Ergocalciferols
(MECHNRXZTMCUDQ-RKHKHRCZSA-N)
Structure
- SMILES
- O[C@H]1CCC(=C)/C(=C\C=C\2/CCC[C@]3([C@H]2CC[C@@H]3[C@@H](/C=C/[C@@H](C(C)C)C)C)C)/C1
- Type(s)
- Approved; Nutraceutical
- ATC code(s)
- A11CC01
- Molecular Formula:
- C28H44O
- Molecular Weight:
- 396.648
- Log P:
- 7.6410
- Hydrogen Bond Acceptor:
- 1
- Hydrogen Bond Donor:
- 1
- TPSA:
- 20.23
- CAS Number(s):
- 50-14-6
Synonym(s)
1.
Ergocalciferols
2.
Calciferols
3.
Vitamin D 2
4.
Ergocalciferol
5.
Vitamin D2
6.
D2, Vitamin
External Link(s)
| MeSH | D004872 |
| PubChem Compound | 5280793 |
| BindingDB | 50247883 |
| ChEBI | 28934 |
| CHEMBL | CHEMBL1536 |
| DrugBank | DB00153 |
| DrugCentral | 2838 |
| KEGG | cpd:C05441 dr:D00187 |
| ZINC | 4629876 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Malnutrition | FAERS: 10 | US FAERS | |
| 2 | Weight decreased | FAERS: 10 | US FAERS | |
| 3 | Asthenia | FAERS: 9 | US FAERS | |
| 4 | Blood 25-hydroxycholecalciferol increased | FAERS: 9 | US FAERS | |
| 5 | Blood parathyroid hormone decreased | FAERS: 9 | US FAERS | |
| 6 | Dehydration | FAERS: 9 | US FAERS | |
| 7 | Hypercalciuria | FAERS: 9 | 6600835 | CTD US FAERS |
| 8 | Hypersensitivity | FAERS: 9 | US FAERS | |
| 9 | Nausea | FAERS: 9 | US FAERS | |
| 10 | Polyuria | FAERS: 9 | US FAERS | |
| 11 | Dysgeusia | FAERS: 8 | US FAERS | |
| 12 | Fatigue | FAERS: 8 | US FAERS | |
| 13 | Headache | FAERS: 7 | US FAERS | |
| 14 | Nephrocalcinosis | FAERS: 7 | 9430241 13414150 | CTD US FAERS |
| 15 | Myalgia | FAERS: 6 | US FAERS | |
| 16 | Vomiting | FAERS: 6 | US FAERS | |
| 17 | Bone pain | FAERS: 5 | US FAERS | |
| 18 | Malaise | FAERS: 5 | US FAERS | |
| 19 | Pruritus | FAERS: 5 | US FAERS | |
| 20 | Urticaria | FAERS: 5 | US FAERS | |
| 21 | Abdominal discomfort | FAERS: 4 | US FAERS | |
| 22 | Dizziness | FAERS: 4 | US FAERS | |
| 23 | Lethargy | FAERS: 4 | US FAERS | |
| 24 | Abasia | FAERS: 3 | US FAERS | |
| 25 | Abdominal Pain | FAERS: 3 | US FAERS | |
| 26 | Amnesia | FAERS: 3 | US FAERS | |
| 27 | Arthralgia | FAERS: 3 | US FAERS | |
| 28 | Constipation | FAERS: 3 | US FAERS | |
| 29 | Drug dispensing error | FAERS: 3 | US FAERS | |
| 30 | Incorrect dose administered | FAERS: 3 | US FAERS | |
| 31 | Pain | FAERS: 3 | US FAERS | |
| 32 | Somnolence | FAERS: 3 | US FAERS | |
| 33 | Toxicity to various agents | FAERS: 3 | US FAERS | |
| 34 | Unevaluable event | FAERS: 3 | US FAERS | |
| 35 | Accidental overdose | FAERS: 2 | US FAERS | |
| 36 | Acute kidney injury | FAERS: 2 | US FAERS | |
| 37 | Alopecia | FAERS: 2 | US FAERS | |
| 38 | Blood creatinine increased | FAERS: 2 | US FAERS | |
| 39 | Chest discomfort | FAERS: 2 | US FAERS | |
| 40 | Flatulence | FAERS: 2 | US FAERS | |
| 41 | Lip swelling | FAERS: 2 | US FAERS | |
| 42 | Medication residue present | FAERS: 2 | US FAERS | |
| 43 | Musculoskeletal stiffness | FAERS: 2 | US FAERS | |
| 44 | Nephrolithiasis | FAERS: 2 | US FAERS | |
| 45 | Thirst | FAERS: 2 | US FAERS | |
| 46 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 47 | Allergic reaction to excipient | FAERS: 1 | US FAERS | |
| 48 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 49 | Angioedema | FAERS: 1 | US FAERS | |
| 50 | Angiotensin converting enzyme increased | FAERS: 1 | US FAERS | |
| 51 | Anxiety | FAERS: 1 | US FAERS | |
| 52 | Aortic Valve Stenosis | FAERS: 1 | US FAERS | |
| 53 | Apathy | FAERS: 1 | US FAERS | |
| 54 | Arthritis | FAERS: 1 | US FAERS | |
| 55 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 56 | Asphyxia | FAERS: 1 | US FAERS | |
| 57 | Astigmatism | FAERS: 1 | US FAERS | |
| 58 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 59 | Back Pain | FAERS: 1 | US FAERS | |
| 60 | Blood 1,25-dihydroxycholecalciferol increased | FAERS: 1 | US FAERS | |
| 61 | Blood parathyroid hormone increased | FAERS: 1 | US FAERS | |
| 62 | Blood urea increased | FAERS: 1 | US FAERS | |
| 63 | Calciphylaxis | FAERS: 1 | US FAERS | |
| 64 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 65 | Chest Pain | FAERS: 1 | US FAERS | |
| 66 | Chills | FAERS: 1 | US FAERS | |
| 67 | Deafness | FAERS: 1 | US FAERS | |
| 68 | Depressed mood | FAERS: 1 | US FAERS | |
| 69 | Drug dose omission | FAERS: 1 | US FAERS | |
| 70 | Drug level above therapeutic | FAERS: 1 | US FAERS | |
| 71 | Drug toxicity | FAERS: 1 | US FAERS | |
| 72 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 73 | Eructation | FAERS: 1 | US FAERS | |
| 74 | Eye irritation | FAERS: 1 | US FAERS | |
| 75 | Eye pain | FAERS: 1 | US FAERS | |
| 76 | Failure to Thrive | FAERS: 1 | US FAERS | |
| 77 | Growth retardation | FAERS: 1 | US FAERS | |
| 78 | Head discomfort | FAERS: 1 | US FAERS | |
| 79 | Hypervitaminosis D | FAERS: 1 | US FAERS | |
| 80 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 81 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 82 | Intercepted drug administration error | FAERS: 1 | US FAERS | |
| 83 | Limb discomfort | FAERS: 1 | US FAERS | |
| 84 | Medication Error | FAERS: 1 | US FAERS | |
| 85 | Memory impairment | FAERS: 1 | US FAERS | |
| 86 | Mental impairment | FAERS: 1 | US FAERS | |
| 87 | Mental status changes | FAERS: 1 | US FAERS | |
| 88 | Morbid thoughts | FAERS: 1 | US FAERS | |
| 89 | Neck Pain | FAERS: 1 | US FAERS | |
| 90 | Nerve injury | FAERS: 1 | US FAERS | |
| 91 | Nocturia | FAERS: 1 | US FAERS | |
| 92 | Overdose | FAERS: 1 | US FAERS | |
| 93 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 94 | Purpura | FAERS: 1 | US FAERS | |
| 95 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 96 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 97 | Respiratory tract irritation | FAERS: 1 | US FAERS | |
| 98 | Rhinalgia | FAERS: 1 | US FAERS | |
| 99 | Skin necrosis | FAERS: 1 | US FAERS | |
| 100 | Stress | FAERS: 1 | US FAERS | |
| 101 | Tinnitus | FAERS: 1 | US FAERS | |
| 102 | Tremor | FAERS: 1 | US FAERS | |
| 103 | Visual Impairment | FAERS: 1 | US FAERS | |
| 104 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 105 | Wheelchair user | FAERS: 1 | US FAERS | |
| 106 | Wheezing | FAERS: 1 | US FAERS | |
| 107 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 108 | muscle injury | FAERS: 1 | US FAERS | |
| 109 | Arteriosclerosis | CTD | ||
| 110 | Atherosclerosis | 18442015 | CTD | |
| 111 | Azotemia | 9430241 | CTD | |
| 112 | Calcinosis | Canada Vigilance: 1 | Canada Vigilance | |
| 113 | Familial Hypophosphatemic Rickets | 9430241 | CTD | |
| 114 | Gastrointestinal Hemorrhage | 18049428 18442015 | CTD | |
| 115 | Hepatitis C | 17420205 | CTD | |
| 116 | Hypercalcemia | CTD | ||
| 117 | Hypoparathyroidism | 8528347 | CTD | |
| 118 | Juvenile osteoporosis | 5305802 | CTD | |
| 119 | Osteomalacia | 4148461 | CTD | |
| 120 | Ulcer | 18049428 18442015 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120240
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.