Invokamet
(WLJCALZLZJOJML-FVYJGOGTSA-N)
Structure
- SMILES
- CN(C(=N)N=C(N)N)C.OC[C@H]1O[C@@H](c2ccc(c(c2)Cc2ccc(s2)c2ccc(cc2)F)C)[C@@H]([C@H]([C@@H]1O)O)O
- Molecular Formula:
- C28H36FN5O5S
- Molecular Weight:
- 573.679
- Log P:
- 3.2248
- Hydrogen Bond Acceptor:
- 11
- Hydrogen Bond Donor:
- 7
- TPSA:
- 209.88
- CAS Number(s):
- N/A
Synonym(s)
1.
Invokamet
External Link(s)
| PubChem Compound | 53386314 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Diabetic Ketoacidosis | FAERS: 50 | US FAERS | |
| 2 | Osteomyelitis | FAERS: 48 | US FAERS | |
| 3 | Drug prescribing error | FAERS: 26 | US FAERS | |
| 4 | Inappropriate schedule of drug administration | FAERS: 25 | US FAERS | |
| 5 | Weight decreased | FAERS: 25 | US FAERS | |
| 6 | Blood glucose increased | FAERS: 23 | US FAERS | |
| 7 | Cellulitis | FAERS: 22 | US FAERS | |
| 8 | Drug dose omission | FAERS: 21 | US FAERS | |
| 9 | Gangrene | FAERS: 21 | US FAERS | |
| 10 | Nausea | FAERS: 21 | US FAERS | |
| 11 | Diabetic foot infection | FAERS: 19 | US FAERS | |
| 12 | Skin Ulcer | FAERS: 18 | US FAERS | |
| 13 | Diabetic Foot | FAERS: 16 | US FAERS | |
| 14 | Acute kidney injury | FAERS: 15 | US FAERS | |
| 15 | Dehydration | FAERS: 13 | US FAERS | |
| 16 | Adverse event | FAERS: 12 | US FAERS | |
| 17 | Urinary tract infection | FAERS: 11 | US FAERS | |
| 18 | Vomiting | FAERS: 11 | US FAERS | |
| 19 | Incorrect dose administered | FAERS: 10 | US FAERS | |
| 20 | Abdominal discomfort | FAERS: 9 | US FAERS | |
| 21 | Malaise | FAERS: 9 | US FAERS | |
| 22 | Metabolic acidosis | FAERS: 8 | US FAERS | |
| 23 | Abdominal Pain | FAERS: 7 | US FAERS | |
| 24 | Amputation | FAERS: 7 | US FAERS | |
| 25 | Drug ineffective | FAERS: 7 | US FAERS | |
| 26 | Blood glucose decreased | FAERS: 6 | US FAERS | |
| 27 | Constipation | FAERS: 6 | US FAERS | |
| 28 | Dizziness | FAERS: 6 | US FAERS | |
| 29 | Gas Gangrene | FAERS: 6 | US FAERS | |
| 30 | Urine output increased | FAERS: 6 | US FAERS | |
| 31 | Wrong technique in product usage process | FAERS: 6 | US FAERS | |
| 32 | Flatulence | FAERS: 5 | US FAERS | |
| 33 | Genital infection fungal | FAERS: 5 | US FAERS | |
| 34 | Headache | FAERS: 5 | US FAERS | |
| 35 | Ketoacidosis | FAERS: 5 | US FAERS | |
| 36 | Sepsis | FAERS: 5 | US FAERS | |
| 37 | Asthenia | FAERS: 4 | US FAERS | |
| 38 | Balanoposthitis | FAERS: 4 | US FAERS | |
| 39 | Drug dispensing error | FAERS: 4 | US FAERS | |
| 40 | Medication Error | FAERS: 4 | US FAERS | |
| 41 | Myalgia | FAERS: 4 | US FAERS | |
| 42 | Polyuria | FAERS: 4 | US FAERS | |
| 43 | Wound Infection | FAERS: 4 | US FAERS | |
| 44 | Blood creatinine increased | FAERS: 3 | US FAERS | |
| 45 | Blood glucose abnormal | FAERS: 3 | US FAERS | |
| 46 | Fatigue | FAERS: 3 | US FAERS | |
| 47 | Medication residue present | FAERS: 3 | US FAERS | |
| 48 | Myocardial Infarction | FAERS: 3 | US FAERS | |
| 49 | Pancreatitis | FAERS: 3 | US FAERS | |
| 50 | Product packaging issue | FAERS: 3 | US FAERS | |
| 51 | Product size issue | FAERS: 3 | US FAERS | |
| 52 | Thirst | FAERS: 3 | US FAERS | |
| 53 | Unevaluable event | FAERS: 3 | US FAERS | |
| 54 | Urine ketone body present | FAERS: 3 | US FAERS | |
| 55 | Urticaria | FAERS: 3 | US FAERS | |
| 56 | Visual Impairment | FAERS: 3 | US FAERS | |
| 57 | Vulvovaginal mycotic infection | FAERS: 3 | US FAERS | |
| 58 | Abdominal Abscess | FAERS: 2 | US FAERS | |
| 59 | Acidosis | FAERS: 2 | US FAERS | |
| 60 | Alopecia | FAERS: 2 | US FAERS | |
| 61 | Amnesia | FAERS: 2 | US FAERS | |
| 62 | Anhedonia | FAERS: 2 | US FAERS | |
| 63 | Carbon dioxide decreased | FAERS: 2 | US FAERS | |
| 64 | Cerebrovascular accident | FAERS: 2 | US FAERS | |
| 65 | Diabetic ulcer | FAERS: 2 | US FAERS | |
| 66 | Dysuria | FAERS: 2 | US FAERS | |
| 67 | Erythema | FAERS: 2 | US FAERS | |
| 68 | Expired product administered | FAERS: 2 | US FAERS | |
| 69 | Extremity necrosis | FAERS: 2 | US FAERS | |
| 70 | Feeling abnormal | FAERS: 2 | US FAERS | |
| 71 | Gout | FAERS: 2 | US FAERS | |
| 72 | Hypotension | FAERS: 2 | US FAERS | |
| 73 | Incorrect product storage | FAERS: 2 | US FAERS | |
| 74 | Necrosis | FAERS: 2 | US FAERS | |
| 75 | Peripheral swelling | FAERS: 2 | US FAERS | |
| 76 | Pneumonia | FAERS: 2 | US FAERS | |
| 77 | Product dispensing error | FAERS: 2 | US FAERS | |
| 78 | Product quality issue | FAERS: 2 | US FAERS | |
| 79 | Product storage error | FAERS: 2 | US FAERS | |
| 80 | Product use complaint | FAERS: 2 | US FAERS | |
| 81 | Product use issue | FAERS: 2 | US FAERS | |
| 82 | Pruritus | FAERS: 2 | US FAERS | |
| 83 | Pyelonephritis | FAERS: 2 | US FAERS | |
| 84 | Renal pain | FAERS: 2 | US FAERS | |
| 85 | Septic Shock | FAERS: 2 | US FAERS | |
| 86 | Syncope | FAERS: 2 | US FAERS | |
| 87 | Tachyphrenia | FAERS: 2 | US FAERS | |
| 88 | Therapeutic response unexpected | FAERS: 2 | US FAERS | |
| 89 | Ulcer | FAERS: 2 | US FAERS | |
| 90 | Urinary Incontinence | FAERS: 2 | US FAERS | |
| 91 | Vulvovaginal pruritus | FAERS: 2 | US FAERS | |
| 92 | Abasia | FAERS: 1 | US FAERS | |
| 93 | Abscess | FAERS: 1 | US FAERS | |
| 94 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 95 | Anal Ulcer | FAERS: 1 | US FAERS | |
| 96 | Anal abscess | FAERS: 1 | US FAERS | |
| 97 | Arthralgia | FAERS: 1 | US FAERS | |
| 98 | Arthropathy | FAERS: 1 | US FAERS | |
| 99 | Atelectasis | FAERS: 1 | US FAERS | |
| 100 | Back Pain | FAERS: 1 | US FAERS | |
| 101 | Bedridden | FAERS: 1 | US FAERS | |
| 102 | Blood glucose fluctuation | FAERS: 1 | US FAERS | |
| 103 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 104 | Blood urine present | FAERS: 1 | US FAERS | |
| 105 | Breast tenderness | FAERS: 1 | US FAERS | |
| 106 | Bronchitis | FAERS: 1 | US FAERS | |
| 107 | Burning sensation | FAERS: 1 | US FAERS | |
| 108 | Choking | FAERS: 1 | US FAERS | |
| 109 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 110 | Dermatitis | FAERS: 1 | US FAERS | |
| 111 | Diabetes mellitus inadequate control | FAERS: 1 | US FAERS | |
| 112 | Disability | FAERS: 1 | US FAERS | |
| 113 | Diverticulitis | FAERS: 1 | US FAERS | |
| 114 | Drug administration error | FAERS: 1 | US FAERS | |
| 115 | Drug screen false positive | FAERS: 1 | US FAERS | |
| 116 | Dyslexia | FAERS: 1 | US FAERS | |
| 117 | Escherichia infection | FAERS: 1 | US FAERS | |
| 118 | Escherichia urinary tract infection | FAERS: 1 | US FAERS | |
| 119 | Flushing | FAERS: 1 | US FAERS | |
| 120 | Hypersensitivity | FAERS: 1 | US FAERS | |
| 121 | Incontinence | FAERS: 1 | US FAERS | |
| 122 | Incorrect product dosage form administered | FAERS: 1 | US FAERS | |
| 123 | Infection | FAERS: 1 | US FAERS | |
| 124 | Influenza | FAERS: 1 | US FAERS | |
| 125 | Intercepted medication error | FAERS: 1 | US FAERS | |
| 126 | Joint swelling | FAERS: 1 | US FAERS | |
| 127 | Lethargy | FAERS: 1 | US FAERS | |
| 128 | Medical procedure | FAERS: 1 | US FAERS | |
| 129 | Memory impairment | FAERS: 1 | US FAERS | |
| 130 | Mental status changes | FAERS: 1 | US FAERS | |
| 131 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 132 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 133 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 134 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 135 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 136 | Pathogen resistance | FAERS: 1 | US FAERS | |
| 137 | Penile size reduced | FAERS: 1 | US FAERS | |
| 138 | Peripheral arterial occlusive disease | FAERS: 1 | US FAERS | |
| 139 | Product commingling | FAERS: 1 | US FAERS | |
| 140 | Product friable | FAERS: 1 | US FAERS | |
| 141 | Product label issue | FAERS: 1 | US FAERS | |
| 142 | Product physical issue | FAERS: 1 | US FAERS | |
| 143 | Product prescribing error | FAERS: 1 | US FAERS | |
| 144 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 145 | Proteinuria | FAERS: 1 | US FAERS | |
| 146 | Retching | FAERS: 1 | US FAERS | |
| 147 | Secretion discharge | FAERS: 1 | US FAERS | |
| 148 | Sinusitis | FAERS: 1 | US FAERS | |
| 149 | Somnolence | FAERS: 1 | US FAERS | |
| 150 | Splenic Infarction | FAERS: 1 | US FAERS | |
| 151 | Staphylococcal osteomyelitis | FAERS: 1 | US FAERS | |
| 152 | Systemic Inflammatory Response Syndrome | FAERS: 1 | US FAERS | |
| 153 | Tachycardia | FAERS: 1 | US FAERS | |
| 154 | Therapy cessation | FAERS: 1 | US FAERS | |
| 155 | Urethral ulcer | FAERS: 1 | US FAERS | |
| 156 | Urinary Retention | FAERS: 1 | US FAERS | |
| 157 | Urinary tract infection fungal | FAERS: 1 | US FAERS | |
| 158 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 159 | Vulvovaginal burning sensation | FAERS: 1 | US FAERS | |
| 160 | Vulvovaginal dryness | FAERS: 1 | US FAERS | |
| 161 | Wound dehiscence | FAERS: 1 | US FAERS | |
| 162 | Wrong technique in drug usage process | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120238
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.