Ketotifen
(YNQQEYBLVYAWNX-WLHGVMLRSA-N)
Structure
- SMILES
- CN1CCC(=C2c3ccccc3CC(=O)c3c2ccs3)CC1.OC(=O)/C=C/C(=O)O
- Molecular Formula:
- C23H23NO5S
- Molecular Weight:
- 425.497
- Log P:
- 3.6641
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 2
- TPSA:
- 123.15
- CAS Number(s):
- 34580-14-8
Synonym(s)
1.
Ketotifen
2.
4,9-Dihydro-4-(1-methyl-4-piperidylidene)-10H-benzo(4,5)-cyclohepta(1,2-b)thiophen-10-one
3.
Ketotifen Fumarate
4.
Ketotifene
5.
Ketotiphen
6.
Ketotiphene
7.
Zaditen
8.
Fumarate, Ketotifen
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 307 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 2 | Eye irritation | FAERS: 263 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 3 | Eye pain | FAERS: 112 | US FAERS | |
| 4 | Instillation site pain | FAERS: 50 | US FAERS | |
| 5 | Product quality issue | FAERS: 25 | US FAERS | |
| 6 | Somnolence | FAERS: 23 | US FAERS | |
| 7 | Hypersensitivity | FAERS: 20 | US FAERS | |
| 8 | Headache | FAERS: 17 | US FAERS | |
| 9 | Asthenopia | FAERS: 15 | US FAERS | |
| 10 | Expired product administered | FAERS: 14 | US FAERS | |
| 11 | Burning sensation | FAERS: 13 | US FAERS | |
| 12 | Dizziness | FAERS: 13 | US FAERS | |
| 13 | Ocular discomfort | FAERS: 13 | US FAERS | |
| 14 | Urticaria | FAERS: 12 | US FAERS | |
| 15 | Erythema | FAERS: 11 | US FAERS | |
| 16 | Nausea | FAERS: 11 | US FAERS | |
| 17 | Pain | FAERS: 11 | US FAERS | |
| 18 | Photophobia | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 19 | Pruritus | FAERS: 11 | US FAERS | |
| 20 | Accidental overdose | FAERS: 10 | US FAERS | |
| 21 | Blood alkaline phosphatase increased | FAERS: 10 | US FAERS | |
| 22 | Eyelid margin crusting | FAERS: 10 | US FAERS | |
| 23 | Foreign body sensation in eyes | FAERS: 10 | US FAERS | |
| 24 | Visual Impairment | FAERS: 9 | US FAERS | |
| 25 | Eye inflammation | FAERS: 8 | US FAERS | |
| 26 | Incorrect dose administered | FAERS: 8 | US FAERS | |
| 27 | Expired drug administered | FAERS: 7 | US FAERS | |
| 28 | No adverse event | FAERS: 7 | US FAERS | |
| 29 | Alanine Aminotransferase Increased | FAERS: 6 | US FAERS | |
| 30 | Aspartate Aminotransferase Increased | FAERS: 6 | US FAERS | |
| 31 | Asthenia | FAERS: 6 | US FAERS | |
| 32 | Asthma | FAERS: 6 | US FAERS | |
| 33 | Contraindicated product administered | FAERS: 6 | US FAERS | |
| 34 | Instillation site irritation | FAERS: 6 | US FAERS | |
| 35 | Medication Error | FAERS: 6 | US FAERS | |
| 36 | treatment failure | FAERS: 6 | US FAERS | |
| 37 | Blepharospasm | FAERS: 5 | US FAERS | |
| 38 | Cataract operation | FAERS: 5 | US FAERS | |
| 39 | Cystitis | FAERS: 5 | US FAERS | |
| 40 | Epistaxis | FAERS: 5 | US FAERS | |
| 41 | Fatigue | FAERS: 5 | US FAERS | |
| 42 | Feeling abnormal | FAERS: 5 | US FAERS | |
| 43 | Malaise | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 44 | Nasopharyngitis | FAERS: 5 | US FAERS | |
| 45 | Syncope | FAERS: 5 | US FAERS | |
| 46 | Conjunctivitis | FAERS: 4 | US FAERS | |
| 47 | Corneal Infection | FAERS: 4 | US FAERS | |
| 48 | Drug effect incomplete | FAERS: 4 | US FAERS | |
| 49 | Eye allergy | FAERS: 4 | US FAERS | |
| 50 | Pneumonia | FAERS: 4 | US FAERS | |
| 51 | Restlessness | FAERS: 4 | US FAERS | |
| 52 | Superficial injury of eye | FAERS: 4 | US FAERS | |
| 53 | Vomiting | FAERS: 4 | US FAERS | |
| 54 | Accidental exposure to product | FAERS: 3 | US FAERS | |
| 55 | Anaphylactic shock | FAERS: 3 | US FAERS | |
| 56 | Angioedema | FAERS: 3 | US FAERS | |
| 57 | Arthralgia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 58 | Blood lactate dehydrogenase increased | FAERS: 3 | US FAERS | |
| 59 | Cyanosis | FAERS: 3 | US FAERS | |
| 60 | Drug exposure during pregnancy | FAERS: 3 | US FAERS | |
| 61 | Drug ineffective for unapproved indication | FAERS: 3 | US FAERS | |
| 62 | Dry skin | FAERS: 3 | US FAERS | |
| 63 | Epilepsy | FAERS: 3 | US FAERS | |
| 64 | Eye Infection | FAERS: 3 | US FAERS | |
| 65 | Eyelid skin dryness | FAERS: 3 | US FAERS | |
| 66 | Eyelids pruritus | FAERS: 3 | US FAERS | |
| 67 | Gastric Lavage | FAERS: 3 | US FAERS | |
| 68 | Gaze palsy | FAERS: 3 | US FAERS | |
| 69 | Hepatotoxicity | FAERS: 3 | US FAERS | |
| 70 | Lip swelling | FAERS: 3 | US FAERS | |
| 71 | Mydriasis | FAERS: 3 | US FAERS | |
| 72 | Nervousness | FAERS: 3 | US FAERS | |
| 73 | Palpitations | FAERS: 3 | US FAERS | |
| 74 | Product container issue | FAERS: 3 | US FAERS | |
| 75 | Tremor | FAERS: 3 | US FAERS | |
| 76 | Agitation | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 77 | Blepharitis | FAERS: 2 | US FAERS | |
| 78 | Bradycardia | FAERS: 2 | US FAERS | |
| 79 | Choking sensation | FAERS: 2 | US FAERS | |
| 80 | Depressed Level of Consciousness | FAERS: 2 | US FAERS | |
| 81 | Diabetes Mellitus | FAERS: 2 | US FAERS | |
| 82 | Discomfort | FAERS: 2 | US FAERS | |
| 83 | Drug administered to patient of inappropriate age | FAERS: 2 | US FAERS | |
| 84 | Drug dispensing error | FAERS: 2 | US FAERS | |
| 85 | Dysgeusia | FAERS: 2 | US FAERS | |
| 86 | Dysuria | FAERS: 2 | US FAERS | |
| 87 | Extra dose administered | FAERS: 2 | US FAERS | |
| 88 | Eye Burns | FAERS: 2 | US FAERS | |
| 89 | Eyelid pain | FAERS: 2 | US FAERS | |
| 90 | Gamma-Glutamyltransferase Increased | FAERS: 2 | US FAERS | |
| 91 | Glossoptosis | FAERS: 2 | US FAERS | |
| 92 | Hypersomnia | FAERS: 2 | US FAERS | |
| 93 | Incorrect route of drug administration | FAERS: 2 | US FAERS | |
| 94 | Influenza | FAERS: 2 | US FAERS | |
| 95 | Lymphocyte transformation test positive | FAERS: 2 | US FAERS | |
| 96 | Memory impairment | FAERS: 2 | US FAERS | |
| 97 | Mental retardation severity unspecified | FAERS: 2 | US FAERS | |
| 98 | Migraine with Aura | FAERS: 2 | US FAERS | |
| 99 | Monoplegia | FAERS: 2 | US FAERS | |
| 100 | Myalgia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 101 | Nephrolithiasis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 102 | Ophthalmic fluid drainage | FAERS: 2 | US FAERS | |
| 103 | Pallor | FAERS: 2 | US FAERS | |
| 104 | Periorbital inflammation | FAERS: 2 | US FAERS | |
| 105 | Pharmaceutical product complaint | FAERS: 2 | US FAERS | |
| 106 | Product packaging confusion | FAERS: 2 | US FAERS | |
| 107 | Product use in unapproved indication | FAERS: 2 | US FAERS | |
| 108 | Protein urine present | FAERS: 2 | US FAERS | |
| 109 | Sputum retention | FAERS: 2 | US FAERS | |
| 110 | Tachycardia | FAERS: 2 | US FAERS | |
| 111 | Therapy responder | FAERS: 2 | US FAERS | |
| 112 | Throat irritation | FAERS: 2 | US FAERS | |
| 113 | Tinnitus | FAERS: 2 | US FAERS | |
| 114 | Visual disturbance | FAERS: 2 | US FAERS | |
| 115 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 116 | jaundice | FAERS: 2 | US FAERS | |
| 117 | Abdominal Pain | FAERS: 1 | US FAERS | |
| 118 | Abdominal cavity drainage | FAERS: 1 | US FAERS | |
| 119 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 120 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 121 | Acanthosis | FAERS: 1 | US FAERS | |
| 122 | Agranulocytosis | FAERS: 1 | US FAERS | |
| 123 | Alanine aminotransferase abnormal | FAERS: 1 | US FAERS | |
| 124 | Allergic reaction to excipient | FAERS: 1 | US FAERS | |
| 125 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 126 | Amnesia | FAERS: 1 | US FAERS | |
| 127 | Anti-HBc IgG antibody positive | FAERS: 1 | US FAERS | |
| 128 | Anxiety | FAERS: 1 | US FAERS | |
| 129 | Apathy | FAERS: 1 | US FAERS | |
| 130 | Application site discomfort | FAERS: 1 | US FAERS | |
| 131 | Application site irritation | FAERS: 1 | US FAERS | |
| 132 | Application site pain | FAERS: 1 | US FAERS | |
| 133 | Aspartate aminotransferase abnormal | FAERS: 1 | US FAERS | |
| 134 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 135 | Brain Death | FAERS: 1 | US FAERS | |
| 136 | Bronchospasm | FAERS: 1 | US FAERS | |
| 137 | Cataract | FAERS: 1 | US FAERS | |
| 138 | Chest Pain | FAERS: 1 | US FAERS | |
| 139 | Chest discomfort | FAERS: 1 | US FAERS | |
| 140 | Chills | FAERS: 1 | US FAERS | |
| 141 | Choking | FAERS: 1 | US FAERS | |
| 142 | Concomitant disease aggravated | FAERS: 1 | US FAERS | |
| 143 | Conjunctival irritation | FAERS: 1 | US FAERS | |
| 144 | Contact lens intolerance | FAERS: 1 | US FAERS | |
| 145 | Conversion disorder | FAERS: 1 | US FAERS | |
| 146 | Corneal degeneration | FAERS: 1 | US FAERS | |
| 147 | Crying | FAERS: 1 | US FAERS | |
| 148 | Cystoscopy | FAERS: 1 | US FAERS | |
| 149 | Dermatomyositis | FAERS: 1 | US FAERS | |
| 150 | Diplopia | FAERS: 1 | US FAERS | |
| 151 | Disorientation | FAERS: 1 | US FAERS | |
| 152 | Drug administration error | FAERS: 1 | US FAERS | |
| 153 | Drug exposure via breast milk | FAERS: 1 | US FAERS | |
| 154 | Dyspepsia | FAERS: 1 | US FAERS | |
| 155 | Eczema | FAERS: 1 | US FAERS | |
| 156 | Eosinophilia | FAERS: 1 | US FAERS | |
| 157 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 158 | Excessive eye blinking | FAERS: 1 | US FAERS | |
| 159 | Exophthalmos | FAERS: 1 | US FAERS | |
| 160 | Eye complication associated with device | FAERS: 1 | US FAERS | |
| 161 | Eyelid exfoliation | FAERS: 1 | US FAERS | |
| 162 | Eyelid infection | FAERS: 1 | US FAERS | |
| 163 | Eyelid irritation | FAERS: 1 | US FAERS | |
| 164 | Fascial infection | FAERS: 1 | US FAERS | |
| 165 | Feeling Cold | FAERS: 1 | US FAERS | |
| 166 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 167 | Glaucoma | FAERS: 1 | US FAERS | |
| 168 | Hemiplegia | FAERS: 1 | US FAERS | |
| 169 | Hepatitis A antibody positive | FAERS: 1 | US FAERS | |
| 170 | Hepatitis | FAERS: 1 | US FAERS | |
| 171 | Hordeolum | FAERS: 1 | US FAERS | |
| 172 | Hyperkeratosis | FAERS: 1 | US FAERS | |
| 173 | Hypotonic urinary bladder | FAERS: 1 | US FAERS | |
| 174 | Inadequate analgesia | FAERS: 1 | US FAERS | |
| 175 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 176 | Instillation site pruritus | FAERS: 1 | US FAERS | |
| 177 | Keratoconjunctivitis Sicca | FAERS: 1 | US FAERS | |
| 178 | Lacrimation decreased | FAERS: 1 | US FAERS | |
| 179 | Lethargy | FAERS: 1 | US FAERS | |
| 180 | Lymphocytic infiltration | FAERS: 1 | US FAERS | |
| 181 | Medication residue | FAERS: 1 | US FAERS | |
| 182 | Meibomian gland dysfunction | FAERS: 1 | US FAERS | |
| 183 | Mental impairment | FAERS: 1 | US FAERS | |
| 184 | Metamorphopsia | FAERS: 1 | US FAERS | |
| 185 | Mouth swelling | FAERS: 1 | US FAERS | |
| 186 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 187 | Night sweats | FAERS: 1 | US FAERS | |
| 188 | No reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 189 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 190 | Ophthalmoplegia | FAERS: 1 | US FAERS | |
| 191 | Pain of skin | FAERS: 1 | US FAERS | |
| 192 | Parakeratosis | FAERS: 1 | US FAERS | |
| 193 | Periorbital swelling | FAERS: 1 | US FAERS | |
| 194 | Presyncope | FAERS: 1 | US FAERS | |
| 195 | Product administration error | FAERS: 1 | US FAERS | |
| 196 | Product label issue | FAERS: 1 | US FAERS | |
| 197 | Product label on wrong product | FAERS: 1 | US FAERS | |
| 198 | Product outer packaging issue | FAERS: 1 | US FAERS | |
| 199 | Product package associated injury | FAERS: 1 | US FAERS | |
| 200 | Product residue present | FAERS: 1 | US FAERS | |
| 201 | Product use complaint | FAERS: 1 | US FAERS | |
| 202 | Product use issue | FAERS: 1 | US FAERS | |
| 203 | Proteinuria | FAERS: 1 | US FAERS | |
| 204 | Prurigo | FAERS: 1 | US FAERS | |
| 205 | Purpura | FAERS: 1 | US FAERS | |
| 206 | Reaction to excipient | FAERS: 1 | US FAERS | |
| 207 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 208 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 209 | Shock | FAERS: 1 | US FAERS | |
| 210 | Sinusitis | FAERS: 1 | US FAERS | |
| 211 | Skin irritation | FAERS: 1 | US FAERS | |
| 212 | Skin test positive | FAERS: 1 | US FAERS | |
| 213 | Spinal column stenosis | FAERS: 1 | US FAERS | |
| 214 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 215 | Sudden Visual Loss | FAERS: 1 | US FAERS | |
| 216 | Suicide attempt | FAERS: 1 | US FAERS | |
| 217 | Swelling of eyelid | FAERS: 1 | US FAERS | |
| 218 | Swelling | FAERS: 1 | US FAERS | |
| 219 | Therapeutic product effect incomplete | FAERS: 1 | US FAERS | |
| 220 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 221 | Thirst | FAERS: 1 | US FAERS | |
| 222 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 223 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 224 | Urinary Retention | FAERS: 1 | US FAERS | |
| 225 | Vascular purpura | FAERS: 1 | US FAERS | |
| 226 | Vasculitis | FAERS: 1 | US FAERS | |
| 227 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 228 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 229 | Crystalluria | Canada Vigilance: 2 | Canada Vigilance | |
| 230 | Diverticulitis | Canada Vigilance: 1 | Canada Vigilance | |
| 231 | Hyperkinesia | Canada Vigilance: 1 | Canada Vigilance | |
| 232 | Onycholysis | Canada Vigilance: 1 | Canada Vigilance | |
| 233 | Somnambulism | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.