Leucovorin
(KVUAALJSMIVURS-ZEDZUCNESA-L)
Structure
- SMILES
- O=CN1C(CNc2ccc(cc2)C(=O)N[C@H](C(=O)[O-])CCC(=O)[O-])CNc2c1c(=O)[nH]c(n2)N.[Ca+2]
- Molecular Formula:
- C20H21CaN7O7
- Molecular Weight:
- 511.501
- Log P:
- -1.5165
- Hydrogen Bond Acceptor:
- 13
- Hydrogen Bond Donor:
- 5
- TPSA:
- 225.5
- CAS Number(s):
- 1492-18-8; 6035-45-6; 80433-71-2
Synonym(s)
1.
Leucovorin
2.
Calcium Leucovorin
3.
Citrovorum Factor
4.
Folinic Acid
5.
N(5)-Formyltetrahydrofolate
6.
5-Formyltetrahydrofolate
7.
5-Formyltetrahydropteroylglutamate
8.
Calcium Folinate
9.
Folinic Acid-SF
10.
Leucovorin, (D)-Isomer
11.
Leucovorin, (DL)-Isomer
12.
Leucovorin, (R)-Isomer
13.
Leucovorin, Calcium (1:1) Salt
14.
Leucovorin, Calcium (1:1) Salt, (DL)-Isomer
15.
Leucovorin, Calcium (1:1) Salt, Pentahydrate
16.
Leucovorin, Monosodium Salt
17.
Leukovorin
18.
Leukovorum
19.
Wellcovorin
20.
5 Formyltetrahydrofolate
21.
5 Formyltetrahydropteroylglutamate
22.
Acid, Folinic
23.
Factor, Citrovorum
24.
Folinate, Calcium
25.
Folinic Acid SF
26.
Leucovorin, Calcium
27.
Monosodium Salt Leucovorin
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Vomiting | FAERS: 36 | US FAERS | |
| 2 | Abdominal Pain | FAERS: 33 | US FAERS | |
| 3 | Dehydration | FAERS: 26 | US FAERS | |
| 4 | Nausea | FAERS: 24 | US FAERS | |
| 5 | Febrile Neutropenia | FAERS: 23 | US FAERS | |
| 6 | Neutropenia | FAERS: 22 | US FAERS | |
| 7 | Asthenia | FAERS: 20 | US FAERS | |
| 8 | Chills | FAERS: 17 | US FAERS | |
| 9 | Fatigue | FAERS: 17 | US FAERS | |
| 10 | Dizziness | FAERS: 14 | US FAERS | |
| 11 | Disease Progression | FAERS: 13 | US FAERS | |
| 12 | Blood creatinine increased | FAERS: 12 | US FAERS | |
| 13 | General physical health deterioration | FAERS: 12 | US FAERS | |
| 14 | Pneumonia | FAERS: 12 | US FAERS | |
| 15 | Pulmonary Embolism | FAERS: 12 | US FAERS | |
| 16 | Back Pain | FAERS: 11 | US FAERS | |
| 17 | Malignant neoplasm progression | FAERS: 11 | US FAERS | |
| 18 | Hypotension | FAERS: 10 | US FAERS | |
| 19 | Infection | FAERS: 10 | US FAERS | |
| 20 | Stomatitis | FAERS: 10 | US FAERS | |
| 21 | Flushing | FAERS: 9 | US FAERS | |
| 22 | Respiratory Failure | FAERS: 9 | US FAERS | |
| 23 | Sepsis | FAERS: 9 | US FAERS | |
| 24 | White blood cell count decreased | FAERS: 9 | US FAERS | |
| 25 | Ascites | FAERS: 8 | US FAERS | |
| 26 | Blood glucose increased | FAERS: 8 | US FAERS | |
| 27 | Urinary Incontinence | FAERS: 8 | US FAERS | |
| 28 | Atrial Fibrillation | FAERS: 7 | US FAERS | |
| 29 | Blood urea increased | FAERS: 7 | US FAERS | |
| 30 | Neutrophil count decreased | FAERS: 7 | US FAERS | |
| 31 | Pain | FAERS: 7 | US FAERS | |
| 32 | Chest Pain | FAERS: 6 | US FAERS | |
| 33 | Gamma-Glutamyltransferase Increased | FAERS: 6 | US FAERS | |
| 34 | Headache | FAERS: 6 | US FAERS | |
| 35 | Hypersensitivity | FAERS: 6 | US FAERS | |
| 36 | Toxicity to various agents | FAERS: 6 | US FAERS | |
| 37 | Cardiac Arrest | FAERS: 5 | US FAERS | |
| 38 | Chest discomfort | FAERS: 5 | US FAERS | |
| 39 | Cholangitis | FAERS: 5 | US FAERS | |
| 40 | Constipation | FAERS: 5 | US FAERS | |
| 41 | Malaise | FAERS: 5 | US FAERS | |
| 42 | Musculoskeletal Pain | FAERS: 5 | US FAERS | |
| 43 | Nephrotic Syndrome | FAERS: 5 | US FAERS | |
| 44 | Posterior reversible encephalopathy syndrome | FAERS: 5 | US FAERS | |
| 45 | Blood albumin decreased | FAERS: 4 | US FAERS | |
| 46 | Blood alkaline phosphatase increased | FAERS: 4 | US FAERS | |
| 47 | Blood lactate dehydrogenase increased | FAERS: 4 | US FAERS | |
| 48 | Blood pressure inadequately controlled | FAERS: 4 | US FAERS | |
| 49 | Cardiomegaly | FAERS: 4 | US FAERS | |
| 50 | Cholecystitis | FAERS: 4 | US FAERS | |
| 51 | Deep Vein Thrombosis | FAERS: 4 | US FAERS | |
| 52 | Dyspepsia | FAERS: 4 | US FAERS | |
| 53 | Pruritus | FAERS: 4 | US FAERS | |
| 54 | Sinus Tachycardia | FAERS: 4 | US FAERS | |
| 55 | Thrombocytopenia | FAERS: 4 | US FAERS | |
| 56 | Urticaria | FAERS: 4 | US FAERS | |
| 57 | Anorexia | FAERS: 3 | US FAERS | |
| 58 | Aspartate Aminotransferase Increased | FAERS: 3 | US FAERS | |
| 59 | Blood cholesterol increased | FAERS: 3 | US FAERS | |
| 60 | Cholelithiasis | FAERS: 3 | US FAERS | |
| 61 | Drug toxicity | FAERS: 3 | US FAERS | |
| 62 | Ejection Fraction Decreased | FAERS: 3 | US FAERS | |
| 63 | Epistaxis | FAERS: 3 | US FAERS | |
| 64 | Extravasation | FAERS: 3 | US FAERS | |
| 65 | Gastrointestinal ulcer | FAERS: 3 | US FAERS | |
| 66 | Hepatomegaly | FAERS: 3 | US FAERS | |
| 67 | Hydrocephalus | FAERS: 3 | US FAERS | |
| 68 | Hypophagia | FAERS: 3 | US FAERS | |
| 69 | Intestinal Perforation | FAERS: 3 | US FAERS | |
| 70 | Lethargy | FAERS: 3 | US FAERS | |
| 71 | Leukopenia | FAERS: 3 | US FAERS | |
| 72 | Malignant ascites | FAERS: 3 | US FAERS | |
| 73 | Myocardial Infarction | FAERS: 3 | US FAERS | |
| 74 | Pancreatitis | FAERS: 3 | US FAERS | |
| 75 | Pancytopenia | FAERS: 3 | US FAERS | |
| 76 | Pelvic Inflammatory Disease | FAERS: 3 | US FAERS | |
| 77 | Pelvic abscess | FAERS: 3 | US FAERS | |
| 78 | Post procedural complication | FAERS: 3 | US FAERS | |
| 79 | Pulmonary Fibrosis | FAERS: 3 | US FAERS | |
| 80 | Septic Shock | FAERS: 3 | US FAERS | |
| 81 | Syncope | FAERS: 3 | US FAERS | |
| 82 | Weight decreased | FAERS: 3 | US FAERS | |
| 83 | Abdominal discomfort | FAERS: 2 | US FAERS | |
| 84 | Alanine Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 85 | Anaphylactic shock | FAERS: 2 | US FAERS | |
| 86 | Aspergillosis | FAERS: 2 | US FAERS | |
| 87 | Biliary sepsis | FAERS: 2 | US FAERS | |
| 88 | Blood creatinine decreased | FAERS: 2 | US FAERS | |
| 89 | Blood potassium decreased | FAERS: 2 | US FAERS | |
| 90 | Blood sodium decreased | FAERS: 2 | US FAERS | |
| 91 | Cataract | FAERS: 2 | US FAERS | |
| 92 | Central nervous system lesion | FAERS: 2 | US FAERS | |
| 93 | Cerebral Infarction | FAERS: 2 | US FAERS | |
| 94 | Cytology abnormal | FAERS: 2 | US FAERS | |
| 95 | Discomfort | FAERS: 2 | US FAERS | |
| 96 | Disease recurrence | FAERS: 2 | US FAERS | |
| 97 | Erythema | FAERS: 2 | US FAERS | |
| 98 | Focal Nodular Hyperplasia | FAERS: 2 | US FAERS | |
| 99 | Hemiparesis | FAERS: 2 | US FAERS | |
| 100 | Hepatotoxicity | FAERS: 2 | US FAERS | |
| 101 | Hydronephrosis | FAERS: 2 | US FAERS | |
| 102 | Hypoxia | FAERS: 2 | US FAERS | |
| 103 | Ileus | FAERS: 2 | US FAERS | |
| 104 | Intestinal Obstruction | FAERS: 2 | US FAERS | |
| 105 | Joint Range of Motion Decreased | FAERS: 2 | US FAERS | |
| 106 | Leukocytosis | FAERS: 2 | US FAERS | |
| 107 | Leukoencephalopathy | FAERS: 2 | US FAERS | |
| 108 | Mental status changes | FAERS: 2 | US FAERS | |
| 109 | Monocyte count decreased | FAERS: 2 | US FAERS | |
| 110 | Nasopharyngitis | FAERS: 2 | US FAERS | |
| 111 | Neutropenic sepsis | FAERS: 2 | US FAERS | |
| 112 | Optic Neuritis | FAERS: 2 | US FAERS | |
| 113 | Pelvic Infection | FAERS: 2 | US FAERS | |
| 114 | Pneumothorax | FAERS: 2 | US FAERS | |
| 115 | Portal Hypertension | FAERS: 2 | US FAERS | |
| 116 | Portal Vein Thrombosis | FAERS: 2 | US FAERS | |
| 117 | Renal tubular necrosis | FAERS: 2 | US FAERS | |
| 118 | Respiratory arrest | FAERS: 2 | US FAERS | |
| 119 | Spinal column stenosis | FAERS: 2 | US FAERS | |
| 120 | Splenomegaly | FAERS: 2 | US FAERS | |
| 121 | Sudden Cardiac Death | FAERS: 2 | US FAERS | |
| 122 | Tachycardia | FAERS: 2 | US FAERS | |
| 123 | Urinary tract infection | FAERS: 2 | US FAERS | |
| 124 | VIIth nerve paralysis | FAERS: 2 | US FAERS | |
| 125 | Abscess | FAERS: 1 | US FAERS | |
| 126 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 127 | Acute respiratory failure | FAERS: 1 | US FAERS | |
| 128 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 129 | Angioedema | FAERS: 1 | US FAERS | |
| 130 | Antibody test positive | FAERS: 1 | US FAERS | |
| 131 | Antiphospholipid antibodies positive | FAERS: 1 | US FAERS | |
| 132 | Anxiety | FAERS: 1 | US FAERS | |
| 133 | Aphasia | FAERS: 1 | US FAERS | |
| 134 | Arthropathy | FAERS: 1 | US FAERS | |
| 135 | Asphyxia | FAERS: 1 | US FAERS | |
| 136 | Ataxia | FAERS: 1 | US FAERS | |
| 137 | Atelectasis | FAERS: 1 | US FAERS | |
| 138 | Bacterial test positive | FAERS: 1 | US FAERS | |
| 139 | Bile Duct Stenosis | FAERS: 1 | US FAERS | |
| 140 | Biliary dilatation | FAERS: 1 | US FAERS | |
| 141 | Bilirubin conjugated increased | FAERS: 1 | US FAERS | |
| 142 | Blood chloride decreased | FAERS: 1 | US FAERS | |
| 143 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 144 | Blood gastrin increased | FAERS: 1 | US FAERS | |
| 145 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 146 | Blood pressure immeasurable | FAERS: 1 | US FAERS | |
| 147 | Blood urea nitrogen/creatinine ratio increased | FAERS: 1 | US FAERS | |
| 148 | Bradycardia | FAERS: 1 | US FAERS | |
| 149 | Brain Death | FAERS: 1 | US FAERS | |
| 150 | Brain natriuretic peptide increased | FAERS: 1 | US FAERS | |
| 151 | Bronchopneumonia | FAERS: 1 | US FAERS | |
| 152 | Bronchopulmonary Aspergillosis | FAERS: 1 | US FAERS | |
| 153 | Bronchospasm | FAERS: 1 | US FAERS | |
| 154 | Burning sensation | FAERS: 1 | US FAERS | |
| 155 | Candida test positive | FAERS: 1 | US FAERS | |
| 156 | Candidiasis | FAERS: 1 | US FAERS | |
| 157 | Cataract operation | FAERS: 1 | US FAERS | |
| 158 | Catheter related complication | FAERS: 1 | US FAERS | |
| 159 | Catheter related infection | FAERS: 1 | US FAERS | |
| 160 | Catheter site extravasation | FAERS: 1 | US FAERS | |
| 161 | Catheter site inflammation | FAERS: 1 | US FAERS | |
| 162 | Catheter site related reaction | FAERS: 1 | US FAERS | |
| 163 | Cementoplasty | FAERS: 1 | US FAERS | |
| 164 | Cerebral artery stenosis | FAERS: 1 | US FAERS | |
| 165 | Cholestasis | FAERS: 1 | US FAERS | |
| 166 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 167 | Clostridium difficile infection | FAERS: 1 | US FAERS | |
| 168 | Clostridium test positive | FAERS: 1 | US FAERS | |
| 169 | Cold sweat | FAERS: 1 | US FAERS | |
| 170 | Colitis | FAERS: 1 | US FAERS | |
| 171 | Completed Suicide | FAERS: 1 | US FAERS | |
| 172 | Complication of device removal | FAERS: 1 | US FAERS | |
| 173 | Conjunctivitis | FAERS: 1 | US FAERS | |
| 174 | Cyanosis | FAERS: 1 | US FAERS | |
| 175 | Cystitis | FAERS: 1 | US FAERS | |
| 176 | Demyelination | FAERS: 1 | US FAERS | |
| 177 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 178 | Device deployment issue | FAERS: 1 | US FAERS | |
| 179 | Device migration | FAERS: 1 | US FAERS | |
| 180 | Diabetes Mellitus | FAERS: 1 | US FAERS | |
| 181 | Dieulafoy's vascular malformation | FAERS: 1 | US FAERS | |
| 182 | Diffuse alveolar damage | FAERS: 1 | US FAERS | |
| 183 | Disorientation | FAERS: 1 | US FAERS | |
| 184 | Drug ineffective | FAERS: 1 | US FAERS | |
| 185 | Dysphonia | FAERS: 1 | US FAERS | |
| 186 | Enterocolitis | FAERS: 1 | US FAERS | |
| 187 | Epilepsy | FAERS: 1 | US FAERS | |
| 188 | Escherichia infection | FAERS: 1 | US FAERS | |
| 189 | Feeding tube complication | FAERS: 1 | US FAERS | |
| 190 | Feeling Cold | FAERS: 1 | US FAERS | |
| 191 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 192 | Fibrin D dimer increased | FAERS: 1 | US FAERS | |
| 193 | Flank Pain | FAERS: 1 | US FAERS | |
| 194 | Gastritis | FAERS: 1 | US FAERS | |
| 195 | Gastrointestinal Pain | FAERS: 1 | US FAERS | |
| 196 | Gastrointestinal cancer metastatic | FAERS: 1 | US FAERS | |
| 197 | Gastrointestinal carcinoma | FAERS: 1 | US FAERS | |
| 198 | Gastrointestinal perforation | FAERS: 1 | US FAERS | |
| 199 | Gluten sensitivity | FAERS: 1 | US FAERS | |
| 200 | Hemiplegia | FAERS: 1 | US FAERS | |
| 201 | Hepatic necrosis | FAERS: 1 | US FAERS | |
| 202 | Hepatitis | FAERS: 1 | US FAERS | |
| 203 | Hernial eventration | FAERS: 1 | US FAERS | |
| 204 | Hypertrophy | FAERS: 1 | US FAERS | |
| 205 | Immunosuppression | FAERS: 1 | US FAERS | |
| 206 | Incontinence | FAERS: 1 | US FAERS | |
| 207 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 208 | Infected seroma | FAERS: 1 | US FAERS | |
| 209 | Inflammation | FAERS: 1 | US FAERS | |
| 210 | Jejunal ulcer | FAERS: 1 | US FAERS | |
| 211 | Laboratory test interference | FAERS: 1 | US FAERS | |
| 212 | Laryngospasm | FAERS: 1 | US FAERS | |
| 213 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 214 | Lymphocyte count decreased | FAERS: 1 | US FAERS | |
| 215 | Lymphoma | FAERS: 1 | US FAERS | |
| 216 | Malnutrition | FAERS: 1 | US FAERS | |
| 217 | Medication Error | FAERS: 1 | US FAERS | |
| 218 | Memory impairment | FAERS: 1 | US FAERS | |
| 219 | Metastatic Neoplasm | FAERS: 1 | US FAERS | |
| 220 | Nephritis | FAERS: 1 | US FAERS | |
| 221 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 222 | Oral pain | FAERS: 1 | US FAERS | |
| 223 | Pallor | FAERS: 1 | US FAERS | |
| 224 | Palpitations | FAERS: 1 | US FAERS | |
| 225 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 226 | Performance status decreased | FAERS: 1 | US FAERS | |
| 227 | Perinephric collection | FAERS: 1 | US FAERS | |
| 228 | Perirectal abscess | FAERS: 1 | US FAERS | |
| 229 | Pharyngolaryngeal Pain | FAERS: 1 | US FAERS | |
| 230 | Pneumatosis intestinalis | FAERS: 1 | US FAERS | |
| 231 | Pneumonitis | FAERS: 1 | US FAERS | |
| 232 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 233 | Post procedural nausea | FAERS: 1 | US FAERS | |
| 234 | Product label confusion | FAERS: 1 | US FAERS | |
| 235 | Product preparation error | FAERS: 1 | US FAERS | |
| 236 | Protein total decreased | FAERS: 1 | US FAERS | |
| 237 | Pseudomonal sepsis | FAERS: 1 | US FAERS | |
| 238 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 239 | Pulmonary toxicity | FAERS: 1 | US FAERS | |
| 240 | Purpura | FAERS: 1 | US FAERS | |
| 241 | Purulence | FAERS: 1 | US FAERS | |
| 242 | Rash erythematous | FAERS: 1 | US FAERS | |
| 243 | Rectal Obstruction | FAERS: 1 | US FAERS | |
| 244 | Renal mass | FAERS: 1 | US FAERS | |
| 245 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 246 | Respiratory distress | FAERS: 1 | US FAERS | |
| 247 | Respiratory syncytial virus test positive | FAERS: 1 | US FAERS | |
| 248 | Restlessness | FAERS: 1 | US FAERS | |
| 249 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 250 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 251 | Somnolence | FAERS: 1 | US FAERS | |
| 252 | Staphylococcus test positive | FAERS: 1 | US FAERS | |
| 253 | Stenotrophomonas infection | FAERS: 1 | US FAERS | |
| 254 | Stress | FAERS: 1 | US FAERS | |
| 255 | Subileus | FAERS: 1 | US FAERS | |
| 256 | Systemic Inflammatory Response Syndrome | FAERS: 1 | US FAERS | |
| 257 | Thoracic vertebral fracture | FAERS: 1 | US FAERS | |
| 258 | Throat irritation | FAERS: 1 | US FAERS | |
| 259 | Tracheobronchitis | FAERS: 1 | US FAERS | |
| 260 | Tremor | FAERS: 1 | US FAERS | |
| 261 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 262 | Ureteritis | FAERS: 1 | US FAERS | |
| 263 | Urinary Retention | FAERS: 1 | US FAERS | |
| 264 | Urine output increased | FAERS: 1 | US FAERS | |
| 265 | Venous thrombosis limb | FAERS: 1 | US FAERS | |
| 266 | Ventricular Dysfunction | FAERS: 1 | US FAERS | |
| 267 | Vitreous floaters | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120235
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.