Rocuronium
(OYTJKRAYGYRUJK-FMCCZJBLSA-M)
Structure
- SMILES
- C=CC[N+]1(CCCC1)[C@H]1C[C@@H]2[C@]([C@H]1OC(=O)C)(C)CC[C@H]1[C@H]2CC[C@@H]2[C@]1(C)C[C@@H]([C@H](C2)O)N1CCOCC1.[Br-]
- Molecular Formula:
- C32H53BrN2O4
- Molecular Weight:
- 609.678
- Log P:
- 1.3082
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 1
- TPSA:
- 59
- CAS Number(s):
- 119302-91-9
Synonym(s)
1.
Rocuronium
2.
1-(17-(Acetoyl)-3-hydroxy-2-(4-morpholinyl)androstan-16-yl)-1-(2-propenyl)pyrrolidinium
3.
Esmeron
4.
Esmerone
5.
ORG 9426
6.
ORG-9426
7.
Pyrrolidinium, 1-((2beta,3alpha,5alpha,16beta,17beta)-17-(acetyloxy)-3-hydroxy-2-(4-morpholinyl)androstan-16-yl)-1-(2-propenyl)-, bromide
8.
Rocuronium Bromide
9.
Zemuron
10.
ORG9426
External Link(s)
| MeSH | D000077123 |
| PubChem Compound | 441351 |
| BindingDB | 50248153 |
| ChEBI | 8885 |
| CHEMBL | CHEMBL1200648 |
| KEGG | dr:D00765 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 156 Canada Vigilance: 11 | Canada Vigilance US FAERS | |
| 2 | Cardiac Arrest | FAERS: 57 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 3 | Hypotension | FAERS: 57 | US FAERS | |
| 4 | Bronchospasm | FAERS: 32 | US FAERS | |
| 5 | Anaphylactic shock | FAERS: 31 | US FAERS | |
| 6 | Tachycardia | FAERS: 31 | US FAERS | |
| 7 | Product quality issue | FAERS: 25 | US FAERS | |
| 8 | Urticaria | FAERS: 19 | US FAERS | |
| 9 | Endotracheal intubation complication | FAERS: 16 | US FAERS | |
| 10 | Hypoxia | FAERS: 15 | US FAERS | |
| 11 | Respiratory arrest | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 12 | Drug effect incomplete | FAERS: 10 | US FAERS | |
| 13 | Hypoventilation | FAERS: 10 | US FAERS | |
| 14 | Product measured potency issue | FAERS: 10 | US FAERS | |
| 15 | Bradycardia | FAERS: 9 | US FAERS | |
| 16 | Erythema | FAERS: 8 | US FAERS | |
| 17 | Flushing | FAERS: 8 | US FAERS | |
| 18 | Spirometry abnormal | FAERS: 8 | US FAERS | |
| 19 | Airway peak pressure increased | FAERS: 7 | US FAERS | |
| 20 | Respiratory Depression | FAERS: 7 | US FAERS | |
| 21 | Shock | FAERS: 7 | US FAERS | |
| 22 | Medication Error | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 23 | Hypersensitivity | FAERS: 5 | US FAERS | |
| 24 | Incorrect product storage | FAERS: 5 | US FAERS | |
| 25 | Procedural complication | FAERS: 5 | US FAERS | |
| 26 | Rhabdomyolysis | FAERS: 5 | US FAERS | |
| 27 | Anxiety | FAERS: 4 | US FAERS | |
| 28 | Asthenia | FAERS: 4 | US FAERS | |
| 29 | Crying | FAERS: 4 | US FAERS | |
| 30 | Incorrect dose administered | FAERS: 4 | US FAERS | |
| 31 | Pharmaceutical product complaint | FAERS: 4 | US FAERS | |
| 32 | Poor quality drug administered | FAERS: 4 | US FAERS | |
| 33 | Product substitution issue | FAERS: 4 | US FAERS | |
| 34 | Unresponsive to stimuli | FAERS: 4 | US FAERS | |
| 35 | Wheezing | FAERS: 4 | US FAERS | |
| 36 | Wrong drug administered | FAERS: 4 | US FAERS | |
| 37 | Accidental exposure to product | FAERS: 3 | US FAERS | |
| 38 | Brain Death | FAERS: 3 | US FAERS | |
| 39 | Drug effect delayed | FAERS: 3 | US FAERS | |
| 40 | Muscle tightness | FAERS: 3 | US FAERS | |
| 41 | No adverse event | FAERS: 3 | US FAERS | |
| 42 | Post procedural complication | FAERS: 3 | US FAERS | |
| 43 | Respiratory Failure | FAERS: 3 | US FAERS | |
| 44 | Respiratory distress | FAERS: 3 | US FAERS | |
| 45 | Sepsis | FAERS: 3 | US FAERS | |
| 46 | Therapeutic product ineffective | FAERS: 3 | US FAERS | |
| 47 | Toxicity to various agents | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 48 | Victim of homicide | FAERS: 3 | US FAERS | |
| 49 | Adverse event | FAERS: 2 | US FAERS | |
| 50 | Anaphylactoid Reaction | FAERS: 2 | US FAERS | |
| 51 | Angioedema | FAERS: 2 | US FAERS | |
| 52 | Atrial Fibrillation | FAERS: 2 | US FAERS | |
| 53 | Completed Suicide | FAERS: 2 | US FAERS | |
| 54 | Electrolyte imbalance | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 55 | Infusion Site Extravasation | FAERS: 2 | US FAERS | |
| 56 | Muscle Rigidity | FAERS: 2 | US FAERS | |
| 57 | Myocardial Infarction | FAERS: 2 | US FAERS | |
| 58 | Neuromuscular blocking therapy | FAERS: 2 | US FAERS | |
| 59 | Overdose | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 60 | Pain | FAERS: 2 | US FAERS | |
| 61 | Paradoxical drug reaction | FAERS: 2 | US FAERS | |
| 62 | Prescribed overdose | FAERS: 2 | US FAERS | |
| 63 | Product complaint | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 64 | Product storage error | FAERS: 2 | US FAERS | |
| 65 | Sinus Tachycardia | FAERS: 2 | US FAERS | |
| 66 | Skin test positive | FAERS: 2 | US FAERS | |
| 67 | Therapeutic product effect incomplete | FAERS: 2 | US FAERS | |
| 68 | Tryptase increased | FAERS: 2 | US FAERS | |
| 69 | Ventricular Fibrillation | FAERS: 2 | US FAERS | |
| 70 | Vocal Cord Dysfunction | FAERS: 2 | US FAERS | |
| 71 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 72 | Abdominal Infection | FAERS: 1 | US FAERS | |
| 73 | Accidental overdose | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 74 | Amnesia | FAERS: 1 | US FAERS | |
| 75 | Apallic syndrome | FAERS: 1 | US FAERS | |
| 76 | Apparent death | FAERS: 1 | US FAERS | |
| 77 | Asthma | FAERS: 1 | US FAERS | |
| 78 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 79 | Burning sensation | FAERS: 1 | US FAERS | |
| 80 | Cerebrovascular accident | FAERS: 1 | US FAERS | |
| 81 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 82 | Deformity | FAERS: 1 | US FAERS | |
| 83 | Drug abuse | FAERS: 1 | US FAERS | |
| 84 | Drug administration error | FAERS: 1 | US FAERS | |
| 85 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 86 | Drug effect variable | FAERS: 1 | US FAERS | |
| 87 | Drug resistance | FAERS: 1 | US FAERS | |
| 88 | Duodenal Ulcer | FAERS: 1 | US FAERS | |
| 89 | Dysarthria | FAERS: 1 | US FAERS | |
| 90 | Electromechanical dissociation | FAERS: 1 | US FAERS | |
| 91 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 92 | Extravasation | FAERS: 1 | US FAERS | |
| 93 | Fracture | FAERS: 1 | US FAERS | |
| 94 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 95 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 96 | Homicide | FAERS: 1 | US FAERS | |
| 97 | Hypersensitivity myocarditis | FAERS: 1 | US FAERS | |
| 98 | Hyperthyroidism | FAERS: 1 | US FAERS | |
| 99 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 100 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 101 | Incorrect route of product administration | FAERS: 1 | US FAERS | |
| 102 | Infusion site pain | FAERS: 1 | US FAERS | |
| 103 | Infusion site rash | FAERS: 1 | US FAERS | |
| 104 | Injection Site Reaction | FAERS: 1 | US FAERS | |
| 105 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 106 | Intubation | FAERS: 1 | US FAERS | |
| 107 | Kounis Syndrome | FAERS: 1 | US FAERS | |
| 108 | Lymphocyte stimulation test positive | FAERS: 1 | US FAERS | |
| 109 | Maternal exposure during delivery | FAERS: 1 | US FAERS | |
| 110 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 111 | Mechanical ventilation | FAERS: 1 | US FAERS | |
| 112 | Mini-tracheostomy | FAERS: 1 | US FAERS | |
| 113 | Monoplegia | FAERS: 1 | US FAERS | |
| 114 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 115 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 116 | Myoglobin blood increased | FAERS: 1 | US FAERS | |
| 117 | Neuroleptic Malignant Syndrome | FAERS: 1 | US FAERS | |
| 118 | Neurological examination abnormal | FAERS: 1 | US FAERS | |
| 119 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 120 | Paraplegia | FAERS: 1 | US FAERS | |
| 121 | Physical disability | FAERS: 1 | US FAERS | |
| 122 | Procedural hypotension | FAERS: 1 | US FAERS | |
| 123 | Product container issue | FAERS: 1 | US FAERS | |
| 124 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 125 | Product use issue | FAERS: 1 | US FAERS | |
| 126 | Purulence | FAERS: 1 | US FAERS | |
| 127 | Radioallergosorbent test positive | FAERS: 1 | US FAERS | |
| 128 | Rash erythematous | FAERS: 1 | US FAERS | |
| 129 | Recurrence of neuromuscular blockade | FAERS: 1 | US FAERS | |
| 130 | Similar reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 131 | Skin reaction | FAERS: 1 | US FAERS | |
| 132 | Stress | FAERS: 1 | US FAERS | |
| 133 | Suicide attempt | FAERS: 1 | US FAERS | |
| 134 | Swelling | FAERS: 1 | US FAERS | |
| 135 | Syncope | FAERS: 1 | US FAERS | |
| 136 | Therapeutic reaction time decreased | FAERS: 1 | US FAERS | |
| 137 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 138 | Therapeutic response unexpected with drug substitution | FAERS: 1 | US FAERS | |
| 139 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 140 | Thermal burn | FAERS: 1 | US FAERS | |
| 141 | Tidal volume decreased | FAERS: 1 | US FAERS | |
| 142 | Toxicologic test abnormal | FAERS: 1 | US FAERS | |
| 143 | Transcription medication error | FAERS: 1 | US FAERS | |
| 144 | Traumatic delivery | FAERS: 1 | US FAERS | |
| 145 | Tremor | FAERS: 1 | US FAERS | |
| 146 | Trismus | FAERS: 1 | US FAERS | |
| 147 | Type III immune complex mediated reaction | FAERS: 1 | US FAERS | |
| 148 | Unevaluable event | FAERS: 1 | US FAERS | |
| 149 | Vascular rupture | FAERS: 1 | US FAERS | |
| 150 | Vocal Cord Paralysis | FAERS: 1 | US FAERS | |
| 151 | Weaning failure | FAERS: 1 | US FAERS | |
| 152 | Wrong product administered | FAERS: 1 | US FAERS | |
| 153 | intensive care | FAERS: 1 | US FAERS | |
| 154 | treatment failure | FAERS: 1 | US FAERS | |
| 155 | Anastomotic Leak | Canada Vigilance: 1 | Canada Vigilance | |
| 156 | Therapeutic product effect decreased | Canada Vigilance: 1 | Canada Vigilance | |
| 157 | Therapy change | Canada Vigilance: 1 | Canada Vigilance | |
| 158 | Urinary Retention | Canada Vigilance: 1 | Canada Vigilance | |
| 159 | Wound Infection | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120239
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.