |
| 102 | Back disorder | FAERS: 1 | US FAERS | |
| 103 | Bicytopenia | FAERS: 1 | US FAERS | |
| 104 | Blood albumin decreased | FAERS: 1 | US FAERS | |
| 105 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 106 | Blood creatinine decreased | FAERS: 1 | US FAERS | |
| 107 | Blood immunoglobulin E increased | FAERS: 1 | US FAERS | |
| 108 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 109 | Bruxism | FAERS: 1 | US FAERS | |
| 110 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 111 | Cerebral ventricle dilatation | FAERS: 1 | US FAERS | |
| 112 | Chest discomfort | FAERS: 1 | US FAERS | |
| 113 | Choking | FAERS: 1 | OFFSIDES US FAERS | |
| 114 | Cholestasis | FAERS: 1 | US FAERS | |
| 115 | Chronic gastritis | FAERS: 1 | US FAERS | |
| 116 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 117 | Cleft Palate | FAERS: 1 | US FAERS | |
| 118 | Congenital heart valve incompetence | FAERS: 1 | US FAERS | |
| 119 | Depressed mood | FAERS: 1 | US FAERS | |
| 120 | Dermatitis | FAERS: 1 | SIDER US FAERS | |
| 121 | Disseminated Intravascular Coagulation | FAERS: 1 | US FAERS | |
| 122 | Drug administration error | FAERS: 1 | OFFSIDES US FAERS | |
| 123 | Drug dose omission | FAERS: 1 | US FAERS | |
| 124 | Drug level increased | FAERS: 1 | US FAERS | |
| 125 | Drug screen positive | FAERS: 1 | US FAERS | |
| 126 | Dyspepsia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 127 | Dysthymic Disorder | FAERS: 1 | US FAERS | |
| 128 | Ecchymosis | FAERS: 1 | US FAERS | |
| 129 | Electroencephalogram abnormal | FAERS: 1 | US FAERS | |
| 130 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 131 | Empyema | FAERS: 1 | US FAERS | |
| 132 | Epidermolysis | FAERS: 1 | US FAERS | |
| 133 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 134 | Erythema Multiforme | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 135 | Excoriation | FAERS: 1 | US FAERS | |
| 136 | Eye pain | FAERS: 1 | US FAERS | |
| 137 | Feeling Cold | FAERS: 1 | US FAERS | |
| 138 | Gallbladder anomaly congenital | FAERS: 1 | US FAERS | |
| 139 | Gamma-Glutamyltransferase Increased | FAERS: 1 | US FAERS | |
| 140 | Gastrointestinal Pain | FAERS: 1 | SIDER US FAERS | |
| 141 | Granulocyte count decreased | FAERS: 1 | US FAERS | |
| 142 | Granulocytosis | FAERS: 1 | US FAERS | |
| 143 | Haematotoxicity | FAERS: 1 | US FAERS | |
| 144 | Head discomfort | FAERS: 1 | US FAERS | |
| 145 | Hepatic necrosis | FAERS: 1 | OFFSIDES US FAERS | |
| 146 | Hepatitis A | FAERS: 1 | US FAERS | |
| 147 | Histiocytosis haematophagic | FAERS: 1 | US FAERS | |
| 148 | Hyperpyrexia | FAERS: 1 | US FAERS | |
| 149 | Hypotension | FAERS: 1 | US FAERS | |
| 150 | Inability to crawl | FAERS: 1 | US FAERS | |
| 151 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 152 | Inflammation | FAERS: 1 | US FAERS | |
| 153 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 154 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 155 | Meningitis | FAERS: 1 | US FAERS | |
| 156 | Metabolic acidosis | FAERS: 1 | OFFSIDES US FAERS | |
| 157 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 158 | Necrosis | FAERS: 1 | 18955802 | CTD US FAERS |
| 159 | Neutropenic sepsis | FAERS: 1 | US FAERS | |
| 160 | Oral helminthic infection | FAERS: 1 | US FAERS | |
| 161 | Pain | FAERS: 1 | US FAERS | |
| 162 | Parasitic gastroenteritis | FAERS: 1 | US FAERS | |
| 163 | Paternal exposure timing unspecified | FAERS: 1 | US FAERS | |
| 164 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 165 | Petechiae | FAERS: 1 | US FAERS | |
| 166 | Poisoning | FAERS: 1 | US FAERS | |
| 167 | Polyhydramnios | FAERS: 1 | OFFSIDES US FAERS | |
| 168 | Portal tract inflammation | FAERS: 1 | US FAERS | |
| 169 | Prescription drug used without a prescription | FAERS: 1 | US FAERS | |
| 170 | Product counterfeit | FAERS: 1 | US FAERS | |
| 171 | Product physical issue | FAERS: 1 | US FAERS | |
| 172 | Product prescribing error | FAERS: 1 | US FAERS | |
| 173 | Product prescribing issue | FAERS: 1 | US FAERS | |
| 174 | Product quality issue | FAERS: 1 | OFFSIDES US FAERS | |
| 175 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 176 | Product tampering | FAERS: 1 | US FAERS | |
| 177 | Protein urine present | FAERS: 1 | US FAERS | |
| 178 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 179 | Respiratory distress | FAERS: 1 | US FAERS | |
| 180 | Retinal pallor | FAERS: 1 | US FAERS | |
| 181 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 182 | Sepsis | FAERS: 1 | US FAERS | |
| 183 | Sinus Arrhythmia | FAERS: 1 | US FAERS | |
| 184 | Skin irritation | FAERS: 1 | US FAERS | |
| 185 | Small intestine carcinoma | FAERS: 1 | US FAERS | |
| 186 | Sopor | FAERS: 1 | US FAERS | |
| 187 | Stool analysis abnormal | FAERS: 1 | US FAERS | |
| 188 | Stridor | FAERS: 1 | OFFSIDES US FAERS | |
| 189 | Swelling | FAERS: 1 | US FAERS | |
| 190 | Syndactyly | FAERS: 1 | US FAERS | |
| 191 | Tachycardia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 192 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 193 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 194 | Thirst | FAERS: 1 | US FAERS | |
| 195 | Ultrasound scan abnormal | FAERS: 1 | US FAERS | |
| 196 | Unevaluable event | FAERS: 1 | US FAERS | |
| 197 | Unresponsive to verbal stimuli | FAERS: 1 | US FAERS | |
| 198 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 199 | Vasculitis | FAERS: 1 | US FAERS | |
| 200 | Vertigo | FAERS: 1 | SIDER US FAERS | |
| 201 | Viral myocarditis | FAERS: 1 | US FAERS | |
| 202 | Vulvovaginal pruritus | FAERS: 1 | US FAERS | |
| 203 | Weight decreased | FAERS: 1 | US FAERS | |
| 204 | White matter lesion | FAERS: 1 | US FAERS | |
| 205 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 206 | treatment failure | FAERS: 1 | US FAERS | |
| 207 | Abnormal vision | OFFSIDES | ||
| 208 | Acute respiratory failure | OFFSIDES | ||
| 209 | Alopecia reversible | SIDER | ||
| 210 | Anti-neutrophil cytoplasmic antibody positive vasculitis | OFFSIDES | ||
| 211 | Anticholinergic Syndrome | OFFSIDES | ||
| 212 | Aortic Aneurysm | OFFSIDES | ||
| 213 | Apnea | OFFSIDES | ||
| 214 | Ascariasis | 18430913 | CTD | |
| 215 | Automatism | OFFSIDES | ||
| 216 | Blood and lymphatic system disorders | SIDER | ||
| 217 | Blurred vision | OFFSIDES | ||
| 218 | Bronchopneumonia | OFFSIDES | ||
| 219 | Cachexia | Canada Vigilance: 1 | Canada Vigilance | |
| 220 | Calcinosis | OFFSIDES | ||
| 221 | Carcinoembryonic antigen increased | OFFSIDES | ||
| 222 | Chemical and Drug Induced Liver Injury | 9838237 18955802 | CTD | |
| 223 | Cholangiolitis | OFFSIDES | ||
| 224 | Chorioretinitis | OFFSIDES | ||
| 225 | Ciliophora Infections | 12113305 | CTD | |
| 226 | Confusion | 17377173 | CTD | |
| 227 | Conjunctival deposit | OFFSIDES | ||
| 228 | Cysticercosis | 9724010 9843265 16382035 | CTD | |
| 229 | Cyst | Canada Vigilance: 1 | Canada Vigilance OFFSIDES | |
| 230 | Delirium | 11164753 | CTD | |
| 231 | Diffuse alveolar damage | OFFSIDES | ||
| 232 | Drowsiness | OFFSIDES | ||
| 233 | Drug withdrawal headache | OFFSIDES | ||
| 234 | Duodenitis | OFFSIDES | ||
| 235 | Dysphonia | OFFSIDES | ||
| 236 | Echinococcosis, Hepatic | 9838237 | CTD | |
| 237 | Enterococcal infection | OFFSIDES | ||
| 238 | Enterocolitis | OFFSIDES | ||
| 239 | Erythrosis | OFFSIDES | ||
| 240 | Facial paralysis | 17377173 | CTD | |
| 241 | Fatty Liver | 18955802 | CTD OFFSIDES | |
| 242 | Fever | 17377173 | CTD | |
| 243 | Fish Diseases | 12113305 | CTD | |
| 244 | Flatulence | Canada Vigilance: 1 | Canada Vigilance OFFSIDES | |
| 245 | Foreign body sensation in eyes | OFFSIDES | ||
| 246 | Giardiasis | 17333792 | CTD | |
| 247 | Granuloma | 9724010 | CTD | |
| 248 | Helminthiasis | 12886816 | CTD | |
| 249 | Hemiparesis | Canada Vigilance: 1 | Canada Vigilance | |
| 250 | Hepatitis B positive | OFFSIDES | ||
| 251 | Hookworm Infections | 18430913 30007544 | CTD | |
| 252 | Impaired work ability | OFFSIDES | ||
| 253 | Injury asphyxiation | OFFSIDES | ||
| 254 | Intention tremor | OFFSIDES | ||
| 255 | Intracranial Hypertension | 8736154 11565520 | CTD | |
| 256 | Klebsiella sepsis | OFFSIDES | ||
| 257 | Lethargy | OFFSIDES | ||
| 258 | Lymphoma | OFFSIDES | ||
| 259 | Mazzotti reaction | OFFSIDES | ||
| 260 | Mechanical ventilation | OFFSIDES | ||
| 261 | Mucosal erosion | OFFSIDES | ||
| 262 | Multiple Sclerosis | OFFSIDES | ||
| 263 | Muscle Weakness | 17377173 | CTD OFFSIDES | |
| 264 | Nephroangiosclerosis | OFFSIDES | ||
| 265 | Neurocysticercosis | CTD | ||
| 266 | Nuchal Rigidity | OFFSIDES | ||
| 267 | Onchocerciasis | 1796233 | CTD | |
| 268 | Optic Neuritis | 9843265 | CTD | |
| 269 | Parasitic Diseases, Animal | 15907572 | CTD | |
| 270 | Plasmodium falciparum infection | OFFSIDES | ||
| 271 | Polyradiculoneuropathy | 8736154 | CTD | |
| 272 | Portal Hypertension | OFFSIDES | ||
| 273 | Rales | OFFSIDES | ||
| 274 | Restrictive cardiomyopathy | OFFSIDES | ||
| 275 | Rhinitis | OFFSIDES | ||
| 276 | Seizures | 11565520 | CTD | |
| 277 | Status Epilepticus | 9724010 | CTD | |
| 278 | Stevens-Johnson Syndrome | 25811541 | CTD OFFSIDES SIDER | |
| 279 | Superinfection bacterial | OFFSIDES | ||
| 280 | Tauopathies | 16930453 | CTD | |
| 281 | Ulcer | OFFSIDES | ||
| 282 | effusion | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120295
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.