brexpiprazole
(ZKIAIYBUSXZPLP-UHFFFAOYSA-N)
Structure
- SMILES
- O=c1ccc2c([nH]1)cc(cc2)OCCCCN1CCN(CC1)c1cccc2c1ccs2
- Type(s)
- Approved; Investigational
- ATC code(s)
- N05AX16
- Molecular Formula:
- C25H27N3O2S
- Molecular Weight:
- 433.566
- Log P:
- 4.7269
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 1
- TPSA:
- 76.81
- CAS Number(s):
- 913611-97-9
Synonym(s)
1.
brexpiprazole
2.
7-(4-(4-(1-benzothiophen-4-yl)piperazin-1-yl)butoxy)quinolin-2(1H)-one
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Akathisia | FAERS: 233 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 2 | Drug ineffective | FAERS: 102 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 3 | No adverse event | FAERS: 99 | US FAERS | |
| 4 | Product use in unapproved indication | FAERS: 75 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 5 | Anxiety | FAERS: 70 | US FAERS | |
| 6 | Drug administered to patient of inappropriate age | FAERS: 68 | US FAERS | |
| 7 | Tremor | FAERS: 67 | US FAERS | |
| 8 | Tardive Dyskinesia | FAERS: 66 | US FAERS | |
| 9 | Feeling abnormal | FAERS: 64 | US FAERS | |
| 10 | Nausea | FAERS: 63 | US FAERS | |
| 11 | Headache | FAERS: 58 | US FAERS | |
| 12 | Incorrect dose administered | FAERS: 57 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 13 | Restlessness | FAERS: 51 | US FAERS | |
| 14 | Fatigue | FAERS: 49 | US FAERS | |
| 15 | Dizziness | FAERS: 44 | US FAERS | |
| 16 | Wrong technique in product usage process | FAERS: 44 | US FAERS | |
| 17 | Adverse event | FAERS: 43 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 18 | Drug dose omission | FAERS: 43 | US FAERS | |
| 19 | Agitation | FAERS: 37 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 20 | Product use issue | FAERS: 34 | US FAERS | |
| 21 | Blood glucose increased | FAERS: 33 | US FAERS | |
| 22 | Inability to afford medication | FAERS: 29 | US FAERS | |
| 23 | Drug effect incomplete | FAERS: 28 | US FAERS | |
| 24 | Somnolence | FAERS: 26 | US FAERS | |
| 25 | Malaise | FAERS: 25 | US FAERS | |
| 26 | Therapy cessation | FAERS: 25 | US FAERS | |
| 27 | Dystonia | FAERS: 23 | US FAERS | |
| 28 | Vomiting | FAERS: 20 | US FAERS | |
| 29 | Hypersensitivity | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 30 | Pruritus | FAERS: 18 | US FAERS | |
| 31 | Abdominal discomfort | FAERS: 17 | US FAERS | |
| 32 | Anger | FAERS: 17 | US FAERS | |
| 33 | Hunger | FAERS: 17 | US FAERS | |
| 34 | Peripheral swelling | FAERS: 17 | US FAERS | |
| 35 | Drug prescribing error | FAERS: 16 | US FAERS | |
| 36 | Food craving | FAERS: 16 | US FAERS | |
| 37 | Palpitations | FAERS: 16 | US FAERS | |
| 38 | Arthralgia | FAERS: 15 | US FAERS | |
| 39 | Disease recurrence | FAERS: 15 | US FAERS | |
| 40 | Urticaria | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 41 | Myalgia | FAERS: 14 | US FAERS | |
| 42 | Completed Suicide | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 43 | Dysarthria | FAERS: 13 | US FAERS | |
| 44 | Overdose | FAERS: 13 | US FAERS | |
| 45 | Pain | FAERS: 13 | US FAERS | |
| 46 | Restless Legs Syndrome | FAERS: 13 | US FAERS | |
| 47 | Stress | FAERS: 13 | US FAERS | |
| 48 | Therapeutic response unexpected | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 49 | Constipation | FAERS: 12 | US FAERS | |
| 50 | Musculoskeletal stiffness | FAERS: 12 | US FAERS | |
| 51 | Nervousness | FAERS: 12 | US FAERS | |
| 52 | Schizophrenia | FAERS: 12 | US FAERS | |
| 53 | Chest Pain | FAERS: 11 | US FAERS | |
| 54 | Hyperphagia | FAERS: 11 | US FAERS | |
| 55 | Memory impairment | FAERS: 11 | US FAERS | |
| 56 | Weight decreased | FAERS: 11 | US FAERS | |
| 57 | Crying | FAERS: 10 | US FAERS | |
| 58 | Drug ineffective for unapproved indication | FAERS: 10 | US FAERS | |
| 59 | Feeling jittery | FAERS: 10 | US FAERS | |
| 60 | Unevaluable event | FAERS: 10 | US FAERS | |
| 61 | Asthenia | FAERS: 9 | US FAERS | |
| 62 | Cerebrovascular accident | FAERS: 9 | US FAERS | |
| 63 | Gambling | FAERS: 9 | US FAERS | |
| 64 | Neuroleptic Malignant Syndrome | FAERS: 9 | US FAERS | |
| 65 | Compulsive shopping | FAERS: 8 | US FAERS | |
| 66 | Hypersomnia | FAERS: 8 | US FAERS | |
| 67 | Hypomania | FAERS: 8 | US FAERS | |
| 68 | Inappropriate schedule of drug administration | FAERS: 8 | US FAERS | |
| 69 | Muscle tightness | FAERS: 8 | US FAERS | |
| 70 | Swelling | FAERS: 8 | US FAERS | |
| 71 | Alopecia | FAERS: 7 | US FAERS | |
| 72 | Bipolar Disorder | FAERS: 7 | US FAERS | |
| 73 | Chest discomfort | FAERS: 7 | US FAERS | |
| 74 | Drug effective for unapproved indication | FAERS: 7 | US FAERS | |
| 75 | Hypotension | FAERS: 7 | US FAERS | |
| 76 | Paranoia | FAERS: 7 | US FAERS | |
| 77 | Rhabdomyolysis | FAERS: 7 | US FAERS | |
| 78 | Syncope | FAERS: 7 | US FAERS | |
| 79 | Urinary Retention | FAERS: 7 | US FAERS | |
| 80 | Amnesia | FAERS: 6 | US FAERS | |
| 81 | Depressed mood | FAERS: 6 | US FAERS | |
| 82 | Disability | FAERS: 6 | US FAERS | |
| 83 | Euphoric mood | FAERS: 6 | US FAERS | |
| 84 | Lip swelling | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 85 | Maternal exposure during pregnancy | FAERS: 6 | US FAERS | |
| 86 | Product packaging quantity issue | FAERS: 6 | US FAERS | |
| 87 | Tachycardia | FAERS: 6 | US FAERS | |
| 88 | Thirst | FAERS: 6 | US FAERS | |
| 89 | Angioedema | FAERS: 5 | US FAERS | |
| 90 | Aphasia | FAERS: 5 | US FAERS | |
| 91 | Blood cholesterol increased | FAERS: 5 | US FAERS | |
| 92 | Blood prolactin increased | FAERS: 5 | US FAERS | |
| 93 | Blood triglycerides increased | FAERS: 5 | US FAERS | |
| 94 | Drooling | FAERS: 5 | US FAERS | |
| 95 | Erythema | FAERS: 5 | US FAERS | |
| 96 | Flat affect | FAERS: 5 | US FAERS | |
| 97 | Impaired driving ability | FAERS: 5 | US FAERS | |
| 98 | Intentional self-injury | FAERS: 5 | US FAERS | |
| 99 | Joint swelling | FAERS: 5 | US FAERS | |
| 100 | Lethargy | FAERS: 5 | US FAERS | |
| 101 | Suicide attempt | FAERS: 5 | US FAERS | |
| 102 | Trismus | FAERS: 5 | US FAERS | |
| 103 | Abasia | FAERS: 4 | US FAERS | |
| 104 | Accidental exposure to product | FAERS: 4 | US FAERS | |
| 105 | Activities of daily living impaired | FAERS: 4 | US FAERS | |
| 106 | Apathy | FAERS: 4 | US FAERS | |
| 107 | Blepharospasm | FAERS: 4 | US FAERS | |
| 108 | Bruxism | FAERS: 4 | US FAERS | |
| 109 | Dehydration | FAERS: 4 | US FAERS | |
| 110 | Diabetes Mellitus | FAERS: 4 | US FAERS | |
| 111 | Drug abuse | FAERS: 4 | US FAERS | |
| 112 | Drug titration error | FAERS: 4 | US FAERS | |
| 113 | Dysphonia | FAERS: 4 | US FAERS | |
| 114 | Emotional disorder | FAERS: 4 | US FAERS | |
| 115 | Emotional distress | FAERS: 4 | US FAERS | |
| 116 | Enlarged uvula | FAERS: 4 | US FAERS | |
| 117 | Epistaxis | FAERS: 4 | US FAERS | |
| 118 | Facial paralysis | FAERS: 4 | US FAERS | |
| 119 | Impaired work ability | FAERS: 4 | US FAERS | |
| 120 | Infection | FAERS: 4 | US FAERS | |
| 121 | Insurance issue | FAERS: 4 | US FAERS | |
| 122 | Muscle Rigidity | FAERS: 4 | US FAERS | |
| 123 | Oculogyric crisis | FAERS: 4 | US FAERS | |
| 124 | Prescribed overdose | FAERS: 4 | US FAERS | |
| 125 | Product quality issue | FAERS: 4 | US FAERS | |
| 126 | Product taste abnormal | FAERS: 4 | US FAERS | |
| 127 | Psychiatric decompensation | FAERS: 4 | US FAERS | |
| 128 | Serotonin Syndrome | FAERS: 4 | US FAERS | |
| 129 | Somnambulism | FAERS: 4 | US FAERS | |
| 130 | Tongue movement disturbance | FAERS: 4 | US FAERS | |
| 131 | Visual Impairment | FAERS: 4 | US FAERS | |
| 132 | Abdominal Pain | FAERS: 3 | US FAERS | |
| 133 | Accidental overdose | FAERS: 3 | US FAERS | |
| 134 | Asthma | FAERS: 3 | US FAERS | |
| 135 | Blood creatine phosphokinase increased | FAERS: 3 | US FAERS | |
| 136 | Blood glucose abnormal | FAERS: 3 | US FAERS | |
| 137 | Bronchitis | FAERS: 3 | US FAERS | |
| 138 | Depressed Level of Consciousness | FAERS: 3 | US FAERS | |
| 139 | Diplopia | FAERS: 3 | US FAERS | |
| 140 | Disorientation | FAERS: 3 | US FAERS | |
| 141 | Drug dose titration not performed | FAERS: 3 | US FAERS | |
| 142 | Dysgraphia | FAERS: 3 | US FAERS | |
| 143 | Dyspepsia | FAERS: 3 | US FAERS | |
| 144 | Hostility | FAERS: 3 | US FAERS | |
| 145 | Limb discomfort | FAERS: 3 | US FAERS | |
| 146 | Mood swings | FAERS: 3 | US FAERS | |
| 147 | Myocardial Infarction | FAERS: 3 | US FAERS | |
| 148 | Night sweats | FAERS: 3 | US FAERS | |
| 149 | Nuchal Rigidity | FAERS: 3 | US FAERS | |
| 150 | Obsessive thoughts | FAERS: 3 | US FAERS | |
| 151 | Oromandibular dystonia | FAERS: 3 | US FAERS | |
| 152 | Poor quality sleep | FAERS: 3 | US FAERS | |
| 153 | Prescribed underdose | FAERS: 3 | US FAERS | |
| 154 | Product dose omission | FAERS: 3 | US FAERS | |
| 155 | Tension | FAERS: 3 | US FAERS | |
| 156 | Urinary Incontinence | FAERS: 3 | US FAERS | |
| 157 | Urinary tract infection | FAERS: 3 | US FAERS | |
| 158 | Vertigo | FAERS: 3 | US FAERS | |
| 159 | Wheezing | FAERS: 3 | US FAERS | |
| 160 | Acne | FAERS: 2 | US FAERS | |
| 161 | Alanine Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 162 | Aspartate Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 163 | Autoscopy | FAERS: 2 | US FAERS | |
| 164 | Blood glucose decreased | FAERS: 2 | US FAERS | |
| 165 | Blood potassium increased | FAERS: 2 | US FAERS | |
| 166 | Blunted affect | FAERS: 2 | US FAERS | |
| 167 | Bradykinesia | FAERS: 2 | US FAERS | |
| 168 | Breast tenderness | FAERS: 2 | US FAERS | |
| 169 | Cellulitis | FAERS: 2 | US FAERS | |
| 170 | Chills | FAERS: 2 | US FAERS | |
| 171 | Choking | FAERS: 2 | US FAERS | |
| 172 | Dementia | FAERS: 2 | US FAERS | |
| 173 | Drug Dependence | FAERS: 2 | US FAERS | |
| 174 | Drug effect delayed | FAERS: 2 | US FAERS | |
| 175 | Drug resistance | FAERS: 2 | US FAERS | |
| 176 | Drug withdrawal syndrome | FAERS: 2 | US FAERS | |
| 177 | Dysgeusia | FAERS: 2 | US FAERS | |
| 178 | Dysphemia | FAERS: 2 | US FAERS | |
| 179 | Dysuria | FAERS: 2 | US FAERS | |
| 180 | Emergency Care | FAERS: 2 | US FAERS | |
| 181 | Enuresis | FAERS: 2 | US FAERS | |
| 182 | Extra dose administered | FAERS: 2 | US FAERS | |
| 183 | Formication | FAERS: 2 | US FAERS | |
| 184 | Frustration tolerance decreased | FAERS: 2 | US FAERS | |
| 185 | Gastric Bypass | FAERS: 2 | US FAERS | |
| 186 | General physical health deterioration | FAERS: 2 | US FAERS | |
| 187 | Hypokinesia | FAERS: 2 | US FAERS | |
| 188 | Impaired quality of life | FAERS: 2 | US FAERS | |
| 189 | Incoherent | FAERS: 2 | US FAERS | |
| 190 | Initial insomnia | FAERS: 2 | US FAERS | |
| 191 | Leukopenia | FAERS: 2 | US FAERS | |
| 192 | Loss of personal independence in daily activities | FAERS: 2 | US FAERS | |
| 193 | Muscle Fatigue | FAERS: 2 | US FAERS | |
| 194 | Mydriasis | FAERS: 2 | US FAERS | |
| 195 | Oral pain | FAERS: 2 | US FAERS | |
| 196 | Pancreatitis | FAERS: 2 | US FAERS | |
| 197 | Physical assault | FAERS: 2 | US FAERS | |
| 198 | Polydipsia | FAERS: 2 | US FAERS | |
| 199 | Product packaging issue | FAERS: 2 | US FAERS | |
| 200 | Schizoaffective Disorder | FAERS: 2 | US FAERS | |
| 201 | Screaming | FAERS: 2 | US FAERS | |
| 202 | Secretion discharge | FAERS: 2 | US FAERS | |
| 203 | Sexual Dysfunction | FAERS: 2 | US FAERS | |
| 204 | Sinus bradycardia | FAERS: 2 | US FAERS | |
| 205 | Sneezing | FAERS: 2 | US FAERS | |
| 206 | Staring | FAERS: 2 | US FAERS | |
| 207 | Stupor | FAERS: 2 | US FAERS | |
| 208 | Tachyphrenia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 209 | Thrombosis | FAERS: 2 | US FAERS | |
| 210 | Tongue biting | FAERS: 2 | US FAERS | |
| 211 | Torticollis | FAERS: 2 | US FAERS | |
| 212 | Abnormal weight gain | FAERS: 1 | US FAERS | |
| 213 | Activation syndrome | FAERS: 1 | US FAERS | |
| 214 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 215 | Acute respiratory failure | FAERS: 1 | US FAERS | |
| 216 | Akinesia | FAERS: 1 | US FAERS | |
| 217 | Anorgasmia | FAERS: 1 | US FAERS | |
| 218 | Asterixis | FAERS: 1 | US FAERS | |
| 219 | Bedridden | FAERS: 1 | US FAERS | |
| 220 | Bipolar I disorder | FAERS: 1 | US FAERS | |
| 221 | Blindness | FAERS: 1 | US FAERS | |
| 222 | Blood caffeine increased | FAERS: 1 | US FAERS | |
| 223 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 224 | Blood urine present | FAERS: 1 | US FAERS | |
| 225 | Boredom | FAERS: 1 | US FAERS | |
| 226 | Bradycardia | FAERS: 1 | US FAERS | |
| 227 | Burning sensation | FAERS: 1 | US FAERS | |
| 228 | Catatonia | FAERS: 1 | US FAERS | |
| 229 | Cheilitis | FAERS: 1 | US FAERS | |
| 230 | Chromaturia | FAERS: 1 | US FAERS | |
| 231 | Cogwheel Rigidity | FAERS: 1 | US FAERS | |
| 232 | Compression fracture | FAERS: 1 | US FAERS | |
| 233 | Cystitis | FAERS: 1 | US FAERS | |
| 234 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 235 | Delusional disorder, unspecified type | FAERS: 1 | US FAERS | |
| 236 | Diabetic Ketoacidosis | FAERS: 1 | US FAERS | |
| 237 | Discomfort | FAERS: 1 | US FAERS | |
| 238 | Disease complication | FAERS: 1 | US FAERS | |
| 239 | Diverticulitis | FAERS: 1 | US FAERS | |
| 240 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 241 | Drug screen positive | FAERS: 1 | US FAERS | |
| 242 | Dystonic tremor | FAERS: 1 | US FAERS | |
| 243 | Ear congestion | FAERS: 1 | US FAERS | |
| 244 | Eating disorder symptom | FAERS: 1 | US FAERS | |
| 245 | Economic problem | FAERS: 1 | US FAERS | |
| 246 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 247 | Electroencephalogram abnormal | FAERS: 1 | US FAERS | |
| 248 | Emotional poverty | FAERS: 1 | US FAERS | |
| 249 | Eosinophilic Pneumonia | FAERS: 1 | US FAERS | |
| 250 | Epilepsy | FAERS: 1 | US FAERS | |
| 251 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 252 | Expired product administered | FAERS: 1 | US FAERS | |
| 253 | Feeding tube user | FAERS: 1 | US FAERS | |
| 254 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 255 | Flatulence | FAERS: 1 | US FAERS | |
| 256 | Flushing | FAERS: 1 | US FAERS | |
| 257 | Fracture treatment | FAERS: 1 | US FAERS | |
| 258 | Fracture | FAERS: 1 | US FAERS | |
| 259 | Gait Apraxia | FAERS: 1 | US FAERS | |
| 260 | Gastrointestinal infection | FAERS: 1 | US FAERS | |
| 261 | Gastrostomy | FAERS: 1 | US FAERS | |
| 262 | Glaucoma | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 263 | Head discomfort | FAERS: 1 | US FAERS | |
| 264 | Head titubation | FAERS: 1 | US FAERS | |
| 265 | Hemiparesis | FAERS: 1 | US FAERS | |
| 266 | Human chorionic gonadotropin increased | FAERS: 1 | US FAERS | |
| 267 | Hyperchlorhydria | FAERS: 1 | US FAERS | |
| 268 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 269 | Hypophagia | FAERS: 1 | US FAERS | |
| 270 | Hyporeflexia | FAERS: 1 | US FAERS | |
| 271 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 272 | Immobile | FAERS: 1 | US FAERS | |
| 273 | Impaired self-care | FAERS: 1 | US FAERS | |
| 274 | Incontinence | FAERS: 1 | US FAERS | |
| 275 | Incorrect product formulation administered | FAERS: 1 | US FAERS | |
| 276 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 277 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 278 | Joint injury | FAERS: 1 | US FAERS | |
| 279 | Laceration | FAERS: 1 | US FAERS | |
| 280 | Lack of satiety | FAERS: 1 | US FAERS | |
| 281 | Lactation Disorder | FAERS: 1 | US FAERS | |
| 282 | Laziness | FAERS: 1 | US FAERS | |
| 283 | Limb injury | FAERS: 1 | US FAERS | |
| 284 | Limb operation | FAERS: 1 | US FAERS | |
| 285 | Lipids abnormal | FAERS: 1 | US FAERS | |
| 286 | Living in residential institution | FAERS: 1 | US FAERS | |
| 287 | Low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 288 | Medication Error | FAERS: 1 | US FAERS | |
| 289 | Menorrhagia | FAERS: 1 | US FAERS | |
| 290 | Middle insomnia | FAERS: 1 | US FAERS | |
| 291 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 292 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 293 | Musculoskeletal discomfort | FAERS: 1 | US FAERS | |
| 294 | Myoclonus | FAERS: 1 | US FAERS | |
| 295 | Myopathy | FAERS: 1 | US FAERS | |
| 296 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 297 | Neck Pain | FAERS: 1 | US FAERS | |
| 298 | Negative thoughts | FAERS: 1 | US FAERS | |
| 299 | Obsessive-Compulsive Disorder | FAERS: 1 | US FAERS | |
| 300 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 301 | Opisthotonus | FAERS: 1 | US FAERS | |
| 302 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 303 | Osteoporosis | FAERS: 1 | US FAERS | |
| 304 | Pain of skin | FAERS: 1 | US FAERS | |
| 305 | Pancytopenia | FAERS: 1 | US FAERS | |
| 306 | Panic Disorder | FAERS: 1 | US FAERS | |
| 307 | Photophobia | FAERS: 1 | US FAERS | |
| 308 | Pneumonia | FAERS: 1 | US FAERS | |
| 309 | Polyuria | FAERS: 1 | US FAERS | |
| 310 | Pre-existing condition improved | FAERS: 1 | US FAERS | |
| 311 | Prescription drug used without a prescription | FAERS: 1 | US FAERS | |
| 312 | Product administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 313 | Product container issue | FAERS: 1 | US FAERS | |
| 314 | Product storage error | FAERS: 1 | US FAERS | |
| 315 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 316 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 317 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 318 | Rabbit syndrome | FAERS: 1 | US FAERS | |
| 319 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 320 | Reduced facial expression | FAERS: 1 | US FAERS | |
| 321 | Rehabilitation therapy | FAERS: 1 | US FAERS | |
| 322 | Saliva altered | FAERS: 1 | US FAERS | |
| 323 | Scab | FAERS: 1 | US FAERS | |
| 324 | Sciatica | FAERS: 1 | US FAERS | |
| 325 | Sedation complication | FAERS: 1 | US FAERS | |
| 326 | Seizure like phenomena | FAERS: 1 | US FAERS | |
| 327 | Sepsis | FAERS: 1 | US FAERS | |
| 328 | Sinusitis | FAERS: 1 | US FAERS | |
| 329 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 330 | Skin irritation | FAERS: 1 | US FAERS | |
| 331 | Skin lesion | FAERS: 1 | US FAERS | |
| 332 | Sleep Paralysis | FAERS: 1 | US FAERS | |
| 333 | Starvation | FAERS: 1 | US FAERS | |
| 334 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 335 | Stomatitis | FAERS: 1 | US FAERS | |
| 336 | Symptom recurrence | FAERS: 1 | US FAERS | |
| 337 | Temperature regulation disorder | FAERS: 1 | US FAERS | |
| 338 | Therapy partial responder | FAERS: 1 | US FAERS | |
| 339 | Thirst decreased | FAERS: 1 | US FAERS | |
| 340 | Tinnitus | FAERS: 1 | US FAERS | |
| 341 | Tongue eruption | FAERS: 1 | US FAERS | |
| 342 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 343 | Violence-related symptom | FAERS: 1 | US FAERS | |
| 344 | Vulvovaginal dryness | FAERS: 1 | US FAERS | |
| 345 | Waist circumference increased | FAERS: 1 | US FAERS | |
| 346 | White blood cell count abnormal | FAERS: 1 | US FAERS | |
| 347 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 348 | Wound dehiscence | FAERS: 1 | US FAERS | |
| 349 | Wrong dose | FAERS: 1 | US FAERS | |
| 350 | intensive care | FAERS: 1 | US FAERS | |
| 351 | nervous system disorder | FAERS: 1 | US FAERS | |
| 352 | treatment failure | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.