Clonidine
(ZNIFSRGNXRYGHF-UHFFFAOYSA-N)
Structure
- SMILES
- Clc1cccc(c1NC1=NCCN1)Cl.Cl
- Molecular Formula:
- C9H10Cl3N3
- Molecular Weight:
- 266.555
- Log P:
- 3.0039
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 3
- TPSA:
- 36.42
- CAS Number(s):
- 4205-91-8
Synonym(s)
1.
Clonidine
2.
Catapres
3.
Catapresan
4.
Catapressan
5.
Chlophazolin
6.
Clofelin
7.
Clofenil
8.
Clonidine Dihydrochloride
9.
Clonidine Hydrochloride
10.
Clonidine Monohydrobromide
11.
Clonidine Monohydrochloride
12.
Clopheline
13.
Dixarit
14.
Gemiton
15.
Hemiton
16.
Isoglaucon
17.
Klofelin
18.
Klofenil
19.
M-5041T
20.
ST-155
21.
Dihydrochloride, Clonidine
22.
Hydrochloride, Clonidine
23.
M 5041T
24.
M5041T
25.
Monohydrobromide, Clonidine
26.
Monohydrochloride, Clonidine
27.
ST 155
28.
ST155
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 68 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 2 | Somnolence | FAERS: 58 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 3 | Toxicity to various agents | FAERS: 35 | US FAERS | |
| 4 | Overdose | FAERS: 33 | US FAERS | |
| 5 | Medication Error | FAERS: 27 | US FAERS | |
| 6 | Headache | FAERS: 26 | US FAERS | |
| 7 | Hypotension | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 8 | Dizziness | FAERS: 24 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 9 | Fatigue | FAERS: 21 | US FAERS | |
| 10 | Bradycardia | FAERS: 19 | US FAERS | |
| 11 | Feeling abnormal | FAERS: 18 | US FAERS | |
| 12 | Lethargy | FAERS: 18 | US FAERS | |
| 13 | Product substitution issue | FAERS: 18 | US FAERS | |
| 14 | Blood pressure fluctuation | FAERS: 17 | US FAERS | |
| 15 | Malaise | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 16 | Blood pressure inadequately controlled | FAERS: 14 | US FAERS | |
| 17 | Constipation | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 18 | Anxiety | FAERS: 13 | US FAERS | |
| 19 | Hypertensive crisis | FAERS: 13 | US FAERS | |
| 20 | Vomiting | FAERS: 13 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 21 | Hypersensitivity | FAERS: 12 | US FAERS | |
| 22 | Drug withdrawal syndrome | FAERS: 11 | US FAERS | |
| 23 | Nausea | FAERS: 11 | US FAERS | |
| 24 | Drug abuser | FAERS: 10 | US FAERS | |
| 25 | Drug dispensing error | FAERS: 10 | US FAERS | |
| 26 | Tremor | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 27 | Mental status changes | FAERS: 9 | US FAERS | |
| 28 | Palpitations | FAERS: 9 | US FAERS | |
| 29 | Respiratory Depression | FAERS: 9 | US FAERS | |
| 30 | Asthenia | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 31 | Depressed Level of Consciousness | FAERS: 8 | US FAERS | |
| 32 | Memory impairment | FAERS: 8 | US FAERS | |
| 33 | Pharmaceutical product complaint | FAERS: 8 | US FAERS | |
| 34 | Product adhesion issue | FAERS: 8 | US FAERS | |
| 35 | Pruritus | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 36 | Syncope | FAERS: 8 | US FAERS | |
| 37 | Cerebrovascular accident | FAERS: 7 | US FAERS | |
| 38 | Chest Pain | FAERS: 7 | US FAERS | |
| 39 | Drug abuse | FAERS: 7 | US FAERS | |
| 40 | Tachycardia | FAERS: 7 | US FAERS | |
| 41 | Agitation | FAERS: 6 | US FAERS | |
| 42 | Drug toxicity | FAERS: 6 | US FAERS | |
| 43 | Incorrect dose administered | FAERS: 6 | US FAERS | |
| 44 | Myocardial Infarction | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 45 | Pallor | FAERS: 6 | US FAERS | |
| 46 | Product quality issue | FAERS: 6 | US FAERS | |
| 47 | Product use issue | FAERS: 6 | US FAERS | |
| 48 | Therapeutic response unexpected with drug substitution | FAERS: 6 | US FAERS | |
| 49 | Accidental exposure to product by child | FAERS: 5 | US FAERS | |
| 50 | Alopecia | FAERS: 5 | US FAERS | |
| 51 | Erythema | FAERS: 5 | US FAERS | |
| 52 | Nervousness | FAERS: 5 | US FAERS | |
| 53 | Rebound effect | FAERS: 5 | US FAERS | |
| 54 | Suicide attempt | FAERS: 5 | US FAERS | |
| 55 | Systolic dysfunction | FAERS: 5 | US FAERS | |
| 56 | Urticaria | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 57 | Accidental drug intake by child | FAERS: 4 | US FAERS | |
| 58 | Accidental exposure | FAERS: 4 | US FAERS | |
| 59 | Apparent death | FAERS: 4 | US FAERS | |
| 60 | Back Pain | FAERS: 4 | US FAERS | |
| 61 | Cyanosis | FAERS: 4 | US FAERS | |
| 62 | Dysgeusia | FAERS: 4 | US FAERS | |
| 63 | Hypoxia | FAERS: 4 | US FAERS | |
| 64 | Pain | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 65 | Product use in unapproved indication | FAERS: 4 | US FAERS | |
| 66 | Thirst | FAERS: 4 | US FAERS | |
| 67 | Abdominal Pain | FAERS: 3 | US FAERS | |
| 68 | Accidental overdose | FAERS: 3 | US FAERS | |
| 69 | Apathy | FAERS: 3 | US FAERS | |
| 70 | Autonomic nervous system imbalance | FAERS: 3 | US FAERS | |
| 71 | Burning sensation | FAERS: 3 | US FAERS | |
| 72 | Cardiac Arrest | FAERS: 3 | US FAERS | |
| 73 | Coma scale abnormal | FAERS: 3 | US FAERS | |
| 74 | Dehydration | FAERS: 3 | US FAERS | |
| 75 | Device leakage | FAERS: 3 | US FAERS | |
| 76 | Diabetes Mellitus | FAERS: 3 | US FAERS | |
| 77 | Drug administered to patient of inappropriate age | FAERS: 3 | US FAERS | |
| 78 | Drug ineffective for unapproved indication | FAERS: 3 | US FAERS | |
| 79 | Dysarthria | FAERS: 3 | US FAERS | |
| 80 | Flushing | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 81 | Malignant neoplasm progression | FAERS: 3 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 82 | Metabolic acidosis | FAERS: 3 | US FAERS | |
| 83 | Paranoia | FAERS: 3 | US FAERS | |
| 84 | Polyuria | FAERS: 3 | US FAERS | |
| 85 | Procedural complication | FAERS: 3 | US FAERS | |
| 86 | Sinus bradycardia | FAERS: 3 | US FAERS | |
| 87 | Unevaluable event | FAERS: 3 | US FAERS | |
| 88 | Unresponsive to stimuli | FAERS: 3 | US FAERS | |
| 89 | Urinary Incontinence | FAERS: 3 | US FAERS | |
| 90 | Wheezing | FAERS: 3 | US FAERS | |
| 91 | Withdrawal hypertension | FAERS: 3 | US FAERS | |
| 92 | nervous system disorder | FAERS: 3 | US FAERS | |
| 93 | Abdominal discomfort | FAERS: 2 | US FAERS | |
| 94 | Altered state of consciousness | FAERS: 2 | US FAERS | |
| 95 | Atherosclerosis | FAERS: 2 | US FAERS | |
| 96 | Atrioventricular Block | FAERS: 2 | US FAERS | |
| 97 | Blood sodium decreased | FAERS: 2 | US FAERS | |
| 98 | Blood testosterone decreased | FAERS: 2 | US FAERS | |
| 99 | Chest discomfort | FAERS: 2 | US FAERS | |
| 100 | Chills | FAERS: 2 | US FAERS | |
| 101 | Choking | FAERS: 2 | US FAERS | |
| 102 | Completed Suicide | FAERS: 2 | US FAERS | |
| 103 | Coronary Artery Disease | FAERS: 2 | US FAERS | |
| 104 | Cortisol increased | FAERS: 2 | US FAERS | |
| 105 | Depressed mood | FAERS: 2 | US FAERS | |
| 106 | Drug administration error | FAERS: 2 | US FAERS | |
| 107 | Drug effect incomplete | FAERS: 2 | US FAERS | |
| 108 | Drug exposure during pregnancy | FAERS: 2 | US FAERS | |
| 109 | Dysphonia | FAERS: 2 | US FAERS | |
| 110 | Dysuria | FAERS: 2 | US FAERS | |
| 111 | Educational problem | FAERS: 2 | US FAERS | |
| 112 | Emotional poverty | FAERS: 2 | US FAERS | |
| 113 | Exposure to toxic agent | FAERS: 2 | US FAERS | |
| 114 | Feeling jittery | FAERS: 2 | US FAERS | |
| 115 | General physical health deterioration | FAERS: 2 | US FAERS | |
| 116 | Head discomfort | FAERS: 2 | US FAERS | |
| 117 | Hypertensive heart disease | FAERS: 2 | US FAERS | |
| 118 | Impaired work ability | FAERS: 2 | US FAERS | |
| 119 | Incorrect route of drug administration | FAERS: 2 | US FAERS | |
| 120 | Incorrect route of product administration | FAERS: 2 | US FAERS | |
| 121 | Increased upper airway secretion | FAERS: 2 | US FAERS | |
| 122 | Infarction | FAERS: 2 | US FAERS | |
| 123 | Infection | FAERS: 2 | US FAERS | |
| 124 | Joint swelling | FAERS: 2 | US FAERS | |
| 125 | Neck Pain | FAERS: 2 | US FAERS | |
| 126 | Night sweats | FAERS: 2 | US FAERS | |
| 127 | Pneumonia | FAERS: 2 | US FAERS | |
| 128 | Polydipsia | FAERS: 2 | US FAERS | |
| 129 | Product compounding quality issue | FAERS: 2 | US FAERS | |
| 130 | Product packaging issue | FAERS: 2 | US FAERS | |
| 131 | Product preparation issue | FAERS: 2 | US FAERS | |
| 132 | Pulmonary Hypertension | FAERS: 2 | US FAERS | |
| 133 | Restlessness | FAERS: 2 | US FAERS | |
| 134 | Screaming | FAERS: 2 | US FAERS | |
| 135 | Status Epilepticus | FAERS: 2 | US FAERS | |
| 136 | Thrombosis | FAERS: 2 | US FAERS | |
| 137 | Urinary Retention | FAERS: 2 | US FAERS | |
| 138 | Vertigo | FAERS: 2 | US FAERS | |
| 139 | Weight decreased | FAERS: 2 | US FAERS | |
| 140 | Wrong drug administered | FAERS: 2 | US FAERS | |
| 141 | Wrong technique in drug usage process | FAERS: 2 | US FAERS | |
| 142 | Acne | FAERS: 1 | US FAERS | |
| 143 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 144 | Adverse event | FAERS: 1 | US FAERS | |
| 145 | Akathisia | FAERS: 1 | US FAERS | |
| 146 | Anal sphincter atony | FAERS: 1 | US FAERS | |
| 147 | Aneurysm | FAERS: 1 | US FAERS | |
| 148 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 149 | Anhedonia | FAERS: 1 | US FAERS | |
| 150 | Anion Gap | FAERS: 1 | US FAERS | |
| 151 | Aphonia | FAERS: 1 | US FAERS | |
| 152 | Appendicitis | FAERS: 1 | US FAERS | |
| 153 | Application site burn | FAERS: 1 | US FAERS | |
| 154 | Application site pruritus | FAERS: 1 | US FAERS | |
| 155 | Application site reaction | FAERS: 1 | US FAERS | |
| 156 | Asthma | FAERS: 1 | US FAERS | |
| 157 | Autoimmune neuropathy | FAERS: 1 | US FAERS | |
| 158 | Back disorder | FAERS: 1 | US FAERS | |
| 159 | Benign neoplasm of thyroid gland | FAERS: 1 | US FAERS | |
| 160 | Blood Pressure | FAERS: 1 | US FAERS | |
| 161 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 162 | Blood corticotrophin increased | FAERS: 1 | US FAERS | |
| 163 | Blood follicle stimulating hormone decreased | FAERS: 1 | US FAERS | |
| 164 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 165 | Blood prolactin increased | FAERS: 1 | US FAERS | |
| 166 | Bone pain | FAERS: 1 | US FAERS | |
| 167 | Breath Holding | FAERS: 1 | US FAERS | |
| 168 | Cellulitis | FAERS: 1 | US FAERS | |
| 169 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 170 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 171 | Croup infectious | FAERS: 1 | US FAERS | |
| 172 | Crying | FAERS: 1 | US FAERS | |
| 173 | Delirium | FAERS: 1 | US FAERS | |
| 174 | Dental caries | FAERS: 1 | US FAERS | |
| 175 | Device Failure | FAERS: 1 | US FAERS | |
| 176 | Device infusion issue | FAERS: 1 | US FAERS | |
| 177 | Device malfunction | FAERS: 1 | US FAERS | |
| 178 | Diet refusal | FAERS: 1 | US FAERS | |
| 179 | Disease Progression | FAERS: 1 | US FAERS | |
| 180 | Disease complication | FAERS: 1 | US FAERS | |
| 181 | Disease recurrence | FAERS: 1 | US FAERS | |
| 182 | Diverticulitis | FAERS: 1 | US FAERS | |
| 183 | Drug Dependence | FAERS: 1 | US FAERS | |
| 184 | Drug diversion | FAERS: 1 | US FAERS | |
| 185 | Drug dose omission | FAERS: 1 | US FAERS | |
| 186 | Drug effect delayed | FAERS: 1 | US FAERS | |
| 187 | Drug level increased | FAERS: 1 | US FAERS | |
| 188 | Drug screen false positive | FAERS: 1 | US FAERS | |
| 189 | Dry skin | FAERS: 1 | US FAERS | |
| 190 | Dyspepsia | FAERS: 1 | US FAERS | |
| 191 | Economic problem | FAERS: 1 | US FAERS | |
| 192 | Eczema | FAERS: 1 | US FAERS | |
| 193 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 194 | Enuresis | FAERS: 1 | US FAERS | |
| 195 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 196 | Epilepsy | FAERS: 1 | US FAERS | |
| 197 | Excessive masturbation | FAERS: 1 | US FAERS | |
| 198 | Exposure during breast feeding | FAERS: 1 | US FAERS | |
| 199 | Extra dose administered | FAERS: 1 | US FAERS | |
| 200 | Eye irritation | FAERS: 1 | US FAERS | |
| 201 | Facial Pain | FAERS: 1 | US FAERS | |
| 202 | Feeding disorder neonatal | FAERS: 1 | US FAERS | |
| 203 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 204 | Flatulence | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 205 | Frustration | FAERS: 1 | US FAERS | |
| 206 | Gastrointestinal hypomotility | FAERS: 1 | US FAERS | |
| 207 | Gastrointestinal motility disorder | FAERS: 1 | US FAERS | |
| 208 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 209 | Glasgow coma scale abnormal | FAERS: 1 | US FAERS | |
| 210 | Glaucoma | FAERS: 1 | US FAERS | |
| 211 | Homicide | FAERS: 1 | US FAERS | |
| 212 | Hyperphagia | FAERS: 1 | US FAERS | |
| 213 | Hypersomnia | FAERS: 1 | US FAERS | |
| 214 | Hypertensive emergency | FAERS: 1 | US FAERS | |
| 215 | Hyperventilation | FAERS: 1 | US FAERS | |
| 216 | Iatrogenic injury | FAERS: 1 | US FAERS | |
| 217 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 218 | Impaired quality of life | FAERS: 1 | US FAERS | |
| 219 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 220 | Increased bronchial secretion | FAERS: 1 | US FAERS | |
| 221 | Infestation | FAERS: 1 | US FAERS | |
| 222 | Inflammation | FAERS: 1 | US FAERS | |
| 223 | Intentional self-injury | FAERS: 1 | US FAERS | |
| 224 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 225 | Labyrinthitis | FAERS: 1 | US FAERS | |
| 226 | Left Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 227 | Leukocytosis | FAERS: 1 | US FAERS | |
| 228 | Lipase decreased | FAERS: 1 | US FAERS | |
| 229 | Medication residue present | FAERS: 1 | US FAERS | |
| 230 | Middle insomnia | FAERS: 1 | US FAERS | |
| 231 | Multiple Chemical Sensitivity | FAERS: 1 | US FAERS | |
| 232 | Multiple allergies | FAERS: 1 | US FAERS | |
| 233 | Myalgia | FAERS: 1 | US FAERS | |
| 234 | Needle issue | FAERS: 1 | US FAERS | |
| 235 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 236 | Nerve injury | FAERS: 1 | US FAERS | |
| 237 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 238 | Obsessive-Compulsive Disorder | FAERS: 1 | US FAERS | |
| 239 | Oliguria | FAERS: 1 | US FAERS | |
| 240 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 241 | Overweight | FAERS: 1 | US FAERS | |
| 242 | Pain of skin | FAERS: 1 | US FAERS | |
| 243 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 244 | Personality Change | FAERS: 1 | US FAERS | |
| 245 | Petechiae | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 246 | Physical assault | FAERS: 1 | US FAERS | |
| 247 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 248 | Pre-existing condition improved | FAERS: 1 | US FAERS | |
| 249 | Precocious Puberty | FAERS: 1 | US FAERS | |
| 250 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 251 | Procedural hypotension | FAERS: 1 | US FAERS | |
| 252 | Product dosage form issue | FAERS: 1 | US FAERS | |
| 253 | Product formulation issue | FAERS: 1 | US FAERS | |
| 254 | Product measured potency issue | FAERS: 1 | US FAERS | |
| 255 | Product supply issue | FAERS: 1 | US FAERS | |
| 256 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 257 | Reaction to excipient | FAERS: 1 | US FAERS | |
| 258 | Renal cancer metastatic | FAERS: 1 | US FAERS | |
| 259 | Renal tubular acidosis | FAERS: 1 | US FAERS | |
| 260 | Respiratory Failure | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 261 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 262 | Seizure like phenomena | FAERS: 1 | US FAERS | |
| 263 | Skin lesion | FAERS: 1 | US FAERS | |
| 264 | Sluggishness | FAERS: 1 | US FAERS | |
| 265 | Splenic Infarction | FAERS: 1 | US FAERS | |
| 266 | Staring | FAERS: 1 | US FAERS | |
| 267 | Stress | FAERS: 1 | US FAERS | |
| 268 | Stridor | FAERS: 1 | US FAERS | |
| 269 | Sudden onset of sleep | FAERS: 1 | US FAERS | |
| 270 | Swelling | FAERS: 1 | US FAERS | |
| 271 | Tetany | FAERS: 1 | US FAERS | |
| 272 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 273 | Therapy change | FAERS: 1 | US FAERS | |
| 274 | Thrombocytopenia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 275 | Tinnitus | FAERS: 1 | US FAERS | |
| 276 | Tonic clonic movements | FAERS: 1 | US FAERS | |
| 277 | Tooth Loss | FAERS: 1 | US FAERS | |
| 278 | Toxic Shock Syndrome | FAERS: 1 | US FAERS | |
| 279 | Transcription medication error | FAERS: 1 | US FAERS | |
| 280 | Troponin increased | FAERS: 1 | US FAERS | |
| 281 | Upper-airway cough syndrome | FAERS: 1 | US FAERS | |
| 282 | Urge Incontinence | FAERS: 1 | US FAERS | |
| 283 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 284 | Uterine Cancer | FAERS: 1 | US FAERS | |
| 285 | Vaginal Discharge | FAERS: 1 | US FAERS | |
| 286 | Visual Impairment | FAERS: 1 | US FAERS | |
| 287 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 288 | treatment failure | FAERS: 1 | US FAERS | |
| 289 | Breast engorgement | Canada Vigilance: 2 | Canada Vigilance | |
| 290 | Breast tenderness | Canada Vigilance: 2 | Canada Vigilance | |
| 291 | Bronchospasm | Canada Vigilance: 1 | Canada Vigilance | |
| 292 | Conjunctivitis | Canada Vigilance: 2 | Canada Vigilance | |
| 293 | Erectile dysfunction | Canada Vigilance: 2 | Canada Vigilance | |
| 294 | Hypokinesia | Canada Vigilance: 1 | Canada Vigilance | |
| 295 | Leukopenia | Canada Vigilance: 1 | Canada Vigilance | |
| 296 | Lymphocytosis | Canada Vigilance: 1 | Canada Vigilance | |
| 297 | Metastasis | Canada Vigilance: 1 | Canada Vigilance | |
| 298 | Pancreatic carcinoma | Canada Vigilance: 1 | Canada Vigilance | |
| 299 | Rash erythematous | Canada Vigilance: 1 | Canada Vigilance | |
| 300 | Urinary tract obstruction | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.