Metoclopramide
(RVFUNJWWXKCWNS-UHFFFAOYSA-N)
Structure
- SMILES
- CCN(CCNC(=O)c1cc(Cl)c(cc1OC)N)CC.Cl
- Molecular Formula:
- C14H23Cl2N3O2
- Molecular Weight:
- 336.257
- Log P:
- 3.7765
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 3
- TPSA:
- 67.59
- CAS Number(s):
- 7232-21-5; 49625-23-2
Synonym(s)
1.
Metoclopramide
2.
4-Amino-5-chloro-N-(2-(diethylamino)ethyl)-2-methoxybenzamide
3.
Cerucal
4.
Maxolon
5.
Metaclopramide
6.
Metoclopramide Dihydrochloride
7.
Metoclopramide Hydrochloride
8.
Metoclopramide Monohydrochloride
9.
Metoclopramide Monohydrochloride, Monohydrate
10.
Primperan
11.
Reglan
12.
Rimetin
13.
Dihydrochloride, Metoclopramide
14.
Hydrochloride, Metoclopramide
15.
Monohydrochloride, Metoclopramide
External Link(s)
| MeSH | D008787 |
| PubChem Compound | 657384 23659 139204451 |
| CHEMBL | CHEMBL1256771 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Tardive Dyskinesia | FAERS: 756 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 2 | Incorrect drug administration duration | FAERS: 564 | US FAERS | |
| 3 | Dystonia | FAERS: 155 | US FAERS | |
| 4 | Tremor | FAERS: 124 | US FAERS | |
| 5 | nervous system disorder | FAERS: 118 | US FAERS | |
| 6 | Asthenia | FAERS: 82 | US FAERS | |
| 7 | Economic problem | FAERS: 81 | US FAERS | |
| 8 | Activities of daily living impaired | FAERS: 80 | US FAERS | |
| 9 | Pain | FAERS: 80 | US FAERS | |
| 10 | Deformity | FAERS: 63 | US FAERS | |
| 11 | Anxiety | FAERS: 62 | US FAERS | |
| 12 | Akathisia | FAERS: 60 | US FAERS | |
| 13 | Quality of life decreased | FAERS: 48 | US FAERS | |
| 14 | Emotional disorder | FAERS: 45 | US FAERS | |
| 15 | Anhedonia | FAERS: 29 | US FAERS | |
| 16 | Restless Legs Syndrome | FAERS: 25 | US FAERS | |
| 17 | Unevaluable event | FAERS: 25 | US FAERS | |
| 18 | Visual Impairment | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 19 | Emotional distress | FAERS: 21 | US FAERS | |
| 20 | Agitation | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 21 | Feeling abnormal | FAERS: 7 | US FAERS | |
| 22 | Tachycardia | FAERS: 7 | US FAERS | |
| 23 | Nausea | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 24 | Depression suicidal | FAERS: 5 | US FAERS | |
| 25 | Dizziness | FAERS: 5 | US FAERS | |
| 26 | Somnolence | FAERS: 5 | US FAERS | |
| 27 | Vomiting | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 28 | Partner stress | FAERS: 4 | US FAERS | |
| 29 | Urticaria | FAERS: 4 | US FAERS | |
| 30 | Acute respiratory failure | FAERS: 3 | US FAERS | |
| 31 | Blepharospasm | FAERS: 3 | US FAERS | |
| 32 | Chorea | FAERS: 3 | US FAERS | |
| 33 | Completed Suicide | FAERS: 3 | US FAERS | |
| 34 | Cyanosis | FAERS: 3 | US FAERS | |
| 35 | Disability | FAERS: 3 | US FAERS | |
| 36 | Dysgraphia | FAERS: 3 | US FAERS | |
| 37 | Fatigue | FAERS: 3 | US FAERS | |
| 38 | Headache | FAERS: 3 | US FAERS | |
| 39 | Impaired work ability | FAERS: 3 | US FAERS | |
| 40 | Malaise | FAERS: 3 | US FAERS | |
| 41 | Memory impairment | FAERS: 3 | US FAERS | |
| 42 | Myoclonus | FAERS: 3 | US FAERS | |
| 43 | Neuroleptic Malignant Syndrome | FAERS: 3 | US FAERS | |
| 44 | PCO2 decreased | FAERS: 3 | US FAERS | |
| 45 | PO2 decreased | FAERS: 3 | US FAERS | |
| 46 | Restlessness | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 47 | Altered state of consciousness | FAERS: 2 | US FAERS | |
| 48 | Bradycardia | FAERS: 2 | US FAERS | |
| 49 | Bruxism | FAERS: 2 | US FAERS | |
| 50 | Cardiac Arrest | FAERS: 2 | US FAERS | |
| 51 | Central nervous system lesion | FAERS: 2 | US FAERS | |
| 52 | Chills | FAERS: 2 | US FAERS | |
| 53 | Coma scale abnormal | FAERS: 2 | US FAERS | |
| 54 | Dehydration | FAERS: 2 | US FAERS | |
| 55 | Dementia | FAERS: 2 | US FAERS | |
| 56 | Disseminated Intravascular Coagulation | FAERS: 2 | US FAERS | |
| 57 | Drug ineffective | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 58 | Gaze palsy | FAERS: 2 | US FAERS | |
| 59 | General physical health deterioration | FAERS: 2 | US FAERS | |
| 60 | Loss of personal independence in daily activities | FAERS: 2 | US FAERS | |
| 61 | Mental status changes | FAERS: 2 | US FAERS | |
| 62 | Musculoskeletal stiffness | FAERS: 2 | US FAERS | |
| 63 | Peripheral swelling | FAERS: 2 | US FAERS | |
| 64 | Pneumonia | FAERS: 2 | US FAERS | |
| 65 | Presyncope | FAERS: 2 | US FAERS | |
| 66 | Product use in unapproved indication | FAERS: 2 | US FAERS | |
| 67 | Pruritus | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 68 | Renal tubular necrosis | FAERS: 2 | US FAERS | |
| 69 | Resting Tremor | FAERS: 2 | US FAERS | |
| 70 | Rhabdomyolysis | FAERS: 2 | US FAERS | |
| 71 | Scab | FAERS: 2 | US FAERS | |
| 72 | Torticollis | FAERS: 2 | US FAERS | |
| 73 | Trismus | FAERS: 2 | US FAERS | |
| 74 | Abdominal discomfort | FAERS: 1 | US FAERS | |
| 75 | Abnormal palmar/plantar creases | FAERS: 1 | US FAERS | |
| 76 | Adverse event | FAERS: 1 | US FAERS | |
| 77 | Amniotic fluid volume increased | FAERS: 1 | US FAERS | |
| 78 | Anorexia | FAERS: 1 | US FAERS | |
| 79 | Asterixis | FAERS: 1 | US FAERS | |
| 80 | Ataxia | FAERS: 1 | US FAERS | |
| 81 | Back Pain | FAERS: 1 | US FAERS | |
| 82 | Bladder spasm | FAERS: 1 | US FAERS | |
| 83 | Chest discomfort | FAERS: 1 | US FAERS | |
| 84 | Clonus | FAERS: 1 | US FAERS | |
| 85 | Clumsiness | FAERS: 1 | US FAERS | |
| 86 | Crying | FAERS: 1 | US FAERS | |
| 87 | Drooling | FAERS: 1 | US FAERS | |
| 88 | Drug administration error | FAERS: 1 | US FAERS | |
| 89 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 90 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 91 | Drug withdrawal syndrome | FAERS: 1 | US FAERS | |
| 92 | Dysarthria | FAERS: 1 | US FAERS | |
| 93 | Dyspepsia | FAERS: 1 | US FAERS | |
| 94 | Electrocardiogram QT interval abnormal | FAERS: 1 | US FAERS | |
| 95 | Excessive eye blinking | FAERS: 1 | US FAERS | |
| 96 | Feeling jittery | FAERS: 1 | US FAERS | |
| 97 | Gastrointestinal Pain | FAERS: 1 | US FAERS | |
| 98 | Glossitis | FAERS: 1 | US FAERS | |
| 99 | Grip strength decreased | FAERS: 1 | US FAERS | |
| 100 | Hyperpyrexia | FAERS: 1 | US FAERS | |
| 101 | Hypersensitivity | FAERS: 1 | US FAERS | |
| 102 | Hypotension | FAERS: 1 | US FAERS | |
| 103 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 104 | Incorrect dose administered | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 105 | Initial insomnia | FAERS: 1 | US FAERS | |
| 106 | Injection site injury | FAERS: 1 | US FAERS | |
| 107 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 108 | Intervertebral disc compression | FAERS: 1 | US FAERS | |
| 109 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 110 | Joint stiffness | FAERS: 1 | US FAERS | |
| 111 | Laceration | FAERS: 1 | US FAERS | |
| 112 | Laryngomalacia | FAERS: 1 | US FAERS | |
| 113 | Lethargy | FAERS: 1 | US FAERS | |
| 114 | Long QT Syndrome | FAERS: 1 | US FAERS | |
| 115 | Loose tooth | FAERS: 1 | US FAERS | |
| 116 | Macrocephaly | FAERS: 1 | US FAERS | |
| 117 | Mastication disorder | FAERS: 1 | US FAERS | |
| 118 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 119 | Medical induction of coma | FAERS: 1 | US FAERS | |
| 120 | Mental impairment | FAERS: 1 | US FAERS | |
| 121 | Metamorphopsia | FAERS: 1 | US FAERS | |
| 122 | Microphthalmos | FAERS: 1 | US FAERS | |
| 123 | Mood swings | FAERS: 1 | US FAERS | |
| 124 | Myocardial Infarction | FAERS: 1 | US FAERS | |
| 125 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 126 | Nervousness | FAERS: 1 | US FAERS | |
| 127 | Nuchal Rigidity | FAERS: 1 | US FAERS | |
| 128 | Oculogyric crisis | FAERS: 1 | US FAERS | |
| 129 | Oral pain | FAERS: 1 | US FAERS | |
| 130 | Otitis Media | FAERS: 1 | US FAERS | |
| 131 | Pallor | FAERS: 1 | US FAERS | |
| 132 | Paraparesis | FAERS: 1 | US FAERS | |
| 133 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 134 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 135 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 136 | Posturing | FAERS: 1 | US FAERS | |
| 137 | Rash erythematous | FAERS: 1 | US FAERS | |
| 138 | Sciatic Nerve Palsy | FAERS: 1 | US FAERS | |
| 139 | Screaming | FAERS: 1 | US FAERS | |
| 140 | Septic Shock | FAERS: 1 | US FAERS | |
| 141 | Staring | FAERS: 1 | US FAERS | |
| 142 | Stridor | FAERS: 1 | US FAERS | |
| 143 | Talipes | FAERS: 1 | US FAERS | |
| 144 | Tongue biting | FAERS: 1 | US FAERS | |
| 145 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 146 | Upper respiratory tract congestion | FAERS: 1 | US FAERS | |
| 147 | Urinary Retention | FAERS: 1 | US FAERS | |
| 148 | Vertigo | FAERS: 1 | US FAERS | |
| 149 | Constipation | Canada Vigilance: 1 | Canada Vigilance | |
| 150 | Depressed Level of Consciousness | Canada Vigilance: 1 | Canada Vigilance | |
| 151 | Dreamy state | Canada Vigilance: 1 | Canada Vigilance | |
| 152 | Flat affect | Canada Vigilance: 1 | Canada Vigilance | |
| 153 | Muscle Rigidity | Canada Vigilance: 1 | Canada Vigilance | |
| 154 | Unresponsive to stimuli | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120269
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.