Pseudoephedrine
(KWGRBVOPPLSCSI-WCBMZHEXSA-N)
Structure
- SMILES
- CN[C@H]([C@H](c1ccccc1)O)C
- Type(s)
- Approved
- ATC code(s)
- R01BA02; R01BA52
- Molecular Formula:
- C10H15NO
- Molecular Weight:
- 165.232
- Log P:
- 1.7188
- Hydrogen Bond Acceptor:
- 2
- Hydrogen Bond Donor:
- 2
- TPSA:
- 32.26
- CAS Number(s):
- 90-82-4
Synonym(s)
1.
Pseudoephedrine
2.
Isoephedrine
3.
Pseudoephedrine HCl
4.
Pseudoephedrine Hydrochloride
5.
Sudafed
6.
Threo Isomer of Ephedrine
7.
Ephedrine Threo Isomer
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 131 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 2 | Therapeutic response unexpected | FAERS: 67 | US FAERS | |
| 3 | Product use in unapproved indication | FAERS: 63 | US FAERS | |
| 4 | Product use issue | FAERS: 52 | US FAERS | |
| 5 | Incorrect dose administered | FAERS: 41 | US FAERS | |
| 6 | Palpitations | FAERS: 38 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 7 | Somnolence | FAERS: 37 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 8 | Hypersensitivity | FAERS: 32 Canada Vigilance: 1 | 9377115 | CTD Canada Vigilance US FAERS |
| 9 | Drug ineffective for unapproved indication | FAERS: 29 | US FAERS | |
| 10 | Expired product administered | FAERS: 25 | US FAERS | |
| 11 | Toxicity to various agents | FAERS: 22 | US FAERS | |
| 12 | Dizziness | FAERS: 17 Canada Vigilance: 3 | 11361053 | CTD Canada Vigilance US FAERS |
| 13 | Feeling abnormal | FAERS: 17 | US FAERS | |
| 14 | Anxiety | FAERS: 16 | US FAERS | |
| 15 | Adverse event | FAERS: 15 | US FAERS | |
| 16 | Drug screen positive | FAERS: 14 | US FAERS | |
| 17 | Urticaria | FAERS: 13 Canada Vigilance: 1 | 12637407 | CTD Canada Vigilance US FAERS |
| 18 | Headache | FAERS: 12 Canada Vigilance: 1 | CTD Canada Vigilance US FAERS | |
| 19 | Sudden infant death syndrome | FAERS: 12 | US FAERS | |
| 20 | Wrong technique in product usage process | FAERS: 11 | US FAERS | |
| 21 | Product packaging issue | FAERS: 10 | US FAERS | |
| 22 | Tremor | FAERS: 10 Canada Vigilance: 2 | 1557278 | CTD Canada Vigilance US FAERS |
| 23 | Drug administration error | FAERS: 9 | US FAERS | |
| 24 | Inappropriate schedule of drug administration | FAERS: 9 | US FAERS | |
| 25 | Intentional product misuse | FAERS: 9 | US FAERS | |
| 26 | Nausea | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 27 | Drug effect incomplete | FAERS: 8 | US FAERS | |
| 28 | Dysuria | FAERS: 8 | US FAERS | |
| 29 | Product package associated injury | FAERS: 8 | US FAERS | |
| 30 | Pruritus | FAERS: 8 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 31 | Agitation | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 32 | Feeling jittery | FAERS: 7 | US FAERS | |
| 33 | Malaise | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 34 | Nervousness | FAERS: 7 | US FAERS | |
| 35 | Accidental overdose | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 36 | Epistaxis | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 37 | Fatigue | FAERS: 6 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 38 | Incorrect drug administration duration | FAERS: 6 | US FAERS | |
| 39 | Poor quality sleep | FAERS: 6 | US FAERS | |
| 40 | Restlessness | FAERS: 6 | US FAERS | |
| 41 | Tachycardia | FAERS: 6 | US FAERS | |
| 42 | Atrial Fibrillation | FAERS: 5 | US FAERS | |
| 43 | Cerebrovascular accident | FAERS: 5 | US FAERS | |
| 44 | Drug Dependence | FAERS: 5 | US FAERS | |
| 45 | Product lot number issue | FAERS: 5 | US FAERS | |
| 46 | Sinusitis | FAERS: 5 | CTD US FAERS | |
| 47 | Vomiting | FAERS: 5 Canada Vigilance: 1 | 1557278 | CTD Canada Vigilance US FAERS |
| 48 | Accidental exposure to product | FAERS: 4 | US FAERS | |
| 49 | Amphetamines positive | FAERS: 4 | US FAERS | |
| 50 | Dehydration | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 51 | Euphoric mood | FAERS: 4 | US FAERS | |
| 52 | Product formulation issue | FAERS: 4 | US FAERS | |
| 53 | Product quality issue | FAERS: 4 | US FAERS | |
| 54 | Unevaluable event | FAERS: 4 | US FAERS | |
| 55 | Abdominal Pain | FAERS: 3 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 56 | Abdominal discomfort | FAERS: 3 | US FAERS | |
| 57 | Acute myocardial infarction | FAERS: 3 | US FAERS | |
| 58 | Anaphylactic shock | FAERS: 3 | US FAERS | |
| 59 | Drug abuse | FAERS: 3 | US FAERS | |
| 60 | Drug screen false positive | FAERS: 3 | US FAERS | |
| 61 | Dysarthria | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 62 | Erythema | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 63 | Head discomfort | FAERS: 3 | US FAERS | |
| 64 | Inappropriate schedule of product administration | FAERS: 3 | US FAERS | |
| 65 | Intentional product use issue | FAERS: 3 | US FAERS | |
| 66 | Kounis Syndrome | FAERS: 3 | US FAERS | |
| 67 | Overdose | FAERS: 3 | US FAERS | |
| 68 | Product blister packaging issue | FAERS: 3 | US FAERS | |
| 69 | Product label issue | FAERS: 3 | US FAERS | |
| 70 | Product use complaint | FAERS: 3 | US FAERS | |
| 71 | Ageusia | FAERS: 2 | US FAERS | |
| 72 | Anger | FAERS: 2 | US FAERS | |
| 73 | Anosmia | FAERS: 2 | US FAERS | |
| 74 | Asthma | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 75 | Carpal Tunnel Syndrome | FAERS: 2 | US FAERS | |
| 76 | Circumstance or information capable of leading to medication error | FAERS: 2 | US FAERS | |
| 77 | Contraindicated product administered | FAERS: 2 | US FAERS | |
| 78 | Dependence | FAERS: 2 | US FAERS | |
| 79 | Depressed mood | FAERS: 2 | US FAERS | |
| 80 | Diplopia | FAERS: 2 | US FAERS | |
| 81 | Drug exposure during pregnancy | FAERS: 2 | US FAERS | |
| 82 | Drug prescribing error | FAERS: 2 | US FAERS | |
| 83 | Dry skin | FAERS: 2 | US FAERS | |
| 84 | Dystonia | FAERS: 2 | US FAERS | |
| 85 | Extra dose administered | FAERS: 2 | US FAERS | |
| 86 | Gastroenteritis | FAERS: 2 | US FAERS | |
| 87 | Hypersomnia | FAERS: 2 | US FAERS | |
| 88 | Impaired driving ability | FAERS: 2 | US FAERS | |
| 89 | Intestinal Obstruction | FAERS: 2 | US FAERS | |
| 90 | Laceration | FAERS: 2 | US FAERS | |
| 91 | Lip swelling | FAERS: 2 | US FAERS | |
| 92 | Loss of personal independence in daily activities | FAERS: 2 | US FAERS | |
| 93 | Middle insomnia | FAERS: 2 | US FAERS | |
| 94 | Multiple allergies | FAERS: 2 | US FAERS | |
| 95 | Neuroleptic Malignant Syndrome | FAERS: 2 | US FAERS | |
| 96 | Onychoclasis | FAERS: 2 | US FAERS | |
| 97 | Pain | FAERS: 2 | US FAERS | |
| 98 | Personality Change | FAERS: 2 | US FAERS | |
| 99 | Presyncope | FAERS: 2 | US FAERS | |
| 100 | Product closure removal difficult | FAERS: 2 | US FAERS | |
| 101 | Product label confusion | FAERS: 2 | US FAERS | |
| 102 | Product packaging quantity issue | FAERS: 2 | US FAERS | |
| 103 | Product physical consistency issue | FAERS: 2 | US FAERS | |
| 104 | Product shape issue | FAERS: 2 | US FAERS | |
| 105 | Product substitution issue | FAERS: 2 | US FAERS | |
| 106 | Rash erythematous | FAERS: 2 | US FAERS | |
| 107 | Reaction to excipient | FAERS: 2 | US FAERS | |
| 108 | Respiratory Failure | FAERS: 2 | US FAERS | |
| 109 | Syncope | FAERS: 2 Canada Vigilance: 1 | 9853729 | CTD Canada Vigilance US FAERS |
| 110 | Tinnitus | FAERS: 2 | US FAERS | |
| 111 | Unintentional use for unapproved indication | FAERS: 2 | US FAERS | |
| 112 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 113 | Acute Coronary Syndrome | FAERS: 1 | 18987767 | CTD US FAERS |
| 114 | Akathisia | FAERS: 1 | US FAERS | |
| 115 | Allergic reaction to excipient | FAERS: 1 | US FAERS | |
| 116 | Alopecia | FAERS: 1 | US FAERS | |
| 117 | Amnesia | FAERS: 1 | US FAERS | |
| 118 | Aneurysm | FAERS: 1 | US FAERS | |
| 119 | Angina Pectoris | FAERS: 1 | 7224270 | CTD US FAERS |
| 120 | Angioedema | FAERS: 1 | 12637407 | CTD US FAERS |
| 121 | Angiogram abnormal | FAERS: 1 | US FAERS | |
| 122 | Apparent death | FAERS: 1 | US FAERS | |
| 123 | Arthropod sting | FAERS: 1 | US FAERS | |
| 124 | Asthenia | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 125 | Atrial Flutter | FAERS: 1 | US FAERS | |
| 126 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 127 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 128 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 129 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 130 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 131 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 132 | Blood urea increased | FAERS: 1 | US FAERS | |
| 133 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 134 | Breath alcohol test positive | FAERS: 1 | US FAERS | |
| 135 | Bronchopneumonia | FAERS: 1 | US FAERS | |
| 136 | Burning sensation | FAERS: 1 | US FAERS | |
| 137 | CYP2D6 polymorphism | FAERS: 1 | US FAERS | |
| 138 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 139 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 140 | Cardiac procedure complication | FAERS: 1 | US FAERS | |
| 141 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 142 | Catheter site related reaction | FAERS: 1 | US FAERS | |
| 143 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 144 | Choking sensation | FAERS: 1 | US FAERS | |
| 145 | Constipation | FAERS: 1 | US FAERS | |
| 146 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 147 | Counterfeit drug administered | FAERS: 1 | US FAERS | |
| 148 | Delirium | FAERS: 1 | US FAERS | |
| 149 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 150 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 151 | Drug diversion | FAERS: 1 | US FAERS | |
| 152 | Drug level increased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 153 | Dyspepsia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 154 | Ear congestion | FAERS: 1 | US FAERS | |
| 155 | Ear discomfort | FAERS: 1 | US FAERS | |
| 156 | Educational problem | FAERS: 1 | US FAERS | |
| 157 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 158 | Electromechanical dissociation | FAERS: 1 | US FAERS | |
| 159 | Emotional distress | FAERS: 1 | US FAERS | |
| 160 | Eosinophilia | FAERS: 1 | US FAERS | |
| 161 | Epilepsy | FAERS: 1 | US FAERS | |
| 162 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 163 | Excitability | FAERS: 1 | US FAERS | |
| 164 | Gastritis | FAERS: 1 | US FAERS | |
| 165 | Gastrointestinal Pain | FAERS: 1 | US FAERS | |
| 166 | Glaucoma | FAERS: 1 | US FAERS | |
| 167 | Hallucinations, mixed | FAERS: 1 | US FAERS | |
| 168 | Hyperplasia | FAERS: 1 | US FAERS | |
| 169 | Hyperreflexia | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 170 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 171 | Hypervigilance | FAERS: 1 | US FAERS | |
| 172 | Hypokinesia | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 173 | Hypotension | FAERS: 1 | US FAERS | |
| 174 | Initial insomnia | FAERS: 1 | US FAERS | |
| 175 | Intentional drug misuse | FAERS: 1 | US FAERS | |
| 176 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 177 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 178 | Joint stiffness | FAERS: 1 | US FAERS | |
| 179 | Leukocytosis | FAERS: 1 | US FAERS | |
| 180 | Macule | FAERS: 1 | US FAERS | |
| 181 | Medication residue present | FAERS: 1 | US FAERS | |
| 182 | Memory impairment | FAERS: 1 | US FAERS | |
| 183 | Mental status changes | FAERS: 1 | US FAERS | |
| 184 | Mood swings | FAERS: 1 | US FAERS | |
| 185 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 186 | Mydriasis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 187 | Myocardial Infarction | FAERS: 1 | 9407485 11381283 18024065 | CTD US FAERS |
| 188 | Myocardial fibrosis | FAERS: 1 | US FAERS | |
| 189 | Myocarditis | FAERS: 1 | US FAERS | |
| 190 | Nasal discomfort | FAERS: 1 | US FAERS | |
| 191 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 192 | Neuralgia | FAERS: 1 | US FAERS | |
| 193 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 194 | Oral pain | FAERS: 1 | US FAERS | |
| 195 | Panic Disorder | FAERS: 1 | US FAERS | |
| 196 | Paranoia | FAERS: 1 | US FAERS | |
| 197 | Performance status decreased | FAERS: 1 | US FAERS | |
| 198 | Physical examination abnormal | FAERS: 1 | US FAERS | |
| 199 | Pneumonia | FAERS: 1 | US FAERS | |
| 200 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 201 | Product coating issue | FAERS: 1 | US FAERS | |
| 202 | Product dispensing error | FAERS: 1 | US FAERS | |
| 203 | Product dose omission | FAERS: 1 | US FAERS | |
| 204 | Product outer packaging issue | FAERS: 1 | US FAERS | |
| 205 | Product physical issue | FAERS: 1 | US FAERS | |
| 206 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 207 | Product storage error | FAERS: 1 | US FAERS | |
| 208 | Product tampering | FAERS: 1 | US FAERS | |
| 209 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 210 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 211 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 212 | Rebound effect | FAERS: 1 | US FAERS | |
| 213 | Rebound nasal congestion | FAERS: 1 | US FAERS | |
| 214 | Reversible cerebral vasoconstriction syndrome | FAERS: 1 | US FAERS | |
| 215 | Screaming | FAERS: 1 | US FAERS | |
| 216 | Sinus headache | FAERS: 1 | US FAERS | |
| 217 | Sinus pain | FAERS: 1 | US FAERS | |
| 218 | Skin laceration | FAERS: 1 | US FAERS | |
| 219 | Skin test positive | FAERS: 1 | US FAERS | |
| 220 | Sudden death | FAERS: 1 | US FAERS | |
| 221 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 222 | Suspected product contamination | FAERS: 1 | US FAERS | |
| 223 | Swelling | FAERS: 1 | US FAERS | |
| 224 | Therapeutic product effect incomplete | FAERS: 1 | US FAERS | |
| 225 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 226 | Thermal burn | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 227 | Tympanic Membrane Perforation | FAERS: 1 | US FAERS | |
| 228 | Vascular rupture | FAERS: 1 | US FAERS | |
| 229 | Vasculitis | FAERS: 1 | US FAERS | |
| 230 | Ventricular hypokinesia | FAERS: 1 | US FAERS | |
| 231 | Visual Impairment | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 232 | Vitreous Detachment | FAERS: 1 | US FAERS | |
| 233 | Weight decreased | FAERS: 1 | US FAERS | |
| 234 | Wolff-Parkinson-White Syndrome | FAERS: 1 | US FAERS | |
| 235 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 236 | Acute kidney injury | 14671078 | CTD | |
| 237 | Ataxia | 10195488 | CTD | |
| 238 | Bipolar Disorder | 3295932 17290343 | CTD | |
| 239 | Brain Edema | 20398975 | CTD | |
| 240 | Cardiomyopathies | 18238747 | CTD | |
| 241 | Cerebral Hemorrhage | 4024187 12791938 16018164 | CTD | |
| 242 | Chest discomfort | Canada Vigilance: 1 | Canada Vigilance | |
| 243 | Colitis, Ischemic | 15522982 | CTD | |
| 244 | Common Cold | 12421505 | CTD | |
| 245 | Disorders of Excessive Somnolence | 12421505 | CTD | |
| 246 | Drug Overdose | 18365604 | CTD | |
| 247 | Focal dyscognitive seizures | Canada Vigilance: 1 | Canada Vigilance | |
| 248 | Heart failure | 18238747 | CTD | |
| 249 | Hypertensive Encephalopathy | 20398975 | CTD | |
| 250 | Inflammation | Canada Vigilance: 1 | Canada Vigilance | |
| 251 | Lethargy | 1557278 | CTD | |
| 252 | Myoclonus | 7110997 | CTD | |
| 253 | Nose Diseases | 14671681 | CTD | |
| 254 | Personality Disorders | 9377115 | CTD | |
| 255 | Pharyngitis | 14671681 | CTD | |
| 256 | Psychoses, Substance-Induced | 9267376 10195488 | CTD | |
| 257 | Puerperal Disorders | 9267376 | CTD | |
| 258 | Rhinitis, Allergic, Perennial | 15119752 | CTD | |
| 259 | Rhinitis | 1098524 | CTD | |
| 260 | Seizures | 7092186 | CTD | |
| 261 | Stupor | Canada Vigilance: 1 | Canada Vigilance | |
| 262 | Tachycardia, Paroxysmal | 18206336 | CTD | |
| 263 | Tachycardia, Ventricular | 12637407 | CTD | |
| 264 | Urinary Calculi | 15759201 | CTD | |
| 265 | Urinary Retention | 18365604 | CTD | |
| 266 | Urolithiasis | 14671078 | CTD | |
| 267 | Vertigo | Canada Vigilance: 1 | Canada Vigilance | |
| 268 | Xerostomia | 12421505 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.