Synjardy
(YBRWIMHXUHRVDV-ZBYKXHQASA-N)
Structure
- SMILES
- CN(C(=N)N=C(N)N)C.CO[C@H]1O[C@@H](c2ccc(c(c2)Cc2ccc(cc2)O[C@@H]2COCC2)Cl)[C@@H]([C@H]([C@@H]1O)O)O.Cl
- Molecular Formula:
- C27H39Cl2N5O7
- Molecular Weight:
- 616.534
- Log P:
- 3.2835
- Hydrogen Bond Acceptor:
- 12
- Hydrogen Bond Donor:
- 7
- TPSA:
- 189.1
- CAS Number(s):
- N/A
Synonym(s)
1.
Synjardy
External Link(s)
| PubChem Compound | 85364160 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Diabetic Ketoacidosis | FAERS: 25 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 2 | Ketoacidosis | FAERS: 20 | US FAERS | |
| 3 | Weight decreased | FAERS: 11 | US FAERS | |
| 4 | Nausea | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 5 | Vomiting | FAERS: 8 | US FAERS | |
| 6 | Blood glucose increased | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 7 | Euglycaemic diabetic ketoacidosis | FAERS: 7 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 8 | Acute kidney injury | FAERS: 6 | US FAERS | |
| 9 | Dizziness | FAERS: 6 | US FAERS | |
| 10 | Asthenia | FAERS: 5 | US FAERS | |
| 11 | Constipation | FAERS: 5 | US FAERS | |
| 12 | Urinary tract infection | FAERS: 5 | US FAERS | |
| 13 | Arthralgia | FAERS: 4 | US FAERS | |
| 14 | Drug ineffective | FAERS: 4 | US FAERS | |
| 15 | Fatigue | FAERS: 4 | US FAERS | |
| 16 | Pruritus | FAERS: 4 | US FAERS | |
| 17 | Abdominal Pain | FAERS: 3 | US FAERS | |
| 18 | Flatulence | FAERS: 3 | US FAERS | |
| 19 | Headache | FAERS: 3 | US FAERS | |
| 20 | Alopecia | FAERS: 2 | US FAERS | |
| 21 | Amputation | FAERS: 2 | US FAERS | |
| 22 | Blood glucose abnormal | FAERS: 2 | US FAERS | |
| 23 | Blood glucose decreased | FAERS: 2 | US FAERS | |
| 24 | Cholangitis | FAERS: 2 | US FAERS | |
| 25 | Dehydration | FAERS: 2 | US FAERS | |
| 26 | Diabetes mellitus inadequate control | FAERS: 2 | US FAERS | |
| 27 | Hypersensitivity | FAERS: 2 | US FAERS | |
| 28 | Hypotension | FAERS: 2 | US FAERS | |
| 29 | Ketonuria | FAERS: 2 | US FAERS | |
| 30 | Metabolic acidosis | FAERS: 2 | US FAERS | |
| 31 | Myocardial Infarction | FAERS: 2 | US FAERS | |
| 32 | Product residue present | FAERS: 2 | US FAERS | |
| 33 | Urticaria | FAERS: 2 | US FAERS | |
| 34 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 35 | Abscess | FAERS: 1 | US FAERS | |
| 36 | Accidental overdose | FAERS: 1 | US FAERS | |
| 37 | Acidosis | FAERS: 1 | US FAERS | |
| 38 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 39 | Albuminuria | FAERS: 1 | US FAERS | |
| 40 | Autonomic neuropathy | FAERS: 1 | US FAERS | |
| 41 | Back Pain | FAERS: 1 | US FAERS | |
| 42 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 43 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 44 | Blood ketone body | FAERS: 1 | US FAERS | |
| 45 | Blood pH abnormal | FAERS: 1 | US FAERS | |
| 46 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 47 | Bronchitis | FAERS: 1 | US FAERS | |
| 48 | Bronchopneumopathy | FAERS: 1 | US FAERS | |
| 49 | Burning sensation | FAERS: 1 | US FAERS | |
| 50 | Cachexia | FAERS: 1 | US FAERS | |
| 51 | Chest Pain | FAERS: 1 | US FAERS | |
| 52 | Craniofacial fracture | FAERS: 1 | US FAERS | |
| 53 | Decreased insulin requirement | FAERS: 1 | US FAERS | |
| 54 | Dental caries | FAERS: 1 | US FAERS | |
| 55 | Diastolic dysfunction | FAERS: 1 | US FAERS | |
| 56 | Disease complication | FAERS: 1 | US FAERS | |
| 57 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 58 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 59 | Dry gangrene | FAERS: 1 | US FAERS | |
| 60 | Dyspepsia | FAERS: 1 | US FAERS | |
| 61 | Electrocardiogram QT interval abnormal | FAERS: 1 | US FAERS | |
| 62 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 63 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 64 | Escherichia urinary tract infection | FAERS: 1 | US FAERS | |
| 65 | Euphoric mood | FAERS: 1 | US FAERS | |
| 66 | Extremity necrosis | FAERS: 1 | US FAERS | |
| 67 | Fasciitis | FAERS: 1 | US FAERS | |
| 68 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 69 | Flank Pain | FAERS: 1 | US FAERS | |
| 70 | General physical health deterioration | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 71 | Head discomfort | FAERS: 1 | US FAERS | |
| 72 | Hepatitis | FAERS: 1 | US FAERS | |
| 73 | Hernia | FAERS: 1 | US FAERS | |
| 74 | Hypophagia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 75 | Inappropriate affect | FAERS: 1 | US FAERS | |
| 76 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 77 | Incorrect product dosage form administered | FAERS: 1 | US FAERS | |
| 78 | Infection | FAERS: 1 | US FAERS | |
| 79 | Inflammatory marker increased | FAERS: 1 | US FAERS | |
| 80 | Intraocular pressure test | FAERS: 1 | US FAERS | |
| 81 | Joint swelling | FAERS: 1 | US FAERS | |
| 82 | Leriche Syndrome | FAERS: 1 | US FAERS | |
| 83 | Lethargy | FAERS: 1 | US FAERS | |
| 84 | Lip swelling | FAERS: 1 | US FAERS | |
| 85 | Malaise | FAERS: 1 | US FAERS | |
| 86 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 87 | Mycosis Fungoides | FAERS: 1 | US FAERS | |
| 88 | Myoclonus | FAERS: 1 | US FAERS | |
| 89 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 90 | Nervousness | FAERS: 1 | US FAERS | |
| 91 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 92 | Osteomyelitis | FAERS: 1 | US FAERS | |
| 93 | Pain | FAERS: 1 | US FAERS | |
| 94 | Palpitations | FAERS: 1 | US FAERS | |
| 95 | Photophobia | FAERS: 1 | US FAERS | |
| 96 | Pneumonia | FAERS: 1 | US FAERS | |
| 97 | Polymyalgia Rheumatica | FAERS: 1 | US FAERS | |
| 98 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 99 | Product dispensing error | FAERS: 1 | US FAERS | |
| 100 | Product quality issue | FAERS: 1 | US FAERS | |
| 101 | Product substitution issue | FAERS: 1 | US FAERS | |
| 102 | Renal pain | FAERS: 1 | US FAERS | |
| 103 | Sepsis | FAERS: 1 | US FAERS | |
| 104 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 105 | Somnolence | FAERS: 1 | US FAERS | |
| 106 | Tachycardia | FAERS: 1 | US FAERS | |
| 107 | Thirst | FAERS: 1 | US FAERS | |
| 108 | Thyroid hormones increased | FAERS: 1 | US FAERS | |
| 109 | Tinnitus | FAERS: 1 | US FAERS | |
| 110 | Urine flow decreased | FAERS: 1 | US FAERS | |
| 111 | Urine ketone body | FAERS: 1 | US FAERS | |
| 112 | Urine ketone body present | FAERS: 1 | US FAERS | |
| 113 | Ventricular hypertrophy | FAERS: 1 | US FAERS | |
| 114 | Visual Impairment | FAERS: 1 | US FAERS | |
| 115 | Vulvovaginal mycotic infection | FAERS: 1 | US FAERS | |
| 116 | Vulvovaginal pruritus | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.