Deoxycholic Acid
(KXGVEGMKQFWNSR-LLQZFEROSA-N)
Structure
- SMILES
- O[C@@H]1CC[C@]2([C@@H](C1)CC[C@@H]1[C@@H]2C[C@H](O)[C@]2([C@H]1CC[C@@H]2[C@@H](CCC(=O)O)C)C)C
- Type(s)
- Approved
- ATC code(s)
- D11AX24
- Molecular Formula:
- C24H40O4
- Molecular Weight:
- 392.572
- Log P:
- 4.4779
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 3
- TPSA:
- 77.76
- CAS Number(s):
- 83-44-3; 115349-14-9
Synonym(s)
1.
Deoxycholic Acid
2.
Deoxycholate
3.
Desoxycholic Acid
4.
Choleic Acid
5.
Deoxycholic Acid, 12beta-Isomer
6.
Deoxycholic Acid, 3beta-Isomer
7.
Deoxycholic Acid, 5alpha-Isomer
8.
Deoxycholic Acid, Disodium Salt
9.
Deoxycholic Acid, Magnesium (2:1) Salt
10.
Deoxycholic Acid, Monoammonium Salt
11.
Deoxycholic Acid, Monopotassium Salt
12.
Deoxycholic Acid, Monosodium Salt
13.
Deoxycholic Acid, Sodium Salt, 12beta-Isomer
14.
Dihydroxycholanoic Acid
15.
Lagodeoxycholic Acid
16.
Sodium Deoxycholate
17.
12beta-Isomer Deoxycholic Acid
18.
3beta-Isomer Deoxycholic Acid
19.
5alpha-Isomer Deoxycholic Acid
20.
Acid, 5alpha-Isomer Deoxycholic
21.
Acid, Choleic
22.
Acid, Deoxycholic
23.
Acid, Desoxycholic
24.
Acid, Dihydroxycholanoic
25.
Acid, Lagodeoxycholic
26.
Deoxycholate, Sodium
27.
Deoxycholic Acid, 12beta Isomer
28.
Deoxycholic Acid, 3beta Isomer
29.
Deoxycholic Acid, 5alpha Isomer
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 148 | US FAERS | |
| 2 | Swelling | FAERS: 108 | US FAERS | |
| 3 | Injection site pain | FAERS: 92 | US FAERS | |
| 4 | Injection site nodule | FAERS: 76 | US FAERS | |
| 5 | Nerve injury | FAERS: 56 | US FAERS | |
| 6 | Facial Paresis | FAERS: 54 | US FAERS | |
| 7 | Injection site mass | FAERS: 46 | US FAERS | |
| 8 | Injection site erythema | FAERS: 41 | US FAERS | |
| 9 | Injection site bruising | FAERS: 40 | US FAERS | |
| 10 | Facial asymmetry | FAERS: 30 | US FAERS | |
| 11 | Alopecia | FAERS: 23 | US FAERS | |
| 12 | Pain | FAERS: 23 | US FAERS | |
| 13 | Erythema | FAERS: 21 | US FAERS | |
| 14 | Wrong technique in product usage process | FAERS: 21 | US FAERS | |
| 15 | Induration | FAERS: 17 | US FAERS | |
| 16 | Neck Pain | FAERS: 17 | US FAERS | |
| 17 | Injection site ulcer | FAERS: 16 | US FAERS | |
| 18 | Nodule | FAERS: 16 | US FAERS | |
| 19 | Dizziness | FAERS: 15 | US FAERS | |
| 20 | Oropharyngeal pain | FAERS: 15 | US FAERS | |
| 21 | Skin Ulcer | FAERS: 15 | US FAERS | |
| 22 | Injection site discomfort | FAERS: 13 | US FAERS | |
| 23 | Headache | FAERS: 12 | US FAERS | |
| 24 | Pallor | FAERS: 12 | US FAERS | |
| 25 | Urticaria | FAERS: 12 | US FAERS | |
| 26 | Facial paralysis | FAERS: 11 | US FAERS | |
| 27 | Feeling abnormal | FAERS: 11 | US FAERS | |
| 28 | Injection site necrosis | FAERS: 11 | US FAERS | |
| 29 | Injection site warmth | FAERS: 11 | US FAERS | |
| 30 | Weight decreased | FAERS: 11 | US FAERS | |
| 31 | Injection site inflammation | FAERS: 10 | US FAERS | |
| 32 | Product administered at inappropriate site | FAERS: 10 | US FAERS | |
| 33 | Nausea | FAERS: 9 | US FAERS | |
| 34 | Administration site induration | FAERS: 8 | US FAERS | |
| 35 | Lymphadenopathy | FAERS: 8 | US FAERS | |
| 36 | Scab | FAERS: 8 | US FAERS | |
| 37 | Wrong drug administered | FAERS: 8 | US FAERS | |
| 38 | Discomfort | FAERS: 7 | US FAERS | |
| 39 | Facial Pain | FAERS: 7 | US FAERS | |
| 40 | Injection site scab | FAERS: 7 | US FAERS | |
| 41 | Toothache | FAERS: 7 | US FAERS | |
| 42 | Vascular occlusion | FAERS: 7 | US FAERS | |
| 43 | Application site swelling | FAERS: 6 | US FAERS | |
| 44 | Expired product administered | FAERS: 6 | US FAERS | |
| 45 | Incorrect route of drug administration | FAERS: 6 | US FAERS | |
| 46 | Incorrect route of product administration | FAERS: 6 | US FAERS | |
| 47 | Pain of skin | FAERS: 6 | US FAERS | |
| 48 | Pruritus | FAERS: 6 | US FAERS | |
| 49 | Rash erythematous | FAERS: 6 | US FAERS | |
| 50 | Vomiting | FAERS: 6 | US FAERS | |
| 51 | Acne | FAERS: 5 | US FAERS | |
| 52 | Cerebrovascular accident | FAERS: 5 | US FAERS | |
| 53 | Dry skin | FAERS: 5 | US FAERS | |
| 54 | Dysarthria | FAERS: 5 | US FAERS | |
| 55 | Injection site scar | FAERS: 5 | US FAERS | |
| 56 | Skin Wrinkling | FAERS: 5 | US FAERS | |
| 57 | Skin tightness | FAERS: 5 | US FAERS | |
| 58 | Accidental exposure to product | FAERS: 4 | US FAERS | |
| 59 | Alopecia Areata | FAERS: 4 | US FAERS | |
| 60 | Drug ineffective for unapproved indication | FAERS: 4 | US FAERS | |
| 61 | Excessive skin | FAERS: 4 | US FAERS | |
| 62 | Hypersensitivity | FAERS: 4 | US FAERS | |
| 63 | Inflammation | FAERS: 4 | US FAERS | |
| 64 | Injection site pruritus | FAERS: 4 | US FAERS | |
| 65 | Injection site vesicles | FAERS: 4 | US FAERS | |
| 66 | Musculoskeletal stiffness | FAERS: 4 | US FAERS | |
| 67 | Occupational exposure to product | FAERS: 4 | US FAERS | |
| 68 | Skin irritation | FAERS: 4 | US FAERS | |
| 69 | Skin necrosis | FAERS: 4 | US FAERS | |
| 70 | Thermal burn | FAERS: 4 | US FAERS | |
| 71 | Adverse event | FAERS: 3 | US FAERS | |
| 72 | Application site alopecia | FAERS: 3 | US FAERS | |
| 73 | Calcinosis | FAERS: 3 | US FAERS | |
| 74 | Chest discomfort | FAERS: 3 | US FAERS | |
| 75 | Chills | FAERS: 3 | US FAERS | |
| 76 | Drug administered at inappropriate site | FAERS: 3 | US FAERS | |
| 77 | Dysgeusia | FAERS: 3 | US FAERS | |
| 78 | Dysphonia | FAERS: 3 | US FAERS | |
| 79 | Eye irritation | FAERS: 3 | US FAERS | |
| 80 | Injection Site Reaction | FAERS: 3 | US FAERS | |
| 81 | Injection site atrophy | FAERS: 3 | US FAERS | |
| 82 | Injection site cyst | FAERS: 3 | US FAERS | |
| 83 | Injection site urticaria | FAERS: 3 | US FAERS | |
| 84 | Joint stiffness | FAERS: 3 | US FAERS | |
| 85 | Lip exfoliation | FAERS: 3 | US FAERS | |
| 86 | Malaise | FAERS: 3 | US FAERS | |
| 87 | Mouth swelling | FAERS: 3 | US FAERS | |
| 88 | Presyncope | FAERS: 3 | US FAERS | |
| 89 | Skin Induration | FAERS: 3 | US FAERS | |
| 90 | Skin lesion | FAERS: 3 | US FAERS | |
| 91 | Ulcer | FAERS: 3 | US FAERS | |
| 92 | Vertigo | FAERS: 3 | US FAERS | |
| 93 | Abscess | FAERS: 2 | US FAERS | |
| 94 | Administration site abscess | FAERS: 2 | US FAERS | |
| 95 | Administration site necrosis | FAERS: 2 | US FAERS | |
| 96 | Amnesia | FAERS: 2 | US FAERS | |
| 97 | Anxiety | FAERS: 2 | US FAERS | |
| 98 | Application site nodule | FAERS: 2 | US FAERS | |
| 99 | Application site pain | FAERS: 2 | US FAERS | |
| 100 | Chemical injury | FAERS: 2 | US FAERS | |
| 101 | Chest Pain | FAERS: 2 | US FAERS | |
| 102 | Chloasma | FAERS: 2 | US FAERS | |
| 103 | Cold sweat | FAERS: 2 | US FAERS | |
| 104 | Counterfeit product administered | FAERS: 2 | US FAERS | |
| 105 | Deformity | FAERS: 2 | US FAERS | |
| 106 | Drug effect incomplete | FAERS: 2 | US FAERS | |
| 107 | Embolism | FAERS: 2 | US FAERS | |
| 108 | Emotional distress | FAERS: 2 | US FAERS | |
| 109 | Encephalitis | FAERS: 2 | US FAERS | |
| 110 | Feeling Cold | FAERS: 2 | US FAERS | |
| 111 | Flushing | FAERS: 2 | US FAERS | |
| 112 | Frostbite | FAERS: 2 | US FAERS | |
| 113 | Gingival Recession | FAERS: 2 | US FAERS | |
| 114 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 115 | Infection | FAERS: 2 | US FAERS | |
| 116 | Injection site alopecia | FAERS: 2 | US FAERS | |
| 117 | Injection site hypersensitivity | FAERS: 2 | US FAERS | |
| 118 | Injection site hypertrophy | FAERS: 2 | US FAERS | |
| 119 | Injection site infection | FAERS: 2 | US FAERS | |
| 120 | Injection site pallor | FAERS: 2 | US FAERS | |
| 121 | Lip swelling | FAERS: 2 | US FAERS | |
| 122 | Muscle tightness | FAERS: 2 | US FAERS | |
| 123 | Musculoskeletal discomfort | FAERS: 2 | US FAERS | |
| 124 | Necrosis | FAERS: 2 | 21362627 | CTD US FAERS |
| 125 | Nuchal Rigidity | FAERS: 2 | US FAERS | |
| 126 | Oral pain | FAERS: 2 | US FAERS | |
| 127 | Oral pustule | FAERS: 2 | US FAERS | |
| 128 | Palpitations | FAERS: 2 | US FAERS | |
| 129 | Procedural complication | FAERS: 2 | US FAERS | |
| 130 | Sepsis | FAERS: 2 | US FAERS | |
| 131 | Soft tissue mass | FAERS: 2 | US FAERS | |
| 132 | Trigeminal palsy | FAERS: 2 | US FAERS | |
| 133 | Visual Impairment | FAERS: 2 | US FAERS | |
| 134 | Vulvovaginal pruritus | FAERS: 2 | US FAERS | |
| 135 | Administration site discomfort | FAERS: 1 | US FAERS | |
| 136 | Administration site erythema | FAERS: 1 | US FAERS | |
| 137 | Administration site extravasation | FAERS: 1 | US FAERS | |
| 138 | Administration site scab | FAERS: 1 | US FAERS | |
| 139 | Administration site swelling | FAERS: 1 | US FAERS | |
| 140 | Administration site warmth | FAERS: 1 | US FAERS | |
| 141 | Ageusia | FAERS: 1 | US FAERS | |
| 142 | Aphasia | FAERS: 1 | US FAERS | |
| 143 | Application site induration | FAERS: 1 | US FAERS | |
| 144 | Application site movement impairment | FAERS: 1 | US FAERS | |
| 145 | Application site plaque | FAERS: 1 | US FAERS | |
| 146 | Application site vesicles | FAERS: 1 | US FAERS | |
| 147 | Arterial Injury | FAERS: 1 | US FAERS | |
| 148 | Arteriosclerosis | FAERS: 1 | US FAERS | |
| 149 | Arthralgia | FAERS: 1 | US FAERS | |
| 150 | Asthenia | FAERS: 1 | US FAERS | |
| 151 | Back Pain | FAERS: 1 | US FAERS | |
| 152 | Blood blister | FAERS: 1 | US FAERS | |
| 153 | Blood ketone body increased | FAERS: 1 | US FAERS | |
| 154 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 155 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 156 | Burning sensation | FAERS: 1 | US FAERS | |
| 157 | Chemical burn of skin | FAERS: 1 | US FAERS | |
| 158 | Choking sensation | FAERS: 1 | US FAERS | |
| 159 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 160 | Cluster Headache | FAERS: 1 | US FAERS | |
| 161 | Constipation | FAERS: 1 | US FAERS | |
| 162 | Cutis Laxa | FAERS: 1 | US FAERS | |
| 163 | Dermatitis | FAERS: 1 | US FAERS | |
| 164 | Disorientation | FAERS: 1 | US FAERS | |
| 165 | Drug administration error | FAERS: 1 | US FAERS | |
| 166 | Ear discomfort | FAERS: 1 | US FAERS | |
| 167 | Fat necrosis | FAERS: 1 | US FAERS | |
| 168 | Fat redistribution | FAERS: 1 | US FAERS | |
| 169 | Gait inability | FAERS: 1 | US FAERS | |
| 170 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 171 | Gingival discomfort | FAERS: 1 | US FAERS | |
| 172 | Granuloma | FAERS: 1 | US FAERS | |
| 173 | Guillain-Barre Syndrome | FAERS: 1 | US FAERS | |
| 174 | Head discomfort | FAERS: 1 | US FAERS | |
| 175 | Hyperplasia | FAERS: 1 | 8095246 | CTD US FAERS |
| 176 | Hypertrophy | FAERS: 1 | US FAERS | |
| 177 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 178 | Hypotrichosis | FAERS: 1 | US FAERS | |
| 179 | Iatrogenic injury | FAERS: 1 | US FAERS | |
| 180 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 181 | Impaired work ability | FAERS: 1 | US FAERS | |
| 182 | Impetigo | FAERS: 1 | US FAERS | |
| 183 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 184 | Injection site abscess | FAERS: 1 | US FAERS | |
| 185 | Injection site cellulitis | FAERS: 1 | US FAERS | |
| 186 | Injection site deformation | FAERS: 1 | US FAERS | |
| 187 | Injection site dermatitis | FAERS: 1 | US FAERS | |
| 188 | Injection site discharge | FAERS: 1 | US FAERS | |
| 189 | Injection site exfoliation | FAERS: 1 | US FAERS | |
| 190 | Injection site fibrosis | FAERS: 1 | US FAERS | |
| 191 | Injection site indentation | FAERS: 1 | US FAERS | |
| 192 | Injection site irritation | FAERS: 1 | US FAERS | |
| 193 | Injection site joint swelling | FAERS: 1 | US FAERS | |
| 194 | Injection site nerve damage | FAERS: 1 | US FAERS | |
| 195 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 196 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 197 | Joint swelling | FAERS: 1 | US FAERS | |
| 198 | Laceration | FAERS: 1 | US FAERS | |
| 199 | Leukoderma | FAERS: 1 | US FAERS | |
| 200 | Limb discomfort | FAERS: 1 | US FAERS | |
| 201 | Lipoatrophy | FAERS: 1 | US FAERS | |
| 202 | Lipohypertrophy | FAERS: 1 | US FAERS | |
| 203 | Lipoma | FAERS: 1 | US FAERS | |
| 204 | Mastication disorder | FAERS: 1 | US FAERS | |
| 205 | Medication Error | FAERS: 1 | US FAERS | |
| 206 | Memory impairment | FAERS: 1 | US FAERS | |
| 207 | Multifocal motor neuropathy | FAERS: 1 | US FAERS | |
| 208 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 209 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 210 | Myalgia | FAERS: 1 | US FAERS | |
| 211 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 212 | Necrosis of artery | FAERS: 1 | US FAERS | |
| 213 | Neuralgia | FAERS: 1 | US FAERS | |
| 214 | Oral pruritus | FAERS: 1 | US FAERS | |
| 215 | Oropharyngeal blistering | FAERS: 1 | US FAERS | |
| 216 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 217 | Overdose | FAERS: 1 | US FAERS | |
| 218 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 219 | Post inflammatory pigmentation change | FAERS: 1 | US FAERS | |
| 220 | Pregnancy | FAERS: 1 | US FAERS | |
| 221 | Product administration error | FAERS: 1 | US FAERS | |
| 222 | Product counterfeit | FAERS: 1 | US FAERS | |
| 223 | Product label confusion | FAERS: 1 | US FAERS | |
| 224 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 225 | Product use issue | FAERS: 1 | US FAERS | |
| 226 | Productive Cough | FAERS: 1 | US FAERS | |
| 227 | Propionibacterium infection | FAERS: 1 | US FAERS | |
| 228 | Pyoderma Gangrenosum | FAERS: 1 | US FAERS | |
| 229 | Reflux laryngitis | FAERS: 1 | US FAERS | |
| 230 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 231 | Seroma | FAERS: 1 | US FAERS | |
| 232 | Skin Erosion | FAERS: 1 | US FAERS | |
| 233 | Skin hypertrophy | FAERS: 1 | US FAERS | |
| 234 | Skin indentation | FAERS: 1 | US FAERS | |
| 235 | Skin laceration | FAERS: 1 | US FAERS | |
| 236 | Skin texture abnormal | FAERS: 1 | US FAERS | |
| 237 | Soft tissue necrosis | FAERS: 1 | US FAERS | |
| 238 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 239 | Syncope | FAERS: 1 | US FAERS | |
| 240 | Tendon discomfort | FAERS: 1 | US FAERS | |
| 241 | Thyroid Neoplasm | FAERS: 1 | US FAERS | |
| 242 | Tinnitus | FAERS: 1 | US FAERS | |
| 243 | Tissue injury | FAERS: 1 | US FAERS | |
| 244 | Tonsillitis | FAERS: 1 | US FAERS | |
| 245 | Tremor | FAERS: 1 | US FAERS | |
| 246 | Trismus | FAERS: 1 | US FAERS | |
| 247 | Venous Injury | FAERS: 1 | US FAERS | |
| 248 | Wrong product administered | FAERS: 1 | US FAERS | |
| 249 | Aberrant Crypt Foci | 12636105 | CTD | |
| 250 | Brain Injuries | 17188501 | CTD | |
| 251 | Chemical and Drug Induced Liver Injury | CTD | ||
| 252 | Colonic Neoplasms | 16213893 18444174 | CTD | |
| 253 | Gliosis | 17188501 | CTD | |
| 254 | Liver Neoplasms, Experimental | 6150873 6150874 | CTD | |
| 255 | Liver neoplasms | 1641875 | CTD | |
| 256 | Movement Disorders | 17188501 | CTD | |
| 257 | Precancerous Conditions | 1974829 8095246 8593453 | CTD | |
| 258 | Stomach Neoplasms | 2704366 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120238
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.