ioversol
(AMDBBAQNWSUWGN-UHFFFAOYSA-N)
Structure
- SMILES
- OCCN(c1c(I)c(C(=O)NCC(CO)O)c(c(c1I)C(=O)NCC(CO)O)I)C(=O)CO
- Type(s)
- Approved
- ATC code(s)
- V08AB07
- Molecular Formula:
- C18H24I3N3O9
- Molecular Weight:
- 807.111
- Log P:
- -1.2342
- Hydrogen Bond Acceptor:
- 12
- Hydrogen Bond Donor:
- 8
- TPSA:
- 199.89
- CAS Number(s):
- 8771-40-2; 87771-40-2
Synonym(s)
1.
ioversol
2.
Optiray
3.
Optiray 300
4.
Optiray 320
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Urticaria | FAERS: 345 Canada Vigilance: 13 | 2917833 | CTD SIDER Canada Vigilance US FAERS |
| 2 | Pruritus | FAERS: 248 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 3 | Throat irritation | FAERS: 169 | US FAERS | |
| 4 | Sneezing | FAERS: 145 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 5 | Anaphylactic shock | FAERS: 137 | SIDER US FAERS | |
| 6 | Erythema | FAERS: 136 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 7 | Nausea | FAERS: 134 Canada Vigilance: 1 | 2917833 | CTD SIDER Canada Vigilance US FAERS |
| 8 | Vomiting | FAERS: 121 Canada Vigilance: 1 | 2917833 | CTD SIDER Canada Vigilance US FAERS |
| 9 | Chest discomfort | FAERS: 92 | US FAERS | |
| 10 | Hypersensitivity | FAERS: 79 | US FAERS | |
| 11 | Shock | FAERS: 64 | SIDER US FAERS | |
| 12 | Cardiac Arrest | FAERS: 60 | SIDER US FAERS | |
| 13 | Contrast media reaction | FAERS: 56 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 14 | Drug administration error | FAERS: 52 | OFFSIDES US FAERS | |
| 15 | Dizziness | FAERS: 46 | SIDER US FAERS | |
| 16 | Air Embolism | FAERS: 43 | OFFSIDES US FAERS | |
| 17 | Bronchospasm | FAERS: 43 | SIDER US FAERS | |
| 18 | Malaise | FAERS: 43 | US FAERS | |
| 19 | Wheezing | FAERS: 42 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 20 | Chest Pain | FAERS: 41 | SIDER US FAERS | |
| 21 | Flushing | FAERS: 38 | SIDER US FAERS | |
| 22 | Hypotension | FAERS: 36 | SIDER US FAERS | |
| 23 | Cyanosis | FAERS: 35 | OFFSIDES SIDER US FAERS | |
| 24 | Lip swelling | FAERS: 33 | US FAERS | |
| 25 | Tremor | FAERS: 33 | SIDER US FAERS | |
| 26 | Headache | FAERS: 32 | SIDER US FAERS | |
| 27 | Injection site extravasation | FAERS: 31 | US FAERS | |
| 28 | Tachycardia | FAERS: 31 | SIDER US FAERS | |
| 29 | Dysphonia | FAERS: 30 | US FAERS | |
| 30 | Procedural complication | FAERS: 30 | OFFSIDES US FAERS | |
| 31 | Chills | FAERS: 28 | SIDER US FAERS | |
| 32 | Respiratory arrest | FAERS: 27 | US FAERS | |
| 33 | Respiratory distress | FAERS: 26 | US FAERS | |
| 34 | Angioedema | FAERS: 25 | SIDER US FAERS | |
| 35 | Oral pruritus | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 36 | Pallor | FAERS: 25 | OFFSIDES SIDER US FAERS | |
| 37 | Unresponsive to stimuli | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 38 | Extravasation | FAERS: 23 | SIDER US FAERS | |
| 39 | Anaphylactoid Reaction | FAERS: 21 | US FAERS | |
| 40 | Asthenia | FAERS: 20 | US FAERS | |
| 41 | Burning sensation | FAERS: 19 | US FAERS | |
| 42 | Depressed Level of Consciousness | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 43 | Post procedural complication | FAERS: 17 | US FAERS | |
| 44 | Feeling abnormal | FAERS: 16 | SIDER US FAERS | |
| 45 | Pain | FAERS: 16 | SIDER US FAERS | |
| 46 | Retching | FAERS: 16 | US FAERS | |
| 47 | Medication Error | FAERS: 15 | US FAERS | |
| 48 | Oropharyngeal pain | FAERS: 14 | OFFSIDES US FAERS | |
| 49 | Papule | FAERS: 14 | US FAERS | |
| 50 | Rash erythematous | FAERS: 14 | US FAERS | |
| 51 | Ventricular Fibrillation | FAERS: 14 | 10823730 | CTD OFFSIDES SIDER US FAERS |
| 52 | Anxiety | FAERS: 13 | SIDER US FAERS | |
| 53 | Bradycardia | FAERS: 13 | SIDER US FAERS | |
| 54 | Agitation | FAERS: 12 | SIDER US FAERS | |
| 55 | Respiratory Failure | FAERS: 12 | US FAERS | |
| 56 | Syncope | FAERS: 12 | SIDER US FAERS | |
| 57 | Abdominal Pain | FAERS: 11 | US FAERS | |
| 58 | Contrast media allergy | FAERS: 11 | US FAERS | |
| 59 | Oropharyngeal discomfort | FAERS: 11 | US FAERS | |
| 60 | Accidental exposure | FAERS: 10 | OFFSIDES US FAERS | |
| 61 | Swelling | FAERS: 10 | US FAERS | |
| 62 | Blood pressure immeasurable | FAERS: 9 | US FAERS | |
| 63 | Myocardial Infarction | FAERS: 9 | SIDER US FAERS | |
| 64 | Palpitations | FAERS: 9 | US FAERS | |
| 65 | Pneumonia | FAERS: 9 | US FAERS | |
| 66 | Wrong technique in drug usage process | FAERS: 9 | OFFSIDES US FAERS | |
| 67 | Asthma | FAERS: 8 | OFFSIDES SIDER US FAERS | |
| 68 | Injection site pain | FAERS: 8 | US FAERS | |
| 69 | Injection site vesicles | FAERS: 8 | OFFSIDES US FAERS | |
| 70 | Petechiae | FAERS: 8 | US FAERS | |
| 71 | Aphasia | FAERS: 7 | SIDER US FAERS | |
| 72 | Fatigue | FAERS: 7 | US FAERS | |
| 73 | Foaming at mouth | FAERS: 7 | OFFSIDES US FAERS | |
| 74 | Incontinence | FAERS: 7 | US FAERS | |
| 75 | Laryngospasm | FAERS: 7 | SIDER US FAERS | |
| 76 | Restlessness | FAERS: 7 | US FAERS | |
| 77 | Choking | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 78 | Cold sweat | FAERS: 6 | US FAERS | |
| 79 | Incorrect route of drug administration | FAERS: 6 | OFFSIDES US FAERS | |
| 80 | Injection site erythema | FAERS: 6 | US FAERS | |
| 81 | Injection site necrosis | FAERS: 6 | US FAERS | |
| 82 | Laryngeal discomfort | FAERS: 6 | US FAERS | |
| 83 | Nasal discomfort | FAERS: 6 | OFFSIDES US FAERS | |
| 84 | Urinary Incontinence | FAERS: 6 | US FAERS | |
| 85 | Altered state of consciousness | FAERS: 5 | US FAERS | |
| 86 | Arthralgia | FAERS: 5 | US FAERS | |
| 87 | Cardiac procedure complication | FAERS: 5 | OFFSIDES US FAERS | |
| 88 | Drug ineffective | FAERS: 5 | US FAERS | |
| 89 | Dysgeusia | FAERS: 5 | SIDER US FAERS | |
| 90 | Eye irritation | FAERS: 5 | US FAERS | |
| 91 | Feeling Cold | FAERS: 5 | US FAERS | |
| 92 | General physical health deterioration | FAERS: 5 | US FAERS | |
| 93 | Hypoaesthesia facial | FAERS: 5 | US FAERS | |
| 94 | Iatrogenic injury | FAERS: 5 | OFFSIDES US FAERS | |
| 95 | Lethargy | FAERS: 5 | US FAERS | |
| 96 | Peripheral swelling | FAERS: 5 | US FAERS | |
| 97 | Product quality issue | FAERS: 5 | US FAERS | |
| 98 | Vertigo | FAERS: 5 | SIDER US FAERS | |
| 99 | Back Pain | FAERS: 4 | US FAERS | |
| 100 | Coronary Artery Disease | FAERS: 4 | US FAERS | |
| 101 | Hyperventilation | FAERS: 4 | US FAERS | |
| 102 | Hypothyroidism | FAERS: 4 | US FAERS | |
| 103 | Musculoskeletal stiffness | FAERS: 4 | SIDER US FAERS | |
| 104 | Pharmaceutical product complaint | FAERS: 4 | US FAERS | |
| 105 | Pharyngolaryngeal discomfort | FAERS: 4 | US FAERS | |
| 106 | Presyncope | FAERS: 4 | US FAERS | |
| 107 | Pulmonary Embolism | FAERS: 4 | US FAERS | |
| 108 | Rales | FAERS: 4 | OFFSIDES US FAERS | |
| 109 | Skin reaction | FAERS: 4 | US FAERS | |
| 110 | Somnolence | FAERS: 4 | SIDER US FAERS | |
| 111 | Tongue pruritus | FAERS: 4 | US FAERS | |
| 112 | Upper respiratory tract congestion | FAERS: 4 | US FAERS | |
| 113 | Band sensation | FAERS: 3 | US FAERS | |
| 114 | Blood creatinine increased | FAERS: 3 | US FAERS | |
| 115 | Brain Death | FAERS: 3 | OFFSIDES US FAERS | |
| 116 | Cerebrovascular accident | FAERS: 3 | SIDER US FAERS | |
| 117 | Coronary artery perforation | FAERS: 3 | OFFSIDES US FAERS | |
| 118 | Dehydration | FAERS: 3 | SIDER US FAERS | |
| 119 | Discomfort | FAERS: 3 | SIDER US FAERS | |
| 120 | Drug exposure during pregnancy | FAERS: 3 | US FAERS | |
| 121 | Drug toxicity | FAERS: 3 | US FAERS | |
| 122 | Ear discomfort | FAERS: 3 | US FAERS | |
| 123 | Epistaxis | FAERS: 3 | US FAERS | |
| 124 | Exophthalmos | FAERS: 3 | OFFSIDES US FAERS | |
| 125 | Facial Pain | FAERS: 3 | US FAERS | |
| 126 | Heart sounds abnormal | FAERS: 3 | OFFSIDES US FAERS | |
| 127 | Hemiparesis | FAERS: 3 | SIDER US FAERS | |
| 128 | Hypoventilation | FAERS: 3 | US FAERS | |
| 129 | Hypoxia | FAERS: 3 | US FAERS | |
| 130 | Immediate post-injection reaction | FAERS: 3 | OFFSIDES US FAERS | |
| 131 | Injection site inflammation | FAERS: 3 | OFFSIDES US FAERS | |
| 132 | Laceration | FAERS: 3 | US FAERS | |
| 133 | Medical device complication | FAERS: 3 | OFFSIDES US FAERS | |
| 134 | Mouth swelling | FAERS: 3 | US FAERS | |
| 135 | No adverse event | FAERS: 3 | US FAERS | |
| 136 | Post procedural hypothyroidism | FAERS: 3 | US FAERS | |
| 137 | Pulmonary congestion | FAERS: 3 | US FAERS | |
| 138 | Renal pain | FAERS: 3 | US FAERS | |
| 139 | Renal tubular necrosis | FAERS: 3 | SIDER US FAERS | |
| 140 | Screaming | FAERS: 3 | US FAERS | |
| 141 | Sepsis | FAERS: 3 | US FAERS | |
| 142 | Stridor | FAERS: 3 | US FAERS | |
| 143 | Syringe issue | FAERS: 3 | US FAERS | |
| 144 | Thrombosis | FAERS: 3 | SIDER US FAERS | |
| 145 | Vessel puncture site discharge | FAERS: 3 | OFFSIDES US FAERS | |
| 146 | Visual Impairment | FAERS: 3 | US FAERS | |
| 147 | Vulvovaginal pruritus | FAERS: 3 | OFFSIDES US FAERS | |
| 148 | Yawning | FAERS: 3 | OFFSIDES US FAERS | |
| 149 | Abdominal discomfort | FAERS: 2 | OFFSIDES US FAERS | |
| 150 | Accidental exposure to product | FAERS: 2 | US FAERS | |
| 151 | Alopecia | FAERS: 2 | US FAERS | |
| 152 | Amnesia | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 153 | Anal sphincter atony | FAERS: 2 | US FAERS | |
| 154 | Anuria | FAERS: 2 | SIDER US FAERS | |
| 155 | Atrioventricular Block | FAERS: 2 | SIDER US FAERS | |
| 156 | Cardiac perforation | FAERS: 2 | OFFSIDES US FAERS | |
| 157 | Cardiovascular insufficiency | FAERS: 2 | US FAERS | |
| 158 | Cellulitis | FAERS: 2 | US FAERS | |
| 159 | Device breakage | FAERS: 2 | OFFSIDES US FAERS | |
| 160 | Disorientation | FAERS: 2 | SIDER US FAERS | |
| 161 | Documented hypersensitivity to administered drug | FAERS: 2 | US FAERS | |
| 162 | Dry skin | FAERS: 2 | US FAERS | |
| 163 | Electrocardiogram ST segment abnormal | FAERS: 2 | US FAERS | |
| 164 | Embolism | FAERS: 2 | SIDER US FAERS | |
| 165 | Emotional distress | FAERS: 2 | US FAERS | |
| 166 | Epidermolysis | FAERS: 2 | US FAERS | |
| 167 | Epilepsy | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 168 | Eye pain | FAERS: 2 | US FAERS | |
| 169 | Idiosyncratic drug reaction | FAERS: 2 | US FAERS | |
| 170 | Increased bronchial secretion | FAERS: 2 | OFFSIDES US FAERS | |
| 171 | Injection site urticaria | FAERS: 2 | US FAERS | |
| 172 | Memory impairment | FAERS: 2 | US FAERS | |
| 173 | Muscle Rigidity | FAERS: 2 | US FAERS | |
| 174 | Muscle tightness | FAERS: 2 | US FAERS | |
| 175 | Myalgia | FAERS: 2 | US FAERS | |
| 176 | Nerve injury | FAERS: 2 | US FAERS | |
| 177 | Overdose | FAERS: 2 | US FAERS | |
| 178 | Procedural hypotension | FAERS: 2 | US FAERS | |
| 179 | Purpura | FAERS: 2 | SIDER US FAERS | |
| 180 | Retinal artery spasm | FAERS: 2 | OFFSIDES US FAERS | |
| 181 | Rhinitis | FAERS: 2 | US FAERS | |
| 182 | Secretion discharge | FAERS: 2 | OFFSIDES US FAERS | |
| 183 | Septic Shock | FAERS: 2 | US FAERS | |
| 184 | Skin tightness | FAERS: 2 | US FAERS | |
| 185 | Tinnitus | FAERS: 2 | SIDER US FAERS | |
| 186 | Ventricular arrhythmia | FAERS: 2 | US FAERS | |
| 187 | jaundice | FAERS: 2 | US FAERS | |
| 188 | nervous system disorder | FAERS: 2 | US FAERS | |
| 189 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 190 | Acute respiratory failure | FAERS: 1 | US FAERS | |
| 191 | Akathisia | FAERS: 1 | US FAERS | |
| 192 | Anoxic Encephalopathy | FAERS: 1 | US FAERS | |
| 193 | Aortic Aneurysm | FAERS: 1 | US FAERS | |
| 194 | Aphonia | FAERS: 1 | US FAERS | |
| 195 | Appendicitis | FAERS: 1 | US FAERS | |
| 196 | Asphyxia | FAERS: 1 | US FAERS | |
| 197 | Bladder sphincter atony | FAERS: 1 | US FAERS | |
| 198 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 199 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 200 | Blood urea increased | FAERS: 1 | US FAERS | |
| 201 | Bone pain | FAERS: 1 | US FAERS | |
| 202 | Catatonia | FAERS: 1 | US FAERS | |
| 203 | Catheter related complication | FAERS: 1 | US FAERS | |
| 204 | Catheter site discharge | FAERS: 1 | US FAERS | |
| 205 | Cheilitis | FAERS: 1 | US FAERS | |
| 206 | Cholestasis | FAERS: 1 | US FAERS | |
| 207 | Clonus | FAERS: 1 | US FAERS | |
| 208 | Crying | FAERS: 1 | US FAERS | |
| 209 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 210 | Dermatitis | FAERS: 1 | SIDER US FAERS | |
| 211 | Device Failure | FAERS: 1 | OFFSIDES US FAERS | |
| 212 | Disease Progression | FAERS: 1 | US FAERS | |
| 213 | Drooling | FAERS: 1 | US FAERS | |
| 214 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 215 | Dysarthria | FAERS: 1 | US FAERS | |
| 216 | Ecchymosis | FAERS: 1 | SIDER US FAERS | |
| 217 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 218 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 219 | Electrocardiogram change | FAERS: 1 | US FAERS | |
| 220 | Electroencephalogram abnormal | FAERS: 1 | US FAERS | |
| 221 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 222 | Electromechanical dissociation | FAERS: 1 | US FAERS | |
| 223 | Endotracheal intubation complication | FAERS: 1 | US FAERS | |
| 224 | Eructation | FAERS: 1 | US FAERS | |
| 225 | Expired drug administered | FAERS: 1 | US FAERS | |
| 226 | Exposure via eye contact | FAERS: 1 | US FAERS | |
| 227 | Eyelids pruritus | FAERS: 1 | US FAERS | |
| 228 | Flatulence | FAERS: 1 | US FAERS | |
| 229 | Formication | FAERS: 1 | US FAERS | |
| 230 | Genital rash | FAERS: 1 | OFFSIDES US FAERS | |
| 231 | Head discomfort | FAERS: 1 | US FAERS | |
| 232 | Hypercalciuria | FAERS: 1 | US FAERS | |
| 233 | Hypercapnia | FAERS: 1 | US FAERS | |
| 234 | Hyperreflexia | FAERS: 1 | US FAERS | |
| 235 | Hypokinesia | FAERS: 1 | US FAERS | |
| 236 | Incoherent | FAERS: 1 | US FAERS | |
| 237 | Incorrect route of product administration | FAERS: 1 | US FAERS | |
| 238 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 239 | Infrequent bowel movements | FAERS: 1 | US FAERS | |
| 240 | Infusion site reaction | FAERS: 1 | US FAERS | |
| 241 | Injection site discomfort | FAERS: 1 | US FAERS | |
| 242 | Injection site irritation | FAERS: 1 | US FAERS | |
| 243 | Iodine allergy | FAERS: 1 | US FAERS | |
| 244 | Kounis Syndrome | FAERS: 1 | US FAERS | |
| 245 | Latent tetany | FAERS: 1 | US FAERS | |
| 246 | Left Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 247 | Lip erosion | FAERS: 1 | US FAERS | |
| 248 | Lip pruritus | FAERS: 1 | US FAERS | |
| 249 | Lividity | FAERS: 1 | US FAERS | |
| 250 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 251 | Mydriasis | FAERS: 1 | US FAERS | |
| 252 | Myoclonus | FAERS: 1 | US FAERS | |
| 253 | Nasal sinus drainage | FAERS: 1 | OFFSIDES US FAERS | |
| 254 | Neck Pain | FAERS: 1 | US FAERS | |
| 255 | Necrosis | FAERS: 1 | SIDER US FAERS | |
| 256 | Neuralgia | FAERS: 1 | US FAERS | |
| 257 | No reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 258 | Occupational exposure to product | FAERS: 1 | US FAERS | |
| 259 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 260 | Oral pain | FAERS: 1 | US FAERS | |
| 261 | Oropharyngeal swelling | FAERS: 1 | US FAERS | |
| 262 | Pain of skin | FAERS: 1 | US FAERS | |
| 263 | Periorbital swelling | FAERS: 1 | US FAERS | |
| 264 | Peritonitis | FAERS: 1 | US FAERS | |
| 265 | Pharyngeal swelling | FAERS: 1 | US FAERS | |
| 266 | Pneumopericardium | FAERS: 1 | US FAERS | |
| 267 | Polyarthritis | FAERS: 1 | US FAERS | |
| 268 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 269 | Postresuscitation encephalopathy | FAERS: 1 | US FAERS | |
| 270 | Posturing | FAERS: 1 | US FAERS | |
| 271 | Primary Hypothyroidism | FAERS: 1 | US FAERS | |
| 272 | Product deposit | FAERS: 1 | US FAERS | |
| 273 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 274 | Product use issue | FAERS: 1 | US FAERS | |
| 275 | Productive Cough | FAERS: 1 | US FAERS | |
| 276 | Radiation exposure during pregnancy | FAERS: 1 | US FAERS | |
| 277 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 278 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 279 | Saliva altered | FAERS: 1 | US FAERS | |
| 280 | Simple Partial Seizures | FAERS: 1 | US FAERS | |
| 281 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 282 | Sinus bradycardia | FAERS: 1 | SIDER US FAERS | |
| 283 | Sinus headache | FAERS: 1 | US FAERS | |
| 284 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 285 | Skin irritation | FAERS: 1 | US FAERS | |
| 286 | Skin test positive | FAERS: 1 | US FAERS | |
| 287 | Small bowel angioedema | FAERS: 1 | US FAERS | |
| 288 | Snoring | FAERS: 1 | US FAERS | |
| 289 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 290 | Superinfection | FAERS: 1 | US FAERS | |
| 291 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 292 | Tachyarrhythmia | FAERS: 1 | US FAERS | |
| 293 | Tension Headache | FAERS: 1 | US FAERS | |
| 294 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 295 | Thermal burn | FAERS: 1 | US FAERS | |
| 296 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 297 | Thrombophlebitis | FAERS: 1 | SIDER US FAERS | |
| 298 | Transaminases decreased | FAERS: 1 | US FAERS | |
| 299 | Trigeminal Neuralgia | FAERS: 1 | US FAERS | |
| 300 | Troponin I increased | FAERS: 1 | US FAERS | |
| 301 | Troponin T increased | FAERS: 1 | US FAERS | |
| 302 | Type II hypersensitivity | FAERS: 1 | US FAERS | |
| 303 | Unevaluable event | FAERS: 1 | US FAERS | |
| 304 | Unresponsive to verbal stimuli | FAERS: 1 | US FAERS | |
| 305 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 306 | Ventricular hypokinesia | FAERS: 1 | US FAERS | |
| 307 | Vital functions abnormal | FAERS: 1 | US FAERS | |
| 308 | Weaning failure | FAERS: 1 | US FAERS | |
| 309 | Weight decreased | FAERS: 1 | US FAERS | |
| 310 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 311 | Abnormal vision | OFFSIDES | ||
| 312 | Acidosis | SIDER | ||
| 313 | Acne | OFFSIDES | ||
| 314 | Acute Coronary Syndrome | SIDER | ||
| 315 | Agraphia | OFFSIDES | ||
| 316 | Alcoholic Intoxication | OFFSIDES | ||
| 317 | Angina Pectoris | SIDER | ||
| 318 | Ankle Fracture | OFFSIDES | ||
| 319 | Anoxia | SIDER | ||
| 320 | Aortic Valve Stenosis | SIDER | ||
| 321 | Arterial thrombosis | SIDER | ||
| 322 | Arteriosclerosis | SIDER | ||
| 323 | Arteriovenous fistula | OFFSIDES SIDER | ||
| 324 | Arthritis | OFFSIDES | ||
| 325 | Atheroma | SIDER | ||
| 326 | Atherosclerosis | SIDER | ||
| 327 | Band neutrophil percentage increased | OFFSIDES | ||
| 328 | Basophil percentage increased | OFFSIDES | ||
| 329 | Blindness | SIDER | ||
| 330 | Blood magnesium decreased | OFFSIDES | ||
| 331 | Blood pressure fluctuation | SIDER | ||
| 332 | Blood triglycerides increased | OFFSIDES | ||
| 333 | Cardiac Tamponade | SIDER | ||
| 334 | Cerebral Infarction | SIDER | ||
| 335 | Choking sensation | OFFSIDES | ||
| 336 | Circumstance or information capable of leading to medication error | OFFSIDES | ||
| 337 | Concomitant disease aggravated | OFFSIDES | ||
| 338 | Conjunctival deposit | OFFSIDES | ||
| 339 | Conjunctivitis | SIDER | ||
| 340 | Coronary angioplasty | OFFSIDES | ||
| 341 | Diplegia | SIDER | ||
| 342 | Disseminated Intravascular Coagulation | SIDER | ||
| 343 | Drowsiness | SIDER | ||
| 344 | Drug prescribing error | OFFSIDES | ||
| 345 | Dysphasia | SIDER | ||
| 346 | Dyspnea | 8761866 | CTD | |
| 347 | Ejection fraction abnormal | OFFSIDES | ||
| 348 | Eschar | OFFSIDES | ||
| 349 | Foreign body trauma | OFFSIDES | ||
| 350 | Gangrene | SIDER | ||
| 351 | Gingival erythema | OFFSIDES | ||
| 352 | Goiter | OFFSIDES | ||
| 353 | Graft infection | OFFSIDES | ||
| 354 | Hemiplegia | SIDER | ||
| 355 | Hypertensive crisis | SIDER | ||
| 356 | Hypotensive | SIDER | ||
| 357 | Infarction | SIDER | ||
| 358 | Injection site dermatitis | OFFSIDES | ||
| 359 | Intention tremor | OFFSIDES | ||
| 360 | Kidney Diseases | 16444061 | CTD | |
| 361 | Lacrimation | SIDER | ||
| 362 | Lightheadedness | SIDER | ||
| 363 | Lordosis | SIDER | ||
| 364 | Lymphoma | OFFSIDES | ||
| 365 | Monoplegia | SIDER | ||
| 366 | Nasopharyngitis | OFFSIDES | ||
| 367 | Neck stiffness | SIDER | ||
| 368 | Neurologic reaction | SIDER | ||
| 369 | Neutropenia | SIDER | ||
| 370 | Nuchal Rigidity | SIDER | ||
| 371 | Nystagmus | SIDER | ||
| 372 | Obstruction | SIDER | ||
| 373 | Oliguria | SIDER | ||
| 374 | Paraplegia | SIDER | ||
| 375 | Polyuria | SIDER | ||
| 376 | Prostate cancer recurrent | OFFSIDES | ||
| 377 | Protein urine present | SIDER | ||
| 378 | Proteinuria | SIDER | ||
| 379 | Quadriplegia | SIDER | ||
| 380 | Renal Colic | SIDER | ||
| 381 | Renal Insufficiency | 9169676 | CTD | |
| 382 | Scotoma | SIDER | ||
| 383 | Seizures | 8761866 | CTD | |
| 384 | Sensation of warmth | SIDER | ||
| 385 | Septic arthritis staphylococcal | OFFSIDES | ||
| 386 | Skin lesion | OFFSIDES | ||
| 387 | Swelling of eyelid | Canada Vigilance: 1 | Canada Vigilance | |
| 388 | Trauma | SIDER | ||
| 389 | Urinary Retention | SIDER | ||
| 390 | Urine output increased | SIDER | ||
| 391 | Vascular insufficiency | SIDER | ||
| 392 | Vascular procedure complication | OFFSIDES | ||
| 393 | Vascular purpura | SIDER | ||
| 394 | Vasodilation procedure | SIDER | ||
| 395 | Vasodilation | SIDER | ||
| 396 | Venous Thrombosis | SIDER | ||
| 397 | Vessel perforation | SIDER | ||
| 398 | bad taste | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120330
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.