Irinotecan
(GURKHSYORGJETM-WAQYZQTGSA-N)
Structure
- SMILES
- CC[C@@]1(O)C(=O)OCc2c1cc1c3nc4ccc(cc4c(c3Cn1c2=O)CC)OC(=O)N1CCC(CC1)N1CCCCC1.Cl
- Molecular Formula:
- C33H39ClN4O6
- Molecular Weight:
- 623.139
- Log P:
- 4.7689
- Hydrogen Bond Acceptor:
- 10
- Hydrogen Bond Donor:
- 2
- TPSA:
- 114.2
- CAS Number(s):
- 100286-90-6
Synonym(s)
1.
Irinotecan
2.
7-Ethyl-10-hydroxycamptothecin
3.
CPT 11
4.
CPT-11
5.
Camptosar
6.
Camptothecin-11
7.
Irinotecan Hydrochloride
8.
Irrinotecan
9.
NK012 Compound
10.
SN 38
11.
SN 38 11
12.
SN-38
13.
SN-38-11
14.
7 Ethyl 10 hydroxycamptothecin
15.
CPT11
16.
Camptothecin 11
17.
SN3811
External Link(s)
| MeSH | D000077146 |
| PubChem Compound | 74990 67108483 |
| ChEBI | 5971 |
| CHEMBL | CHEMBL541887 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Neutropenia | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 2 | Dehydration | FAERS: 14 | US FAERS | |
| 3 | Vomiting | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 4 | Febrile Neutropenia | FAERS: 13 | US FAERS | |
| 5 | Nausea | FAERS: 12 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 6 | Abdominal Pain | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 7 | Dysarthria | FAERS: 10 | US FAERS | |
| 8 | Pneumonitis | FAERS: 8 | US FAERS | |
| 9 | Aphasia | FAERS: 7 | US FAERS | |
| 10 | Dizziness | FAERS: 7 | US FAERS | |
| 11 | Thrombocytopenia | FAERS: 7 | US FAERS | |
| 12 | Chills | FAERS: 6 | US FAERS | |
| 13 | Infection reactivation | FAERS: 6 | US FAERS | |
| 14 | Leukopenia | FAERS: 6 | US FAERS | |
| 15 | Pneumonia | FAERS: 6 | US FAERS | |
| 16 | Toxicity to various agents | FAERS: 6 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 17 | Disease Progression | FAERS: 5 | US FAERS | |
| 18 | Erythema | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 19 | Fatigue | FAERS: 5 | US FAERS | |
| 20 | General physical health deterioration | FAERS: 5 | US FAERS | |
| 21 | Pruritus | FAERS: 5 | US FAERS | |
| 22 | Respiratory Failure | FAERS: 5 | US FAERS | |
| 23 | Septic Shock | FAERS: 5 | US FAERS | |
| 24 | Asthenia | FAERS: 4 | US FAERS | |
| 25 | Chest Pain | FAERS: 4 | US FAERS | |
| 26 | Empyema | FAERS: 4 | US FAERS | |
| 27 | Flushing | FAERS: 4 | US FAERS | |
| 28 | MYELODYSPLASTIC SYNDROME | FAERS: 4 | US FAERS | |
| 29 | Sepsis | FAERS: 4 | US FAERS | |
| 30 | Urticaria | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 31 | Alopecia | FAERS: 3 | US FAERS | |
| 32 | Cholangitis | FAERS: 3 | US FAERS | |
| 33 | Hypotension | FAERS: 3 | US FAERS | |
| 34 | Large intestine perforation | FAERS: 3 | US FAERS | |
| 35 | Lymphopenia | FAERS: 3 | US FAERS | |
| 36 | Malaise | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 37 | Malignant neoplasm progression | FAERS: 3 | US FAERS | |
| 38 | Neutropenic sepsis | FAERS: 3 | US FAERS | |
| 39 | Pneumothorax | FAERS: 3 | US FAERS | |
| 40 | Shock | FAERS: 3 | US FAERS | |
| 41 | White blood cell count decreased | FAERS: 3 | US FAERS | |
| 42 | Acute kidney injury | FAERS: 2 | US FAERS | |
| 43 | Alanine Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 44 | Angioedema | FAERS: 2 | US FAERS | |
| 45 | Anorexia | FAERS: 2 | US FAERS | |
| 46 | Blood creatinine increased | FAERS: 2 | US FAERS | |
| 47 | Blood iron increased | FAERS: 2 | US FAERS | |
| 48 | Blood magnesium decreased | FAERS: 2 | US FAERS | |
| 49 | Blood urea increased | FAERS: 2 | US FAERS | |
| 50 | Cold sweat | FAERS: 2 | US FAERS | |
| 51 | Disseminated Intravascular Coagulation | FAERS: 2 | US FAERS | |
| 52 | Dyspepsia | FAERS: 2 | US FAERS | |
| 53 | Gastrointestinal toxicity | FAERS: 2 | US FAERS | |
| 54 | Hemiparesis | FAERS: 2 | US FAERS | |
| 55 | Hyperpyrexia | FAERS: 2 | US FAERS | |
| 56 | Hypersensitivity | FAERS: 2 | US FAERS | |
| 57 | Ileal ulcer | FAERS: 2 | US FAERS | |
| 58 | Leukocytosis | FAERS: 2 | US FAERS | |
| 59 | Metabolic acidosis | FAERS: 2 | US FAERS | |
| 60 | Myoclonus | FAERS: 2 | US FAERS | |
| 61 | Neutropenic colitis | FAERS: 2 | US FAERS | |
| 62 | Oral mucosal exfoliation | FAERS: 2 | US FAERS | |
| 63 | Pancytopenia | FAERS: 2 | US FAERS | |
| 64 | Polyneuropathy | FAERS: 2 | US FAERS | |
| 65 | Post procedural bile leak | FAERS: 2 | US FAERS | |
| 66 | Pulmonary toxicity | FAERS: 2 | US FAERS | |
| 67 | Rales | FAERS: 2 | US FAERS | |
| 68 | Renal tubular acidosis | FAERS: 2 | US FAERS | |
| 69 | Sudden death | FAERS: 2 | US FAERS | |
| 70 | Syncope | FAERS: 2 | US FAERS | |
| 71 | Tachycardia | FAERS: 2 | US FAERS | |
| 72 | Wheezing | FAERS: 2 | US FAERS | |
| 73 | Abdominal Abscess | FAERS: 1 | US FAERS | |
| 74 | Abscess | FAERS: 1 | US FAERS | |
| 75 | Acidosis | FAERS: 1 | US FAERS | |
| 76 | Acute Coronary Syndrome | FAERS: 1 | US FAERS | |
| 77 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 78 | Anal infection | FAERS: 1 | US FAERS | |
| 79 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 80 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 81 | Anti-platelet antibody positive | FAERS: 1 | US FAERS | |
| 82 | Ascites | FAERS: 1 | US FAERS | |
| 83 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 84 | Asthma | FAERS: 1 | US FAERS | |
| 85 | Autonomic neuropathy | FAERS: 1 | US FAERS | |
| 86 | Back Pain | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 87 | Bacteria blood identified | FAERS: 1 | US FAERS | |
| 88 | Blood bilirubin unconjugated increased | FAERS: 1 | US FAERS | |
| 89 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 90 | Blood creatinine decreased | FAERS: 1 | US FAERS | |
| 91 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 92 | Blood pressure inadequately controlled | FAERS: 1 | US FAERS | |
| 93 | Blood pressure orthostatic abnormal | FAERS: 1 | US FAERS | |
| 94 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 95 | Bradycardia | FAERS: 1 | US FAERS | |
| 96 | Bronchopulmonary Aspergillosis | FAERS: 1 | US FAERS | |
| 97 | Carbohydrate antigen 19-9 increased | FAERS: 1 | US FAERS | |
| 98 | Cellulitis | FAERS: 1 | US FAERS | |
| 99 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 100 | Cerebral Thrombosis | FAERS: 1 | US FAERS | |
| 101 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 102 | Chest discomfort | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 103 | Colitis | FAERS: 1 | US FAERS | |
| 104 | Constipation | FAERS: 1 | US FAERS | |
| 105 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 106 | Device related infection | FAERS: 1 | US FAERS | |
| 107 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 108 | Diplopia | FAERS: 1 | US FAERS | |
| 109 | Drug abuser | FAERS: 1 | US FAERS | |
| 110 | Drug ineffective | FAERS: 1 | US FAERS | |
| 111 | Drug toxicity | FAERS: 1 | US FAERS | |
| 112 | Drug withdrawal syndrome | FAERS: 1 | US FAERS | |
| 113 | Duodenal ulcer perforation | FAERS: 1 | US FAERS | |
| 114 | Dyslalia | FAERS: 1 | US FAERS | |
| 115 | Dysuria | FAERS: 1 | US FAERS | |
| 116 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 117 | Epilepsy | FAERS: 1 | US FAERS | |
| 118 | Eructation | FAERS: 1 | US FAERS | |
| 119 | Essential Hypertension | FAERS: 1 | US FAERS | |
| 120 | Extravasation | FAERS: 1 | US FAERS | |
| 121 | Eye irritation | FAERS: 1 | US FAERS | |
| 122 | Fanconi Syndrome | FAERS: 1 | US FAERS | |
| 123 | Fine motor delay | FAERS: 1 | US FAERS | |
| 124 | Flatulence | FAERS: 1 | US FAERS | |
| 125 | Gastric infection | FAERS: 1 | US FAERS | |
| 126 | Gastrointestinal candidiasis | FAERS: 1 | US FAERS | |
| 127 | Gene Mutation | FAERS: 1 | US FAERS | |
| 128 | Gram stain positive | FAERS: 1 | US FAERS | |
| 129 | Headache | FAERS: 1 | US FAERS | |
| 130 | Hepatitis | FAERS: 1 | US FAERS | |
| 131 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 132 | Homicide | FAERS: 1 | US FAERS | |
| 133 | Hypertransaminasaemia | FAERS: 1 | US FAERS | |
| 134 | Incontinence | FAERS: 1 | US FAERS | |
| 135 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 136 | Infusion site swelling | FAERS: 1 | US FAERS | |
| 137 | Laryngospasm | FAERS: 1 | US FAERS | |
| 138 | Leukoencephalopathy | FAERS: 1 | US FAERS | |
| 139 | Lip swelling | FAERS: 1 | US FAERS | |
| 140 | Liver Abscess | FAERS: 1 | US FAERS | |
| 141 | Macroglossia | FAERS: 1 | US FAERS | |
| 142 | Malnutrition | FAERS: 1 | US FAERS | |
| 143 | Metastasis | FAERS: 1 | US FAERS | |
| 144 | Monocyte count decreased | FAERS: 1 | US FAERS | |
| 145 | Myalgia | FAERS: 1 | US FAERS | |
| 146 | Myocarditis | FAERS: 1 | US FAERS | |
| 147 | Myositis | FAERS: 1 | US FAERS | |
| 148 | Neuropathy | FAERS: 1 | US FAERS | |
| 149 | Oculomucocutaneous syndrome | FAERS: 1 | US FAERS | |
| 150 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 151 | Pain | FAERS: 1 | US FAERS | |
| 152 | Pelvic abscess | FAERS: 1 | US FAERS | |
| 153 | Performance status decreased | FAERS: 1 | US FAERS | |
| 154 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 155 | Peripheral motor neuropathy | FAERS: 1 | US FAERS | |
| 156 | Peritonitis | FAERS: 1 | US FAERS | |
| 157 | Petechiae | FAERS: 1 | US FAERS | |
| 158 | Phlebitis | FAERS: 1 | US FAERS | |
| 159 | Pleural Infection | FAERS: 1 | US FAERS | |
| 160 | Pneumatosis intestinalis | FAERS: 1 | US FAERS | |
| 161 | Portal venous gas | FAERS: 1 | US FAERS | |
| 162 | Product barcode issue | FAERS: 1 | US FAERS | |
| 163 | Product quality issue | FAERS: 1 | US FAERS | |
| 164 | Productive Cough | FAERS: 1 | US FAERS | |
| 165 | Pseudomonas bronchitis | FAERS: 1 | US FAERS | |
| 166 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 167 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 168 | Purulence | FAERS: 1 | US FAERS | |
| 169 | Recall phenomenon | FAERS: 1 | US FAERS | |
| 170 | Sense of oppression | FAERS: 1 | US FAERS | |
| 171 | Small cell lung cancer extensive stage | FAERS: 1 | US FAERS | |
| 172 | Small intestinal ulcer perforation | FAERS: 1 | US FAERS | |
| 173 | Stomatitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 174 | Subileus | FAERS: 1 | US FAERS | |
| 175 | Sudden Visual Loss | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 176 | Swelling | FAERS: 1 | US FAERS | |
| 177 | Tachyphylaxis | FAERS: 1 | US FAERS | |
| 178 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 179 | Transaminases increased | FAERS: 1 | US FAERS | |
| 180 | Transferrin saturation increased | FAERS: 1 | US FAERS | |
| 181 | Tremor | FAERS: 1 | US FAERS | |
| 182 | Vasculitis | FAERS: 1 | US FAERS | |
| 183 | pseudomembranous colitis | FAERS: 1 | US FAERS | |
| 184 | Pharyngeal swelling | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.