ribociclib
(RHXHGRAEPCAFML-UHFFFAOYSA-N)
Structure
- SMILES
- CN(C(=O)c1cc2c(n1C1CCCC1)nc(nc2)Nc1ccc(cn1)N1CCNCC1)C
- Type(s)
- Approved; Investigational
- ATC code(s)
- L01XE42
- Molecular Formula:
- C23H30N8O
- Molecular Weight:
- 434.537
- Log P:
- 3.2632
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 2
- TPSA:
- 91.21
- CAS Number(s):
- 1211441-98-3
Synonym(s)
1.
ribociclib
2.
LEE011
External Link(s)
| MeSH | C000589651 |
| PubChem Compound | 44631912 |
| BindingDB | 148264 |
| CHEMBL | CHEMBL3545110 |
| DrugBank | DB11730 |
| DrugCentral | 5218 |
| IUPHAR/BPS Guide to PHARMACOLOGY | 7383 |
| KEGG | dr:D10883 |
| Therapeutic Target Database | D08MXP |
| ZINC | 72316335 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Nausea | FAERS: 122 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 2 | Fatigue | FAERS: 111 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 3 | Neutropenia | FAERS: 105 Canada Vigilance: 15 | Canada Vigilance US FAERS | |
| 4 | White blood cell count decreased | FAERS: 62 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 5 | Malaise | FAERS: 57 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 6 | Malignant neoplasm progression | FAERS: 56 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 7 | Vomiting | FAERS: 47 | US FAERS | |
| 8 | Alopecia | FAERS: 41 | US FAERS | |
| 9 | Disease Progression | FAERS: 39 | US FAERS | |
| 10 | Drug ineffective | FAERS: 36 Canada Vigilance: 23 | Canada Vigilance US FAERS | |
| 11 | Constipation | FAERS: 32 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 12 | Pruritus | FAERS: 27 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 13 | Back Pain | FAERS: 26 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 14 | Dizziness | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 15 | Pain | FAERS: 25 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 16 | Headache | FAERS: 24 | US FAERS | |
| 17 | Feeling abnormal | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 18 | Asthenia | FAERS: 16 | US FAERS | |
| 19 | Nasopharyngitis | FAERS: 16 | US FAERS | |
| 20 | Peripheral swelling | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 21 | Abdominal discomfort | FAERS: 15 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 22 | Abdominal Pain | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 23 | Leukopenia | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 24 | Pneumonia | FAERS: 14 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 25 | Chest Pain | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 26 | Aspartate Aminotransferase Increased | FAERS: 12 | US FAERS | |
| 27 | Febrile Neutropenia | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 28 | Full blood count decreased | FAERS: 12 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 29 | Palpitations | FAERS: 12 | US FAERS | |
| 30 | Stomatitis | FAERS: 12 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 31 | Myocardial Infarction | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 32 | Alanine Aminotransferase Increased | FAERS: 10 | US FAERS | |
| 33 | Arthralgia | FAERS: 10 | US FAERS | |
| 34 | Atrial Fibrillation | FAERS: 10 | US FAERS | |
| 35 | Blood creatinine increased | FAERS: 10 | US FAERS | |
| 36 | Dehydration | FAERS: 10 | US FAERS | |
| 37 | Inappropriate schedule of drug administration | FAERS: 10 | US FAERS | |
| 38 | Infection | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 39 | Lethargy | FAERS: 9 | US FAERS | |
| 40 | Pulmonary Embolism | FAERS: 9 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 41 | Somnolence | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 42 | Thrombocytopenia | FAERS: 9 | US FAERS | |
| 43 | Tremor | FAERS: 9 | US FAERS | |
| 44 | Visual Impairment | FAERS: 9 | US FAERS | |
| 45 | Bone pain | FAERS: 8 | US FAERS | |
| 46 | Dyspepsia | FAERS: 8 | US FAERS | |
| 47 | Hypersensitivity | FAERS: 8 | US FAERS | |
| 48 | Inappropriate schedule of product administration | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 49 | Oropharyngeal pain | FAERS: 8 | US FAERS | |
| 50 | Pneumonitis | FAERS: 8 | US FAERS | |
| 51 | Weight decreased | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 52 | Electrocardiogram abnormal | FAERS: 7 | US FAERS | |
| 53 | Erythema | FAERS: 7 | US FAERS | |
| 54 | General physical health deterioration | FAERS: 7 | US FAERS | |
| 55 | Musculoskeletal chest pain | FAERS: 7 | US FAERS | |
| 56 | Myalgia | FAERS: 7 | US FAERS | |
| 57 | Neutrophil count decreased | FAERS: 7 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 58 | Syncope | FAERS: 7 | US FAERS | |
| 59 | Urticaria | FAERS: 7 | US FAERS | |
| 60 | Blood count abnormal | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 61 | Bradycardia | FAERS: 6 | US FAERS | |
| 62 | Chest discomfort | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 63 | Dysgeusia | FAERS: 6 | US FAERS | |
| 64 | Hepatotoxicity | FAERS: 6 | US FAERS | |
| 65 | Incorrect dose administered | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 66 | Ascites | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 67 | Blood urea increased | FAERS: 5 | US FAERS | |
| 68 | Cerebrovascular accident | FAERS: 5 | US FAERS | |
| 69 | Colitis | FAERS: 5 | US FAERS | |
| 70 | Epistaxis | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 71 | Lymphadenopathy | FAERS: 5 | US FAERS | |
| 72 | Memory impairment | FAERS: 5 | US FAERS | |
| 73 | Musculoskeletal Pain | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 74 | Pancreatitis | FAERS: 5 | US FAERS | |
| 75 | Pancytopenia | FAERS: 5 | US FAERS | |
| 76 | Product use in unapproved indication | FAERS: 5 | US FAERS | |
| 77 | Product use issue | FAERS: 5 | US FAERS | |
| 78 | Sepsis | FAERS: 5 | US FAERS | |
| 79 | Therapy cessation | FAERS: 5 | US FAERS | |
| 80 | Anxiety | FAERS: 4 | US FAERS | |
| 81 | Blood creatine increased | FAERS: 4 | US FAERS | |
| 82 | Cellulitis | FAERS: 4 | US FAERS | |
| 83 | Chills | FAERS: 4 | US FAERS | |
| 84 | Dry skin | FAERS: 4 | US FAERS | |
| 85 | Hypotension | FAERS: 4 | US FAERS | |
| 86 | Influenza | FAERS: 4 | US FAERS | |
| 87 | Product dose omission | FAERS: 4 | US FAERS | |
| 88 | Radiation injury | FAERS: 4 | US FAERS | |
| 89 | Rash erythematous | FAERS: 4 | US FAERS | |
| 90 | Sinusitis | FAERS: 4 | US FAERS | |
| 91 | Swelling | FAERS: 4 | US FAERS | |
| 92 | Therapy change | FAERS: 4 | US FAERS | |
| 93 | Thrombasthenia | FAERS: 4 | US FAERS | |
| 94 | Urinary tract infection | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 95 | Acute kidney injury | FAERS: 3 | US FAERS | |
| 96 | Aphonia | FAERS: 3 | US FAERS | |
| 97 | Blood glucose increased | FAERS: 3 | US FAERS | |
| 98 | Bone lesion | FAERS: 3 | US FAERS | |
| 99 | Bone marrow infiltration | FAERS: 3 | US FAERS | |
| 100 | Bronchitis | FAERS: 3 | US FAERS | |
| 101 | Cardiac Arrest | FAERS: 3 | US FAERS | |
| 102 | Decreased immune responsiveness | FAERS: 3 | US FAERS | |
| 103 | Dementia | FAERS: 3 | US FAERS | |
| 104 | Drug dose omission | FAERS: 3 | US FAERS | |
| 105 | Eructation | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 106 | Feeling Cold | FAERS: 3 | US FAERS | |
| 107 | Hypersomnia | FAERS: 3 | US FAERS | |
| 108 | Joint swelling | FAERS: 3 | US FAERS | |
| 109 | Laryngitis | FAERS: 3 | US FAERS | |
| 110 | Lower respiratory tract infection | FAERS: 3 | US FAERS | |
| 111 | Nervousness | FAERS: 3 | US FAERS | |
| 112 | Neutropenic sepsis | FAERS: 3 | US FAERS | |
| 113 | No adverse event | FAERS: 3 | US FAERS | |
| 114 | Oral candidiasis | FAERS: 3 | US FAERS | |
| 115 | Oral pain | FAERS: 3 | US FAERS | |
| 116 | Overdose | FAERS: 3 | US FAERS | |
| 117 | Productive Cough | FAERS: 3 | US FAERS | |
| 118 | Sinus bradycardia | FAERS: 3 | US FAERS | |
| 119 | Stress | FAERS: 3 | US FAERS | |
| 120 | Tachycardia | FAERS: 3 | US FAERS | |
| 121 | Thrombosis | FAERS: 3 | US FAERS | |
| 122 | Transaminases increased | FAERS: 3 | US FAERS | |
| 123 | Wrong technique in product usage process | FAERS: 3 | US FAERS | |
| 124 | Acne | FAERS: 2 | US FAERS | |
| 125 | Anaphylactic shock | FAERS: 2 | US FAERS | |
| 126 | Arthropod sting | FAERS: 2 | US FAERS | |
| 127 | Asthma | FAERS: 2 | US FAERS | |
| 128 | Autoimmune hepatitis | FAERS: 2 | US FAERS | |
| 129 | Blood magnesium decreased | FAERS: 2 | US FAERS | |
| 130 | Blood phosphorus decreased | FAERS: 2 | US FAERS | |
| 131 | Blood potassium decreased | FAERS: 2 | US FAERS | |
| 132 | Blood potassium increased | FAERS: 2 | US FAERS | |
| 133 | Cancer Pain | FAERS: 2 | US FAERS | |
| 134 | Carbohydrate antigen 27.29 increased | FAERS: 2 | US FAERS | |
| 135 | Cardiotoxicity | FAERS: 2 | US FAERS | |
| 136 | Cerebral disorder | FAERS: 2 | US FAERS | |
| 137 | Concomitant disease aggravated | FAERS: 2 | US FAERS | |
| 138 | Discomfort | FAERS: 2 | US FAERS | |
| 139 | Dysuria | FAERS: 2 | US FAERS | |
| 140 | Electrocardiogram QT interval abnormal | FAERS: 2 | US FAERS | |
| 141 | Electrocardiogram ST segment abnormal | FAERS: 2 | US FAERS | |
| 142 | Emotional disorder | FAERS: 2 | US FAERS | |
| 143 | Feeling of body temperature change | FAERS: 2 | US FAERS | |
| 144 | Food Poisoning | FAERS: 2 | US FAERS | |
| 145 | Gamma-Glutamyltransferase Increased | FAERS: 2 | US FAERS | |
| 146 | Gastrointestinal infection | FAERS: 2 | US FAERS | |
| 147 | General physical condition abnormal | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 148 | Hepatitis | FAERS: 2 | US FAERS | |
| 149 | Hypoxia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 150 | Lymphocyte count decreased | FAERS: 2 | US FAERS | |
| 151 | Lymphoma | FAERS: 2 | US FAERS | |
| 152 | Maternal exposure timing unspecified | FAERS: 2 | US FAERS | |
| 153 | Metastasis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 154 | Monocyte count decreased | FAERS: 2 | US FAERS | |
| 155 | Musculoskeletal discomfort | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 156 | Myocarditis | FAERS: 2 | US FAERS | |
| 157 | Night sweats | FAERS: 2 | US FAERS | |
| 158 | Nonspecific reaction | FAERS: 2 | US FAERS | |
| 159 | Optic Neuritis | FAERS: 2 | US FAERS | |
| 160 | Pleurisy | FAERS: 2 | US FAERS | |
| 161 | Product storage error | FAERS: 2 | US FAERS | |
| 162 | Purpura | FAERS: 2 | US FAERS | |
| 163 | Skin lesion | FAERS: 2 | US FAERS | |
| 164 | Snoring | FAERS: 2 | US FAERS | |
| 165 | Therapeutic response unexpected | FAERS: 2 | US FAERS | |
| 166 | Tooth Infection | FAERS: 2 | US FAERS | |
| 167 | Vertigo | FAERS: 2 | US FAERS | |
| 168 | Vitreous floaters | FAERS: 2 | US FAERS | |
| 169 | Acute respiratory failure | FAERS: 1 | US FAERS | |
| 170 | Adverse event | FAERS: 1 | US FAERS | |
| 171 | Ageusia | FAERS: 1 | US FAERS | |
| 172 | Agitation | FAERS: 1 | US FAERS | |
| 173 | Anal Fistula | FAERS: 1 | US FAERS | |
| 174 | Aneurysm | FAERS: 1 | US FAERS | |
| 175 | Angina Pectoris | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 176 | Appendicitis | FAERS: 1 | US FAERS | |
| 177 | Blindness | FAERS: 1 | US FAERS | |
| 178 | Blood bilirubin abnormal | FAERS: 1 | US FAERS | |
| 179 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 180 | Blood creatine phosphokinase MB increased | FAERS: 1 | US FAERS | |
| 181 | Blood electrolytes abnormal | FAERS: 1 | US FAERS | |
| 182 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 183 | Blood iron decreased | FAERS: 1 | US FAERS | |
| 184 | Blood lactate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 185 | Blood phosphorus increased | FAERS: 1 | US FAERS | |
| 186 | Blood urine present | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 187 | Burning sensation | FAERS: 1 | US FAERS | |
| 188 | Carcinoembryonic antigen increased | FAERS: 1 | US FAERS | |
| 189 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 190 | Cardiac dysfunction | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 191 | Cataract | FAERS: 1 | US FAERS | |
| 192 | Choking sensation | FAERS: 1 | US FAERS | |
| 193 | Cholangitis | FAERS: 1 | US FAERS | |
| 194 | Cholecystitis | FAERS: 1 | US FAERS | |
| 195 | Chromaturia | FAERS: 1 | US FAERS | |
| 196 | Cold sweat | FAERS: 1 | US FAERS | |
| 197 | Cor pulmonale | FAERS: 1 | US FAERS | |
| 198 | Critical Illness | FAERS: 1 | US FAERS | |
| 199 | Crying | FAERS: 1 | US FAERS | |
| 200 | Cystitis | FAERS: 1 | US FAERS | |
| 201 | Cytopenia | FAERS: 1 | US FAERS | |
| 202 | Depressed mood | FAERS: 1 | US FAERS | |
| 203 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 204 | Diplopia | FAERS: 1 | US FAERS | |
| 205 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 206 | Dysgraphia | FAERS: 1 | US FAERS | |
| 207 | Dysphonia | FAERS: 1 | US FAERS | |
| 208 | Enterococcal infection | FAERS: 1 | US FAERS | |
| 209 | Eosinophilia | FAERS: 1 | US FAERS | |
| 210 | Epilepsy | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 211 | Erysipelas | FAERS: 1 | US FAERS | |
| 212 | Exophthalmos | FAERS: 1 | US FAERS | |
| 213 | Extra dose administered | FAERS: 1 | US FAERS | |
| 214 | Flatulence | FAERS: 1 | US FAERS | |
| 215 | Flushing | FAERS: 1 | US FAERS | |
| 216 | Food Allergy | FAERS: 1 | US FAERS | |
| 217 | Frustration tolerance decreased | FAERS: 1 | US FAERS | |
| 218 | Gait inability | FAERS: 1 | US FAERS | |
| 219 | Genital contusion | FAERS: 1 | US FAERS | |
| 220 | Head Banging | FAERS: 1 | US FAERS | |
| 221 | Hospice Care | FAERS: 1 | US FAERS | |
| 222 | Hypertransaminasaemia | FAERS: 1 | US FAERS | |
| 223 | Hypokinesia | FAERS: 1 | US FAERS | |
| 224 | Hypophagia | FAERS: 1 | US FAERS | |
| 225 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 226 | Increased tendency to bruise | FAERS: 1 | US FAERS | |
| 227 | Infectious pleural effusion | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 228 | Intervertebral disc compression | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 229 | Intestinal Perforation | FAERS: 1 | US FAERS | |
| 230 | Keratitis | FAERS: 1 | US FAERS | |
| 231 | Left Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 232 | Limb discomfort | FAERS: 1 | US FAERS | |
| 233 | Lip swelling | FAERS: 1 | US FAERS | |
| 234 | Liver function test decreased | FAERS: 1 | US FAERS | |
| 235 | Lupus-like syndrome | FAERS: 1 | US FAERS | |
| 236 | Lymphangiosis carcinomatosa | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 237 | Lymphangitis | FAERS: 1 | US FAERS | |
| 238 | Manufacturing product shipping issue | FAERS: 1 | US FAERS | |
| 239 | Monocyte count increased | FAERS: 1 | US FAERS | |
| 240 | Mood swings | FAERS: 1 | US FAERS | |
| 241 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 242 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 243 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 244 | Neck Pain | FAERS: 1 | US FAERS | |
| 245 | Negative thoughts | FAERS: 1 | US FAERS | |
| 246 | Neuralgia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 247 | Neutrophil count abnormal | FAERS: 1 | US FAERS | |
| 248 | Onychoclasis | FAERS: 1 | US FAERS | |
| 249 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 250 | Osteopenia | FAERS: 1 | US FAERS | |
| 251 | Oxygen saturation abnormal | FAERS: 1 | US FAERS | |
| 252 | Pallor | FAERS: 1 | US FAERS | |
| 253 | Paraparesis | FAERS: 1 | US FAERS | |
| 254 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 255 | Petechiae | FAERS: 1 | US FAERS | |
| 256 | Pharyngitis | FAERS: 1 | US FAERS | |
| 257 | Platelet count abnormal | FAERS: 1 | US FAERS | |
| 258 | Platelet distribution width decreased | FAERS: 1 | US FAERS | |
| 259 | Poor quality product administered | FAERS: 1 | US FAERS | |
| 260 | Prescribed underdose | FAERS: 1 | US FAERS | |
| 261 | Procedural complication | FAERS: 1 | US FAERS | |
| 262 | Product prescribing error | FAERS: 1 | US FAERS | |
| 263 | Product size issue | FAERS: 1 | US FAERS | |
| 264 | Product use complaint | FAERS: 1 | US FAERS | |
| 265 | Protein total increased | FAERS: 1 | US FAERS | |
| 266 | Psoriasis | FAERS: 1 | US FAERS | |
| 267 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 268 | Punctate keratitis | FAERS: 1 | US FAERS | |
| 269 | Puncture site reaction | FAERS: 1 | US FAERS | |
| 270 | QRS axis abnormal | FAERS: 1 | US FAERS | |
| 271 | Red cell distribution width decreased | FAERS: 1 | US FAERS | |
| 272 | Renal mass | FAERS: 1 | US FAERS | |
| 273 | Renal pain | FAERS: 1 | US FAERS | |
| 274 | Respiratory Failure | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 275 | Right Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 276 | Rosacea | FAERS: 1 | US FAERS | |
| 277 | Sinus Arrhythmia | FAERS: 1 | US FAERS | |
| 278 | Sinus headache | FAERS: 1 | US FAERS | |
| 279 | Skin irritation | FAERS: 1 | US FAERS | |
| 280 | Skin reaction | FAERS: 1 | US FAERS | |
| 281 | Skin texture abnormal | FAERS: 1 | US FAERS | |
| 282 | Skin toxicity | FAERS: 1 | US FAERS | |
| 283 | Sneezing | FAERS: 1 | US FAERS | |
| 284 | Splenic cyst | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 285 | Status Epilepticus | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 286 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 287 | Sudden death | FAERS: 1 | US FAERS | |
| 288 | Terminal state | FAERS: 1 | US FAERS | |
| 289 | Thermal burn | FAERS: 1 | US FAERS | |
| 290 | Throat irritation | FAERS: 1 | US FAERS | |
| 291 | Thrombocytosis | FAERS: 1 | US FAERS | |
| 292 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 293 | Tracheitis | FAERS: 1 | US FAERS | |
| 294 | Ulcer | FAERS: 1 | US FAERS | |
| 295 | Unevaluable event | FAERS: 1 | US FAERS | |
| 296 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 297 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 298 | Urinary Retention | FAERS: 1 | US FAERS | |
| 299 | Urinary Tract Pain | FAERS: 1 | US FAERS | |
| 300 | Vein collapse | FAERS: 1 | US FAERS | |
| 301 | Vertebral lesion | FAERS: 1 | US FAERS | |
| 302 | Vocal Cord Paralysis | FAERS: 1 | US FAERS | |
| 303 | Wheezing | FAERS: 1 | US FAERS | |
| 304 | Wrong dose | FAERS: 1 | US FAERS | |
| 305 | Xerophthalmia | FAERS: 1 | US FAERS | |
| 306 | furuncle | FAERS: 1 | US FAERS | |
| 307 | Dermatitis | Canada Vigilance: 1 | Canada Vigilance | |
| 308 | Failure to Thrive | Canada Vigilance: 1 | Canada Vigilance | |
| 309 | Nasal discomfort | Canada Vigilance: 1 | Canada Vigilance | |
| 310 | Purulent discharge | Canada Vigilance: 1 | Canada Vigilance | |
| 311 | Scab | Canada Vigilance: 1 | Canada Vigilance | |
| 312 | Tongue exfoliation | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.